DE1476048C - - Google Patents
Info
- Publication number
- DE1476048C DE1476048C DE1476048C DE 1476048 C DE1476048 C DE 1476048C DE 1476048 C DE1476048 C DE 1476048C
- Authority
- DE
- Germany
- Prior art keywords
- cylinder head
- liner
- sealing surface
- sealing ring
- sealing
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 238000007789 sealing Methods 0.000 claims description 68
- 238000002485 combustion reaction Methods 0.000 claims description 8
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 3
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 229910052804 chromium Inorganic materials 0.000 claims description 3
- 239000011651 chromium Substances 0.000 claims description 3
- 229910052742 iron Inorganic materials 0.000 claims description 3
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 3
- 229910052759 nickel Inorganic materials 0.000 claims description 3
- 229910052698 phosphorus Inorganic materials 0.000 claims description 3
- 239000011574 phosphorus Substances 0.000 claims description 3
- 229910052710 silicon Inorganic materials 0.000 claims description 3
- 239000010703 silicon Substances 0.000 claims description 3
- 229910001220 stainless steel Inorganic materials 0.000 claims description 3
- 239000010935 stainless steel Substances 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 description 7
- 239000000463 material Substances 0.000 description 6
- 230000000694 effects Effects 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 239000000498 cooling water Substances 0.000 description 2
- 239000000446 fuel Substances 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 239000002826 coolant Substances 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1476048B1 (de) | Zylinderkopfabdichtung an einer Brennkraftmaschine | |
| DE4112889C2 (de) | Verfahren zur Herstellung eines Kolbenkopfes mit Kühlung für einen mehrteiligen, gegliederten Kolben für Verbrennungsmotore, sowie danach hergestellter Kolbenkopf | |
| EP0152763B1 (de) | Buchsdichtung zum Trennen eines zylindrischen Körpers von einer ihn aufnehmenden Bohrung | |
| DE1946220U (de) | Dichtungsring. | |
| DE2625191A1 (de) | Kolben fuer verbrennungskraftmaschinen | |
| DE3005005C2 (de) | Stationäre Dichtung | |
| DE2024840A1 (de) | Abdichtungskonstruktion für Rohrverbindungen | |
| DE3150198C2 (de) | Ringförmige Hartdichtung | |
| DE102017123197A1 (de) | Kolben | |
| DE3215709C2 (en:Method) | ||
| DE3142344A1 (de) | Zylinderkopfdichtung | |
| DE10307908B4 (de) | Mehrteiliger Kolben | |
| DE2714776C2 (de) | Zylinderkopfdichtung für Verbrennungskraftmaschinen | |
| DE3313438A1 (de) | Zylinderkopfdichtung | |
| DE19722053A1 (de) | Kolben für einen Verbrennungsmotor | |
| DE1476048C (en:Method) | ||
| DE2510192A1 (de) | Kolben fuer brennkraftmaschinen | |
| DE9210548U1 (de) | Dichtring für Druckrohrleitungen | |
| AT3210U1 (de) | Kolben für eine brennkraftmaschine | |
| DE2111480C3 (de) | Hubkolbenbrennkraftmaschine | |
| DE3017952A1 (de) | Durch periodische druckspitzen belastetes lager | |
| DE10205179B4 (de) | Kühlwasserabdichtung zwischen einem Motorblock und einer Zylinderlaufbuchse | |
| DE2236465A1 (de) | Dichtungsbaugruppe | |
| DE921489C (de) | Kolben-Brennkraftmaschine | |
| DE69003476T2 (de) | Zylinderkopfabdichtung mit Abdichtungen mit Mehrstufen-Kompressibilität. |