DE1617393C2 - Verfahren zur Herstellung von biologisch aktive Stoffe enthaltenden hydrophilen vernetzten Copolymeren - Google Patents
Verfahren zur Herstellung von biologisch aktive Stoffe enthaltenden hydrophilen vernetzten CopolymerenInfo
- Publication number
- DE1617393C2 DE1617393C2 DE1617393A DE1617393A DE1617393C2 DE 1617393 C2 DE1617393 C2 DE 1617393C2 DE 1617393 A DE1617393 A DE 1617393A DE 1617393 A DE1617393 A DE 1617393A DE 1617393 C2 DE1617393 C2 DE 1617393C2
- Authority
- DE
- Germany
- Prior art keywords
- biologically active
- active substances
- active substance
- ethylene glycol
- carrier
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000013543 active substance Substances 0.000 title claims description 25
- 229920001577 copolymer Polymers 0.000 title claims description 11
- 238000000034 method Methods 0.000 title claims description 6
- 238000002360 preparation method Methods 0.000 title claims description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 26
- 239000000203 mixture Substances 0.000 claims description 21
- 229940088623 biologically active substance Drugs 0.000 claims description 16
- 238000007334 copolymerization reaction Methods 0.000 claims description 5
- 239000000178 monomer Substances 0.000 claims description 5
- TURITJIWSQEMDB-UHFFFAOYSA-N 2-methyl-n-[(2-methylprop-2-enoylamino)methyl]prop-2-enamide Chemical compound CC(=C)C(=O)NCNC(=O)C(C)=C TURITJIWSQEMDB-UHFFFAOYSA-N 0.000 claims description 4
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 claims description 4
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 claims description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 3
- 239000003431 cross linking reagent Substances 0.000 claims description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 claims description 3
- 239000011976 maleic acid Substances 0.000 claims description 3
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 claims description 3
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 claims description 3
- 229920000728 polyester Polymers 0.000 claims description 3
- 229920001223 polyethylene glycol Polymers 0.000 claims description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims description 3
- 239000000017 hydrogel Substances 0.000 description 11
- 229920000642 polymer Polymers 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- 239000000126 substance Substances 0.000 description 10
- 230000002378 acidificating effect Effects 0.000 description 9
- 239000000969 carrier Substances 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 8
- 239000007943 implant Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 229940079593 drug Drugs 0.000 description 6
- 239000003814 drug Substances 0.000 description 6
- 210000001519 tissue Anatomy 0.000 description 6
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical compound CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 description 5
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 5
- 238000009792 diffusion process Methods 0.000 description 5
- 235000019441 ethanol Nutrition 0.000 description 5
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 5
- 230000007935 neutral effect Effects 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 4
- 239000004372 Polyvinyl alcohol Substances 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 238000003795 desorption Methods 0.000 description 4
- 235000011187 glycerol Nutrition 0.000 description 4
- -1 glycol acrylates Chemical class 0.000 description 4
- 239000003999 initiator Substances 0.000 description 4
- 210000000056 organ Anatomy 0.000 description 4
- 238000006116 polymerization reaction Methods 0.000 description 4
- 229920002451 polyvinyl alcohol Polymers 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- 229920002818 (Hydroxyethyl)methacrylate Polymers 0.000 description 3
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 239000003242 anti bacterial agent Substances 0.000 description 3
- 229940088710 antibiotic agent Drugs 0.000 description 3
- 239000001768 carboxy methyl cellulose Substances 0.000 description 3
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 3
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 210000004907 gland Anatomy 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 230000001926 lymphatic effect Effects 0.000 description 3
- 210000004400 mucous membrane Anatomy 0.000 description 3
- 235000002639 sodium chloride Nutrition 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 230000008961 swelling Effects 0.000 description 3
- 229920003169 water-soluble polymer Polymers 0.000 description 3
- OLQFXOWPTQTLDP-UHFFFAOYSA-N 2-(2-hydroxyethoxy)ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCO OLQFXOWPTQTLDP-UHFFFAOYSA-N 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- GOLSFPMYASLXJC-UHFFFAOYSA-N 2-(dimethylamino)ethyl acetate Chemical compound CN(C)CCOC(C)=O GOLSFPMYASLXJC-UHFFFAOYSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 206010052428 Wound Diseases 0.000 description 2
- 208000027418 Wounds and injury Diseases 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 230000003385 bacteriostatic effect Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 241001233037 catfish Species 0.000 description 2
- 229960005091 chloramphenicol Drugs 0.000 description 2
- WIIZWVCIJKGZOK-RKDXNWHRSA-N chloramphenicol Chemical compound ClC(Cl)C(=O)N[C@H](CO)[C@H](O)C1=CC=C([N+]([O-])=O)C=C1 WIIZWVCIJKGZOK-RKDXNWHRSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Chemical compound CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 description 2
- 210000001035 gastrointestinal tract Anatomy 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 244000052769 pathogen Species 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- RWPGFSMJFRPDDP-UHFFFAOYSA-L potassium metabisulfite Chemical compound [K+].[K+].[O-]S(=O)S([O-])(=O)=O RWPGFSMJFRPDDP-UHFFFAOYSA-L 0.000 description 2
- 235000010263 potassium metabisulphite Nutrition 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 239000004160 Ammonium persulphate Substances 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- 229930182555 Penicillin Natural products 0.000 description 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 1
- 229920002845 Poly(methacrylic acid) Polymers 0.000 description 1
- PTFCDOFLOPIGGS-UHFFFAOYSA-N Zinc dication Chemical compound [Zn+2] PTFCDOFLOPIGGS-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 235000019395 ammonium persulphate Nutrition 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000002930 anti-sclerotic effect Effects 0.000 description 1
- 239000003146 anticoagulant agent Substances 0.000 description 1
- 229940127219 anticoagulant drug Drugs 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 230000017531 blood circulation Effects 0.000 description 1
- 210000001124 body fluid Anatomy 0.000 description 1
- 239000010839 body fluid Substances 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- XMEVHPAGJVLHIG-FMZCEJRJSA-N chembl454950 Chemical compound [Cl-].C1=CC=C2[C@](O)(C)[C@H]3C[C@H]4[C@H]([NH+](C)C)C(O)=C(C(N)=O)C(=O)[C@@]4(O)C(O)=C3C(=O)C2=C1O XMEVHPAGJVLHIG-FMZCEJRJSA-N 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- JZCCFEFSEZPSOG-UHFFFAOYSA-L copper(II) sulfate pentahydrate Chemical compound O.O.O.O.O.[Cu+2].[O-]S([O-])(=O)=O JZCCFEFSEZPSOG-UHFFFAOYSA-L 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- MLUCVPSAIODCQM-NSCUHMNNSA-N crotonaldehyde Chemical compound C\C=C\C=O MLUCVPSAIODCQM-NSCUHMNNSA-N 0.000 description 1
- MLUCVPSAIODCQM-UHFFFAOYSA-N crotonaldehyde Natural products CC=CC=O MLUCVPSAIODCQM-UHFFFAOYSA-N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000003118 drug derivative Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 210000001198 duodenum Anatomy 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000005357 flat glass Substances 0.000 description 1
- 235000011389 fruit/vegetable juice Nutrition 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 229920001480 hydrophilic copolymer Polymers 0.000 description 1
- 238000002513 implantation Methods 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 230000000622 irritating effect Effects 0.000 description 1
- LGYTZKPVOAIUKX-UHFFFAOYSA-N kebuzone Chemical compound O=C1C(CCC(=O)C)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 LGYTZKPVOAIUKX-UHFFFAOYSA-N 0.000 description 1
- 229960000194 kebuzone Drugs 0.000 description 1
- 150000002605 large molecules Chemical class 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- 210000004324 lymphatic system Anatomy 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229940126601 medicinal product Drugs 0.000 description 1
- 210000004379 membrane Anatomy 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 238000012009 microbiological test Methods 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 229940049954 penicillin Drugs 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 230000002980 postoperative effect Effects 0.000 description 1
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 230000000979 retarding effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000009738 saturating Methods 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 239000006190 sub-lingual tablet Substances 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 229960004989 tetracycline hydrochloride Drugs 0.000 description 1
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 1
- 230000001549 tubercolostatic effect Effects 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/20—Pills, tablets, discs, rods
- A61K9/2004—Excipients; Inactive ingredients
- A61K9/2022—Organic macromolecular compounds
- A61K9/2027—Organic macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds, e.g. polyvinyl pyrrolidone, poly(meth)acrylates
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F36/00—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds
- C08F36/02—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds the radical having only two carbon-to-carbon double bonds
- C08F36/20—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds the radical having only two carbon-to-carbon double bonds unconjugated
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Animal Behavior & Ethology (AREA)
- Polymers & Plastics (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Preparation (AREA)
- Materials For Medical Uses (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS8366 | 1966-01-06 | ||
| CS83866 | 1966-02-09 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1617393A1 DE1617393A1 (de) | 1971-03-18 |
| DE1617393C2 true DE1617393C2 (de) | 1982-11-11 |
Family
ID=25745236
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1617393A Expired DE1617393C2 (de) | 1966-01-06 | 1967-01-05 | Verfahren zur Herstellung von biologisch aktive Stoffe enthaltenden hydrophilen vernetzten Copolymeren |
Country Status (7)
| Country | Link |
|---|---|
| US (2) | US3551556A (enExample) |
| AU (1) | AU411053B2 (enExample) |
| DE (1) | DE1617393C2 (enExample) |
| ES (1) | ES335314A1 (enExample) |
| FR (1) | FR1586811A (enExample) |
| GB (1) | GB1135966A (enExample) |
| IT (1) | IT1050353B (enExample) |
Families Citing this family (119)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1586811A (enExample) * | 1966-01-06 | 1970-03-06 | ||
| US3885078A (en) * | 1968-03-06 | 1975-05-20 | Ceskoslovenska Akademie Ved | Hydrogel laminates and method of manufacturing thereof |
| US3860701A (en) * | 1968-04-22 | 1975-01-14 | Searle & Co | Method for use and compositions of 11-lower alkyl steroids and drug delivery system for the controlled elution of 11-lower alkyl steroids |
| CA988849A (en) * | 1969-06-16 | 1976-05-11 | Antonio Scommegna | Anti-fertility device |
| US3857932A (en) * | 1970-09-09 | 1974-12-31 | F Gould | Dry hydrophilic acrylate or methacrylate polymer prolonged release drug implants |
| US3710795A (en) * | 1970-09-29 | 1973-01-16 | Alza Corp | Drug-delivery device with stretched, rate-controlling membrane |
| CS157213B1 (enExample) * | 1971-01-08 | 1974-09-16 | ||
| US3731683A (en) * | 1971-06-04 | 1973-05-08 | Alza Corp | Bandage for the controlled metering of topical drugs to the skin |
| BE789524A (fr) * | 1971-09-30 | 1973-01-15 | Alza Corp | Dispositif de liberation de medicaments |
| CH582002A5 (enExample) * | 1972-06-09 | 1976-11-30 | Purdue Research Foundation | |
| US3811444A (en) * | 1972-12-27 | 1974-05-21 | Alza Corp | Bioerodible ocular device |
| US3954959A (en) * | 1973-03-28 | 1976-05-04 | A/S Alfred Benzon | Oral drug preparations |
| US3920806A (en) * | 1973-05-04 | 1975-11-18 | Merck & Co Inc | Growth promoting subcutaneous compositions |
| US3904745A (en) * | 1973-09-10 | 1975-09-09 | Union Corp | Sustained release of chlorpheniramine maleate |
| US3901966A (en) * | 1973-09-10 | 1975-08-26 | Union Corp | Sustained release of methantheline |
| US4178361A (en) * | 1973-09-10 | 1979-12-11 | Union Corporation | Sustained release pharmaceutical composition |
| US3901967A (en) * | 1973-09-10 | 1975-08-26 | Union Corp | Sustained release of atropine |
| US3901969A (en) * | 1973-09-10 | 1975-08-26 | Union Corp | Sustained release of methantheline |
| US3911100A (en) * | 1973-09-10 | 1975-10-07 | Union Corp | Sustained release of methantheline |
| US3901971A (en) * | 1973-09-10 | 1975-08-26 | Union Corp | Sustained release of hydrochlorothiazide |
| US4007258A (en) * | 1973-09-10 | 1977-02-08 | Union Corporation | Sustained release pesticidal composition |
| US3901968A (en) * | 1973-09-10 | 1975-08-26 | Union Corp | Sustained release of methantheline |
| US3901970A (en) * | 1973-09-10 | 1975-08-26 | Union Corp | Sustained release of dexamethasone |
| US3901232A (en) * | 1973-10-26 | 1975-08-26 | Alza Corp | Integrated device for administering beneficial drug at programmed rate |
| GB1572598A (en) * | 1975-12-29 | 1980-07-30 | Univ Strathclyde | Injectable medicinal compounds |
| US4185618A (en) * | 1976-01-05 | 1980-01-29 | Population Research, Inc. | Promotion of fibrous tissue growth in fallopian tubes for female sterilization |
| US4244728A (en) * | 1976-02-03 | 1981-01-13 | Westvaco Corporation | Cross-linked lignin gels |
| JPS52156913A (en) * | 1976-06-21 | 1977-12-27 | Toko Yakuhin Kogyo Kk | Production of injectionable medicine |
| DE2650306A1 (de) * | 1976-11-02 | 1978-05-03 | Merck Patent Gmbh | Antibakteriell wirkender wundverband und verfahren zu seiner herstellung |
| US4235988A (en) | 1976-12-13 | 1980-11-25 | Imperial Chemical Industries Limited | Delivery means for biologically active agents |
| GB1551620A (en) | 1976-12-13 | 1979-08-30 | Ici Ltd | Delivery means for biologically active agents |
| US4136250A (en) * | 1977-07-20 | 1979-01-23 | Ciba-Geigy Corporation | Polysiloxane hydrogels |
| US4277582A (en) * | 1978-03-03 | 1981-07-07 | Ciba-Geigy Corporation | Water-insoluble hydrophilic copolymers |
| US4210633A (en) * | 1978-10-20 | 1980-07-01 | Eli Lilly And Company | Flurandrenolide film formulation |
| US4430260A (en) | 1979-02-27 | 1984-02-07 | Lee Weng Y | Penicillin-polyvinyl alcohol conjugate and process of preparation |
| US4296097A (en) * | 1979-02-27 | 1981-10-20 | Lee Weng Y | Suppression of reaginic antibodies to drugs employing polyvinyl alcohol as carrier therefor |
| DE3071006D1 (en) * | 1979-03-21 | 1985-09-26 | Nat Res Dev | Composition for the controlled release of an active substance and process for its preparation |
| US4298002A (en) * | 1979-09-10 | 1981-11-03 | National Patent Development Corporation | Porous hydrophilic materials, chambers therefrom, and devices comprising such chambers and biologically active tissue and methods of preparation |
| SE447446B (sv) * | 1979-12-05 | 1986-11-17 | Medline Ab | Anordning for tillforande av medicinskt aktiva substanser for att fremja en abort |
| US4443428A (en) * | 1982-06-21 | 1984-04-17 | Euroceltique, S.A. | Extended action controlled release compositions |
| GB8305797D0 (en) * | 1983-03-02 | 1983-04-07 | Graham N B | Hydrogel-containing envelopes |
| CA1196863A (en) * | 1983-06-08 | 1985-11-19 | Mattheus F.A. Goosen | Slow release injectable insulin composition |
| GB8331546D0 (en) * | 1983-11-25 | 1984-01-04 | Exxon Research Engineering Co | Polymeric compositions |
| US4749576A (en) * | 1984-05-10 | 1988-06-07 | Ciba-Geigy Corporation | Active agent containing hydrogel devices wherein the active agent concentration profile contains a sigmoidal concentration gradient for improved constant release, their manufacture and use |
| US4624848A (en) * | 1984-05-10 | 1986-11-25 | Ciba-Geigy Corporation | Active agent containing hydrogel devices wherein the active agent concentration profile contains a sigmoidal concentration gradient for improved constant release, their manufacture and use |
| US4673527A (en) * | 1985-05-20 | 1987-06-16 | Autotrol Corporation | Tablet granulation |
| US4668506A (en) * | 1985-08-16 | 1987-05-26 | Bausch & Lomb Incorporated | Sustained-release formulation containing and amino acid polymer |
| US4713244A (en) * | 1985-08-16 | 1987-12-15 | Bausch & Lomb Incorporated | Sustained-release formulation containing an amino acid polymer with a lower alkyl (C1 -C4) polar solvent |
| CA1295941C (en) | 1985-08-16 | 1992-02-18 | Rajan Bawa | Sustained-release formulation comprising a hydrophobic polymer system |
| GB2181053B (en) * | 1985-10-01 | 1990-05-23 | Sandoz Ltd | Pharmaceutical formulations with controlled release of the active substance |
| JPS62123112A (ja) * | 1985-11-22 | 1987-06-04 | Sunstar Inc | 軟膏基剤 |
| US5200196A (en) * | 1986-05-09 | 1993-04-06 | Alza Corporation | Improvement in pulsed drug therapy |
| US4948592A (en) * | 1986-05-09 | 1990-08-14 | Alza Corporation | Pulsed drug delivery |
| US4986987A (en) * | 1986-05-09 | 1991-01-22 | Alza Corporation | Pulsed drug delivery |
| WO1987006828A1 (en) * | 1986-05-16 | 1987-11-19 | The State Of Victoria | Biocompatible implants |
| US4959217A (en) * | 1986-05-22 | 1990-09-25 | Syntex (U.S.A.) Inc. | Delayed/sustained release of macromolecules |
| US4855127A (en) * | 1986-07-07 | 1989-08-08 | Dow Corning Corporation | Lattice-entrapped composition |
| US4837030A (en) * | 1987-10-06 | 1989-06-06 | American Cyanamid Company | Novel controlled release formulations of tetracycline compounds |
| US5277915A (en) * | 1987-10-30 | 1994-01-11 | Fmc Corporation | Gel-in-matrix containing a fractured hydrogel |
| US4931282A (en) * | 1987-11-25 | 1990-06-05 | Minnesota Mining And Manufacturing Company | Pressure-sensitive medical sealant |
| US5047244A (en) * | 1988-06-03 | 1991-09-10 | Watson Laboratories, Inc. | Mucoadhesive carrier for delivery of therapeutical agent |
| US5342624A (en) * | 1989-02-16 | 1994-08-30 | British Technology Group Ltd. | Dispensing device |
| EP0431719B1 (en) | 1989-10-31 | 1994-11-09 | Columbia Laboratories, Inc. | Vaginal tissue moisturizing composition |
| US6764697B1 (en) * | 1991-06-27 | 2004-07-20 | Alza Corporation | System for delaying drug delivery up to seven hours |
| US5352448A (en) * | 1992-07-20 | 1994-10-04 | Purdue Research Foundatioin | Oral administration of antigens |
| US5750585A (en) * | 1995-04-04 | 1998-05-12 | Purdue Research Foundation | Super absorbent hydrogel foams |
| US5980951A (en) * | 1996-04-10 | 1999-11-09 | Merck & Co., Inc. | Oral coated active drugs |
| DE19631085A1 (de) * | 1996-08-01 | 1998-02-05 | Basf Ag | Verwendung von (Meth)acrylsäure-Maleinsäure-Copolymeren zur Verbesserung der Permeabilität der Schleimhaut |
| EP0975328A1 (en) * | 1997-04-02 | 2000-02-02 | Purdue Research Foundation | Method for oral delivery of proteins |
| US6271278B1 (en) | 1997-05-13 | 2001-08-07 | Purdue Research Foundation | Hydrogel composites and superporous hydrogel composites having fast swelling, high mechanical strength, and superabsorbent properties |
| WO2000029206A1 (en) * | 1998-11-13 | 2000-05-25 | Sensor Technologies Inc. | Monodisperse preparations useful with implanted devices |
| AU6494300A (en) * | 1999-08-17 | 2001-03-13 | Porex Technologies Corporation | Self-sealing materials and devices comprising same |
| US6360129B1 (en) | 1999-12-13 | 2002-03-19 | Cardiac Pacemakers, Inc. | Mannitol/hydrogel cap for tissue-insertable connections |
| EP1280521B1 (en) | 2000-05-12 | 2005-07-20 | Pharmacia & Upjohn Company LLC | Vaccine composition, method of preparing the same, and method of vaccinating vertebrates |
| US7371403B2 (en) * | 2002-06-14 | 2008-05-13 | Providence Health System-Oregon | Wound dressing and method for controlling severe, life-threatening bleeding |
| US7897832B2 (en) * | 2001-06-14 | 2011-03-01 | Hemcon Medical Technologies, Inc. | Compositions, assemblies, and methods applied during or after a dental procedure to ameliorate fluid loss and/or promote healing, using a hydrophilic polymer sponge structure such as chitosan |
| EP1401352B1 (en) * | 2001-06-14 | 2012-03-21 | Kenton W. Gregory | Method for producing a chitosan wound dressing |
| US8741335B2 (en) | 2002-06-14 | 2014-06-03 | Hemcon Medical Technologies, Inc. | Hemostatic compositions, assemblies, systems, and methods employing particulate hemostatic agents formed from hydrophilic polymer foam such as Chitosan |
| US20050147656A1 (en) * | 2001-06-14 | 2005-07-07 | Hemcon, Inc. | Tissue dressing assemblies, systems, and methods formed from hydrophilic polymer sponge structures such as chitosan |
| US8765167B2 (en) | 2001-10-12 | 2014-07-01 | Monosol Rx, Llc | Uniform films for rapid-dissolve dosage form incorporating anti-tacking compositions |
| US11207805B2 (en) | 2001-10-12 | 2021-12-28 | Aquestive Therapeutics, Inc. | Process for manufacturing a resulting pharmaceutical film |
| US7425292B2 (en) | 2001-10-12 | 2008-09-16 | Monosol Rx, Llc | Thin film with non-self-aggregating uniform heterogeneity and drug delivery systems made therefrom |
| US7666337B2 (en) | 2002-04-11 | 2010-02-23 | Monosol Rx, Llc | Polyethylene oxide-based films and drug delivery systems made therefrom |
| US8603514B2 (en) | 2002-04-11 | 2013-12-10 | Monosol Rx, Llc | Uniform films for rapid dissolve dosage form incorporating taste-masking compositions |
| US10285910B2 (en) | 2001-10-12 | 2019-05-14 | Aquestive Therapeutics, Inc. | Sublingual and buccal film compositions |
| US7357891B2 (en) | 2001-10-12 | 2008-04-15 | Monosol Rx, Llc | Process for making an ingestible film |
| US8900498B2 (en) | 2001-10-12 | 2014-12-02 | Monosol Rx, Llc | Process for manufacturing a resulting multi-layer pharmaceutical film |
| US7910641B2 (en) | 2001-10-12 | 2011-03-22 | Monosol Rx, Llc | PH modulated films for delivery of actives |
| US20110033542A1 (en) | 2009-08-07 | 2011-02-10 | Monosol Rx, Llc | Sublingual and buccal film compositions |
| US20190328679A1 (en) | 2001-10-12 | 2019-10-31 | Aquestive Therapeutics, Inc. | Uniform films for rapid-dissolve dosage form incorporating anti-tacking compositions |
| US8663687B2 (en) | 2001-10-12 | 2014-03-04 | Monosol Rx, Llc | Film compositions for delivery of actives |
| US20070281003A1 (en) | 2001-10-12 | 2007-12-06 | Fuisz Richard C | Polymer-Based Films and Drug Delivery Systems Made Therefrom |
| US8900497B2 (en) | 2001-10-12 | 2014-12-02 | Monosol Rx, Llc | Process for making a film having a substantially uniform distribution of components |
| US8017150B2 (en) | 2002-04-11 | 2011-09-13 | Monosol Rx, Llc | Polyethylene oxide-based films and drug delivery systems made therefrom |
| DK2561860T3 (en) * | 2002-05-31 | 2018-04-30 | Titan Pharmaceuticals Inc | Implantable polymer device for prolonged release of buprenorphine |
| US20050137512A1 (en) * | 2003-12-23 | 2005-06-23 | Campbell Todd D. | Wound dressing and method for controlling severe, life-threatening bleeding |
| US8269058B2 (en) | 2002-06-14 | 2012-09-18 | Hemcon Medical Technologies, Inc. | Absorbable tissue dressing assemblies, systems, and methods formed from hydrophilic polymer sponge structures such as chitosan |
| DE602004031512D1 (de) * | 2003-03-31 | 2011-04-07 | Titan Pharmaceuticals Inc | Polymeres implantat zur verzögerten freisetzung von dopamin antagonisten |
| US9204957B2 (en) | 2005-03-17 | 2015-12-08 | Hemcon Medical Technologies, Inc. | Systems and methods for hemorrhage control and or tissue repair |
| US20070172515A1 (en) * | 2006-01-20 | 2007-07-26 | Monosolrx, Llc | Film bandage for mucosal administration of actives |
| JP2009538192A (ja) * | 2006-05-23 | 2009-11-05 | プロビデンス ヘルス システム−オレゴン ディー/ビー/エー プロビデンス セント ビンセント メディカル センター | 体の内腔または体の中空器官内に包帯構造を導入および適用するシステムおよび方法 |
| US8141717B2 (en) * | 2006-08-18 | 2012-03-27 | Porex Corporation | Sintered polymeric materials and applications thereof |
| AU2007297697A1 (en) | 2006-09-20 | 2008-03-27 | Monosol Rx Llc | Edible water-soluble film containing a foam reducing flavoring agent |
| WO2009086119A2 (en) * | 2007-12-20 | 2009-07-09 | 7L, Llc | Swallowable self-expanding gastric space occupying device |
| KR101548766B1 (ko) * | 2008-05-02 | 2015-08-31 | 프로비던스 헬스 앤드 서비시즈, 오레곤 | 상처 드레싱 기구 및 방법 |
| WO2010042540A1 (en) | 2008-10-06 | 2010-04-15 | Providence Health System - Oregon | Foam medical devices and methods |
| US8475832B2 (en) | 2009-08-07 | 2013-07-02 | Rb Pharmaceuticals Limited | Sublingual and buccal film compositions |
| ES2569339T3 (es) | 2010-06-10 | 2016-05-10 | Midatech Ltd. | Sistemas de administración de película de nanopartículas |
| AU2011268951B2 (en) * | 2010-06-22 | 2014-08-07 | Universite De Rouen | Improved crosslinked hyaluronan hydrogels for 3D cell culture |
| US9962275B2 (en) | 2010-10-07 | 2018-05-08 | Randy Louis Werneth | Temporary gastric device (TGD) and method of use |
| US9149959B2 (en) | 2010-10-22 | 2015-10-06 | Monosol Rx, Llc | Manufacturing of small film strips |
| EP2721103A1 (en) | 2011-06-15 | 2014-04-23 | Porex Corporation | Sintered porous plastic liquid barrier media and applications thereof |
| US10596330B2 (en) | 2015-08-26 | 2020-03-24 | Medtronic Xomed, Inc. | Resorbable, drug-eluting submucosal turbinate implant device and method |
| US11273131B2 (en) | 2016-05-05 | 2022-03-15 | Aquestive Therapeutics, Inc. | Pharmaceutical compositions with enhanced permeation |
| KR20230137362A (ko) | 2016-05-05 | 2023-10-04 | 어퀘스티브 테라퓨틱스, 아이엔씨. | 강화된 전달 에프네프린 조성물 |
| US12427121B2 (en) | 2016-05-05 | 2025-09-30 | Aquestive Therapeutics, Inc. | Enhanced delivery epinephrine compositions |
| US12433850B2 (en) | 2016-05-05 | 2025-10-07 | Aquestive Therapeutics, Inc. | Enhanced delivery epinephrine and prodrug compositions |
| US12433597B2 (en) | 2019-06-04 | 2025-10-07 | Trisalus Life Sciences, Inc. | Atraumatic occlusive system with compartment for measurement of vascular pressure change |
| EP4422607A4 (en) | 2021-10-25 | 2025-09-03 | Aquestive Therapeutics Inc | ORAL AND NASAL COMPOSITIONS AND METHODS OF TREATMENT |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3220960A (en) * | 1960-12-21 | 1965-11-30 | Wichterle Otto | Cross-linked hydrophilic polymers and articles made therefrom |
| FR1586811A (enExample) * | 1966-01-06 | 1970-03-06 |
-
1967
- 1967-01-05 FR FR1586811D patent/FR1586811A/fr not_active Expired
- 1967-01-05 IT IT11212/67A patent/IT1050353B/it active
- 1967-01-05 ES ES0335314A patent/ES335314A1/es not_active Expired
- 1967-01-05 DE DE1617393A patent/DE1617393C2/de not_active Expired
- 1967-01-06 US US607637A patent/US3551556A/en not_active Expired - Lifetime
- 1967-01-06 AU AU16202/67A patent/AU411053B2/en not_active Expired
- 1967-01-06 GB GB832/67A patent/GB1135966A/en not_active Expired
-
1970
- 1970-09-23 US US74905A patent/US3689634A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| AU411053B2 (en) | 1971-03-01 |
| DE1617393A1 (de) | 1971-03-18 |
| AU1620267A (en) | 1968-07-11 |
| FR1586811A (enExample) | 1970-03-06 |
| US3551556A (en) | 1970-12-29 |
| ES335314A1 (es) | 1967-12-01 |
| IT1050353B (it) | 1981-03-10 |
| GB1135966A (en) | 1968-12-11 |
| US3689634A (en) | 1972-09-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1617393C2 (de) | Verfahren zur Herstellung von biologisch aktive Stoffe enthaltenden hydrophilen vernetzten Copolymeren | |
| DE60028415T2 (de) | Methode und zusammensetzungen für verbesserte abgabevorrichtungen | |
| DE69831074T2 (de) | Superporöse hydrogelverbundstoffe mit schneller quellung,hoher mechanischer festigkeit und superabsorbierenden eigenschaften | |
| DE19503336C2 (de) | Arzneiform zur Abgabe von Wirkstoffen an Wunden, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE68902954T2 (de) | Waessrige ueberzugsemulsion fuer pharmazeutische dosierungsformen. | |
| DE69217685T2 (de) | Äusserliches auf der Haut anzuwendendes Lidocain enthaltendes Arzneimittel | |
| DE69502029T2 (de) | Gel geformed durch die Interaktion von Polyvinylpyrrolidon mit Chitosan-Derivativen | |
| EP0140828B1 (de) | Vernetzte poröse Polymere für eine kontrollierte Wirkstoffabgabe | |
| DE2725261C2 (de) | Transparentes Flüssigkeitsverbandmaterial, seine Herstellung und Verwendung | |
| DE10026678C1 (de) | Transdermales Pflaster für einen entzündungshemmenden Wirkstoff oder für entzündungshemmende Wirkstoffe | |
| DE69020875T2 (de) | Oestrogenhaltiges Gelpräparat. | |
| DE4414755C2 (de) | Kollagenzubereitung zur gesteuerten Abgabe von Wirkstoffen, Verfahren und Verwendung | |
| DE2933250A1 (de) | Abdeckmaterial | |
| DE102017130893A1 (de) | pH regulierende Wundauflage | |
| DE10145910A1 (de) | Ophtalmologische Formulierung mit verlangsamter Freisetzung und langer Verweildauer sowie Herstellungsverfahren hierfür | |
| DE19925519A1 (de) | Wundauflage zur gesteuerten Abgabe von Wirkstoff an Wunden und Verfahren zu ihrer Herstellung | |
| DD145062A5 (de) | Transparentes fluessigkeitsverbandsmaterial | |
| DE69029969T2 (de) | Kunsthaut | |
| DE3586569T2 (de) | Verband und verfahren zu seiner herstellung. | |
| DE69010317T2 (de) | Acrylgel und seine Herstellung. | |
| DE3901551C2 (enExample) | ||
| DE1911095C3 (de) | Hydrogel-Laminate und Verfahren zu ihrer Herstellung | |
| DE60205906T2 (de) | Poröses schwammartiges Cellulosematerial zur Behandlung von Verletzungen | |
| DE2557607A1 (de) | Jod enthaltende produkte und pharmazeutische zubereitungen, die diese enthalten | |
| DE60214154T2 (de) | Pharmazeutisches freigabekonstrukt zur magenretention |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| D2 | Grant after examination |