DE1489438A1 - Gasgefuellte Anordnung,insbesondere Gluehlampe,mit Schwaerzungsschutz um einen gluehenden Koerper - Google Patents
Gasgefuellte Anordnung,insbesondere Gluehlampe,mit Schwaerzungsschutz um einen gluehenden KoerperInfo
- Publication number
- DE1489438A1 DE1489438A1 DE19651489438 DE1489438A DE1489438A1 DE 1489438 A1 DE1489438 A1 DE 1489438A1 DE 19651489438 DE19651489438 DE 19651489438 DE 1489438 A DE1489438 A DE 1489438A DE 1489438 A1 DE1489438 A1 DE 1489438A1
- Authority
- DE
- Germany
- Prior art keywords
- grid
- evaporation
- incandescent lamp
- gas
- glowing body
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000008020 evaporation Effects 0.000 claims description 23
- 238000001704 evaporation Methods 0.000 claims description 23
- 229910052751 metal Inorganic materials 0.000 claims description 19
- 239000002184 metal Substances 0.000 claims description 19
- 230000005855 radiation Effects 0.000 claims description 5
- 244000052616 bacterial pathogen Species 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 2
- 238000000034 method Methods 0.000 claims 1
- 239000007789 gas Substances 0.000 description 20
- 239000000463 material Substances 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 5
- 238000010521 absorption reaction Methods 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- 239000004071 soot Substances 0.000 description 5
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 239000010936 titanium Substances 0.000 description 4
- 229910052719 titanium Inorganic materials 0.000 description 4
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 229910052721 tungsten Inorganic materials 0.000 description 3
- 239000010937 tungsten Substances 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 229910052722 tritium Inorganic materials 0.000 description 2
- 238000004804 winding Methods 0.000 description 2
- FMFKNGWZEQOWNK-UHFFFAOYSA-N 1-butoxypropan-2-yl 2-(2,4,5-trichlorophenoxy)propanoate Chemical compound CCCCOCC(C)OC(=O)C(C)OC1=CC(Cl)=C(Cl)C=C1Cl FMFKNGWZEQOWNK-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 101100208721 Mus musculus Usp5 gene Proteins 0.000 description 1
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 238000000151 deposition Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 229910052805 deuterium Inorganic materials 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 238000005265 energy consumption Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910052756 noble gas Inorganic materials 0.000 description 1
- 230000005658 nuclear physics Effects 0.000 description 1
- 230000006911 nucleation Effects 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 230000003313 weakening effect Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01K—ELECTRIC INCANDESCENT LAMPS
- H01K1/00—Details
- H01K1/52—Means for obtaining or maintaining the desired pressure within the vessel
- H01K1/54—Means for absorbing or absorbing gas, or for preventing or removing efflorescence, e.g. by gettering
Landscapes
- Resistance Heating (AREA)
- Physical Vapour Deposition (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Investigating, Analyzing Materials By Fluorescence Or Luminescence (AREA)
- Investigating Or Analysing Materials By Optical Means (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEN0026964 | 1965-06-29 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1489438A1 true DE1489438A1 (de) | 1969-04-24 |
Family
ID=7344042
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19651489438 Pending DE1489438A1 (de) | 1965-06-29 | 1965-06-29 | Gasgefuellte Anordnung,insbesondere Gluehlampe,mit Schwaerzungsschutz um einen gluehenden Koerper |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3479550A (OSRAM) |
| BE (1) | BE683228A (OSRAM) |
| CH (1) | CH461635A (OSRAM) |
| DE (1) | DE1489438A1 (OSRAM) |
| ES (1) | ES328415A1 (OSRAM) |
| GB (1) | GB1137434A (OSRAM) |
| NL (1) | NL6608780A (OSRAM) |
| NO (1) | NO120326B (OSRAM) |
| SE (1) | SE309810B (OSRAM) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3683226A (en) * | 1970-09-30 | 1972-08-08 | Gen Electric | Electric lamp apparatus having diffusion barrier |
| US5646483A (en) * | 1995-05-30 | 1997-07-08 | Matsushita Electronics Corporation | Discharge lamp having cesium compound |
| US20040261265A1 (en) * | 2003-06-25 | 2004-12-30 | General Electric Company | Method for improving the wear resistance of a support region between a turbine outer case and a supported turbine vane |
| RU2761175C1 (ru) * | 2020-07-09 | 2021-12-06 | Юрий Михайлович Ермаков | Электрическая лампа |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2232817A (en) * | 1938-10-20 | 1941-02-25 | Sherwin Williams Co | Preparation of pure titanium oxide |
| IT454148A (OSRAM) * | 1948-01-15 | |||
| US2725497A (en) * | 1951-04-25 | 1955-11-29 | Westinghouse Electric Corp | Floating grids for fluorescent lamps |
| US2605440A (en) * | 1951-06-04 | 1952-07-29 | Westinghouse Electric Corp | Incandescent electric lamp |
| US2763814A (en) * | 1952-04-22 | 1956-09-18 | Sebel S A | Electronic fluorescent illuminating lamp |
| US2812465A (en) * | 1954-05-10 | 1957-11-05 | Kenneth J Germeshausen | Gaseous-discharge device |
| US2917650A (en) * | 1955-06-29 | 1959-12-15 | Hyperion Sa | Electrode for discharge tubes |
| US2933632A (en) * | 1957-10-28 | 1960-04-19 | Gen Electric | Incandescent lamp with blackening collector screen |
-
1965
- 1965-06-29 DE DE19651489438 patent/DE1489438A1/de active Pending
-
1966
- 1966-06-20 US US558824A patent/US3479550A/en not_active Expired - Lifetime
- 1966-06-24 GB GB28293/66A patent/GB1137434A/en not_active Expired
- 1966-06-24 NL NL6608780A patent/NL6608780A/xx unknown
- 1966-06-27 SE SE8727/66A patent/SE309810B/xx unknown
- 1966-06-27 NO NO163665A patent/NO120326B/no unknown
- 1966-06-27 ES ES0328415A patent/ES328415A1/es not_active Expired
- 1966-06-27 BE BE683228D patent/BE683228A/xx unknown
- 1966-06-27 CH CH926166A patent/CH461635A/de unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ES328415A1 (es) | 1967-04-01 |
| US3479550A (en) | 1969-11-18 |
| CH461635A (de) | 1968-08-31 |
| GB1137434A (en) | 1968-12-18 |
| SE309810B (OSRAM) | 1969-04-08 |
| NO120326B (OSRAM) | 1970-10-05 |
| BE683228A (OSRAM) | 1966-12-27 |
| NL6608780A (OSRAM) | 1966-12-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3500022C2 (de) | Verfahren zum Herstellen von Kapseln mit genau bemessenem Materialinhalt | |
| DE973156C (de) | Verfahren zur Herstellung lichtelektrisch leitender Schichten fuer Photowiderstaende | |
| DE1489147B2 (OSRAM) | ||
| DE1246120B (de) | Quecksilberdampfniederdruck-Entladungslampe | |
| DE1764979A1 (de) | Quecksilber-Metallhalogenid-Dampflampe mit Regeneration | |
| DE670868C (de) | Elektrische Entladungsroehre mit Gasfuellung | |
| DE2522209A1 (de) | Hochdrucknatriumdampflampe mit niedriger zuendspannung | |
| DE803779C (de) | Verfahren zum Herstellen eines Mosaikschirmes | |
| DE1489438A1 (de) | Gasgefuellte Anordnung,insbesondere Gluehlampe,mit Schwaerzungsschutz um einen gluehenden Koerper | |
| DE490709C (de) | Roentgenroehre mit Gluehkathode, die in einem Metallgefaess angebracht ist, dessen Wandungen einen Teil der Roehrenhuelle bilden und von dem die Antikathode isoliert ist | |
| DE965706C (de) | Elektrische Entladungsroehre zum Verstaerken von Roentgenbildern | |
| DE2433334A1 (de) | Wolfram-halogen-lampe | |
| DE2118828A1 (de) | Hochdruck-Natriumdampf-Entladungslampe | |
| DE1490950A1 (de) | Zinn-Oxyd-Widerstand | |
| DE2920712A1 (de) | Atom-spektrallampe | |
| DE1639080B2 (de) | Elektrische halogengluehlampe | |
| DE1807439B2 (de) | Gluehlampe mit verbesserter lichtausbeute | |
| DE290932C (OSRAM) | ||
| DE2535922A1 (de) | Quecksilberdampf-hochdruckentladungslampe fuer horizontale brennlage | |
| DE2559065A1 (de) | Verdampfungs-vorrichtung | |
| DE902528C (de) | Elektrische Hochdruckentladungsleuchtroehre | |
| DE3036827A1 (de) | Gluehlampe | |
| DE939276C (de) | Mittelbar geheizte Kathode fuer elektrische Entladungsgefaesse und Verfahren zur Herstellung und/oder zum Betrieb eines Entladungsgefaesses mit einer solchen Kathode | |
| DE509825C (de) | Elektrische Entladungsroehre zum Aussenden von Strahlen | |
| AT132856B (de) | Elektrisches Entladungsgefäß mit Glühkathode. |