DE1618247B - - Google Patents
Info
- Publication number
- DE1618247B DE1618247B DE1618247B DE 1618247 B DE1618247 B DE 1618247B DE 1618247 B DE1618247 B DE 1618247B
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- aromatic
- reduction
- compounds
- methanol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 16
- 229910052714 tellurium Inorganic materials 0.000 claims description 15
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 claims description 15
- 150000001875 compounds Chemical class 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 14
- 125000003118 aryl group Chemical group 0.000 claims description 12
- 230000009467 reduction Effects 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 230000008569 process Effects 0.000 claims description 6
- MQRWPMGRGIILKQ-UHFFFAOYSA-N sodium telluride Chemical compound [Na][Te][Na] MQRWPMGRGIILKQ-UHFFFAOYSA-N 0.000 claims description 6
- 150000004772 tellurides Chemical class 0.000 claims description 6
- 239000003638 chemical reducing agent Substances 0.000 claims description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 3
- 150000001298 alcohols Chemical class 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 3
- 238000005695 dehalogenation reaction Methods 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- 125000005936 piperidyl group Chemical group 0.000 claims description 2
- 239000012429 reaction media Substances 0.000 claims description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 51
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- 238000006243 chemical reaction Methods 0.000 description 17
- 239000011734 sodium Substances 0.000 description 13
- WZXXZHONLFRKGG-UHFFFAOYSA-N 2,3,4,5-tetrachlorothiophene Chemical compound ClC=1SC(Cl)=C(Cl)C=1Cl WZXXZHONLFRKGG-UHFFFAOYSA-N 0.000 description 12
- OVXHWSNIIKNEQD-UHFFFAOYSA-N 2,3,4-trichlorothiophene Chemical compound ClC1=CSC(Cl)=C1Cl OVXHWSNIIKNEQD-UHFFFAOYSA-N 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 239000012299 nitrogen atmosphere Substances 0.000 description 9
- 150000002367 halogens Chemical class 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- -1 2-phenoxy-3,4,5-trichlorothiophene Chemical compound 0.000 description 7
- 229910052736 halogen Inorganic materials 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- QVFXSOFIEKYPOE-UHFFFAOYSA-N 3,4-dichlorothiophene Chemical compound ClC1=CSC=C1Cl QVFXSOFIEKYPOE-UHFFFAOYSA-N 0.000 description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 238000009835 boiling Methods 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 238000004817 gas chromatography Methods 0.000 description 4
- XWGJFPHUCFXLBL-UHFFFAOYSA-M rongalite Chemical compound [Na+].OCS([O-])=O XWGJFPHUCFXLBL-UHFFFAOYSA-M 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 238000004508 fractional distillation Methods 0.000 description 3
- 238000002329 infrared spectrum Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- JHBKHLUZVFWLAG-UHFFFAOYSA-N 1,2,4,5-tetrachlorobenzene Chemical compound ClC1=CC(Cl)=C(Cl)C=C1Cl JHBKHLUZVFWLAG-UHFFFAOYSA-N 0.000 description 2
- PDXPGLDHBNSNFV-UHFFFAOYSA-N 2,3,4,5-tetrachloroselenophene Chemical compound ClC=1[se]C(Cl)=C(Cl)C=1Cl PDXPGLDHBNSNFV-UHFFFAOYSA-N 0.000 description 2
- LVNVLQIXMBTMPH-UHFFFAOYSA-N 2,3-dichlorothiophene Chemical compound ClC=1C=CSC=1Cl LVNVLQIXMBTMPH-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- IOQJGQDDIMMFEB-UHFFFAOYSA-N Clc1sc(N2CCCCC2)c(Cl)c1Cl Chemical compound Clc1sc(N2CCCCC2)c(Cl)c1Cl IOQJGQDDIMMFEB-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- RWNKSTSCBHKHTB-UHFFFAOYSA-N Hexachloro-1,3-butadiene Chemical compound ClC(Cl)=C(Cl)C(Cl)=C(Cl)Cl RWNKSTSCBHKHTB-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 150000001491 aromatic compounds Chemical class 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 150000002366 halogen compounds Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- CKAPSXZOOQJIBF-UHFFFAOYSA-N hexachlorobenzene Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl CKAPSXZOOQJIBF-UHFFFAOYSA-N 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 238000001256 steam distillation Methods 0.000 description 2
- XSOKHXFFCGXDJZ-UHFFFAOYSA-N telluride(2-) Chemical compound [Te-2] XSOKHXFFCGXDJZ-UHFFFAOYSA-N 0.000 description 2
- RTNLUFLDZOAXIC-UHFFFAOYSA-N 1,2,3,4,5,6,7,8-octachloronaphthalene Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C2=C(Cl)C(Cl)=C(Cl)C(Cl)=C21 RTNLUFLDZOAXIC-UHFFFAOYSA-N 0.000 description 1
- NDZIBNJHNBUHKW-UHFFFAOYSA-N 1,2,3,4,5,6,7-heptachloronaphthalene Chemical compound ClC1=C(Cl)C(Cl)=C2C(Cl)=C(Cl)C(Cl)=CC2=C1Cl NDZIBNJHNBUHKW-UHFFFAOYSA-N 0.000 description 1
- AUNILJJPQWWXOE-UHFFFAOYSA-N 2,3,4-trichloro-5-iodothiophene Chemical compound ClC=1SC(I)=C(Cl)C=1Cl AUNILJJPQWWXOE-UHFFFAOYSA-N 0.000 description 1
- MHHSSWGQNHKLNI-UHFFFAOYSA-N 2-bromo-3,4,5-trichlorothiophene Chemical compound ClC=1SC(Br)=C(Cl)C=1Cl MHHSSWGQNHKLNI-UHFFFAOYSA-N 0.000 description 1
- WPYTZXCRMJJEBO-UHFFFAOYSA-N 3,4-diiodothiophene Chemical compound IC1=CSC=C1I WPYTZXCRMJJEBO-UHFFFAOYSA-N 0.000 description 1
- GBLJVZWJVQZQNF-UHFFFAOYSA-N 3-chloroselenophene Chemical compound ClC=1C=C[se]C=1 GBLJVZWJVQZQNF-UHFFFAOYSA-N 0.000 description 1
- WGKRMQIQXMJVFZ-UHFFFAOYSA-N 3-iodothiophene Chemical compound IC=1C=CSC=1 WGKRMQIQXMJVFZ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- HRKQOINLCJTGBK-UHFFFAOYSA-L dioxidosulfate(2-) Chemical group [O-]S[O-] HRKQOINLCJTGBK-UHFFFAOYSA-L 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 150000002896 organic halogen compounds Chemical class 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2337396A1 (de) | Verfahren zur herstellung aromatischer 1,3-diketone | |
| DE1939112B2 (de) | Ester der N-(3-Trifluormethylphenyl) -anthranilsäure, Verfahren zu ihrer Herstellung und pharmakologisch wirksame Zubereitungen derselben | |
| DE1468395C3 (de) | Verfahren zur Herstellung fluo rierter aromatischer Verbindungen und 1,3 Dichlor tetrafluorbenzol als solches | |
| DE1618247B (cg-RX-API-DMAC7.html) | ||
| DE2644641C2 (de) | Verfahren zur Herstellung von bestimmten kernchlorierten Benzotrichloriden | |
| DE1543326C3 (de) | Verfahren zur Herstellung von halogenierten 1,2-Nitranilinen | |
| DE1618247C (cg-RX-API-DMAC7.html) | ||
| DE2652810C3 (de) | Verfahren zur Herstellung von aromatischen Fluorverbindungen | |
| EP0089485B1 (de) | Verfahren zur Herstellung von 5-Chlor-1H-tetrazol-1-carbonsäureestern sowie Verfahren zur Herstellung der erforderlichen Dichlorisonitril-carbonsäureester | |
| EP0048372B1 (de) | Verfahren zur Herstellung von Pyrazol | |
| DE2503699A1 (de) | Verfahren zur herstellung von 1,2- benzisothiazolen | |
| DE2118191A1 (de) | N-Alkylsulfonylbenzoylhalogen= alkylsulfonanilide | |
| DE907414C (de) | Verfahren zur Herstellung von 2-(2-Methyl-5-halogen-phenyl-1-mercapto)-benzoesaeuren | |
| DE1668034A1 (de) | Verfahren zur Herstellung von Benzylcyaniden und deren Homologen | |
| DE890339C (de) | Verfahren zur Herstellung von symm. 1, 2, 4, 5-Tetrachlorbenzol aus ª€-Heptachlorcyclohexan | |
| US3574217A (en) | Process for substituting aromatically bound halogen by hydrogen | |
| DE2458191C3 (de) | Verfahren zur Herstellung von s-Trialkoxybenzolen | |
| DE515540C (de) | Verfahren zur Darstellung von Diacidylderivaten des meta-Xylols | |
| DE3025910A1 (de) | Verfahren zur herstellung von 2,6-dichlorbenzthiazol | |
| DE896344C (de) | Verfahren zur Herstellung im Kern alkoxysubstituierter fettaromatischer Nitrile | |
| EP0470434B1 (de) | Trifluor- bzw. Chlordifluormethoxy-1,3,5,-triazine und Verfahren zu ihrer Herstellung | |
| DE3210296C2 (cg-RX-API-DMAC7.html) | ||
| DE875653C (de) | Verfahren zur Herstellung von Diaminodicyclohexylmethanen und ihren Homologen | |
| DE2602647C3 (de) | Cyclohexyläther mehrfach chlorsubstituierter Phenole und Verfahren zu ihrer Herstellung | |
| DE925774C (de) | Verfahren zur Herstellung von ª‰-Methylen-glutarsaeuredinitril |