DE1593405B - - Google Patents
Info
- Publication number
- DE1593405B DE1593405B DE1593405B DE 1593405 B DE1593405 B DE 1593405B DE 1593405 B DE1593405 B DE 1593405B
- Authority
- DE
- Germany
- Prior art keywords
- ethyl ester
- acid
- ethyl
- methoxy
- formic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 125000004494 ethyl ester group Chemical group 0.000 claims description 13
- VEXZGXHMUGYJMC-UHFFFAOYSA-N HCl Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 6
- 239000003054 catalyst Substances 0.000 claims description 5
- 239000000126 substance Substances 0.000 claims description 5
- XYIBRDXRRQCHLP-UHFFFAOYSA-N Ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 claims description 4
- 238000010992 reflux Methods 0.000 claims description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N formic acid Substances OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- 125000004492 methyl ester group Chemical group 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 239000000047 product Substances 0.000 claims description 2
- XEAQIWGXBXCYFX-GUOLPTJISA-N Kawain Chemical group C1C(OC)=CC(=O)O[C@H]1\C=C\C1=CC=CC=C1 XEAQIWGXBXCYFX-GUOLPTJISA-N 0.000 claims 2
- 230000001476 alcoholic Effects 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 claims 1
- ZFDIRQKJPRINOQ-HWKANZROSA-N ethyl (E)-but-2-enoate Chemical compound CCOC(=O)\C=C\C ZFDIRQKJPRINOQ-HWKANZROSA-N 0.000 claims 1
- 238000010438 heat treatment Methods 0.000 claims 1
- 238000000746 purification Methods 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 4
- WDJHALXBUFZDSR-UHFFFAOYSA-N Acetoacetic acid Natural products CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 3
- -1 acetoacetic acid ester Chemical class 0.000 description 3
- RBTARNINKXHZNM-UHFFFAOYSA-K Iron(III) chloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- NMCUIPGRVMDVDB-UHFFFAOYSA-L Iron(II) chloride Chemical compound Cl[Fe]Cl NMCUIPGRVMDVDB-UHFFFAOYSA-L 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2600541C3 (de) | Verfahren zur Herstellung von Phenylbrenztraubensäure oder Arylbrenztraubensäuren | |
| EP0008096B1 (de) | Verfahren zur Herstellung von 2-(Perfluoralkyl)-äthanolen | |
| DE3443596A1 (de) | Verfahren zur herstellung von phthalsaeureestern, zur herstellung von phthalsaeureestern verwendbarer katalysator und verfahren zu seiner herstellung | |
| DE2505902C2 (de) | Verfahren zur Herstellung von 2,5- Dimethyl-3-(2H)-furanon | |
| DE69013490T2 (de) | Verfahren zur Herstellung von Estern von alpha-beta ungesättigten Karbonsäuren. | |
| DE2725255A1 (de) | Verfahren zur herstellung von dimethylaminoaethylmethacrylat | |
| DE2524930A1 (de) | Verfahren zur umesterung von estern der acryl- oder methacrylsaeure | |
| DE1593405C (nl) | ||
| DE1593405B (nl) | ||
| DE2533335C2 (de) | 3-Methyl-3-aryl-brenztraubensäureester und Verfahren zur Herstellung substituierter Brenztraubensäureester | |
| DE2508779C2 (de) | Verfahren zur Herstellung von β-Isophoron | |
| DE3933247C1 (nl) | ||
| DE10002835C1 (de) | Verfahren zur Herstellung von 4-Methylpyrimidin | |
| DE1173454B (de) | Verfahren zur Herstellung von N-Vinyl-carbaminsaeureestern | |
| DE3710631A1 (de) | Trifluormethylbenzoylbromid und dessen umwandlung zu brombenzotrifluorid | |
| EP0627412B1 (de) | Verfahren zur Herstellung von 2-Cyanoacetoxy-propionsäureestern | |
| DE3783431T2 (de) | Herstellungsverfahren von 2,6-diacetoxynaphthalen. | |
| DE3016119C2 (nl) | ||
| DE1620406A1 (de) | Basisch substituierte Adamantyl-2,3-di-hydro-1,5-benzthiazepinone und Verfahren zu ihrer Herstellung | |
| EP0735032B1 (de) | Verfahren zur Herstellung von 5-Hydroxy-4-methyl-2(5H)-furanon | |
| DE2727612C2 (de) | Verfahren zur Herstellung von 2-(2,2-Dihalogenvinyl)-3,3-dimethylcyclopropancarbonitrilen | |
| DE3011175C2 (de) | Verfahren zur Gewinnung von Dimethylterephthalat und Zwischenprodukten der DMT-Herstellung | |
| DE2439742C3 (de) | Verfahren zur Herstellung von Cyclopentenonderivaten | |
| EP1409462A1 (de) | Verfahren zur herstellung von 4-methylpyrimidin | |
| CH678725A5 (nl) |