DE1720566C3 - Verfahren zur Herstellung von emulgierbaren Poly-α-olefinen - Google Patents
Verfahren zur Herstellung von emulgierbaren Poly-α-olefinenInfo
- Publication number
- DE1720566C3 DE1720566C3 DE1720566A DE1720566A DE1720566C3 DE 1720566 C3 DE1720566 C3 DE 1720566C3 DE 1720566 A DE1720566 A DE 1720566A DE 1720566 A DE1720566 A DE 1720566A DE 1720566 C3 DE1720566 C3 DE 1720566C3
- Authority
- DE
- Germany
- Prior art keywords
- poly
- olefins
- viscosity
- measured
- inherent viscosity
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 38
- 229920013639 polyalphaolefin Polymers 0.000 title claims description 12
- 238000002360 preparation method Methods 0.000 title claims description 4
- 239000000047 product Substances 0.000 claims description 27
- 239000002253 acid Substances 0.000 claims description 24
- 239000000155 melt Substances 0.000 claims description 24
- 229920000642 polymer Polymers 0.000 claims description 20
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 claims description 16
- 238000006243 chemical reaction Methods 0.000 claims description 14
- 238000007127 saponification reaction Methods 0.000 claims description 14
- 238000004519 manufacturing process Methods 0.000 claims description 10
- 150000007513 acids Chemical class 0.000 claims description 8
- 229920001577 copolymer Polymers 0.000 claims description 8
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 claims description 6
- 239000002904 solvent Substances 0.000 claims description 6
- 150000002978 peroxides Chemical class 0.000 claims description 5
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 4
- 150000001336 alkenes Chemical class 0.000 claims description 4
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 4
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 239000007857 degradation product Substances 0.000 claims description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims 1
- 239000005977 Ethylene Substances 0.000 claims 1
- 238000000465 moulding Methods 0.000 claims 1
- 230000000379 polymerizing effect Effects 0.000 claims 1
- 239000011787 zinc oxide Substances 0.000 claims 1
- -1 polypropylene Polymers 0.000 description 23
- 239000004743 Polypropylene Substances 0.000 description 16
- 229920001155 polypropylene Polymers 0.000 description 16
- 230000015556 catabolic process Effects 0.000 description 13
- 238000006731 degradation reaction Methods 0.000 description 13
- 239000000839 emulsion Substances 0.000 description 11
- VXNZUUAINFGPBY-UHFFFAOYSA-N ethyl ethylene Natural products CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 11
- 229920005606 polypropylene copolymer Polymers 0.000 description 11
- 229910052751 metal Inorganic materials 0.000 description 10
- 239000002184 metal Substances 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- 238000003756 stirring Methods 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000007795 chemical reaction product Substances 0.000 description 7
- CRSBERNSMYQZNG-UHFFFAOYSA-N 1-dodecene Chemical compound CCCCCCCCCCC=C CRSBERNSMYQZNG-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 6
- YWAKXRMUMFPDSH-UHFFFAOYSA-N pentene Chemical compound CCCC=C YWAKXRMUMFPDSH-UHFFFAOYSA-N 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 5
- 230000002349 favourable effect Effects 0.000 description 5
- 239000004753 textile Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 4
- 239000004698 Polyethylene Substances 0.000 description 4
- 238000005299 abrasion Methods 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- LSXWFXONGKSEMY-UHFFFAOYSA-N di-tert-butyl peroxide Chemical compound CC(C)(C)OOC(C)(C)C LSXWFXONGKSEMY-UHFFFAOYSA-N 0.000 description 4
- LDCRTTXIJACKKU-ARJAWSKDSA-N dimethyl maleate Chemical compound COC(=O)\C=C/C(=O)OC LDCRTTXIJACKKU-ARJAWSKDSA-N 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 238000005498 polishing Methods 0.000 description 4
- 229920000573 polyethylene Polymers 0.000 description 4
- OFNISBHGPNMTMS-UHFFFAOYSA-N 3-methylideneoxolane-2,5-dione Chemical compound C=C1CC(=O)OC1=O OFNISBHGPNMTMS-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 125000000129 anionic group Chemical group 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 229940069096 dodecene Drugs 0.000 description 3
- 239000001530 fumaric acid Substances 0.000 description 3
- 229920001519 homopolymer Polymers 0.000 description 3
- 239000012535 impurity Substances 0.000 description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 3
- 239000011976 maleic acid Substances 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 229920000098 polyolefin Polymers 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000001993 wax Substances 0.000 description 3
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 2
- WSSSPWUEQFSQQG-UHFFFAOYSA-N 4-methyl-1-pentene Chemical compound CC(C)CC=C WSSSPWUEQFSQQG-UHFFFAOYSA-N 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- CBTVGIZVANVGBH-UHFFFAOYSA-N aminomethyl propanol Chemical compound CC(C)(N)CO CBTVGIZVANVGBH-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- LDCRTTXIJACKKU-ONEGZZNKSA-N dimethyl fumarate Chemical compound COC(=O)\C=C\C(=O)OC LDCRTTXIJACKKU-ONEGZZNKSA-N 0.000 description 2
- 229960004419 dimethyl fumarate Drugs 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- CFJYNSNXFXLKNS-UHFFFAOYSA-N p-menthane Chemical compound CC(C)C1CCC(C)CC1 CFJYNSNXFXLKNS-UHFFFAOYSA-N 0.000 description 2
- KJFMBFZCATUALV-UHFFFAOYSA-N phenolphthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2C(=O)O1 KJFMBFZCATUALV-UHFFFAOYSA-N 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 239000003784 tall oil Substances 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- AKUNSTOMHUXJOZ-UHFFFAOYSA-N 1-hydroperoxybutane Chemical compound CCCCOO AKUNSTOMHUXJOZ-UHFFFAOYSA-N 0.000 description 1
- GVJRTUUUJYMTNQ-UHFFFAOYSA-N 2-(2,5-dioxofuran-3-yl)acetic acid Chemical compound OC(=O)CC1=CC(=O)OC1=O GVJRTUUUJYMTNQ-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 1
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 description 1
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 description 1
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 1
- GQZXRLWUYONVCP-UHFFFAOYSA-N 3-[1-(dimethylamino)ethyl]phenol Chemical compound CN(C)C(C)C1=CC=CC(O)=C1 GQZXRLWUYONVCP-UHFFFAOYSA-N 0.000 description 1
- YHQXBTXEYZIYOV-UHFFFAOYSA-N 3-methylbut-1-ene Chemical compound CC(C)C=C YHQXBTXEYZIYOV-UHFFFAOYSA-N 0.000 description 1
- AYKYXWQEBUNJCN-UHFFFAOYSA-N 3-methylfuran-2,5-dione Chemical compound CC1=CC(=O)OC1=O AYKYXWQEBUNJCN-UHFFFAOYSA-N 0.000 description 1
- KLCNJIQZXOQYTE-UHFFFAOYSA-N 4,4-dimethylpent-1-ene Chemical compound CC(C)(C)CC=C KLCNJIQZXOQYTE-UHFFFAOYSA-N 0.000 description 1
- JDOZUYVDIAKODH-PLNGDYQASA-N 4-o-ethyl 1-o-methyl (z)-but-2-enedioate Chemical compound CCOC(=O)\C=C/C(=O)OC JDOZUYVDIAKODH-PLNGDYQASA-N 0.000 description 1
- 101150067539 AMBP gene Proteins 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 229910052776 Thorium Inorganic materials 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 239000012969 di-tertiary-butyl peroxide Substances 0.000 description 1
- JBSLOWBPDRZSMB-FPLPWBNLSA-N dibutyl (z)-but-2-enedioate Chemical compound CCCCOC(=O)\C=C/C(=O)OCCCC JBSLOWBPDRZSMB-FPLPWBNLSA-N 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- 238000004945 emulsification Methods 0.000 description 1
- 229940082150 encore Drugs 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- XLYMOEINVGRTEX-UHFFFAOYSA-N fumaric acid monoethyl ester Natural products CCOC(=O)C=CC(O)=O XLYMOEINVGRTEX-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- QUPCNWFFTANZPX-UHFFFAOYSA-N hydrogen peroxide;1-methyl-4-propan-2-ylcyclohexane Chemical class OO.CC(C)C1CCC(C)CC1 QUPCNWFFTANZPX-UHFFFAOYSA-N 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000012170 montan wax Substances 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 229930004008 p-menthane Natural products 0.000 description 1
- 239000004848 polyfunctional curative Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- DNYWZCXLKNTFFI-UHFFFAOYSA-N uranium Chemical compound [U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U] DNYWZCXLKNTFFI-UHFFFAOYSA-N 0.000 description 1
- 229910000634 wood's metal Inorganic materials 0.000 description 1
- 239000004711 α-olefin Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F255/00—Macromolecular compounds obtained by polymerising monomers on to polymers of hydrocarbons as defined in group C08F10/00
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US502437A US3480580A (en) | 1965-10-22 | 1965-10-22 | Modified polymers |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1720566A1 DE1720566A1 (de) | 1971-07-01 |
| DE1720566B2 DE1720566B2 (de) | 1981-02-26 |
| DE1720566C3 true DE1720566C3 (de) | 1982-02-25 |
Family
ID=23997823
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1720566A Expired DE1720566C3 (de) | 1965-10-22 | 1966-10-20 | Verfahren zur Herstellung von emulgierbaren Poly-α-olefinen |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3480580A (enExample) |
| JP (1) | JPS4536311B1 (enExample) |
| DE (1) | DE1720566C3 (enExample) |
| GB (1) | GB1154544A (enExample) |
Families Citing this family (85)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4028436A (en) * | 1975-04-01 | 1977-06-07 | Eastman Kodak Company | Melt phase process for the preparation of emulsifiable polyethylene waxes |
| JPS6016442B2 (ja) * | 1976-03-08 | 1985-04-25 | 日石三菱株式会社 | 変性ポリオレフインワツクスの製造法 |
| US4190565A (en) * | 1978-08-30 | 1980-02-26 | Eastman Kodak Company | Filled hot-melt adhesives containing modified polyethylene |
| US4240944A (en) * | 1979-02-12 | 1980-12-23 | Ppg Industries, Inc. | Emulsion composition and method for use in treating glass fibers |
| US4283322A (en) * | 1979-02-12 | 1981-08-11 | Ppg Industries, Inc. | Emulsion composition and method for use in treating glass fibers |
| US4358564A (en) * | 1981-05-29 | 1982-11-09 | Eastman Kodak Company | Process for controlling the viscosity during the preparation of grafted polyethylene and ethylene/alpha olefin waxes |
| US4376855A (en) * | 1981-06-22 | 1983-03-15 | Eastman Kodak Company | Emulsifiable ethylene containing polyolefin waxes having improved emulsifiability and process for their preparation |
| US4338230A (en) * | 1981-06-22 | 1982-07-06 | Eastman Kodak Company | Emulsifiable polyolefin waxes prepared by reacting pivalolactone and a polyolefin wax containing carboxyl groups |
| EP0191224B1 (en) * | 1984-12-13 | 1994-05-11 | Morton International, Inc. | Primer composition and process for preparing it |
| US4622352A (en) * | 1985-12-30 | 1986-11-11 | Shell Oil Company | Low smoke modified polypropylene insulation compositions |
| US4853154A (en) * | 1985-11-27 | 1989-08-01 | Shell Oil Company | Low smoke polypropylene insulation compositions |
| US4622350A (en) * | 1985-12-30 | 1986-11-11 | Shell Oil Company | Low smoke polypropylene insulation compositions |
| CA1307864C (en) * | 1985-11-27 | 1992-09-22 | Lie Khong Djiauw | Low smoke modified polypropylene insulation compositions and process for the preparation thereof |
| US4859366A (en) * | 1985-11-27 | 1989-08-22 | Shell Oil Company | Low smoke modified polypropylene insulation compositions |
| US4794132A (en) * | 1986-12-29 | 1988-12-27 | Shell Oil Company | Low smoke polypropylene insulation compositions |
| ES2069595T3 (es) * | 1988-11-21 | 1995-05-16 | Mitsui Petrochemical Ind | Particulas de poliolefina modificadas y su procedimiento de preparacion. |
| US5091469A (en) * | 1990-06-28 | 1992-02-25 | Eastman Kodak Company | Compatibilized epoxy/polyamide compositions containing polyolefins |
| US5300580A (en) * | 1991-05-22 | 1994-04-05 | Quantum Chemical Corporation | Modified ethylene/n-butyl acrylate copolymers having improved adhesion |
| US5139878A (en) * | 1991-08-12 | 1992-08-18 | Allied-Signal Inc. | Multilayer film constructions |
| US5780402A (en) * | 1991-08-22 | 1998-07-14 | Mobil Oil Corp | Alkylated thiophenol lubricants |
| US5153074A (en) * | 1991-11-05 | 1992-10-06 | Mobil Oil Corporation | Metallized film combination |
| US5230963A (en) * | 1991-12-20 | 1993-07-27 | Mobil Oil Corporation | Oxygen and water vapor transmission resistant film and method |
| US5225270A (en) * | 1991-12-24 | 1993-07-06 | Allied-Signal Inc. | Compatibilized polyphenylene ether/polyamide monofilament and felt made therefrom |
| US5334444A (en) * | 1991-12-24 | 1994-08-02 | Alliedsignal Inc. | Compatibilized polyphenylene ether/polyamide monofilament and felt made thereform |
| JP2610559B2 (ja) * | 1992-03-18 | 1997-05-14 | 日本製紙株式会社 | 水性被覆組成物 |
| US5290954A (en) * | 1992-08-13 | 1994-03-01 | Eastman Kodak Company | High clarity emulsions containing high melt viscosity maleated polypropylene wax |
| AT403581B (de) * | 1993-06-07 | 1998-03-25 | Danubia Petrochem Polymere | Verfahren zur herstellung von neuen polypropylenen durch chemische degradierung |
| DE4321529A1 (de) * | 1993-06-29 | 1995-01-12 | Danubia Petrochem Deutschland | Neue, durch chemische Degradierung erhältliche Polypropylene |
| US5346965A (en) * | 1993-08-19 | 1994-09-13 | Ferro Corporation | Process for the production of fuel additives from chlorinated polybutenes |
| US6187870B1 (en) * | 1993-12-16 | 2001-02-13 | Eastman Chemical Company | Apparatus and process for the production of low molecular weight grafted polyolefins |
| US5420303A (en) * | 1993-12-16 | 1995-05-30 | Eastman Chemical Company | Process for the maleation of polyethylene waxes |
| KR970705587A (ko) * | 1994-08-25 | 1997-10-09 | 그윈넬 해리 제이 | 고산가 고분자량 저색도 말레화 폴리프로필렌(maleated high acid number high molecular weight polypropylene of low color) |
| US7408007B2 (en) * | 1994-08-25 | 2008-08-05 | Eastman Chemical Company | Maleated high acid number high molecular weight polypropylene of low color |
| US6472081B1 (en) | 1994-09-26 | 2002-10-29 | Exxonmobil Oil Corporation | Semi-transparent high barrier film |
| US5529834A (en) * | 1994-12-02 | 1996-06-25 | Mobil Oil Corporation | Heat sealable muliilayer film comprising evoh skin and acrylic coating and its method of preparation |
| ZA96626B (en) | 1995-02-09 | 1996-08-15 | Sastech Pty Ltd | Copolymerization |
| DE19508655A1 (de) * | 1995-03-13 | 1996-09-19 | Basf Ag | Wäßrige Lösungen oder wäßrige Dispersionen von Copolymerisaten aus monoethylenisch ungesättigten Dicarbonsäuren oder deren Anhydriden und verzweigtkettigen Oligomeren oder Polymeren |
| DE19523511C1 (de) * | 1995-06-28 | 1996-12-19 | Bayer Ag | Wäßrige Dispersionen, Verfahren zu ihrer Herstellung und ihre Verwendung |
| US5667575A (en) * | 1995-09-21 | 1997-09-16 | Eastman Chemical Company | Process for reducing the color of an emulsion containing functionalized polyolefin wax |
| DE19648895A1 (de) * | 1996-11-26 | 1998-05-28 | Clariant Gmbh | Polar modifizierte Polypropylen-Wachse |
| US5810894A (en) * | 1996-12-20 | 1998-09-22 | Ferro Corporation | Monoamines and a method of making the same |
| US5912296A (en) * | 1997-05-19 | 1999-06-15 | Bridgestone Corporation | Extended polymer composition derived from grafted elastomers and polypropylene |
| US5910530A (en) * | 1997-05-19 | 1999-06-08 | Bridgestone Corporation | High damping gel derived from extending grafted elastomers and polypropylene |
| US6306503B1 (en) | 1997-06-11 | 2001-10-23 | Alliedsignal Inc. | Multilayer fluoropolymer films with improved adhesion |
| US6166118A (en) * | 1997-06-13 | 2000-12-26 | Eastman Chemical Company | Emulsification process for functionalized polyolefins and emulsions made therefrom |
| US6432542B1 (en) | 1997-11-06 | 2002-08-13 | Alliedsignal Inc. | Multicomponent structures having improved adhesion |
| US6248827B1 (en) | 1997-12-22 | 2001-06-19 | Bridgestone Corporation | Centipede polymers and preparation and application in rubber compositions |
| US6107409A (en) * | 1998-05-06 | 2000-08-22 | Bridgestone Corporation | Gels derived from extending grafted comb polymers and polypropylene via a solution synthesis |
| US5905116A (en) * | 1998-05-06 | 1999-05-18 | Bridgestone Corporation | Gels derived from extending grafted α-olefin-maleimide centipede polymers and polypropylene |
| US6048930A (en) * | 1998-05-06 | 2000-04-11 | Bridgestone Corporation | Grafted maleimide-styrene-g-polypropylene copolymers used in rubber compounds for increasing hysteresis |
| US6248825B1 (en) | 1998-05-06 | 2001-06-19 | Bridgestone Corporation | Gels derived from extending grafted centipede polymers and polypropylene |
| US6054532A (en) * | 1998-05-06 | 2000-04-25 | Bridgestone Corporation | Centipede polymers grafted with hydrogenated block copolymers and polypropylene and gels thereof |
| US6204354B1 (en) | 1998-05-06 | 2001-03-20 | Bridgestone Corporation | Soft compounds derived from polypropylene grafted disubstituted ethylene- maleimide copolymers |
| US6207763B1 (en) | 1998-06-12 | 2001-03-27 | Bridgestone Corporation | Application of disubstituted ethylene-maleimide copolymers in rubber compounds |
| US6310134B1 (en) | 1998-06-30 | 2001-10-30 | Eastman Chemical Company | Adhesion-promoting primer compositions for polyolefin substrates |
| US6184292B1 (en) | 1998-10-05 | 2001-02-06 | Bridgestone Corporation | Soft gel polymers for high temperature use |
| US6632518B1 (en) * | 1998-10-14 | 2003-10-14 | E. I. Du Pont De Nemours And Company | Fluoropolymer film structures and laminates produced therefrom |
| US6133354A (en) * | 1998-11-17 | 2000-10-17 | Bridgestone Corporation | Copolymers as additives in thermoplastic elastomer gels |
| US6191217B1 (en) | 1998-11-17 | 2001-02-20 | Bridgestone Corporation | Gels derived from polypropylene grafted alkyl vinylether-maleimide copolymers |
| US6270909B1 (en) | 1999-04-07 | 2001-08-07 | Honeywell International Inc. | High temperature release films |
| WO2001070822A2 (en) | 2000-03-23 | 2001-09-27 | Bridgestone Corporation | Process for forming centipede polymer gels |
| US6384134B1 (en) | 2000-06-05 | 2002-05-07 | Bridgestone Corporation | Poly(alkenyl-co-maleimide) and maleated polyalkylene grafted with grafting agent, and epoxy polymer |
| US6476117B1 (en) | 2000-06-05 | 2002-11-05 | Bridgestone Corporation | Grafted near-gelation polymers having high damping properties |
| US6350800B1 (en) | 2000-06-05 | 2002-02-26 | Bridgestone Corporation | Soft polymer gel |
| US6417259B1 (en) | 2000-06-05 | 2002-07-09 | Bridgestone Corporation | Polyalkylene grafted centipede polymers |
| US6353054B1 (en) | 2000-07-31 | 2002-03-05 | Bridgestone Corporation | Alkenyl-co-maleimide/diene rubber copolymers and applications |
| US6359064B1 (en) | 2000-09-08 | 2002-03-19 | Bridgestone Corporation | Compound of polyester and polyalkylene grafted comb polymer |
| KR20030096358A (ko) * | 2001-05-06 | 2003-12-24 | 허니웰 인터내셔널 인코포레이티드 | 말레이트된 폴리프로필렌 및 그 제조방법 |
| US6855771B2 (en) * | 2002-10-31 | 2005-02-15 | Grant Doney | Process for making block polymers or copolymers from isotactic polypropylene |
| WO2004050353A2 (de) * | 2002-11-29 | 2004-06-17 | Treofan Germany Gmbh & Co. Kg | Biaxial orientierte folie mit einer schicht aus ethylen-vinyl-alkohol-copolymer (evoh) |
| US6887334B2 (en) * | 2003-01-27 | 2005-05-03 | Honeywell International Inc. | Thin film lamination-delamination process for fluoropolymers |
| US7223814B2 (en) * | 2003-11-17 | 2007-05-29 | Eastman Chemical Company | Hot melt adhesives with improved performance window |
| WO2005056616A1 (ja) * | 2003-12-10 | 2005-06-23 | Sanyo Chemical Industries, Ltd. | 変性ポリオレフィンの製造法 |
| US7427430B2 (en) | 2005-12-29 | 2008-09-23 | Honeywell International Inc. | Polyamide blend composition having excellent gas barrier performance |
| US7985483B2 (en) * | 2006-11-16 | 2011-07-26 | Smarthealth, Inc. | Digital printing of low volume applications |
| US8513361B2 (en) | 2007-12-28 | 2013-08-20 | Bridgestone Corporation | Interpolymers containing isobutylene and diene mer units |
| US20100276057A1 (en) * | 2009-04-30 | 2010-11-04 | H.B. Fuller Company | Ethylene-butene copolymer, adhesive composition including the same, and method of making and using the same |
| US9511914B2 (en) | 2009-09-01 | 2016-12-06 | Philip Morris Usa Inc. | Thermoformable multilayer films and blister packs produced therefrom |
| JP5526951B2 (ja) * | 2010-04-05 | 2014-06-18 | 株式会社オートネットワーク技術研究所 | 電線被覆材用組成物、絶縁電線及びワイヤーハーネス |
| WO2012080885A2 (en) * | 2010-12-13 | 2012-06-21 | Ecolab Usa Inc. | Soil resistant floor cleaner |
| CN102643371B (zh) * | 2012-05-02 | 2013-09-04 | 四川大学 | 一种热降解制备链端含苯氧基团聚乙烯蜡的方法 |
| DE102018101747A1 (de) | 2018-01-26 | 2019-08-01 | Brückner Maschinenbau GmbH & Co. KG | Inline beschichtete biaxial orientierte Polypropylenfolie und Verfahren zu ihrer Herstellung |
| WO2019177865A1 (en) | 2018-03-15 | 2019-09-19 | Advansix Resins & Chemicals Llc | Laminate film, package, and methods for oxygen-sensitive materials |
| KR102848751B1 (ko) | 2020-10-30 | 2025-08-22 | 삼성전자 주식회사 | 플렉서블 디스플레이의 촬영 안내 방법 및 장치 |
| JP7758594B2 (ja) * | 2022-02-16 | 2025-10-22 | 三井化学株式会社 | 水分散体、表面処理剤、処理繊維および処理フィラー |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2766214A (en) * | 1953-10-22 | 1956-10-09 | Allied Chem & Dye Corp | Emulsifiable polyethylene waxes and preparation thereof |
| US2829296A (en) * | 1955-10-31 | 1958-04-01 | Sylvania Electric Prod | Gaseous discharge tube |
| NL213364A (enExample) * | 1955-12-30 | |||
| US2970129A (en) * | 1956-11-15 | 1961-01-31 | Union Carbide Corp | Graft copolymer of polyethylene and polymerizable acrylic compounds, process for preparing same, and composition thereof |
| NO126663L (enExample) * | 1957-01-09 | |||
| US2973344A (en) * | 1957-12-11 | 1961-02-28 | Exxon Research Engineering Co | Modified polymers |
| US3290415A (en) * | 1959-03-26 | 1966-12-06 | Du Pont | Graft copolymer of polymeric hydrocarbon and organic acid bearing radical |
| DE1247656B (de) * | 1962-05-16 | 1967-08-17 | Basf Ag | Verfahren zur Herstellung von emulgierbaren Polyolefinwachsen |
| US3267173A (en) * | 1962-05-18 | 1966-08-16 | Allied Chem | Product and process for making a polyethylene-maleate diester graft copolymer |
| US3341621A (en) * | 1963-05-31 | 1967-09-12 | Eastman Kodak Co | Thermally degraded block copolymers of propylene and 1-butene |
| US3328362A (en) * | 1964-01-30 | 1967-06-27 | Celanese Corp | Preparation of modified polymers |
-
1965
- 1965-10-22 US US502437A patent/US3480580A/en not_active Expired - Lifetime
-
1966
- 1966-08-08 JP JP5173366A patent/JPS4536311B1/ja active Pending
- 1966-10-20 DE DE1720566A patent/DE1720566C3/de not_active Expired
- 1966-10-21 GB GB47220/66A patent/GB1154544A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE1720566A1 (de) | 1971-07-01 |
| JPS4536311B1 (enExample) | 1970-11-18 |
| GB1154544A (en) | 1969-06-11 |
| US3480580A (en) | 1969-11-25 |
| DE1720566B2 (de) | 1981-02-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1720566C3 (de) | Verfahren zur Herstellung von emulgierbaren Poly-α-olefinen | |
| EP0941257B1 (de) | Polar modifizierte polypropylen-wachse | |
| DE1720563A1 (de) | Verfahren zur Herstellung von emulgierbaren Poly-alpha-olefinen | |
| DE2005482C3 (de) | Verfahren zur Herstellung chlorierter, Carboxylgruppenhaltiger Poly-α-olefine | |
| DE2241057C3 (de) | Verfahren zur Herstellung eines modifizierten wachsartigen Äthylenpolymeren | |
| DE1520518A1 (de) | Verfahren zur Herstellung von diaminmodifizierten Mischpolymerisaten aus alpha-Olefinen und alpha,beta-aethylenungesaettigten Monocarbonsaeuren | |
| DE2454808A1 (de) | Pulverfoermige beschichtungsmasse und substrat mit einer elektrostatisch darauf aufgebrachten derartigen beschichtungsmasse | |
| AT400719B (de) | Verfahren zur herstellung von wasserverdünnbaren lufttrocknenden lackbindemitteln und deren verwendung | |
| DE2649684A1 (de) | Ester und deren verwendung als schmiermittel | |
| EP0009169B1 (de) | Verfahren zur Herstellung von Copolymerisaten aus Maleinsäureanhydrid und Alkenen | |
| US3433777A (en) | Emulsifiable polyolefin composition and process for its preparation | |
| DE68912143T2 (de) | Modifizierte chlorierte polyolefine. | |
| DE2416658A1 (de) | Mit acryl- oder methacrylsaeure modifizierte alkydharze fuer wasserfarben | |
| DE2611332A1 (de) | Ionisch vernetzte aethylen-copolymerisate | |
| DE2026189C2 (de) | Verfahren zur Herstellung von Copolymeren von Äthylen, einem funktionellen Monomeren sowie ggf. α-Olefinen mit 3-18 C-Atomen und/oder einem nicht-konjugierten Dien | |
| DE2126725C3 (de) | Verfahren zur Herstellung eines modifizierten Polyäthylenwachses | |
| EP0467178A2 (de) | Gepfropfte und vernetzte Propylencopolymerisate | |
| DE1495938C3 (de) | Verfahren zur Herstellung von emulgierbaren Athylenpolymeren und Verwendung dieser Polymeren zur Erzeugung wässriger Emulsionen | |
| DE2341462A1 (de) | Ionomere von alkylester-terpolymerisaten | |
| Thames et al. | Air-dry primer coatings from dehydrated lesquerella oil | |
| EP0054139B1 (de) | Bindemittel für aus der Schmelze zu verarbeitende Beschichtungsstoffe und ihre Verwendung | |
| DE2102068A1 (de) | Polymerdispersionen und Verfahren zu ihrer Herstellung | |
| DE1197230B (de) | Verfahren zum Herstellen von wasseremulgier-barem Polyaethylenwachs | |
| DE2166407C3 (de) | Verfahren zur Herstellung von modifizierten Polyäthylenwachs | |
| DE1233605B (de) | Verfahren zum Herstellen von Copolymerisaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |