DE1443837C - - Google Patents
Info
- Publication number
- DE1443837C DE1443837C DE19621443837 DE1443837 DE1443837C DE 1443837 C DE1443837 C DE 1443837C DE 19621443837 DE19621443837 DE 19621443837 DE 1443837 DE1443837 DE 1443837 DE 1443837 C DE1443837 C DE 1443837C
- Authority
- DE
- Germany
- Prior art keywords
- hydrogen fluoride
- halogen
- chromium
- mol
- fluoride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 claims description 14
- 229910000040 hydrogen fluoride Inorganic materials 0.000 claims description 14
- QCMJBECJXQJLIL-UHFFFAOYSA-L chromium(6+);oxygen(2-);difluoride Chemical compound [O-2].[O-2].[F-].[F-].[Cr+6] QCMJBECJXQJLIL-UHFFFAOYSA-L 0.000 claims description 5
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- 150000001299 aldehydes Chemical class 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 238000003682 fluorination reaction Methods 0.000 claims description 4
- 150000002576 ketones Chemical class 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 2
- 150000001721 carbon Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 150000001728 carbonyl compounds Chemical class 0.000 claims description 2
- 229910052804 chromium Inorganic materials 0.000 claims description 2
- 239000011651 chromium Substances 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- 150000004677 hydrates Chemical class 0.000 claims description 2
- 239000003054 catalyst Substances 0.000 description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- JVTSHOJDBRTPHD-UHFFFAOYSA-N 2,2,2-trifluoroacetaldehyde Chemical compound FC(F)(F)C=O JVTSHOJDBRTPHD-UHFFFAOYSA-N 0.000 description 3
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 3
- DOJXGHGHTWFZHK-UHFFFAOYSA-N Hexachloroacetone Chemical compound ClC(Cl)(Cl)C(=O)C(Cl)(Cl)Cl DOJXGHGHTWFZHK-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- PVFOMCVHYWHZJE-UHFFFAOYSA-N trichloroacetyl chloride Chemical compound ClC(=O)C(Cl)(Cl)Cl PVFOMCVHYWHZJE-UHFFFAOYSA-N 0.000 description 3
- DCEPGADSNJKOJK-UHFFFAOYSA-N 2,2,2-trifluoroacetyl fluoride Chemical compound FC(=O)C(F)(F)F DCEPGADSNJKOJK-UHFFFAOYSA-N 0.000 description 2
- -1 carboxylic acid halide Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- VQWFNAGFNGABOH-UHFFFAOYSA-K chromium(iii) hydroxide Chemical compound [OH-].[OH-].[OH-].[Cr+3] VQWFNAGFNGABOH-UHFFFAOYSA-K 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- VBZWSGALLODQNC-UHFFFAOYSA-N hexafluoroacetone Chemical compound FC(F)(F)C(=O)C(F)(F)F VBZWSGALLODQNC-UHFFFAOYSA-N 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- HFFLGKNGCAIQMO-UHFFFAOYSA-N trichloroacetaldehyde Chemical compound ClC(Cl)(Cl)C=O HFFLGKNGCAIQMO-UHFFFAOYSA-N 0.000 description 2
- BVFDUKJYTCHZNE-UHFFFAOYSA-N 2,2,2-trichloroacetaldehyde Chemical compound ClC(Cl)(Cl)C=O.ClC(Cl)(Cl)C=O BVFDUKJYTCHZNE-UHFFFAOYSA-N 0.000 description 1
- LNDJIMKADVTHOS-UHFFFAOYSA-N 2,2,2-trichloroacetyl fluoride Chemical compound FC(=O)C(Cl)(Cl)Cl LNDJIMKADVTHOS-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229910021564 Chromium(III) fluoride Inorganic materials 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- OGDYVWQEAVKKDI-UHFFFAOYSA-N chromium(3+);oxygen(2-);hydrate Chemical class O.[O-2].[O-2].[O-2].[Cr+3].[Cr+3] OGDYVWQEAVKKDI-UHFFFAOYSA-N 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- FTBATIJJKIIOTP-UHFFFAOYSA-K trifluorochromium Chemical compound F[Cr](F)F FTBATIJJKIIOTP-UHFFFAOYSA-K 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1443837C true DE1443837C (enrdf_load_stackoverflow) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1443837A1 (de) | Verfahren zur Fluorierung sauerstoffhaltiger aliphatischer Verbindungen | |
| DE69801489T2 (de) | Verfahren zur herstellung von 1,1,1,3,3-pentafluorpropan | |
| DE69518645T2 (de) | Herstellung von 1,2-dihydro und 2,2-dihydro hexafluorpropanen und ihre azeotrope mit hf | |
| EP0036123B1 (de) | Verfahren zur Herstellung von hochreinen teilfluorierten Äthanen | |
| DE1080993B (de) | Verfahren zur Herstellung organischer Fluorverbindungen | |
| DE69633985T2 (de) | Behandlung von Chromoxid und dessen Verwendung in der katalytischen Herstellung von Vinylfluorid | |
| DE1468680C3 (de) | Verfahren zur Herstellung chlorfluorierter Derivate des Äthylens oder des Äthans | |
| DE69304838T2 (de) | Verfahren zur herstellung von halogeniertem buten und butan | |
| DE1443837C (enrdf_load_stackoverflow) | ||
| DE60216117T2 (de) | Verfahren zur herstellung von hexafluoraceton und dessen hydrat | |
| EP0337127B1 (de) | Verfahren zur Herstellung von Hexafluorpropen | |
| DE69801180T2 (de) | Verfahren zur Herstellung von 3,3-dichlor-1,1,1-trifluoraceton | |
| DE1237084B (de) | Verfahren zur Herstellung von 1, 2-Dichlor-1, 1, 2, 3, 3, 3,-hexafluorpropan | |
| DE1443837B (enrdf_load_stackoverflow) | ||
| DE1222040C2 (de) | Verfahren zur herstellung von tetrafluoraethylen | |
| DE1443382A1 (de) | Verfahren zur Herstellung von fluorierten Kohlenwasserstoffen | |
| DE1518857C3 (enrdf_load_stackoverflow) | ||
| EP0492386B1 (de) | Verfahren zur Herstellung von Fluor enthaltenden Ethanderivaten | |
| DE1257782B (de) | Verfahren zur Herstellung von Aminen | |
| DE2719021A1 (de) | Verfahren zur herstellung von 1,1,1-trifluor-2-chloraethan | |
| DE4130696A1 (de) | Verfahren zur herstellung von fluor enthaltenden ethanderivaten | |
| DE1287056B (de) | Verfahren zur Herstellung von hochfluorierten Perhalogenverbindungen | |
| DE69907573T2 (de) | Verfahren zur Herstellung von 1,1,1,2,3,3,3-Heptafluoropropane | |
| DE2203326C3 (de) | Verfahren zur Herstellung von Trifluoracetylchlorid | |
| DE2106243C2 (de) | Verfahren zur Herstellung von Aldehyden |