DE1446149C - - Google Patents
Info
- Publication number
- DE1446149C DE1446149C DE1446149C DE 1446149 C DE1446149 C DE 1446149C DE 1446149 C DE1446149 C DE 1446149C
- Authority
- DE
- Germany
- Prior art keywords
- palladium
- gold
- layer
- copper
- immersion
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 66
- 229910052763 palladium Inorganic materials 0.000 claims description 31
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 claims description 23
- 229910052737 gold Inorganic materials 0.000 claims description 23
- 239000010931 gold Substances 0.000 claims description 23
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 16
- 229910052802 copper Inorganic materials 0.000 claims description 16
- 239000010949 copper Substances 0.000 claims description 16
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 10
- 229910052751 metal Inorganic materials 0.000 claims description 8
- 239000002184 metal Substances 0.000 claims description 8
- IIACRCGMVDHOTQ-UHFFFAOYSA-M sulfamate Chemical compound NS([O-])(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-M 0.000 claims description 8
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 7
- 229910052707 ruthenium Inorganic materials 0.000 claims description 7
- 239000010953 base metal Substances 0.000 claims description 6
- 230000008021 deposition Effects 0.000 claims description 6
- 229910052697 platinum Inorganic materials 0.000 claims description 5
- 229910045601 alloy Inorganic materials 0.000 claims description 4
- 239000000956 alloy Substances 0.000 claims description 4
- 229910052703 rhodium Inorganic materials 0.000 claims description 4
- 239000010948 rhodium Substances 0.000 claims description 4
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 238000007747 plating Methods 0.000 claims description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 2
- 239000012266 salt solution Substances 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims 1
- 239000010408 film Substances 0.000 description 14
- 238000007654 immersion Methods 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 239000010410 layer Substances 0.000 description 9
- 239000000243 solution Substances 0.000 description 8
- 239000000853 adhesive Substances 0.000 description 7
- 230000001070 adhesive effect Effects 0.000 description 7
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 6
- 229910000510 noble metal Inorganic materials 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000010970 precious metal Substances 0.000 description 4
- 239000004575 stone Substances 0.000 description 4
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000001805 chlorine compounds Chemical class 0.000 description 3
- 238000004140 cleaning Methods 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000009792 diffusion process Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000008262 pumice Substances 0.000 description 3
- YWYZEGXAUVWDED-UHFFFAOYSA-N triammonium citrate Chemical compound [NH4+].[NH4+].[NH4+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O YWYZEGXAUVWDED-UHFFFAOYSA-N 0.000 description 3
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 2
- 230000004888 barrier function Effects 0.000 description 2
- 150000001649 bromium compounds Chemical class 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 238000007598 dipping method Methods 0.000 description 2
- 229960001484 edetic acid Drugs 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 239000002344 surface layer Substances 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 239000003082 abrasive agent Substances 0.000 description 1
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- BBKFSSMUWOMYPI-UHFFFAOYSA-N gold palladium Chemical compound [Pd].[Au] BBKFSSMUWOMYPI-UHFFFAOYSA-N 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000011229 interlayer Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- INIOZDBICVTGEO-UHFFFAOYSA-L palladium(ii) bromide Chemical compound Br[Pd]Br INIOZDBICVTGEO-UHFFFAOYSA-L 0.000 description 1
- YTXAYGAYACWVGD-UHFFFAOYSA-N palladium;hydrate Chemical compound O.[Pd] YTXAYGAYACWVGD-UHFFFAOYSA-N 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L peroxydisulfate Chemical compound [O-]S(=O)(=O)OOS([O-])(=O)=O JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- 239000011241 protective layer Substances 0.000 description 1
- MMRXYMKDBFSWJR-UHFFFAOYSA-K rhodium(3+);tribromide Chemical class [Br-].[Br-].[Br-].[Rh+3] MMRXYMKDBFSWJR-UHFFFAOYSA-K 0.000 description 1
- 238000005201 scrubbing Methods 0.000 description 1
- 229910000679 solder Inorganic materials 0.000 description 1
- 238000005476 soldering Methods 0.000 description 1
- 230000003746 surface roughness Effects 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1446149B2 (de) | Verfahren zum Abscheiden einer Bimetallschicht auf einem Grundmetall in einer gedruckten Schaltung | |
| DE69203287T2 (de) | Saures Bad zum Aufbringen einer Palladiumzwischenschicht. | |
| DE1696312C2 (de) | Bad zum stromlosen Abscheiden von Kupferüberzügen | |
| DE2947821A1 (de) | Bad zum stromlosen abscheiden von zinn | |
| DE1233693B (de) | Verfahren zur stromlosen Abscheidung von festhaftenden Zinnueberzuegen auf Aluminium | |
| DE1068970B (de) | Galvanisches Abscheiden schwarzer Nickelüberzüge und Vorbehandlung der zu überziehenden Werkstücke | |
| DE670403C (de) | Verfahren zur elektrolytischen Herstellung von im wesentlichen aus Zinn bestehenden UEberzuegen | |
| DE3317493A1 (de) | Galvanische abscheidung von palladium-ueberzuegen | |
| DE3337856A1 (de) | Verfahren zur aktivierung von substraten fuer die stromlose metallisierung | |
| DE647334C (de) | Elektrolyt zur Erzeugung elektrolytischer Niederschlaege von Ruthenium | |
| DE1247804B (de) | Alkalisches Bad zum chemischen Abscheiden von festhaftenden Palladiumueberzuegen | |
| DE1446149C (enExample) | ||
| EP0619386B1 (de) | Elektrolytische Abscheidung von Palladium oder Palladiumlegierungen | |
| DE3339856A1 (de) | Verfahren zur haftaktivierung von polyamidsubstraten fuer die stromlose metallisierung | |
| DE1255434B (de) | Verfahren zum stromlosen Abscheiden von UEberzuegen aus Zinn auf Gegenstaende aus Blei oder einer Bleilegierung | |
| DE19954613A1 (de) | Verfahren zur stromlosen Verzinnung von Kupfer oder Kupferlegierungen | |
| DE3300543A1 (de) | Waessrig-saure chromatierloesung und verfahren zur herstellung gefaerbter chromatueberzuege auf elektrochemisch abgeschiedenen zink-nickel-legierungen | |
| US5182172A (en) | Post-plating passivation treatment | |
| DE69011549T2 (de) | Elektroplattierung von Gold enthaltenden Legierungen. | |
| DE69113389T2 (de) | Bad zum stromlosen Abscheiden einer Blei-Zinn Legierung. | |
| DE1521080A1 (de) | Verfahren zur Aufbringung von metallischen Oberflaechenschichten auf Werkstuecke aus Titan | |
| DE2807564C2 (de) | Verfahren zur stromlosen Abscheidung einer Gold-Nickel-Legierung | |
| DE19749382A1 (de) | Verzinnung von Kupferrohren | |
| DE2354588C3 (de) | Wässriges, alkalisches Bad zur Beschichtung von Aluminium- und Aluminiumlegierungsflächen | |
| DE1621145B1 (de) | Verfahren zur vorbehandlung von aluminium oder seinen legie rungen vor der galvanischen beschichtung |