DE1520329A1 - Waermewiderstandsfaehige Polyamide - Google Patents
Waermewiderstandsfaehige PolyamideInfo
- Publication number
- DE1520329A1 DE1520329A1 DE19631520329 DE1520329A DE1520329A1 DE 1520329 A1 DE1520329 A1 DE 1520329A1 DE 19631520329 DE19631520329 DE 19631520329 DE 1520329 A DE1520329 A DE 1520329A DE 1520329 A1 DE1520329 A1 DE 1520329A1
- Authority
- DE
- Germany
- Prior art keywords
- aromatic
- radicals
- group
- ring
- poly
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229920002647 polyamide Polymers 0.000 title claims description 11
- 239000004952 Polyamide Substances 0.000 title claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 27
- 125000003118 aryl group Chemical group 0.000 claims description 22
- 239000000203 mixture Substances 0.000 claims description 18
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 8
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical group C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- 239000004760 aramid Substances 0.000 claims description 6
- 229920003235 aromatic polyamide Polymers 0.000 claims description 6
- 150000004820 halides Chemical class 0.000 claims description 6
- 239000003960 organic solvent Substances 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 5
- 229910003460 diamond Inorganic materials 0.000 claims description 4
- 239000010432 diamond Substances 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 238000002844 melting Methods 0.000 claims description 3
- 230000008018 melting Effects 0.000 claims description 3
- 210000003298 dental enamel Anatomy 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 2
- 125000001475 halogen functional group Chemical group 0.000 claims 1
- 229920000642 polymer Polymers 0.000 description 27
- 150000004985 diamines Chemical class 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- -1 aromatic Radicals Chemical class 0.000 description 11
- 238000006116 polymerization reaction Methods 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 6
- 239000000370 acceptor Substances 0.000 description 5
- GSCPDZHWVNUUFI-UHFFFAOYSA-N 3-aminobenzamide Chemical compound NC(=O)C1=CC=CC(N)=C1 GSCPDZHWVNUUFI-UHFFFAOYSA-N 0.000 description 4
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 4
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 4
- 229940113088 dimethylacetamide Drugs 0.000 description 4
- 238000010528 free radical solution polymerization reaction Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- QIKYZXDTTPVVAC-UHFFFAOYSA-N 4-Aminobenzamide Chemical compound NC(=O)C1=CC=C(N)C=C1 QIKYZXDTTPVVAC-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 238000012695 Interfacial polymerization Methods 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 150000004984 aromatic diamines Chemical class 0.000 description 3
- 235000010290 biphenyl Nutrition 0.000 description 3
- 239000004305 biphenyl Substances 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 125000005521 carbonamide group Chemical group 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 238000004455 differential thermal analysis Methods 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 230000004580 weight loss Effects 0.000 description 3
- UPYXKEAOXBAIFT-UHFFFAOYSA-N 3,4-dimethylazete-2-carboxamide Chemical compound CC1=C(C)C(C(N)=O)=N1 UPYXKEAOXBAIFT-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- FDQSRULYDNDXQB-UHFFFAOYSA-N benzene-1,3-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC(C(Cl)=O)=C1 FDQSRULYDNDXQB-UHFFFAOYSA-N 0.000 description 2
- LWBPNIJBHRISSS-UHFFFAOYSA-L beryllium dichloride Chemical compound Cl[Be]Cl LWBPNIJBHRISSS-UHFFFAOYSA-L 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 238000011835 investigation Methods 0.000 description 2
- QZUPTXGVPYNUIT-UHFFFAOYSA-N isophthalamide Chemical compound NC(=O)C1=CC=CC(C(N)=O)=C1 QZUPTXGVPYNUIT-UHFFFAOYSA-N 0.000 description 2
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- NZZGQZMNFCTNAM-UHFFFAOYSA-N naphthalene-2,6-dicarbonyl chloride Chemical compound C1=C(C(Cl)=O)C=CC2=CC(C(=O)Cl)=CC=C21 NZZGQZMNFCTNAM-UHFFFAOYSA-N 0.000 description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000009987 spinning Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- LXEJRKJRKIFVNY-UHFFFAOYSA-N terephthaloyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)=O)C=C1 LXEJRKJRKIFVNY-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- FILVIKOEJGORQS-UHFFFAOYSA-N 1,5-dimethylpyrrolidin-2-one Chemical compound CC1CCC(=O)N1C FILVIKOEJGORQS-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- NCROMWRGDGXTEG-UHFFFAOYSA-N 3-(3-carbonochloridoylphenyl)benzoyl chloride Chemical compound ClC(=O)C1=CC=CC(C=2C=C(C=CC=2)C(Cl)=O)=C1 NCROMWRGDGXTEG-UHFFFAOYSA-N 0.000 description 1
- HZYJTADTGMRSFN-UHFFFAOYSA-N 5-ethyl-2-methylbenzene-1,3-dicarbonyl chloride Chemical compound CC1=C(C(=O)Cl)C=C(C=C1C(=O)Cl)CC HZYJTADTGMRSFN-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 229910001627 beryllium chloride Inorganic materials 0.000 description 1
- 125000002529 biphenylenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C12)* 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 125000004427 diamine group Chemical group 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000000578 dry spinning Methods 0.000 description 1
- 238000010292 electrical insulation Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 230000001012 protector Effects 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000003252 repetitive effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000003698 tetramethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine group Chemical group C(CCC)N(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/02—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids
- C08G69/26—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from polyamines and polycarboxylic acids
- C08G69/32—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from polyamines and polycarboxylic acids from aromatic diamines and aromatic dicarboxylic acids with both amino and carboxylic groups aromatically bound
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyamides (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US222930A US3240760A (en) | 1962-09-11 | 1962-09-11 | Thermally resistant wholly aromatic polyamides |
Publications (1)
Publication Number | Publication Date |
---|---|
DE1520329A1 true DE1520329A1 (de) | 1969-05-22 |
Family
ID=22834312
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DE19631520329 Pending DE1520329A1 (de) | 1962-09-11 | 1963-09-11 | Waermewiderstandsfaehige Polyamide |
Country Status (9)
Families Citing this family (19)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3354125A (en) * | 1963-07-29 | 1967-11-21 | Monsanto Co | Polymers from diaminobenzanilides |
US3379692A (en) * | 1963-08-08 | 1968-04-23 | Monsanto Co | Amide-urethane copolymers |
US3453244A (en) * | 1965-07-14 | 1969-07-01 | Monsanto Co | Novel aliphatic-aromatic copolyamides |
US3671542A (en) * | 1966-06-13 | 1972-06-20 | Du Pont | Optically anisotropic aromatic polyamide dopes |
USRE30352E (en) * | 1966-06-13 | 1980-07-29 | E. I. Du Pont De Nemours And Company | Optically anisotropic aromatic polyamide dopes |
JPS5012006B1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1968-06-12 | 1975-05-08 | ||
US3541054A (en) * | 1968-08-05 | 1970-11-17 | Gen Electric | Polymers containing quinazolone rings |
US4118374A (en) * | 1974-09-09 | 1978-10-03 | Sumitomo Chemical Company, Limited | Production of aromatic polyamides from dicarboxylic acid and diamine |
NL157327C (nl) * | 1975-02-21 | 1984-05-16 | Akzo Nv | Werkwijze ter bereiding van poly-p-fenyleentereftaalamide. |
JPS5223198A (en) * | 1975-08-15 | 1977-02-21 | Hitachi Ltd | Preparation of aromatic polyether amide resin |
US4178431A (en) * | 1976-05-28 | 1979-12-11 | Ube Industries, Ltd. | Aromatic copolyamide fiber from benzidine sulfone or diamino phenanthridone |
US4200818A (en) * | 1978-08-01 | 1980-04-29 | Westinghouse Electric Corp. | Resin impregnated aromatic polyamide covered glass based slot wedge for large dynamoelectric machines |
CA1125940A (en) * | 1978-08-16 | 1982-06-15 | Yorikazu Tamura | Aromatic polyamide composition |
DE3001040A1 (de) * | 1980-01-12 | 1981-07-16 | Westinghouse Electric Corp., 15222 Pittsburgh, Pa. | Nutenkeile fuer dynamoelektrische maschinen |
FR2496678B1 (fr) * | 1980-12-22 | 1985-10-11 | Rhone Poulenc Textile | Compositions de polyparaphenyleneterephtalamide ainsi que leur preparation et un procede d'obtention de fibres a partir de telles compositions |
US4758651A (en) * | 1986-03-19 | 1988-07-19 | Akzo Nv | Amorphous aromatic copolyamide, a process for the preparation thereof, and shaped object |
US5004834A (en) * | 1990-04-05 | 1991-04-02 | E. I. Du Pont De Nemours And Company | Preparation of polyamides from unstable diamines |
KR20160068797A (ko) * | 2013-10-04 | 2016-06-15 | 아크론 폴리머 시스템즈, 인코포레이티드 | 수지 조성물, 기판 및 전자장치를 제조하는 방법 |
CN105491839A (zh) * | 2014-10-02 | 2016-04-13 | 亚克朗聚合物系统公司 | 盖构件和电子器件 |
Family Cites Families (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
GB709924A (en) * | 1951-03-16 | 1954-06-02 | British Celanese | Improvements in the production of polyamides |
US2917490A (en) * | 1958-01-16 | 1959-12-15 | Eastman Kodak Co | Polyamides from norcamphaneaminocarboxylic acids |
US3094511A (en) * | 1958-11-17 | 1963-06-18 | Du Pont | Wholly aromatic polyamides |
US3049518A (en) * | 1960-03-31 | 1962-08-14 | Du Pont | Polyamides from n, n'-bis (3-aminophenyl)-isophthalamide |
-
0
- NL NL297738D patent/NL297738A/xx unknown
- NL NL128396D patent/NL128396C/xx active
- BE BE637257D patent/BE637257A/xx unknown
-
1962
- 1962-09-11 US US222930A patent/US3240760A/en not_active Expired - Lifetime
-
1963
- 1963-09-09 GB GB35546/63A patent/GB980907A/en not_active Expired
- 1963-09-10 CH CH1114363A patent/CH435732A/fr unknown
- 1963-09-10 SE SE9906/63A patent/SE305081B/xx unknown
- 1963-09-10 LU LU44409D patent/LU44409A1/xx unknown
- 1963-09-11 DK DK430163AA patent/DK114657B/da unknown
- 1963-09-11 DE DE19631520329 patent/DE1520329A1/de active Pending
Also Published As
Publication number | Publication date |
---|---|
DK114657B (da) | 1969-07-21 |
LU44409A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1964-03-10 |
GB980907A (en) | 1965-01-20 |
CH435732A (fr) | 1967-05-15 |
NL128396C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
US3240760A (en) | 1966-03-15 |
BE637257A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
SE305081B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1968-10-14 |
NL297738A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE1520329A1 (de) | Waermewiderstandsfaehige Polyamide | |
EP0199090B1 (de) | Geformte Gebilde aus aromatischen Copolyamiden und Verfahren zu ihrer Herstellung | |
DE1595681A1 (de) | Verfahren zur Herstellung von hochschmelzenden Polyamiden | |
EP0327700B1 (de) | Formmassen bestehend aus einem thermoplastisch verarbeitbaren, aromatischen Polyamid | |
DE1570890A1 (de) | Polymerisate aus Diaminobenzaniliden | |
DE2153642A1 (de) | Verfahren zur herstellung von linearen aromatischen poly-1,3,4-oxadiazolen | |
DE1745165A1 (de) | Heteroxyclisches Amidpolymerisat und Verfahren zu dessen Herstellung | |
DE2144126C3 (de) | Hochmolekulare aromatische Polyamide und Fäden aus ihnen | |
DE1271985B (de) | Verfahren zur Herstellung von Polyamiden | |
DE3835405A1 (de) | Vollaromatische polyamide, verfahren zu ihrer herstellung und daraus geformte gebilde | |
DE1793700B2 (de) | 4,4'· eckige Klammer auf p-Phenylenbis- eckige Klammer auf (phenylimino)carbamyl eckige Klammer zu eckige Klammer zu diphthalsäureanhydrid und Verfahren zu seiner Herstellung | |
DE1801366A1 (de) | Verfahren zur Herstellung von Polyamiden und Mischpolyamiden | |
DE2313308A1 (de) | Verfahren zur herstellung von faeden, fasern und folien aus aromatischen polyamiden | |
DE2339865C2 (de) | Sulfonatgruppenhaltige Polycaprolactame, Verfahren zu ihrer Herstellung und Fäden und Fasern aus Polycaprolactamen, die diese sulfonatgruppenhaltigen Polycaprolactame zugemischt enthalten | |
DE69228797T2 (de) | Vollständig aromatische Polyamidharzzusammensetzung mit verbesserter Lichtbeständigkeit | |
DE1222674B (de) | Verfahren zur Herstellung von Polyamiden | |
EP0450589A2 (de) | Verfahren zur Herstellung von aromatischen Polyamiden mit hoher Hydrolysebeständigkeit | |
DE3932912A1 (de) | Sterisch gehinderte aminogruppen enthaltende synthetische polyamide | |
DE2041797A1 (de) | Verfahren zur Herstellung von Polyarylendihydrotetrazinen | |
DE2420530A1 (de) | Verfahren zur herstellung von sulfonatgruppenhaltigen aromatischen polyamiden | |
DE1256886B (de) | Polyamidpigmentmasse | |
DE1520330A1 (de) | Waermewiderstandsfaehige Polyamide | |
AT343916B (de) | Verfahren zur herstellung von hochmolekularen poly-p-phenylenterephthalamid oder seiner copolymere | |
DE2632416C2 (de) | Verfahren zur Herstellung von Poly-p-phenylenterephthalamid oder seiner Copolymere | |
CH631472A5 (en) | Process for the preparation of poly-p-phenylene terephthalamide or copolymers thereof |