DE1668185C - - Google Patents
Info
- Publication number
- DE1668185C DE1668185C DE1668185C DE 1668185 C DE1668185 C DE 1668185C DE 1668185 C DE1668185 C DE 1668185C
- Authority
- DE
- Germany
- Prior art keywords
- mesitylene
- aromatics
- propene
- percent
- weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- AUHZEENZYGFFBQ-UHFFFAOYSA-N mesitylene Substances CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 claims description 42
- 125000001827 mesitylenyl group Chemical group [H]C1=C(C(*)=C(C([H])=C1C([H])([H])[H])C([H])([H])[H])C([H])([H])[H] 0.000 claims description 41
- QQONPFPTGQHPMA-UHFFFAOYSA-N Propene Chemical compound CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 21
- 239000000203 mixture Substances 0.000 claims description 12
- 230000029936 alkylation Effects 0.000 claims description 9
- 238000005804 alkylation reaction Methods 0.000 claims description 9
- 238000004821 distillation Methods 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- 238000000926 separation method Methods 0.000 claims description 5
- 229940100198 alkylating agent Drugs 0.000 claims description 4
- 239000002168 alkylating agent Substances 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 4
- 238000002955 isolation Methods 0.000 claims description 4
- GWHJZXXIDMPWGX-UHFFFAOYSA-N 1,2,4-trimethylbenzene Chemical compound CC1=CC=C(C)C(C)=C1 GWHJZXXIDMPWGX-UHFFFAOYSA-N 0.000 description 18
- HYFLWBNQFMXCPA-UHFFFAOYSA-N 1-ethyl-2-methylbenzene Chemical compound CCC1=CC=CC=C1C HYFLWBNQFMXCPA-UHFFFAOYSA-N 0.000 description 8
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical compound CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 230000006207 propylation Effects 0.000 description 5
- JRLPEMVDPFPYPJ-UHFFFAOYSA-N 1-ethyl-4-methylbenzene Chemical compound CCC1=CC=C(C)C=C1 JRLPEMVDPFPYPJ-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 3
- ZLCSFXXPPANWQY-UHFFFAOYSA-N 3-ethyltoluene Chemical compound CCC1=CC=CC(C)=C1 ZLCSFXXPPANWQY-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical group CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000004939 coking Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- WZEYZMKZKQPXSX-UHFFFAOYSA-N 1,3,5-trimethylbenzene Chemical compound CC1=CC(C)=CC(C)=C1.CC1=CC(C)=CC(C)=C1 WZEYZMKZKQPXSX-UHFFFAOYSA-N 0.000 description 1
- DQGMASZUGMDEFA-UHFFFAOYSA-N 1-methyl-2-nitrosoimidazole Chemical compound CN1C=CN=C1N=O DQGMASZUGMDEFA-UHFFFAOYSA-N 0.000 description 1
- KZDCMKVLEYCGQX-UDPGNSCCSA-N 2-(diethylamino)ethyl 4-aminobenzoate;(2s,5r,6r)-3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;hydrate Chemical compound O.CCN(CC)CCOC(=O)C1=CC=C(N)C=C1.N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 KZDCMKVLEYCGQX-UDPGNSCCSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- UREBDLICKHMUKA-CXSFZGCWSA-N dexamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-CXSFZGCWSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229940078552 o-xylene Drugs 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2340816C3 (de) | Verfahren zur Herstellung von sek.-Butanol | |
| DE1518622A1 (de) | Rohstoffgemisch | |
| DE1668185C (enExample) | ||
| DE1668185B1 (de) | Verfahren zur Isolierung von reinem Mesitylen aus seinen Gemischen mit C9-Aromaten | |
| DE69717771T2 (de) | Alkylierungsverfahren mit höherer Katalysatorstabilität | |
| DE2027610A1 (de) | Verfahren zur kontinuierlichen Herstellung von m-Alkylphenolen | |
| DE1618331A1 (de) | Verfahren zur Herstellung von Isopren | |
| DE897998C (de) | Verfahren zur Alkylierung von aromatischen Kohlenwasserstoffen | |
| DE2044479C3 (enExample) | ||
| DE2301183B2 (de) | Verfahren zum alkylieren von isobuten und/oder isopentan | |
| DE1793367A1 (de) | Verfahren zur Abtrennung von 1,3,5-Trimethylbenzol aus aromatischen Kohlenwasserstofffraktionen | |
| DE1518917C (enExample) | ||
| DE1935750B2 (de) | Verfahren zur Herstellung von Alkylbenzolen | |
| DE2148874C3 (de) | Katalysator für die Alkylierung von aromatischen Kohlenwasserstoffen | |
| DE2003427A1 (de) | Verfahren zur Alkylierung von Isoparaffinen mit Olefinen | |
| DE2024604A1 (de) | Verfahren zur Herstellung von Durol | |
| DE2705413B2 (de) | Verfahren zur Gewinnung von Motorkraftstoff alkylat | |
| DE1275037B (de) | Verfahren zur kontinuierlichen Alkylierung von aromatischen Kohlenwasserstoffen | |
| DE1919495A1 (de) | Verfahren zur Herstellung von Trioxan | |
| DE1493270A1 (de) | Verfahren zur Alkylierung von Isobutan | |
| DE1418028C (enExample) | ||
| DE1468639A1 (de) | AEthylterphenyl-Gemische und Verfahren zu ihrer Herstellung | |
| DE2438451C3 (de) | Verfahren zur Gewinnung von reinem m-Cymol bzw. eines Gemisches aus o- und p-Cymol aus Gleichgewichtsgemischen der Isomeren | |
| DE1944392C3 (de) | Verfahren zur Gewinnung vonreillem Isobutylen | |
| AT222105B (de) | Verfahren zur Kernalkylierung von aromatischen Kohlenwasserstoffen |