DE1668843A1 - Biologisch aktive substituierte Amidine - Google Patents
Biologisch aktive substituierte AmidineInfo
- Publication number
- DE1668843A1 DE1668843A1 DE19671668843 DE1668843A DE1668843A1 DE 1668843 A1 DE1668843 A1 DE 1668843A1 DE 19671668843 DE19671668843 DE 19671668843 DE 1668843 A DE1668843 A DE 1668843A DE 1668843 A1 DE1668843 A1 DE 1668843A1
- Authority
- DE
- Germany
- Prior art keywords
- amidino
- urea
- addition salt
- amidinourea
- acid addition
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001409 amidines Chemical class 0.000 title 1
- 239000002253 acid Substances 0.000 claims description 53
- 150000003839 salts Chemical class 0.000 claims description 53
- 238000000034 method Methods 0.000 claims description 45
- 150000001875 compounds Chemical class 0.000 claims description 42
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 35
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 33
- SQSPRWMERUQXNE-UHFFFAOYSA-N Guanylurea Chemical compound NC(=N)NC(N)=O SQSPRWMERUQXNE-UHFFFAOYSA-N 0.000 claims description 32
- -1 substituent halogen Chemical group 0.000 claims description 31
- 229940123208 Biguanide Drugs 0.000 claims description 27
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 23
- 150000002367 halogens Chemical group 0.000 claims description 20
- 238000002360 preparation method Methods 0.000 claims description 20
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 claims description 19
- 229910052736 halogen Inorganic materials 0.000 claims description 18
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical compound NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 claims description 17
- XNCOSPRUTUOJCJ-UHFFFAOYSA-N Biguanide Chemical compound NC(N)=NC(N)=N XNCOSPRUTUOJCJ-UHFFFAOYSA-N 0.000 claims description 15
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 15
- 239000004202 carbamide Substances 0.000 claims description 13
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 claims description 13
- 150000002825 nitriles Chemical class 0.000 claims description 11
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 claims description 10
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 10
- ZFBKYGFPUCUYIF-UHFFFAOYSA-N 4-amino-2-chlorobenzonitrile Chemical group NC1=CC=C(C#N)C(Cl)=C1 ZFBKYGFPUCUYIF-UHFFFAOYSA-N 0.000 claims description 9
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 8
- 125000004953 trihalomethyl group Chemical group 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 239000008187 granular material Substances 0.000 claims description 7
- 239000007788 liquid Substances 0.000 claims description 7
- 229940098779 methanesulfonic acid Drugs 0.000 claims description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 7
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 6
- 239000011260 aqueous acid Substances 0.000 claims description 6
- 239000007787 solid Substances 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- 150000001408 amides Chemical class 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 5
- 239000000825 pharmaceutical preparation Substances 0.000 claims description 5
- 239000000725 suspension Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- FEYBPSKVORXMON-UHFFFAOYSA-N 1-(3-chloro-4-cyanophenyl)-3-(diaminomethylidene)urea Chemical compound NC(N)=NC(=O)NC1=CC=C(C#N)C(Cl)=C1 FEYBPSKVORXMON-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- CYESCLHCWJKRKM-UHFFFAOYSA-N DCPU Natural products NC(=O)NC1=CC=C(Cl)C(Cl)=C1 CYESCLHCWJKRKM-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 125000002560 nitrile group Chemical group 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 239000002775 capsule Substances 0.000 claims description 2
- 229950005627 embonate Drugs 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 238000007911 parenteral administration Methods 0.000 claims description 2
- PWXJULSLLONQHY-UHFFFAOYSA-N phenylcarbamic acid Chemical class OC(=O)NC1=CC=CC=C1 PWXJULSLLONQHY-UHFFFAOYSA-N 0.000 claims description 2
- 230000003301 hydrolyzing effect Effects 0.000 claims 2
- NHRPCBRGTAHNKB-UHFFFAOYSA-N (3-chloro-4-cyanophenyl)carbamic acid Chemical group ClC=1C=C(C=CC1C#N)NC(O)=O NHRPCBRGTAHNKB-UHFFFAOYSA-N 0.000 claims 1
- LILCPQCSZLDGDS-UHFFFAOYSA-N [amino(hydroxy)methylidene]azanium;methanesulfonate Chemical compound NC(N)=O.CS(O)(=O)=O LILCPQCSZLDGDS-UHFFFAOYSA-N 0.000 claims 1
- 125000005907 alkyl ester group Chemical group 0.000 claims 1
- YCLDXRHGQVDVJR-UHFFFAOYSA-N carbamothioylurea Chemical compound NC(=O)NC(N)=S YCLDXRHGQVDVJR-UHFFFAOYSA-N 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 239000002552 dosage form Substances 0.000 claims 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 1
- 230000003647 oxidation Effects 0.000 claims 1
- 238000007254 oxidation reaction Methods 0.000 claims 1
- 238000002844 melting Methods 0.000 description 85
- 230000008018 melting Effects 0.000 description 85
- 239000000243 solution Substances 0.000 description 60
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 51
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 48
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 44
- 239000002585 base Substances 0.000 description 41
- 238000005187 foaming Methods 0.000 description 32
- 238000001953 recrystallisation Methods 0.000 description 20
- 239000000047 product Substances 0.000 description 16
- 238000006243 chemical reaction Methods 0.000 description 15
- 238000001816 cooling Methods 0.000 description 15
- 230000000694 effects Effects 0.000 description 15
- 238000000354 decomposition reaction Methods 0.000 description 11
- 241000223992 Plasmodium gallinaceum Species 0.000 description 10
- 241000223829 Plasmodium vinckei Species 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- 235000013877 carbamide Nutrition 0.000 description 9
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical class NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 9
- 241001465754 Metazoa Species 0.000 description 8
- 229960004198 guanidine Drugs 0.000 description 8
- 208000015181 infectious disease Diseases 0.000 description 8
- 201000004792 malaria Diseases 0.000 description 8
- 150000004283 biguanides Chemical class 0.000 description 7
- 210000004369 blood Anatomy 0.000 description 7
- 239000008280 blood Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 241000699670 Mus sp. Species 0.000 description 6
- WKSAUQYGYAYLPV-UHFFFAOYSA-N pyrimethamine Chemical compound CCC1=NC(N)=NC(N)=C1C1=CC=C(Cl)C=C1 WKSAUQYGYAYLPV-UHFFFAOYSA-N 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 150000001448 anilines Chemical class 0.000 description 5
- WHTVZRBIWZFKQO-UHFFFAOYSA-N chloroquine Natural products ClC1=CC=C2C(NC(C)CCCN(CC)CC)=CC=NC2=C1 WHTVZRBIWZFKQO-UHFFFAOYSA-N 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 238000011081 inoculation Methods 0.000 description 5
- 244000052769 pathogen Species 0.000 description 5
- 229960000611 pyrimethamine Drugs 0.000 description 5
- WHTVZRBIWZFKQO-AWEZNQCLSA-N (S)-chloroquine Chemical compound ClC1=CC=C2C(N[C@@H](C)CCCN(CC)CC)=CC=NC2=C1 WHTVZRBIWZFKQO-AWEZNQCLSA-N 0.000 description 4
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 241000607479 Yersinia pestis Species 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 229960003677 chloroquine Drugs 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 238000011282 treatment Methods 0.000 description 4
- YBAZINRZQSAIAY-UHFFFAOYSA-N 4-aminobenzonitrile Chemical compound NC1=CC=C(C#N)C=C1 YBAZINRZQSAIAY-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 241000224017 Plasmodium berghei Species 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 210000003743 erythrocyte Anatomy 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000011321 prophylaxis Methods 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- 239000000375 suspending agent Substances 0.000 description 3
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 2
- OREVCMGFYSUYPX-UHFFFAOYSA-N 4-amino-3-chlorobenzonitrile Chemical compound NC1=CC=C(C#N)C=C1Cl OREVCMGFYSUYPX-UHFFFAOYSA-N 0.000 description 2
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 description 2
- LKFAOIUULBPANX-UHFFFAOYSA-N C(C)S(=O)(=O)O.NC(=O)N Chemical compound C(C)S(=O)(=O)O.NC(=O)N LKFAOIUULBPANX-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 241000287828 Gallus gallus Species 0.000 description 2
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-M Methanesulfonate Chemical compound CS([O-])(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 2
- 206010035148 Plague Diseases 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 239000003430 antimalarial agent Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000023555 blood coagulation Effects 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 235000013330 chicken meat Nutrition 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- YEDMWSJQDMJDCG-UHFFFAOYSA-N ethyl n-(4-cyanophenyl)carbamate Chemical compound CCOC(=O)NC1=CC=C(C#N)C=C1 YEDMWSJQDMJDCG-UHFFFAOYSA-N 0.000 description 2
- 150000002303 glucose derivatives Chemical class 0.000 description 2
- 229960000789 guanidine hydrochloride Drugs 0.000 description 2
- PJJJBBJSCAKJQF-UHFFFAOYSA-N guanidinium chloride Chemical compound [Cl-].NC(N)=[NH2+] PJJJBBJSCAKJQF-UHFFFAOYSA-N 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 229960002897 heparin Drugs 0.000 description 2
- 229920000669 heparin Polymers 0.000 description 2
- 125000001841 imino group Chemical group [H]N=* 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- 238000009533 lab test Methods 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 244000045947 parasite Species 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- INDBQLZJXZLFIT-UHFFFAOYSA-N primaquine Chemical compound N1=CC=CC2=CC(OC)=CC(NC(C)CCCN)=C21 INDBQLZJXZLFIT-UHFFFAOYSA-N 0.000 description 2
- 239000012266 salt solution Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- LTTMXKZGXNXBMM-UHFFFAOYSA-N 1-(3-chloro-4-nitrophenyl)-3-(diaminomethylidene)urea methanesulfonic acid Chemical compound CS(=O)(=O)O.C(N)(=N)NC(=O)NC1=CC(=C(C=C1)[N+](=O)[O-])Cl LTTMXKZGXNXBMM-UHFFFAOYSA-N 0.000 description 1
- ZJAWVBLMRPEUPW-UHFFFAOYSA-N 1-(diaminomethylidene)-2-(3,4-dichlorophenyl)guanidine Chemical compound NC(N)=NC(N)=NC1=CC=C(Cl)C(Cl)=C1 ZJAWVBLMRPEUPW-UHFFFAOYSA-N 0.000 description 1
- ZLCVRJYWKQGGFA-UHFFFAOYSA-N 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-(diaminomethylidene)urea Chemical compound NC(=N)NC(=O)NC1=CC=C(Cl)C(C(F)(F)F)=C1 ZLCVRJYWKQGGFA-UHFFFAOYSA-N 0.000 description 1
- HQROXDLWVGFPDE-UHFFFAOYSA-N 1-chloro-4-nitro-2-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C(C(F)(F)F)=C1 HQROXDLWVGFPDE-UHFFFAOYSA-N 0.000 description 1
- GUMCAKKKNKYFEB-UHFFFAOYSA-N 2,4,5-trichloroaniline Chemical compound NC1=CC(Cl)=C(Cl)C=C1Cl GUMCAKKKNKYFEB-UHFFFAOYSA-N 0.000 description 1
- KDHYVTSTJSOINL-UHFFFAOYSA-N 2-(2-chloro-4-cyanophenyl)-1-(diaminomethylidene)guanidine hydrochloride Chemical compound Cl.ClC1=C(C=CC(=C1)C#N)NC(=N)NC(=N)N KDHYVTSTJSOINL-UHFFFAOYSA-N 0.000 description 1
- VXMDOKODOQETRU-UHFFFAOYSA-N 2-[(4-amino-2,5-dihydro-1H-1,3,5-triazin-6-ylidene)-methylazaniumyl]acetate Chemical compound C\[N+](CC([O-])=O)=C1\NCN=C(N)N1 VXMDOKODOQETRU-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical class CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- SDYWXFYBZPNOFX-UHFFFAOYSA-N 3,4-dichloroaniline Chemical compound NC1=CC=C(Cl)C(Cl)=C1 SDYWXFYBZPNOFX-UHFFFAOYSA-N 0.000 description 1
- MFUVCHZWGSJKEQ-UHFFFAOYSA-N 3,4-dichlorphenylisocyanate Chemical compound ClC1=CC=C(N=C=O)C=C1Cl MFUVCHZWGSJKEQ-UHFFFAOYSA-N 0.000 description 1
- XENORHLEQQVHAP-UHFFFAOYSA-N 3-(3,4-dichlorophenyl)-1,1-diethylurea Chemical compound CCN(CC)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XENORHLEQQVHAP-UHFFFAOYSA-N 0.000 description 1
- LDSIOPGMLLPSSR-UHFFFAOYSA-N 3-chloro-4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C(Cl)=C1 LDSIOPGMLLPSSR-UHFFFAOYSA-N 0.000 description 1
- BGNGWHSBYQYVRX-UHFFFAOYSA-N 4-(dimethylamino)benzaldehyde Chemical compound CN(C)C1=CC=C(C=O)C=C1 BGNGWHSBYQYVRX-UHFFFAOYSA-N 0.000 description 1
- FDUGOYTWYJZNNP-UHFFFAOYSA-N 4-amino-2-fluorobenzonitrile Chemical compound NC1=CC=C(C#N)C(F)=C1 FDUGOYTWYJZNNP-UHFFFAOYSA-N 0.000 description 1
- RGHJWZADAWEIFE-UHFFFAOYSA-N 4-amino-2-methylbenzonitrile Chemical compound CC1=CC(N)=CC=C1C#N RGHJWZADAWEIFE-UHFFFAOYSA-N 0.000 description 1
- MBZDCUMFFPWLTJ-UHFFFAOYSA-N 4-amino-3-methylbenzonitrile Chemical compound CC1=CC(C#N)=CC=C1N MBZDCUMFFPWLTJ-UHFFFAOYSA-N 0.000 description 1
- RJWBTWIBUIGANW-UHFFFAOYSA-N 4-chlorobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Cl)C=C1 RJWBTWIBUIGANW-UHFFFAOYSA-N 0.000 description 1
- VVDIMAMYKUTSCL-UHFFFAOYSA-N 5-amino-2-chlorobenzonitrile Chemical compound NC1=CC=C(Cl)C(C#N)=C1 VVDIMAMYKUTSCL-UHFFFAOYSA-N 0.000 description 1
- ASPDJZINBYYZRU-UHFFFAOYSA-N 5-amino-2-chlorobenzotrifluoride Chemical compound NC1=CC=C(Cl)C(C(F)(F)F)=C1 ASPDJZINBYYZRU-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 208000009182 Parasitemia Diseases 0.000 description 1
- 208000030852 Parasitic disease Diseases 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 208000010362 Protozoan Infections Diseases 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000000078 anti-malarial effect Effects 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 229940033495 antimalarials Drugs 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 239000000022 bacteriostatic agent Substances 0.000 description 1
- 230000003385 bacteriostatic effect Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- JIRRNZWTWJGJCT-UHFFFAOYSA-N carbamothioylthiourea Chemical class NC(=S)NC(N)=S JIRRNZWTWJGJCT-UHFFFAOYSA-N 0.000 description 1
- 150000001722 carbon compounds Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 241001233037 catfish Species 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000005056 compaction Methods 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 229910000336 copper(I) sulfate Inorganic materials 0.000 description 1
- WIVXEZIMDUGYRW-UHFFFAOYSA-L copper(i) sulfate Chemical compound [Cu+].[Cu+].[O-]S([O-])(=O)=O WIVXEZIMDUGYRW-UHFFFAOYSA-L 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000003226 decolorizating effect Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- OKGXJRGLYVRVNE-UHFFFAOYSA-N diaminomethylidenethiourea Chemical class NC(N)=NC(N)=S OKGXJRGLYVRVNE-UHFFFAOYSA-N 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- YGLLICRFEVEWOZ-UHFFFAOYSA-L disodium;3-carboxy-1-[(3-carboxy-2-oxidonaphthalen-1-yl)methyl]naphthalen-2-olate Chemical compound [Na+].[Na+].C1=CC=C2C(CC3=C4C=CC=CC4=CC(=C3O)C([O-])=O)=C(O)C(C([O-])=O)=CC2=C1 YGLLICRFEVEWOZ-UHFFFAOYSA-L 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000003979 granulating agent Substances 0.000 description 1
- 150000002357 guanidines Chemical class 0.000 description 1
- ZJYYHGLJYGJLLN-UHFFFAOYSA-N guanidinium thiocyanate Chemical compound SC#N.NC(N)=N ZJYYHGLJYGJLLN-UHFFFAOYSA-N 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- CZGDYZDUMJDQSD-UHFFFAOYSA-N hydron;4-(trifluoromethyl)aniline;chloride Chemical compound Cl.NC1=CC=C(C(F)(F)F)C=C1 CZGDYZDUMJDQSD-UHFFFAOYSA-N 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000002458 infectious effect Effects 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- 210000004731 jugular vein Anatomy 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000005649 metathesis reaction Methods 0.000 description 1
- DSKJXGYAJJHDOE-UHFFFAOYSA-N methylideneurea Chemical compound NC(=O)N=C DSKJXGYAJJHDOE-UHFFFAOYSA-N 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- KUWAAZMPJBFLEO-UHFFFAOYSA-N n,n,2-trichloroaniline Chemical compound ClN(Cl)C1=CC=CC=C1Cl KUWAAZMPJBFLEO-UHFFFAOYSA-N 0.000 description 1
- CMUOJBJRZUHRMU-UHFFFAOYSA-N nitrourea Chemical compound NC(=O)N[N+]([O-])=O CMUOJBJRZUHRMU-UHFFFAOYSA-N 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- 230000024241 parasitism Effects 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 229920006316 polyvinylpyrrolidine Polymers 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 229960005179 primaquine Drugs 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- SSOLNOMRVKKSON-UHFFFAOYSA-N proguanil Chemical compound CC(C)\N=C(/N)N=C(N)NC1=CC=C(Cl)C=C1 SSOLNOMRVKKSON-UHFFFAOYSA-N 0.000 description 1
- 229960005385 proguanil Drugs 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- GURNTNKIRDSILY-UHFFFAOYSA-M silver;ethanesulfonate Chemical compound [Ag+].CCS([O-])(=O)=O GURNTNKIRDSILY-UHFFFAOYSA-M 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 125000004149 thio group Chemical group *S* 0.000 description 1
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 1
- GZNAASVAJNXPPW-UHFFFAOYSA-M tin(4+) chloride dihydrate Chemical compound O.O.[Cl-].[Sn+4] GZNAASVAJNXPPW-UHFFFAOYSA-M 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Substances O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C279/00—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups
- C07C279/20—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylguanidines
- C07C279/24—Y being a hetero atom
- C07C279/26—X and Y being nitrogen atoms, i.e. biguanides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Structures Of Non-Positive Displacement Pumps (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB19028/67A GB1194835A (en) | 1966-07-07 | 1966-07-07 | Novel 1-Amidino-3-Phenyl-Urea Derivatives, the preparation thereof and Compositions containing the same |
| GB3047966 | 1966-07-07 | ||
| GB5654666 | 1966-12-16 | ||
| GB539167 | 1967-02-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1668843A1 true DE1668843A1 (de) | 1972-02-24 |
Family
ID=27447446
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671793745 Pending DE1793745A1 (de) | 1966-07-07 | 1967-07-04 | Arylsubstituierte biguanide |
| DE19671668843 Pending DE1668843A1 (de) | 1966-07-07 | 1967-07-04 | Biologisch aktive substituierte Amidine |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671793745 Pending DE1793745A1 (de) | 1966-07-07 | 1967-07-04 | Arylsubstituierte biguanide |
Country Status (15)
| Country | Link |
|---|---|
| US (2) | US3539616A (cg-RX-API-DMAC10.html) |
| BE (1) | BE700895A (cg-RX-API-DMAC10.html) |
| CA (1) | CA947316A (cg-RX-API-DMAC10.html) |
| CH (5) | CH501597A (cg-RX-API-DMAC10.html) |
| DE (2) | DE1793745A1 (cg-RX-API-DMAC10.html) |
| DK (1) | DK125705B (cg-RX-API-DMAC10.html) |
| FR (2) | FR1548340A (cg-RX-API-DMAC10.html) |
| GB (1) | GB1194835A (cg-RX-API-DMAC10.html) |
| IL (1) | IL28189A (cg-RX-API-DMAC10.html) |
| LU (1) | LU54053A1 (cg-RX-API-DMAC10.html) |
| MC (1) | MC666A1 (cg-RX-API-DMAC10.html) |
| NL (1) | NL6709484A (cg-RX-API-DMAC10.html) |
| NO (1) | NO126225B (cg-RX-API-DMAC10.html) |
| OA (1) | OA02467A (cg-RX-API-DMAC10.html) |
| SE (1) | SE330010B (cg-RX-API-DMAC10.html) |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3761597A (en) * | 1967-06-30 | 1973-09-25 | L Walls | 1-amidino-3-(substituted-phenyl) urea antimalarial composition and method of use |
| IL37047A0 (en) * | 1970-06-30 | 1971-08-25 | Wellcome Found | Substituted amidines,their preparation and pharmaceutical compositions containing them |
| US4326074A (en) * | 1972-09-22 | 1982-04-20 | William H. Rorer, Inc. | Amidinoureas |
| US4220658A (en) * | 1972-09-22 | 1980-09-02 | William H. Rorer, Inc. | Treatment of hypertension with amidinoureas |
| US4488993A (en) * | 1972-09-22 | 1984-12-18 | William H. Rorer, Inc. | Amidinoureas |
| US4025652A (en) * | 1975-03-31 | 1977-05-24 | William H. Rorer, Inc. | Amidinoureas |
| FR2223361B1 (cg-RX-API-DMAC10.html) * | 1973-03-27 | 1977-04-29 | Philagro Sa | |
| JPS5646157B2 (cg-RX-API-DMAC10.html) * | 1973-06-05 | 1981-10-31 | ||
| US4216230A (en) * | 1973-07-16 | 1980-08-05 | William H. Rorer, Inc. | Method for alleviating hypertension with amidinoureas |
| US4060635A (en) * | 1975-03-31 | 1977-11-29 | William H. Rorer, Inc. | Amidinoureas for treating diarrhea |
| US4150154A (en) * | 1975-03-03 | 1979-04-17 | William H. Rorer, Inc. | Amidinoureas |
| ZA743750B (en) * | 1973-07-16 | 1975-06-25 | Rorer Inc William H | Amindinoureas |
| US4283555A (en) * | 1973-07-16 | 1981-08-11 | William H. Rorer, Inc. | Amidinoureas |
| US4216229A (en) * | 1973-07-16 | 1980-08-05 | William H. Rorer, Inc. | Method for treating gastrointestinal hyperacidity or ulceration with amidinoureas |
| FR2237625B1 (cg-RX-API-DMAC10.html) * | 1973-07-16 | 1978-07-28 | Rorer Inc William H | |
| US4203920A (en) * | 1975-03-31 | 1980-05-20 | William H. Rorer, Inc. | Amidinoureas |
| US4204000A (en) * | 1975-03-31 | 1980-05-20 | William H. Rorer, Inc. | Anti-ulcer amidinoureas |
| US4242339A (en) * | 1976-03-30 | 1980-12-30 | William H. Rorer, Inc. | Method for treatment of gastrointestinal spasmodic disease conditions or symptoms in mammals |
| US4242337A (en) * | 1976-03-30 | 1980-12-30 | William H. Rorer, Inc. | Method for treatment of diarrheal disease conditions or symptons in mammals |
| US4058557A (en) * | 1976-03-30 | 1977-11-15 | William H. Rorer, Inc. | Amidinoureas |
| US4353842A (en) * | 1978-09-14 | 1982-10-12 | William H. Rorer, Inc. | Amidinoureas |
| US4440949A (en) * | 1979-01-08 | 1984-04-03 | William H. Rorer, Inc. | Amidinoureas |
| US4340609A (en) * | 1980-01-02 | 1982-07-20 | William H. Rorer, Inc. | Amidinourea derivative veterinary compositions for suppression of parasitemia |
| NL8120313A (nl) * | 1981-08-24 | 1983-07-01 | Rorer Int Overseas | Heterocyclische amidino-gesubstitueerde ureums en de farmaceutische toepassingen daarvan. |
| HUT43034A (en) * | 1985-02-15 | 1987-09-28 | Rorer Int Overseas | Process for preparing amidino-urea derivatives and pharmaceutical compositions comprising such compounds |
| EP0648749B1 (de) * | 1993-08-18 | 1997-12-10 | Bayer Ag | N-Cyanoaryl-Stickstoffheterocyclen |
| US5681794A (en) * | 1993-08-18 | 1997-10-28 | Bayer Aktiengesellschaft | N-cyanoaryl-nitrogen heterocycles |
| DE4412079A1 (de) * | 1993-08-18 | 1995-02-23 | Bayer Ag | N-Cyanoaryl-Stickstoffheterocyclen |
| DE4335438A1 (de) * | 1993-10-18 | 1995-04-20 | Bayer Ag | 4-Cyanophenyliminoheterocyclen |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3119867A (en) * | 1962-01-26 | 1964-01-28 | Clairol Inc | Amino, nitro-phenyl-biguanides and amino, nitro-phenyl; guanyl-ureas |
-
1966
- 1966-07-07 GB GB19028/67A patent/GB1194835A/en not_active Expired
-
1967
- 1967-06-22 CA CA993,746A patent/CA947316A/en not_active Expired
- 1967-06-23 IL IL28189A patent/IL28189A/en unknown
- 1967-06-29 SE SE09660/67*A patent/SE330010B/xx unknown
- 1967-06-30 US US650225A patent/US3539616A/en not_active Expired - Lifetime
- 1967-07-04 DE DE19671793745 patent/DE1793745A1/de active Pending
- 1967-07-04 DE DE19671668843 patent/DE1668843A1/de active Pending
- 1967-07-04 OA OA52998A patent/OA02467A/xx unknown
- 1967-07-04 NO NO00168928A patent/NO126225B/no unknown
- 1967-07-04 BE BE700895D patent/BE700895A/xx unknown
- 1967-07-05 FR FR1548340D patent/FR1548340A/fr not_active Expired
- 1967-07-06 MC MC705A patent/MC666A1/fr unknown
- 1967-07-06 DK DK349067AA patent/DK125705B/da unknown
- 1967-07-07 LU LU54053D patent/LU54053A1/xx unknown
- 1967-07-07 CH CH966767A patent/CH501597A/de not_active IP Right Cessation
- 1967-07-07 CH CH325170A patent/CH554318A/xx not_active IP Right Cessation
- 1967-07-07 NL NL6709484A patent/NL6709484A/xx unknown
- 1967-07-07 CH CH1705770A patent/CH501599A/de not_active IP Right Cessation
- 1967-07-07 CH CH324870A patent/CH501598A/de not_active IP Right Cessation
- 1967-07-07 CH CH325070A patent/CH500952A/de not_active IP Right Cessation
- 1967-10-03 FR FR123107A patent/FR7055M/fr not_active Expired
-
1970
- 1970-06-30 US US00051325A patent/US3784582A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FR7055M (cg-RX-API-DMAC10.html) | 1969-06-23 |
| CA947316A (en) | 1974-05-14 |
| OA02467A (fr) | 1970-05-05 |
| GB1194835A (en) | 1970-06-10 |
| CH500952A (de) | 1970-12-31 |
| US3539616A (en) | 1970-11-10 |
| CH501599A (de) | 1971-01-15 |
| MC666A1 (fr) | 1968-04-01 |
| CH501598A (de) | 1971-01-15 |
| DE1793745A1 (de) | 1973-05-30 |
| CH554318A (de) | 1974-09-30 |
| IL28189A (en) | 1971-04-28 |
| FR1548340A (cg-RX-API-DMAC10.html) | 1968-12-06 |
| NO126225B (cg-RX-API-DMAC10.html) | 1973-01-08 |
| DK125705B (da) | 1973-03-26 |
| NL6709484A (cg-RX-API-DMAC10.html) | 1968-01-08 |
| LU54053A1 (cg-RX-API-DMAC10.html) | 1968-03-12 |
| US3784582A (en) | 1974-01-08 |
| SE330010B (cg-RX-API-DMAC10.html) | 1970-11-02 |
| BE700895A (cg-RX-API-DMAC10.html) | 1968-01-04 |
| CH501597A (de) | 1971-01-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1668843A1 (de) | Biologisch aktive substituierte Amidine | |
| EP0186087B1 (de) | Tetrahydro-benzthiazole, deren Herstellung und deren Verwendung als Zwischenprodukte oder als Arnzneimittel | |
| DE68929460T2 (de) | Substituierte Phenylpyrimidine Derivate, für die Behandlung oder Prevention von ZNS-Erkrankungen | |
| DE2718799A1 (de) | 1-(4-phenoxy-phenyl)-1,3,5-triazin- derivate, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel und wachstumsfoerderer | |
| DE1470053A1 (de) | 5,6-disubstituierte (3-Aminopyrazinoyl)-guanidinverbindungen und Verfahren zu deren Herstellung | |
| DE2246109A1 (de) | 1-(4-phenoxy-phenyl)-1,3,5-triazinderivate, ein verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2313721A1 (de) | Neue 1-phenylsubstituierte 1,3,5triazine, verfahren zu ihrer herstellung, sowie ihre verwendung als arzneimittel | |
| DD248056A5 (de) | Arzneimittel und deren verwendung | |
| EP0153617B1 (de) | 1-[4-(Benzothia- oder -oxazol-2-ylthio- oder -2-yloxy) phenyl]-1,3,5-triazin-2,4,6(1H,3H,5H)-trione, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel | |
| DE69013871T2 (de) | 4-Benzyl-5-phenyl-2,4-dihydro-3H-1,2,4-triazol-3-one und ihre Verwendung als Antikonvulsiva. | |
| DE2355262C3 (de) | 1-Piperidinsulfonylharnstoffe, Verfahren zu deren Herstellung und diese enthaltende pharmazeutische Präparate | |
| DE1770490C3 (de) | 2,4-Diamino-6-nitrosamino-chinazolinverbindungen und Verfahren zu ihrer Herstellung | |
| DE3314739A1 (de) | 1-(4-(4-(fluoralkylmethylthio- oder -sulfinyl- oder -sulfonyl-)phenoxy) phenyl)-1,3,5-triazin-2,4,6(1h,3h,5h)-trione, verfahren zu ihrer herstellung und ihre verwendung als coccidiosemittel | |
| DE10129704A1 (de) | Verwendung von Benzolsulfonyl(thio)harnstoffen in der Behandlung des septischen Schocks | |
| DE3134780A1 (de) | "sulfonylharnstoffe, verfahren zu ihrer herstellung, pharmazeutische praeparate auf basis dieser verbindungen und ihre verwendung" | |
| DE2731039A1 (de) | 7-(substituierte)-7h-pyrrolo eckige klammer auf 3,2-f eckige klammer zu -chinazolin-1,3-diamine | |
| DE69026936T2 (de) | 5-aminocarbonyl-5h-dibenzo-a,d]cyclohepten-5,10-imine zur behandlung von epilepsie und kokainsucht | |
| DE2609574C3 (de) | 1 -^-Fluor-S-trifluormethylthiophenyD-piperazin, dessen Salze, Verfahren zu dessen Herstellung und Arzneimittel | |
| DE2132028A1 (de) | Biologisch aktive substituierte Amidine | |
| DE2056606C3 (de) | Alkylhydrazincarbodithioatderivate | |
| AT281860B (de) | K.rfahren zur herstellung von neuen amidinoharnstoffen oder ihren saeureadditionssalzen | |
| AT281058B (de) | Verfahren zur herstellung von neuen amidinoharnstoffen oder ihren saeureadditionssalzen | |
| CH370765A (de) | Verfahren zur Herstellung von oral wirksamen Antidiabetika | |
| US3761597A (en) | 1-amidino-3-(substituted-phenyl) urea antimalarial composition and method of use | |
| DE2116252A1 (de) | Dihydrotnazine, ihre Saureadditions salze und N Acyldenvate, Verfahren zu ihrer Herstellung und Arzneimittel, die diese Verbindungen als Wirkstoffe ent halten |