DE1543884A1 - Verfahren zur Herstellung von Hydroxyaethern durch Reaktion von Epoxyverbindungen mit Phenolen in Gegenwart eines Katalysators - Google Patents
Verfahren zur Herstellung von Hydroxyaethern durch Reaktion von Epoxyverbindungen mit Phenolen in Gegenwart eines KatalysatorsInfo
- Publication number
- DE1543884A1 DE1543884A1 DE19661543884 DE1543884A DE1543884A1 DE 1543884 A1 DE1543884 A1 DE 1543884A1 DE 19661543884 DE19661543884 DE 19661543884 DE 1543884 A DE1543884 A DE 1543884A DE 1543884 A1 DE1543884 A1 DE 1543884A1
- Authority
- DE
- Germany
- Prior art keywords
- catalyst
- phenol
- reaction
- phenols
- bis
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000003054 catalyst Substances 0.000 title claims description 22
- 238000000034 method Methods 0.000 title claims description 16
- 150000002989 phenols Chemical class 0.000 title claims description 16
- 150000001875 compounds Chemical class 0.000 title claims description 15
- 238000002360 preparation method Methods 0.000 title claims description 4
- 239000004593 Epoxy Substances 0.000 title description 19
- JSPLKZUTYZBBKA-UHFFFAOYSA-N trioxidane Chemical class OOO JSPLKZUTYZBBKA-UHFFFAOYSA-N 0.000 title description 4
- 238000006243 chemical reaction Methods 0.000 claims description 25
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 22
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 claims description 20
- -1 monooxy compound Chemical class 0.000 claims description 13
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 claims description 11
- 229930195733 hydrocarbon Natural products 0.000 claims description 11
- 239000004215 Carbon black (E152) Substances 0.000 claims description 10
- 125000003700 epoxy group Chemical group 0.000 claims description 10
- 229920000570 polyether Polymers 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 9
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 8
- 229920000647 polyepoxide Polymers 0.000 claims description 8
- 239000001294 propane Substances 0.000 claims description 5
- FQYUMYWMJTYZTK-UHFFFAOYSA-N Phenyl glycidyl ether Chemical compound C1OC1COC1=CC=CC=C1 FQYUMYWMJTYZTK-UHFFFAOYSA-N 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 3
- 229910052787 antimony Inorganic materials 0.000 claims description 3
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 3
- 229910052785 arsenic Inorganic materials 0.000 claims description 3
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 claims description 3
- 125000003055 glycidyl group Chemical group C(C1CO1)* 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 229910052698 phosphorus Inorganic materials 0.000 claims description 3
- 239000011574 phosphorus Substances 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052797 bismuth Inorganic materials 0.000 claims description 2
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 2
- 125000004464 hydroxyphenyl group Chemical group 0.000 claims description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims 2
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 claims 1
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 1
- 239000000047 product Substances 0.000 description 25
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 21
- 229920005989 resin Polymers 0.000 description 15
- 239000011347 resin Substances 0.000 description 15
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 11
- 239000000203 mixture Substances 0.000 description 11
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 10
- 238000004519 manufacturing process Methods 0.000 description 9
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical class C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 230000001476 alcoholic effect Effects 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 5
- 239000000376 reactant Substances 0.000 description 5
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 238000000576 coating method Methods 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 150000003003 phosphines Chemical class 0.000 description 4
- 238000007086 side reaction Methods 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- MIHINWMALJZIBX-UHFFFAOYSA-N cyclohexa-2,4-dien-1-ol Chemical compound OC1CC=CC=C1 MIHINWMALJZIBX-UHFFFAOYSA-N 0.000 description 3
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical compound NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000004848 polyfunctional curative Substances 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 150000003512 tertiary amines Chemical class 0.000 description 3
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 241000607479 Yersinia pestis Species 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- ZSWFCLXCOIISFI-UHFFFAOYSA-N cyclopentadiene Chemical compound C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 2
- 125000001033 ether group Chemical group 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- JYINMLPNDRBKKZ-UHFFFAOYSA-N hydroperoxybenzene Chemical class OOC1=CC=CC=C1 JYINMLPNDRBKKZ-UHFFFAOYSA-N 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- GRAKJTASWCEOQI-UHFFFAOYSA-N tridodecylphosphane Chemical compound CCCCCCCCCCCCP(CCCCCCCCCCCC)CCCCCCCCCCCC GRAKJTASWCEOQI-UHFFFAOYSA-N 0.000 description 2
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 1
- STMDPCBYJCIZOD-UHFFFAOYSA-N 2-(2,4-dinitroanilino)-4-methylpentanoic acid Chemical compound CC(C)CC(C(O)=O)NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O STMDPCBYJCIZOD-UHFFFAOYSA-N 0.000 description 1
- ZXJBWUAALADCRI-UHFFFAOYSA-N 2-(octadecoxymethyl)oxirane Chemical compound CCCCCCCCCCCCCCCCCCOCC1CO1 ZXJBWUAALADCRI-UHFFFAOYSA-N 0.000 description 1
- WHNBDXQTMPYBAT-UHFFFAOYSA-N 2-butyloxirane Chemical compound CCCCC1CO1 WHNBDXQTMPYBAT-UHFFFAOYSA-N 0.000 description 1
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 1
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical compound C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 229930185605 Bisphenol Chemical group 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- OUQGOXCIUOCDNN-UHFFFAOYSA-N Glycidyl stearate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC1CO1 OUQGOXCIUOCDNN-UHFFFAOYSA-N 0.000 description 1
- HEFNNWSXXWATRW-UHFFFAOYSA-N Ibuprofen Chemical compound CC(C)CC1=CC=C(C(C)C(O)=O)C=C1 HEFNNWSXXWATRW-UHFFFAOYSA-N 0.000 description 1
- 206010035148 Plague Diseases 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 229910000074 antimony hydride Inorganic materials 0.000 description 1
- RBFQJDQYXXHULB-UHFFFAOYSA-N arsane Chemical compound [AsH3] RBFQJDQYXXHULB-UHFFFAOYSA-N 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- JRPRCOLKIYRSNH-UHFFFAOYSA-N bis(oxiran-2-ylmethyl) benzene-1,2-dicarboxylate Chemical compound C=1C=CC=C(C(=O)OCC2OC2)C=1C(=O)OCC1CO1 JRPRCOLKIYRSNH-UHFFFAOYSA-N 0.000 description 1
- ZXOATMQSUNJNNG-UHFFFAOYSA-N bis(oxiran-2-ylmethyl) benzene-1,3-dicarboxylate Chemical compound C=1C=CC(C(=O)OCC2OC2)=CC=1C(=O)OCC1CO1 ZXOATMQSUNJNNG-UHFFFAOYSA-N 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Inorganic materials [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- ZOMBKNNSYQHRCA-UHFFFAOYSA-J calcium sulfate hemihydrate Chemical compound O.[Ca+2].[Ca+2].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O ZOMBKNNSYQHRCA-UHFFFAOYSA-J 0.000 description 1
- 150000001723 carbon free-radicals Chemical class 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 239000004567 concrete Substances 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- DESCFCKGNXZCHU-UHFFFAOYSA-N cyclohexylarsane Chemical compound [AsH2]C1CCCCC1 DESCFCKGNXZCHU-UHFFFAOYSA-N 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 150000002118 epoxides Chemical class 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- LDLDYFCCDKENPD-UHFFFAOYSA-N ethenylcyclohexane Chemical compound C=CC1CCCCC1 LDLDYFCCDKENPD-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000011507 gypsum plaster Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 235000012907 honey Nutrition 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 235000021388 linseed oil Nutrition 0.000 description 1
- 239000000944 linseed oil Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229920003986 novolac Polymers 0.000 description 1
- JKXONPYJVWEAEL-UHFFFAOYSA-N oxiran-2-ylmethyl acetate Chemical compound CC(=O)OCC1CO1 JKXONPYJVWEAEL-UHFFFAOYSA-N 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 150000004291 polyenes Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- OUULRIDHGPHMNQ-UHFFFAOYSA-N stibane Chemical compound [SbH3] OUULRIDHGPHMNQ-UHFFFAOYSA-N 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000011269 tar Substances 0.000 description 1
- 239000012970 tertiary amine catalyst Substances 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 1
- BXJWDOYMROEHEN-UHFFFAOYSA-N tributylstibane Chemical compound CCCC[Sb](CCCC)CCCC BXJWDOYMROEHEN-UHFFFAOYSA-N 0.000 description 1
- YHLFKRHUIBDYJG-UHFFFAOYSA-N trihexadecylphosphane Chemical compound CCCCCCCCCCCCCCCCP(CCCCCCCCCCCCCCCC)CCCCCCCCCCCCCCCC YHLFKRHUIBDYJG-UHFFFAOYSA-N 0.000 description 1
- BPLUKJNHPBNVQL-UHFFFAOYSA-N triphenylarsine Chemical compound C1=CC=CC=C1[As](C=1C=CC=CC=1)C1=CC=CC=C1 BPLUKJNHPBNVQL-UHFFFAOYSA-N 0.000 description 1
- ZHXAZZQXWJJBHA-UHFFFAOYSA-N triphenylbismuthane Chemical compound C1=CC=CC=C1[Bi](C=1C=CC=CC=1)C1=CC=CC=C1 ZHXAZZQXWJJBHA-UHFFFAOYSA-N 0.000 description 1
- HVYVMSPIJIWUNA-UHFFFAOYSA-N triphenylstibine Chemical compound C1=CC=CC=C1[Sb](C=1C=CC=CC=1)C1=CC=CC=C1 HVYVMSPIJIWUNA-UHFFFAOYSA-N 0.000 description 1
- 235000021122 unsaturated fatty acids Nutrition 0.000 description 1
- 150000004670 unsaturated fatty acids Chemical class 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 239000011345 viscous material Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/18—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing
- C08G59/40—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing characterised by the curing agents used
- C08G59/62—Alcohols or phenols
- C08G59/621—Phenols
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D303/00—Compounds containing three-membered rings having one oxygen atom as the only ring hetero atom
- C07D303/02—Compounds containing oxirane rings
- C07D303/12—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms
- C07D303/18—Compounds containing oxirane rings with hydrocarbon radicals, substituted by singly or doubly bound oxygen atoms by etherified hydroxyl radicals
- C07D303/20—Ethers with hydroxy compounds containing no oxirane rings
- C07D303/24—Ethers with hydroxy compounds containing no oxirane rings with polyhydroxy compounds
- C07D303/26—Ethers with hydroxy compounds containing no oxirane rings with polyhydroxy compounds having one or more free hydroxyl radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Epoxy Resins (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US50627965A | 1965-11-03 | 1965-11-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1543884A1 true DE1543884A1 (de) | 1969-11-27 |
Family
ID=24013934
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19661543884 Pending DE1543884A1 (de) | 1965-11-03 | 1966-11-02 | Verfahren zur Herstellung von Hydroxyaethern durch Reaktion von Epoxyverbindungen mit Phenolen in Gegenwart eines Katalysators |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3547881A (show.php) |
| BE (1) | BE689140A (show.php) |
| CH (1) | CH476657A (show.php) |
| DE (1) | DE1543884A1 (show.php) |
| GB (1) | GB1116740A (show.php) |
| NL (2) | NL6615381A (show.php) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2108428A1 (show.php) * | 1970-02-24 | 1971-09-02 |
Families Citing this family (88)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3931336A (en) * | 1972-08-22 | 1976-01-06 | Badische Anilin- & Soda-Fabrik Aktiengesellschaft | Production of oxyalkylated α-hydroxy acetylenic compounds |
| US3888808A (en) * | 1972-09-29 | 1975-06-10 | Mobil Oil Corp | Tall oil epoxy ester exterior coating for lap-seam beverage cans |
| US3949895A (en) * | 1973-11-30 | 1976-04-13 | Mobil Oil Corporation | Epoxy exterior coating for lap-seam beverage cans |
| US3888942A (en) * | 1973-12-13 | 1975-06-10 | Gen Electric | Resinous compositions and laminates made therefrom |
| US3978027A (en) * | 1975-05-07 | 1976-08-31 | Shell Oil Company | Process for reacting a phenol with an epoxy compound |
| US4122067A (en) * | 1977-10-07 | 1978-10-24 | Celanese Polymer Specialties Company | Process of reacting a polyepoxide compound with a phenol in aqueous medium |
| CH633977A5 (de) * | 1978-09-15 | 1983-01-14 | Mettler Instrumente Ag | Wechselbuerette. |
| US4220805A (en) * | 1978-09-18 | 1980-09-02 | General Electric Company | Linear dimers of bisphenols and method for making |
| SE457726B (sv) * | 1980-12-18 | 1989-01-23 | Sumitomo Chemical Co | Zinkpulverlack innehaallande en polyhydroxieter |
| US4330644A (en) * | 1981-04-03 | 1982-05-18 | Shell Oil Company | Curable tris(hydroxyalkyl) aminomethane-modified epoxy resin composition |
| EP0080500A4 (en) * | 1981-06-05 | 1983-09-30 | Gen Electric | HEAT-CURABLE EPOXY COMPONENT. |
| US4358578A (en) * | 1981-08-24 | 1982-11-09 | Shell Oil Company | Process for reacting a phenol with an epoxy compound |
| US4758638A (en) * | 1982-06-10 | 1988-07-19 | The Dow Chemical Company | Advanced epoxy resins |
| WO1983004414A1 (en) * | 1982-06-10 | 1983-12-22 | The Dow Chemical Company | Advanced epoxy resins and coating compositions containing the advanced epoxy resins |
| US4608313A (en) * | 1982-06-10 | 1986-08-26 | The Dow Chemical Company | Advanced epoxy resins crosslinked with polyisocyanates |
| US4465722A (en) * | 1982-07-08 | 1984-08-14 | Ciba-Geigy Corporation | Process for the preparation of epoxide resins by the advancement method |
| US4438254A (en) | 1983-02-28 | 1984-03-20 | The Dow Chemical Company | Process for producing epoxy resins |
| US4474935A (en) * | 1983-05-20 | 1984-10-02 | Shell Oil Company | Stable precatalyzed saturated epoxy resin compositions |
| GB8315230D0 (en) * | 1983-06-03 | 1983-07-06 | Shell Int Research | Polyglycidyl ethers |
| DE3475524D1 (en) * | 1983-06-03 | 1989-01-12 | Shell Int Research | Novel polyglycidyl ethers, their preparation and their use as thermosetting coating compositions |
| GB8329881D0 (en) * | 1983-11-09 | 1983-12-14 | Shell Int Research | Preparation of binders for coatings |
| US4477645A (en) * | 1983-07-21 | 1984-10-16 | The Dow Chemical Company | Immobilized epoxy advancement initiators |
| US4507461A (en) * | 1983-10-14 | 1985-03-26 | Wilmington Chemical Corporation | Low viscosity epoxy resins |
| US5599856A (en) * | 1984-03-01 | 1997-02-04 | Amoco Corporation | Epoxy resin systems containing modifiers |
| US5599628A (en) * | 1984-03-01 | 1997-02-04 | Amoco Corporation | Accelerated cycloaliphatic epoxide/aromatic amine resin systems |
| US5596050A (en) * | 1984-03-01 | 1997-01-21 | Amoco Corporation | High modulus epoxy resin systems |
| US4594291A (en) * | 1984-07-17 | 1986-06-10 | The Dow Chemical Company | Curable, partially advanced epoxy resins |
| US4946817A (en) * | 1984-07-17 | 1990-08-07 | The Dow Chemical Company | Latent catalysts for epoxy-containing compounds |
| US5503937A (en) * | 1984-07-17 | 1996-04-02 | The Dow Chemical Company | Curable composition which comprises adducts of heterocyclic compounds |
| US4568735A (en) * | 1984-11-05 | 1986-02-04 | Shell Oil Company | Process for preparing polyepoxides (II) |
| US4783509A (en) * | 1985-03-25 | 1988-11-08 | The Dow Chemical Company | Non-thermoset thermally stable capped epoxy resin compositions |
| US4721743A (en) * | 1985-03-25 | 1988-01-26 | The Dow Chemical Company | Non-thermoset thermally stable capped epoxy resin compositions |
| US4634757A (en) * | 1985-07-15 | 1987-01-06 | Shell Oil Company | Fusion product |
| US4684701A (en) * | 1986-02-14 | 1987-08-04 | The Dow Chemical Company | Method for preparing advanced epoxy or phenoxy resins with low aliphatic halide content |
| US4684700A (en) * | 1986-02-14 | 1987-08-04 | The Dow Chemical Company | Advanced epoxy resins prepared from triglycidyl ethers and dihydri phenols |
| US4672103A (en) * | 1986-02-14 | 1987-06-09 | The Dow Chemical Company | Non-sintering epoxy resins prepared from triglycidyl ethers and epihalohydrins |
| US4737553A (en) * | 1986-09-29 | 1988-04-12 | Ciba-Geigy Corporation | Advanced resins from diglycidyl ethers of di-secondary alcohols and dihydric phenols |
| EP0366157B1 (de) * | 1986-12-19 | 1997-07-09 | Ciba SC Holding AG | Epoxidharze enthaltend Polyester auf Polyalkylenglykolbasis und bei höheren Temperaturen wirksame Härter |
| US4732958A (en) * | 1986-12-30 | 1988-03-22 | Shell Oil Company | Epoxy fusion process |
| US5073605A (en) * | 1988-07-14 | 1991-12-17 | General Electric Company | Bromine-bisphenol reacted bisphenol and novolak epoxy resins with polyphenylene ether |
| US4996279A (en) * | 1988-10-07 | 1991-02-26 | Shell Oil Company | Dissymmetric polymer materials |
| US5143998A (en) * | 1989-04-26 | 1992-09-01 | The Dow Chemical Company | Hydroxy-functional poly(amide ethers) as thermoplastic barrier resins |
| US5360884A (en) * | 1990-08-03 | 1994-11-01 | The Dow Chemical Company | Mesogenic glycidyl amine blends |
| US5362822A (en) * | 1990-08-03 | 1994-11-08 | The Dow Chemical Company | Mesogenic adducts |
| US5262509A (en) * | 1990-08-03 | 1993-11-16 | The Dow Chemical Company | Mesogenic glycidyl amines |
| US5089588A (en) * | 1990-10-17 | 1992-02-18 | The Dow Chemical Company | Hydroxy-functional poly(amide ethers) as thermoplastic barrier resins |
| US5565505A (en) * | 1993-06-30 | 1996-10-15 | Henkel Corporation | Self-dispersing curable epoxy resins, dispersions made therewith, and coating compositions made therefrom |
| US5583167A (en) * | 1993-06-30 | 1996-12-10 | Henkel Corporation | Curing agents for aqueous epoxy resins |
| EP0739367A4 (en) | 1993-12-27 | 1997-12-10 | Henkel Corp | SELF-DISPERSING CURABLE EPOXY RESINS AND COATING COMPOSITIONS |
| US5604269A (en) * | 1993-12-27 | 1997-02-18 | Henkel Corporation | Self-dispersing curable epoxy resins, dispersions made therewith, and coating compositions made therefrom |
| US5565506A (en) * | 1994-03-01 | 1996-10-15 | Henkel Corporation | Self-dispersing curable epoxy resins, dispersions made therewith, and coating compositions made therefrom |
| AU3862995A (en) * | 1994-07-25 | 1996-02-22 | Henkel Corporation | Curing agents for aqueous epoxy resins |
| US5508373A (en) * | 1994-08-04 | 1996-04-16 | Henkel Corporation | Curing agents for epoxy resins based on 1,2-diaminocyclohexane |
| US5643976A (en) * | 1994-12-29 | 1997-07-01 | Henkel Corporation | Self-dispersing curable epoxy resin dispersions and coating compositions made therefrom |
| US5750595A (en) * | 1994-12-29 | 1998-05-12 | Henkel Corporation | Self-dispersing curable epoxy resin dispersions and coating compositions made therefrom |
| WO1996020970A1 (en) * | 1994-12-29 | 1996-07-11 | Henkel Corporation | Aqueous self-dispersible epoxy resin based on epoxy-amine adducts |
| US5648409A (en) * | 1994-12-29 | 1997-07-15 | Henkel Corporation | Aqueous self-dispersible epoxy resin based on epoxy-amine adducts containing aromatic polyepoxide |
| AR006683A1 (es) * | 1996-04-19 | 1999-09-08 | Shell Int Research | Un procedimiento para la preparacion de una resina avanzada, y una composicion curada obtenida mediante el uso de dicha resina |
| US5719210A (en) * | 1996-11-26 | 1998-02-17 | Henkel Corporation | Self-dispersing curable epoxy resins, dispersions made therewith, and coating compositions made therefrom |
| US6492483B1 (en) | 1999-12-21 | 2002-12-10 | Resolution Performance Products Llc | Integrated continuous process for upstaging epoxy resins |
| US6534621B2 (en) * | 2000-05-18 | 2003-03-18 | Dow Global Technologies Inc. | Process for manufacturing a hydroxyester derivative intermediate and epoxy resins prepared therefrom |
| PL1615966T5 (pl) | 2003-04-02 | 2020-06-29 | Swimc Llc | Dyspersje wodne i powłoki |
| US6855738B2 (en) | 2003-06-06 | 2005-02-15 | Dow Global Technologies Inc. | Nanoporous laminates |
| EP3733798B1 (en) | 2004-10-20 | 2022-01-26 | Swimc Llc | Coating compositions for cans and methods of coating |
| CA2622550C (en) * | 2005-10-18 | 2014-03-25 | Valspar Sourcing, Inc. | Coating compositions for containers and methods of coating |
| WO2010118356A1 (en) | 2009-04-09 | 2010-10-14 | Valspar Sourcing, Inc. | Polymer having unsaturated cycloaliphatic functionality and coating compositions formed therefrom |
| US8747979B2 (en) | 2009-07-17 | 2014-06-10 | Valspar Sourcing, Inc. | Coating compositions and articles coated therewith |
| WO2011035172A1 (en) | 2009-09-18 | 2011-03-24 | Valspar Sourcing, Inc. | Polyurethane coating composition |
| EP2723796B1 (en) | 2011-06-24 | 2015-07-22 | Dow Global Technologies LLC | Thermosetting composition and process for preparing fiber-reinforced composites |
| JP6008958B2 (ja) | 2011-06-30 | 2016-10-19 | ダウ グローバル テクノロジーズ エルエルシー | アミン硬化剤の混合物及び過剰のエポキシ基を含む硬化性エポキシ樹脂系 |
| WO2014062407A2 (en) | 2012-10-19 | 2014-04-24 | Dow Global Technologies Llc | Anhydride-cured epoxy resin systems containing divinylarene dioxides |
| BR112015010679A2 (pt) | 2012-11-13 | 2017-07-11 | Dow Global Technologies Llc | sistema de resina epóxi curável, processo para formar um compósito de epóxi reforçado com fibra e compósito reforçado com fibra curada |
| EP2920227B1 (en) | 2012-11-13 | 2017-02-08 | Dow Global Technologies LLC | Epoxy resin system containing polyethylene tetraamines for resin transfer molding processes |
| EP3102622B1 (en) | 2014-02-07 | 2019-01-09 | Dow Global Technologies Llc | Fast curing high glass transition temperature epoxy resin system |
| KR20170083054A (ko) | 2014-11-11 | 2017-07-17 | 다우 글로벌 테크놀로지스 엘엘씨 | 고속 경화성의 높은 유리전이 온도 에폭시 수지 시스템 |
| WO2016209864A1 (en) | 2015-06-25 | 2016-12-29 | Dow Global Technologies Llc | Novel epoxy resin system for making carbon fiber composites |
| WO2017007650A1 (en) | 2015-07-07 | 2017-01-12 | Dow Global Technologies Llc | Stable high glass transition temperature epoxy resin system for making composites |
| WO2017087663A1 (en) | 2015-11-17 | 2017-05-26 | Zephyros, Inc. | Additive manufacturing materials system |
| EP3472259A1 (en) | 2016-06-21 | 2019-04-24 | Dow Global Technologies, LLC | Composition for recovering hydrocarbon fluids from a subterranean reservoir |
| WO2017223490A1 (en) | 2016-06-24 | 2017-12-28 | Dow Global Technologies Llc | Method for reducing the permeability of a subterranean formation to aqueous-based fluids |
| WO2018005307A1 (en) | 2016-06-27 | 2018-01-04 | Dow Global Technologies Llc | Water soluble alpha-glycol sulfonated epoxy resin composition and process for preparing the same |
| CN109642017A (zh) | 2016-06-29 | 2019-04-16 | 陶氏环球技术有限责任公司 | 改变地下地层对水的渗透性的方法 |
| US11390741B2 (en) | 2016-08-19 | 2022-07-19 | Dow Global Technologies Llc | Epoxy resin compositions containing an internal mold release agent |
| WO2018164794A1 (en) | 2017-03-09 | 2018-09-13 | Dow Global Technologies Llc | Stable epoxy/internal mold release agent blends for the manufacture of composite articles |
| US20210277174A1 (en) | 2017-06-20 | 2021-09-09 | Dow Global Technologies Llc | Epoxy resin system for making fiber reinforced composites |
| WO2020005393A1 (en) | 2018-06-26 | 2020-01-02 | Dow Global Technologies Llc | Fibre-reinforced composite and process of making this composite |
| WO2020033036A1 (en) | 2018-08-08 | 2020-02-13 | Dow Global Technologies Llc | Epoxy resin composition |
| WO2020033037A1 (en) | 2018-08-08 | 2020-02-13 | Dow Global Technologies Llc | Epoxy resin composition |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2615008A (en) * | 1945-09-18 | 1952-10-21 | Devoe & Raynolds Co | Epoxide resin compositions |
| NL204817A (show.php) * | 1955-02-24 |
-
0
- NL NL137295D patent/NL137295C/xx active
-
1965
- 1965-11-03 US US506279A patent/US3547881A/en not_active Expired - Lifetime
-
1966
- 1966-10-31 BE BE689140D patent/BE689140A/xx unknown
- 1966-11-01 NL NL6615381A patent/NL6615381A/xx unknown
- 1966-11-01 CH CH1579666A patent/CH476657A/de not_active IP Right Cessation
- 1966-11-01 GB GB48977/66A patent/GB1116740A/en not_active Expired
- 1966-11-02 DE DE19661543884 patent/DE1543884A1/de active Pending
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2108428A1 (show.php) * | 1970-02-24 | 1971-09-02 |
Also Published As
| Publication number | Publication date |
|---|---|
| CH476657A (de) | 1969-08-15 |
| NL6615381A (show.php) | 1967-05-05 |
| GB1116740A (en) | 1968-06-12 |
| US3547881A (en) | 1970-12-15 |
| BE689140A (show.php) | 1967-05-02 |
| NL137295C (show.php) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1543884A1 (de) | Verfahren zur Herstellung von Hydroxyaethern durch Reaktion von Epoxyverbindungen mit Phenolen in Gegenwart eines Katalysators | |
| DE1812972A1 (de) | Verfahren zur Herstellung von Phenylhydroxyaethern | |
| DE2527117A1 (de) | (2,5-dihydroxyphenyl)phosphoniumhydroxid - inneres salz | |
| DE956988C (de) | Verfahren zur Herstellung eines Polyglycidylaethers eines Phenols | |
| DE1966703C3 (de) | Langkettige, aliphatische oder cycloaliphatische Säurereste enthaltende Diglycidylester | |
| DE1495446C3 (de) | Verfahren zur Herstellung von selbstverlöschenden vernetzten Epoxydpolyaddukten | |
| DE1595484C3 (de) | Verfahren zur Herstellung von Ricinusölpolyglycidyläthem und deren Verwendung zur Herstellung einer härtbaren Masse | |
| DE1495012A1 (de) | Verfahren zur Herstellung von Epoxyharzen | |
| EP0135477B1 (de) | Polyglycidyläther | |
| DE2206218A1 (de) | Verfahren zur herstellung von epoxidharzen | |
| DE1942836A1 (de) | Neue Diglycidylester von aliphatischen Dicarbonsaeuren,Verfahren zu ihrer Herstellung und ihrer Anwendung | |
| EP0018949A1 (de) | Härtbare Epoxidharzgemische und Härtungsbeschleuniger dafür | |
| DE1768187A1 (de) | Diglycidyl-o-phthalat mit hohem Epoxydgehalt und Anwendung in haertbaren Gemischen | |
| DE2461355A1 (de) | Ungesaettigter polyester | |
| DE2052024C3 (de) | Verfahren zur Herstellung eines Hydroxyäthers | |
| DE1543884B (de) | Verfahren zur Herstellung von Phenyl hydroxyathern durch Umsetzung von Epoxy verbindungen mit Phenolen in Gegenwart eines Katalysators | |
| DE1816933C (de) | Verfahren zur Herstellung von Epoxy Polyaddukten | |
| DE2505345B2 (de) | Verfahren zur herstellung von festen epoxidharzen | |
| DE1816096A1 (de) | Neue langkettige,aromatische Saeurereste enthaltende Polyglycidylester,Verfahren zu ihrer Herstellung und Anwendung | |
| DE2643336C3 (de) | Herstellung von festen Glycidyläthern mehrwertiger Phenole | |
| DE2130679A1 (de) | Verfahren zur Herstellung von Phenyl-ss-hydroxyalkylaethern | |
| DE1745451C3 (de) | Verfahren zum Härten von Epoxidharzen | |
| DE2220549C3 (de) | Diglycidylester, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1059441B (de) | Verfahren zur Herstellung von Alkinylgruppen enthaltenden Epoxyaethern | |
| DE2609475A1 (de) | Verfahren zum umsetzen von epoxiden und zusammensetzung auf basis von epoxyharzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| SH | Request for examination between 03.10.1968 and 22.04.1971 |