DE1569021B2 - Flammschutzmittel für synthetische organische Polymere - Google Patents
Flammschutzmittel für synthetische organische PolymereInfo
- Publication number
- DE1569021B2 DE1569021B2 DE1964H0054739 DEH0054739A DE1569021B2 DE 1569021 B2 DE1569021 B2 DE 1569021B2 DE 1964H0054739 DE1964H0054739 DE 1964H0054739 DE H0054739 A DEH0054739 A DE H0054739A DE 1569021 B2 DE1569021 B2 DE 1569021B2
- Authority
- DE
- Germany
- Prior art keywords
- antimony
- compounds
- carbon atoms
- weight
- chlorine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000003063 flame retardant Substances 0.000 title claims description 10
- 229920005613 synthetic organic polymer Polymers 0.000 title claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 26
- 239000000460 chlorine Chemical group 0.000 claims description 19
- 229910052787 antimony Inorganic materials 0.000 claims description 8
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 6
- 239000011737 fluorine Substances 0.000 claims description 6
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 claims description 5
- 125000004122 cyclic group Chemical group 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical group ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 4
- 229910052785 arsenic Inorganic materials 0.000 claims description 4
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 150000001622 bismuth compounds Chemical class 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims description 2
- 125000001153 fluoro group Chemical group F* 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 238000002844 melting Methods 0.000 claims description 2
- 230000008018 melting Effects 0.000 claims description 2
- 229920000642 polymer Polymers 0.000 description 15
- -1 antimony salts organic acids Chemical class 0.000 description 14
- 239000000654 additive Substances 0.000 description 9
- ZSWFCLXCOIISFI-UHFFFAOYSA-N cyclopentadiene Chemical class C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 9
- 230000009970 fire resistant effect Effects 0.000 description 9
- 239000003973 paint Substances 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- 238000005698 Diels-Alder reaction Methods 0.000 description 7
- 239000004743 Polypropylene Substances 0.000 description 6
- 229910000410 antimony oxide Inorganic materials 0.000 description 6
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 6
- 229920001155 polypropylene Polymers 0.000 description 6
- VYXHVRARDIDEHS-QGTKBVGQSA-N (1z,5z)-cycloocta-1,5-diene Chemical compound C\1C\C=C/CC\C=C/1 VYXHVRARDIDEHS-QGTKBVGQSA-N 0.000 description 5
- VUNCWTMEJYMOOR-UHFFFAOYSA-N hexachlorocyclopentadiene Chemical compound ClC1=C(Cl)C(Cl)(Cl)C(Cl)=C1Cl VUNCWTMEJYMOOR-UHFFFAOYSA-N 0.000 description 5
- 238000000465 moulding Methods 0.000 description 5
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 4
- 235000021388 linseed oil Nutrition 0.000 description 4
- 239000000944 linseed oil Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 229920000620 organic polymer Polymers 0.000 description 4
- 239000004912 1,5-cyclooctadiene Substances 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 229920002292 Nylon 6 Polymers 0.000 description 3
- 150000001463 antimony compounds Chemical class 0.000 description 3
- 239000013068 control sample Substances 0.000 description 3
- 239000013256 coordination polymer Substances 0.000 description 3
- 239000000523 sample Substances 0.000 description 3
- VYXHVRARDIDEHS-UHFFFAOYSA-N 1,5-cyclooctadiene Chemical compound C1CC=CCCC=C1 VYXHVRARDIDEHS-UHFFFAOYSA-N 0.000 description 2
- HECLRDQVFMWTQS-RGOKHQFPSA-N 1755-01-7 Chemical compound C1[C@H]2[C@@H]3CC=C[C@@H]3[C@@H]1C=C2 HECLRDQVFMWTQS-RGOKHQFPSA-N 0.000 description 2
- SDJHPPZKZZWAKF-UHFFFAOYSA-N 2,3-dimethylbuta-1,3-diene Chemical compound CC(=C)C(C)=C SDJHPPZKZZWAKF-UHFFFAOYSA-N 0.000 description 2
- 239000004342 Benzoyl peroxide Substances 0.000 description 2
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 150000001447 alkali salts Chemical class 0.000 description 2
- AQTIRDJOWSATJB-UHFFFAOYSA-K antimonic acid Chemical compound O[Sb](O)(O)=O AQTIRDJOWSATJB-UHFFFAOYSA-K 0.000 description 2
- 150000001462 antimony Chemical class 0.000 description 2
- 229940058905 antimony compound for treatment of leishmaniasis and trypanosomiasis Drugs 0.000 description 2
- 235000019400 benzoyl peroxide Nutrition 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N methylene hexane Natural products CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 229920001225 polyester resin Polymers 0.000 description 2
- 239000004645 polyester resin Substances 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 150000005846 sugar alcohols Polymers 0.000 description 2
- MZJCFRKLOXHQIL-CCAGOZQPSA-N (1Z,3Z)-cyclodeca-1,3-diene Chemical compound C1CCC\C=C/C=C\CC1 MZJCFRKLOXHQIL-CCAGOZQPSA-N 0.000 description 1
- RZUNIXAGSKNOIB-HSFFGMMNSA-N (1z,3e)-cyclododeca-1,3-diene Chemical compound C1CCCC\C=C/C=C/CCC1 RZUNIXAGSKNOIB-HSFFGMMNSA-N 0.000 description 1
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical compound C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 description 1
- NUYUCYZVFLZIPX-UHFFFAOYSA-N 1,2,3,4,5,5-hexabromocyclopenta-1,3-diene Chemical compound BrC1=C(Br)C(Br)(Br)C(Br)=C1Br NUYUCYZVFLZIPX-UHFFFAOYSA-N 0.000 description 1
- ZULBFSSEZXLFIV-UHFFFAOYSA-N 1,2,3,4,5-pentachloro-6-(chloromethyl)benzene Chemical compound ClCC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl ZULBFSSEZXLFIV-UHFFFAOYSA-N 0.000 description 1
- AVSIMRGRHWKCAY-UHFFFAOYSA-N 1,2,3,4,5-pentachloro-6-methylbenzene Chemical compound CC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl AVSIMRGRHWKCAY-UHFFFAOYSA-N 0.000 description 1
- NEECIJLRKOZOFM-UHFFFAOYSA-N 1,2,3,4-tetrachloro-5,5-difluorocyclopenta-1,3-diene Chemical compound FC1(F)C(Cl)=C(Cl)C(Cl)=C1Cl NEECIJLRKOZOFM-UHFFFAOYSA-N 0.000 description 1
- UHSMEJQTFMHABA-UHFFFAOYSA-N 1,2,3,4-tetrachloro-5,5-dimethoxycyclopenta-1,3-diene Chemical compound COC1(OC)C(Cl)=C(Cl)C(Cl)=C1Cl UHSMEJQTFMHABA-UHFFFAOYSA-N 0.000 description 1
- SDRZFSPCVYEJTP-UHFFFAOYSA-N 1-ethenylcyclohexene Chemical compound C=CC1=CCCCC1 SDRZFSPCVYEJTP-UHFFFAOYSA-N 0.000 description 1
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 1
- KWKAKUADMBZCLK-UHFFFAOYSA-N 1-octene Chemical compound CCCCCCC=C KWKAKUADMBZCLK-UHFFFAOYSA-N 0.000 description 1
- BBDKZWKEPDTENS-UHFFFAOYSA-N 4-Vinylcyclohexene Chemical compound C=CC1CCC=CC1 BBDKZWKEPDTENS-UHFFFAOYSA-N 0.000 description 1
- WSSSPWUEQFSQQG-UHFFFAOYSA-N 4-methyl-1-pentene Chemical compound CC(C)CC=C WSSSPWUEQFSQQG-UHFFFAOYSA-N 0.000 description 1
- JIUFYGIESXPUPL-UHFFFAOYSA-N 5-methylhex-1-ene Chemical compound CC(C)CCC=C JIUFYGIESXPUPL-UHFFFAOYSA-N 0.000 description 1
- 239000004641 Diallyl-phthalate Substances 0.000 description 1
- 208000008454 Hyperhidrosis Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 241000219000 Populus Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229910000004 White lead Inorganic materials 0.000 description 1
- NFZLXJUWPXLBGJ-UHFFFAOYSA-K [Sb+3].CCCCC([O-])=O.CCCCC([O-])=O.CCCCC([O-])=O Chemical compound [Sb+3].CCCCC([O-])=O.CCCCC([O-])=O.CCCCC([O-])=O NFZLXJUWPXLBGJ-UHFFFAOYSA-K 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 150000007824 aliphatic compounds Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229940071248 anisate Drugs 0.000 description 1
- KHVXAAMNAFHCGC-UHFFFAOYSA-K antimony(3+) decanoate Chemical compound [O-]C(=O)CCCCCCCCC.[Sb+3].[O-]C(=O)CCCCCCCCC.[O-]C(=O)CCCCCCCCC KHVXAAMNAFHCGC-UHFFFAOYSA-K 0.000 description 1
- AZIUFAHATDOMOO-UHFFFAOYSA-K antimony(3+) nonanoate Chemical compound [Sb+3].CCCCCCCCC([O-])=O.CCCCCCCCC([O-])=O.CCCCCCCCC([O-])=O AZIUFAHATDOMOO-UHFFFAOYSA-K 0.000 description 1
- FQPDKRHZCYINJH-UHFFFAOYSA-N antimony(3+);2-ethylhexan-1-olate Chemical compound [Sb+3].CCCCC(CC)C[O-].CCCCC(CC)C[O-].CCCCC(CC)C[O-] FQPDKRHZCYINJH-UHFFFAOYSA-N 0.000 description 1
- XQRVLQLHRAJWLU-UHFFFAOYSA-K antimony(3+);butanoate Chemical compound [Sb+3].CCCC([O-])=O.CCCC([O-])=O.CCCC([O-])=O XQRVLQLHRAJWLU-UHFFFAOYSA-K 0.000 description 1
- BWPYPGGBQGIIMR-UHFFFAOYSA-K antimony(3+);octanoate Chemical compound [Sb+3].CCCCCCCC([O-])=O.CCCCCCCC([O-])=O.CCCCCCCC([O-])=O BWPYPGGBQGIIMR-UHFFFAOYSA-K 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 229920005601 base polymer Polymers 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- QUDWYFHPNIMBFC-UHFFFAOYSA-N bis(prop-2-enyl) benzene-1,2-dicarboxylate Chemical compound C=CCOC(=O)C1=CC=CC=C1C(=O)OCC=C QUDWYFHPNIMBFC-UHFFFAOYSA-N 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 229940114081 cinnamate Drugs 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 238000007706 flame test Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000012760 heat stabilizer Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- AHAREKHAZNPPMI-UHFFFAOYSA-N hexa-1,3-diene Chemical compound CCC=CC=C AHAREKHAZNPPMI-UHFFFAOYSA-N 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 239000011872 intimate mixture Substances 0.000 description 1
- RYZCLUQMCYZBJQ-UHFFFAOYSA-H lead(2+);dicarbonate;dihydroxide Chemical compound [OH-].[OH-].[Pb+2].[Pb+2].[Pb+2].[O-]C([O-])=O.[O-]C([O-])=O RYZCLUQMCYZBJQ-UHFFFAOYSA-H 0.000 description 1
- GIWKOZXJDKMGQC-UHFFFAOYSA-L lead(2+);naphthalene-2-carboxylate Chemical compound [Pb+2].C1=CC=CC2=CC(C(=O)[O-])=CC=C21.C1=CC=CC2=CC(C(=O)[O-])=CC=C21 GIWKOZXJDKMGQC-UHFFFAOYSA-L 0.000 description 1
- UMKARVFXJJITLN-UHFFFAOYSA-N lead;phosphorous acid Chemical compound [Pb].OP(O)O UMKARVFXJJITLN-UHFFFAOYSA-N 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- SGGOJYZMTYGPCH-UHFFFAOYSA-L manganese(2+);naphthalene-2-carboxylate Chemical compound [Mn+2].C1=CC=CC2=CC(C(=O)[O-])=CC=C21.C1=CC=CC2=CC(C(=O)[O-])=CC=C21 SGGOJYZMTYGPCH-UHFFFAOYSA-L 0.000 description 1
- DDIZAANNODHTRB-UHFFFAOYSA-N methyl p-anisate Chemical compound COC(=O)C1=CC=C(OC)C=C1 DDIZAANNODHTRB-UHFFFAOYSA-N 0.000 description 1
- NFWSQSCIDYBUOU-UHFFFAOYSA-N methylcyclopentadiene Chemical compound CC1=CC=CC1 NFWSQSCIDYBUOU-UHFFFAOYSA-N 0.000 description 1
- 239000012768 molten material Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- AICOOMRHRUFYCM-ZRRPKQBOSA-N oxazine, 1 Chemical compound C([C@@H]1[C@H](C(C[C@]2(C)[C@@H]([C@H](C)N(C)C)[C@H](O)C[C@]21C)=O)CC1=CC2)C[C@H]1[C@@]1(C)[C@H]2N=C(C(C)C)OC1 AICOOMRHRUFYCM-ZRRPKQBOSA-N 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- YWAKXRMUMFPDSH-UHFFFAOYSA-N pentene Chemical compound CCCC=C YWAKXRMUMFPDSH-UHFFFAOYSA-N 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920001228 polyisocyanate Polymers 0.000 description 1
- 239000005056 polyisocyanate Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- YPMOSINXXHVZIL-UHFFFAOYSA-N sulfanylideneantimony Chemical class [Sb]=S YPMOSINXXHVZIL-UHFFFAOYSA-N 0.000 description 1
- 210000004243 sweat Anatomy 0.000 description 1
- 208000013460 sweaty Diseases 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M trans-cinnamate Chemical compound [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 230000004580 weight loss Effects 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09D—COATING COMPOSITIONS, e.g. PAINTS, VARNISHES OR LACQUERS; FILLING PASTES; CHEMICAL PAINT OR INK REMOVERS; INKS; CORRECTING FLUIDS; WOODSTAINS; PASTES OR SOLIDS FOR COLOURING OR PRINTING; USE OF MATERIALS THEREFOR
- C09D5/00—Coating compositions, e.g. paints, varnishes or lacquers, characterised by their physical nature or the effects produced; Filling pastes
- C09D5/18—Fireproof paints including high temperature resistant paints
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/02—Halogenated hydrocarbons
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Materials Engineering (AREA)
- Wood Science & Technology (AREA)
- Engineering & Computer Science (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Fireproofing Substances (AREA)
- Paints Or Removers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US39022064A | 1964-08-17 | 1964-08-17 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1569021A1 DE1569021A1 (de) | 1969-08-21 |
| DE1569021B2 true DE1569021B2 (de) | 1970-11-05 |
Family
ID=23541603
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1964H0054739 Pending DE1569021B2 (de) | 1964-08-17 | 1964-12-31 | Flammschutzmittel für synthetische organische Polymere |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3403036A (cg-RX-API-DMAC10.html) |
| BE (1) | BE690777A (cg-RX-API-DMAC10.html) |
| BR (1) | BR6566177D0 (cg-RX-API-DMAC10.html) |
| CH (1) | CH468435A (cg-RX-API-DMAC10.html) |
| DE (1) | DE1569021B2 (cg-RX-API-DMAC10.html) |
| FR (1) | FR1439030A (cg-RX-API-DMAC10.html) |
| GB (1) | GB1090598A (cg-RX-API-DMAC10.html) |
| NL (1) | NL126840C (cg-RX-API-DMAC10.html) |
| SE (1) | SE315129B (cg-RX-API-DMAC10.html) |
Families Citing this family (50)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3891600A (en) * | 1966-04-12 | 1975-06-24 | Hooker Chemicals Plastics Corp | Halogen containing fire retardant additive with improved heat stability |
| US3919356A (en) * | 1968-12-09 | 1975-11-11 | Borg Warner | Halogenated norbornene-methanonaphthalene derivatives and their applications |
| US3962164A (en) * | 1970-09-23 | 1976-06-08 | Chemische Fabrik Kalk Gmbh | Self-extinguishing acrylonitrile-butadiene-styrene moulding composition |
| ZA718662B (en) * | 1971-02-12 | 1972-09-27 | Cities Service Co | Fire retardant compositions |
| US3819575A (en) * | 1971-04-30 | 1974-06-25 | Cities Service Co | Flame retardant compositions |
| DE2141036C3 (de) * | 1971-08-17 | 1983-12-01 | Bayer Ag, 5090 Leverkusen | Selbstverlöschende Polyamidformmassen |
| US3891599A (en) * | 1971-11-15 | 1975-06-24 | Hooker Chemicals Plastics Corp | Fire retardant polymer compositions |
| US3872054A (en) * | 1971-11-26 | 1975-03-18 | Gen Electric | Flame retardant room temperature vulcanizing organopolysiloxane composition |
| US3965214A (en) * | 1971-12-17 | 1976-06-22 | Michigan Chemical Corporation | Flame retardant ABS polymer compositions |
| US3912792A (en) * | 1972-08-04 | 1975-10-14 | M & T Chemicals Inc | Flame retardant compositions |
| US3899463A (en) * | 1972-08-18 | 1975-08-12 | Cities Service Co | Flame-retardant composition |
| US3950456A (en) * | 1972-08-18 | 1976-04-13 | Cities Service Company | Flame-retardant composition |
| DE2247652A1 (de) * | 1972-09-28 | 1974-04-04 | Basf Ag | Schwer entflammbare und selbstverloeschende formmassen |
| US3915932A (en) * | 1972-12-11 | 1975-10-28 | Cities Service Co | Flame-retardant composition |
| US4032508A (en) * | 1973-02-08 | 1977-06-28 | Velsicol Chemical Corporation | Plastic compositions |
| US4016138A (en) * | 1973-02-08 | 1977-04-05 | Michigan Chemical Corporation | Plastic compositions |
| JPS5236139B2 (cg-RX-API-DMAC10.html) * | 1973-02-26 | 1977-09-13 | ||
| US3864302A (en) * | 1973-03-16 | 1975-02-04 | Du Pont | Flame resistant polyamides |
| US4005156A (en) * | 1973-09-13 | 1977-01-25 | Universal Oil Products Company | Novel flame retardant compositions of matter |
| US3940366A (en) * | 1973-12-28 | 1976-02-24 | General Electric Company | Flame retardant polycarbonate composition |
| US3933734A (en) * | 1973-12-28 | 1976-01-20 | General Electric Company | Flame retardant polycarbonate composition |
| US3941758A (en) * | 1974-03-04 | 1976-03-02 | Hooker Chemicals & Plastics Corporation | Halogen containing fire retardant additive with improved heat stability |
| US3970716A (en) * | 1974-06-05 | 1976-07-20 | Uniroyal, Inc. | Flame resistant thermoplastic blend |
| US3976722A (en) * | 1974-07-22 | 1976-08-24 | Hooker Chemicals & Plastics Corporation | Polymer compositions containing adduct of hexahalocyclopentadiene and bicyclononadiene |
| JPS536016B2 (cg-RX-API-DMAC10.html) * | 1974-10-17 | 1978-03-03 | ||
| DE2604250A1 (de) * | 1975-02-07 | 1976-08-26 | Showa Denko Kk | Flammbestaendige harzmasse |
| US4000114A (en) * | 1975-02-24 | 1976-12-28 | Hooker Chemicals & Plastics Corporation | Fire retardant polymer compositions with improved physical properties |
| US4169469A (en) * | 1975-07-29 | 1979-10-02 | Yardney Company | Orthopedic device |
| FR2322173A1 (fr) * | 1975-08-27 | 1977-03-25 | Rhone Poulenc Ind | Compositions ignifugees de polyamide |
| US4098848A (en) * | 1976-03-15 | 1978-07-04 | Uniroyal, Inc. | Flame retardant thermoplastic elastomer |
| GB1585085A (en) | 1976-06-21 | 1981-02-25 | Ici Ltd | Polyamide compositions |
| JPS5316063A (en) * | 1976-07-29 | 1978-02-14 | Idemitsu Kosan Co Ltd | Flame-retardant resin compositions |
| US4067930A (en) * | 1976-11-26 | 1978-01-10 | Cities Service Company | Flame-retardant composition |
| US4299758A (en) * | 1977-12-22 | 1981-11-10 | National Distillers And Chemical Corp. | Halogenated cyclopentadiene diadducts of diacetylenic compounds |
| US4194072A (en) * | 1978-10-02 | 1980-03-18 | Hooker Chemicals & Plastics Corp. | Flame retardant nylon compositions |
| CH640548A5 (de) * | 1979-08-28 | 1984-01-13 | Ciba Geigy Ag | Flammwidrige kunststofformmasse. |
| US4388429A (en) * | 1981-04-24 | 1983-06-14 | Occidental Chemical Corporation | Flame retardant polymer compositions |
| US4447572A (en) * | 1981-11-06 | 1984-05-08 | Occidental Chemical Corporation | Fire retardant polyamide |
| DE3215911A1 (de) * | 1982-04-29 | 1983-11-03 | Basf Ag, 6700 Ludwigshafen | Verfahren zur behandlung von (co)polymerisaten zur entfernung von restmonomeren |
| BR8500215A (pt) * | 1984-01-30 | 1985-09-03 | Occidental Chem Co | Composicao de poliolefina retardantes de chama |
| US4810742A (en) * | 1988-02-01 | 1989-03-07 | Occidental Chemical Corporation | UV stable, impact resistant, flame retarded ABS composition containing aliphatic resin |
| US4810743A (en) * | 1988-02-01 | 1989-03-07 | Occidental Chemical Corporation | UV stable, impact resistant, flame retarded ABS composition |
| NL8800799A (nl) * | 1988-03-30 | 1989-10-16 | Gen Electric | Polymeermengsel met aromatisch polycarbonaat, polyester en vlamvertragend middel. |
| US4885318A (en) * | 1989-03-31 | 1989-12-05 | Shell Oil Company | Polyketone flame retardant composition |
| US5187005A (en) * | 1991-04-24 | 1993-02-16 | Amoco Corporation | Self-bonded nonwoven web and woven fabric composites |
| US5356986A (en) * | 1992-08-28 | 1994-10-18 | E. I. Du Pont De Nemours And Company | Plasticized fluoropolymers |
| CA2709587C (en) * | 2009-07-16 | 2016-10-04 | General Cable Technologies Corporation | Thermoplastic polyurethane material with enhanced fluid immersion and water absorption capabilities |
| US20120103498A1 (en) | 2010-10-27 | 2012-05-03 | E.I. Du Pont De Nemours And Company | Tire containing a heat and flame resistant fibrous barrier layer and method for protecting a tire |
| US9370970B2 (en) | 2013-11-20 | 2016-06-21 | E I Du Pont De Nemours And Company | Tire containing noise reducing fibrous layers |
| DE102020111288B4 (de) * | 2020-04-24 | 2022-12-08 | Pfinder Kg | Verwendung einer Zusammensetzung zur Herstellung eines geruchs- und emissionsreduzierten Korrosionsschutzmittels zur Hohlraumversiegelung oder zum Unterbodenschutz eines Bauteils |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2606910A (en) * | 1946-01-05 | 1952-08-12 | Velsicol Corp | Diels-alder adducts of hexahalo-cyclopentadiene |
| US2635977A (en) * | 1948-08-21 | 1953-04-21 | Shell Dev | Polycyclic insecticidal dienes |
| US2576666A (en) * | 1949-12-07 | 1951-11-27 | Julius Hyman & Company | Process for producing heptachlor |
| US2967842A (en) * | 1958-02-27 | 1961-01-10 | Dow Chemical Co | Composition comprising alkenyl aromatic resin and hexachlorocyclopentadiene-divinylbenzene adduct and process for preparing |
| US2951099A (en) * | 1959-01-12 | 1960-08-30 | Hooker Chemical Corp | 1, 4, 5, 6, 7, 7-hexachloro-2, 3-bis(bromomethyl)-bicyclo(2.2.1)-heptadiene-2, 5 |
| NL273742A (cg-RX-API-DMAC10.html) * | 1961-01-30 |
-
1964
- 1964-12-18 GB GB51585/64A patent/GB1090598A/en not_active Expired
- 1964-12-30 SE SE15866/64A patent/SE315129B/xx unknown
- 1964-12-31 CH CH1688464A patent/CH468435A/de unknown
- 1964-12-31 NL NL6415331A patent/NL126840C/xx active
- 1964-12-31 DE DE1964H0054739 patent/DE1569021B2/de active Pending
- 1964-12-31 FR FR549A patent/FR1439030A/fr not_active Expired
-
1965
- 1965-01-13 BR BR166177/65A patent/BR6566177D0/pt unknown
-
1966
- 1966-12-06 BE BE690777D patent/BE690777A/xx unknown
-
1967
- 1967-03-24 US US625594A patent/US3403036A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| CH468435A (de) | 1969-02-15 |
| DE1569021A1 (de) | 1969-08-21 |
| SE315129B (cg-RX-API-DMAC10.html) | 1969-09-22 |
| GB1090598A (en) | 1967-11-08 |
| FR1439030A (fr) | 1966-05-20 |
| BR6566177D0 (pt) | 1973-04-17 |
| BE690777A (cg-RX-API-DMAC10.html) | 1967-05-16 |
| NL6415331A (cg-RX-API-DMAC10.html) | 1966-02-18 |
| NL126840C (cg-RX-API-DMAC10.html) | 1969-07-15 |
| US3403036A (en) | 1968-09-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1569021B2 (de) | Flammschutzmittel für synthetische organische Polymere | |
| DE1569032C3 (de) | Flammschutzmittel für synthetische organische Polymere | |
| US3717609A (en) | Flame retardant polymers | |
| DE2646218B2 (de) | Phosphorhaltige Verbindungen, Verfahren zu deren Herstellung und Verwendung derselben zur Flammfestmachung | |
| DE2459062A1 (de) | Glasfaserverstaerkte, flammwidrige, thermoplastische polyesterformmassen | |
| US3158588A (en) | Fire retardant polymer compositions containing a dimer of hexachlorocyclopentadiene | |
| DE2921325A1 (de) | Flammabweisende aromatische polycarbonatmassen | |
| DD207917A5 (de) | Verfahren zum stabilisieren von polymerisaten auf der basis von vinylchlorid | |
| DE1794072C3 (de) | Schwerbrennbare Formmassen auf der Basis von Polymerisaten des Propylene | |
| DE1569033A1 (de) | Feuerhemmende Polymermassen mit verbesserten thermischen Eigenschaften | |
| DE2162271A1 (de) | Halogen enthaltende Benzolpolycarbonsäureester | |
| DE2820846B2 (de) | Flammfest- und Tropffreimachen von thermoplastischen Polyurethanen | |
| DE1193669B (de) | Selbstverloeschende Formmassen aus Olefin- oder Styrolpolymerisaten | |
| US3547877A (en) | Synergistic flame-retardant compositions | |
| DE1569021C (de) | Flammschutzmittel fur synthetische organische Polymere | |
| US3547878A (en) | Synergistic flame-retardant compositions containing diels-alder adducts and phosphorous compounds | |
| DE1519181C3 (de) | Feuerabweisende bituminöse Anstrichmasse | |
| US3513119A (en) | Flame-retardant compositions for plastics comprising ethylene phosphite and a chlorinated hydrocarbon | |
| DE69214192T2 (de) | Elastomerische thermoplastische Polyesterether mit verbesserter thermischer Stabilität und Hydrolysebeständigkeit | |
| CH477495A (de) | Wärmehärtbare flammwidrige Kunststoff-Formmassen | |
| DE2802047A1 (de) | Flammverzoegernde halogenhaltige polymerzusammensetzung | |
| DE2244543A1 (de) | Tri-(2,3-dibrompropyl)-isocyanurat, verfahren zu dessen herstellung sowie dessen verwendung als flammhemmender zusatz fuer polymere | |
| US3547876A (en) | Synergistic flame-retardant compositions | |
| DE1669811B2 (de) | Thermoplastische massen zur herstellung schwerentflammbarer formteile aus polyolefinen | |
| DE69229689T2 (de) | Flammhemmende Zusammensetzung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| SH | Request for examination between 03.10.1968 and 22.04.1971 | ||
| E77 | Valid patent as to the heymanns-index 1977 |