DE1410543A1 - Zickzacknaehmaschine mit Zierstichwaehleinrichtung - Google Patents
Zickzacknaehmaschine mit ZierstichwaehleinrichtungInfo
- Publication number
- DE1410543A1 DE1410543A1 DE19591410543 DE1410543A DE1410543A1 DE 1410543 A1 DE1410543 A1 DE 1410543A1 DE 19591410543 DE19591410543 DE 19591410543 DE 1410543 A DE1410543 A DE 1410543A DE 1410543 A1 DE1410543 A1 DE 1410543A1
- Authority
- DE
- Germany
- Prior art keywords
- cam
- control
- manual
- package
- pin
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000009958 sewing Methods 0.000 title claims description 20
- 238000006073 displacement reaction Methods 0.000 claims description 3
- 206010033799 Paralysis Diseases 0.000 claims 1
- 241001116498 Taxus baccata Species 0.000 claims 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims 1
- 241000130764 Tinea Species 0.000 claims 1
- 208000002474 Tinea Diseases 0.000 claims 1
- 230000009471 action Effects 0.000 description 10
- 238000000034 method Methods 0.000 description 5
- 230000008569 process Effects 0.000 description 5
- 239000000463 material Substances 0.000 description 4
- 230000008859 change Effects 0.000 description 3
- 210000000078 claw Anatomy 0.000 description 3
- 244000228957 Ferula foetida Species 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 210000003128 head Anatomy 0.000 description 2
- 230000010355 oscillation Effects 0.000 description 2
- 239000000523 sample Substances 0.000 description 2
- ZZIZZTHXZRDOFM-XFULWGLBSA-N tamsulosin hydrochloride Chemical compound [H+].[Cl-].CCOC1=CC=CC=C1OCCN[C@H](C)CC1=CC=C(OC)C(S(N)(=O)=O)=C1 ZZIZZTHXZRDOFM-XFULWGLBSA-N 0.000 description 2
- 101100479039 Caenorhabditis elegans aars-1 gene Proteins 0.000 description 1
- 208000010201 Exanthema Diseases 0.000 description 1
- 241000533867 Fordia Species 0.000 description 1
- 208000012266 Needlestick injury Diseases 0.000 description 1
- 241000949477 Toona ciliata Species 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 210000002969 egg yolk Anatomy 0.000 description 1
- 201000005884 exanthem Diseases 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 210000000887 face Anatomy 0.000 description 1
- 210000001061 forehead Anatomy 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052754 neon Inorganic materials 0.000 description 1
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical group [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 description 1
- 230000036316 preload Effects 0.000 description 1
- 206010037844 rash Diseases 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 230000033764 rhythmic process Effects 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D05—SEWING; EMBROIDERING; TUFTING
- D05B—SEWING
- D05B19/00—Programme-controlled sewing machines
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Sewing Machines And Sewing (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEP0022967 | 1959-06-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1410543A1 true DE1410543A1 (de) | 1969-10-02 |
Family
ID=7368970
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19591410543 Pending DE1410543A1 (de) | 1959-06-13 | 1959-06-13 | Zickzacknaehmaschine mit Zierstichwaehleinrichtung |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3043252A (en:Method) |
| BE (1) | BE588960A (en:Method) |
| CH (2) | CH379894A (en:Method) |
| DE (1) | DE1410543A1 (en:Method) |
| ES (1) | ES253007A1 (en:Method) |
| GB (1) | GB945344A (en:Method) |
| NL (2) | NL246592A (en:Method) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3330928A1 (de) * | 1983-08-27 | 1985-03-21 | Dorina Nähmaschinen GmbH, 7500 Karlsruhe | Naehmaschine mit stichmustersteuerung |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3177835A (en) * | 1961-09-08 | 1965-04-13 | Koyo Seiko Company Ltd | Automatic pattern zigzag sewing machine |
| US3188991A (en) * | 1962-02-05 | 1965-06-15 | Aichi Kogyo Kabushiki Kaisha | Cam controlling mechanism in a pattern stitch sewing machine |
| US3356051A (en) * | 1963-10-28 | 1967-12-05 | Janome Sewing Machine Co Ltd | Cam selecting arrangment |
| US3699910A (en) * | 1971-08-16 | 1972-10-24 | Singer Co | Cam selector mechanisms for sewing machines |
| US3724282A (en) * | 1971-08-26 | 1973-04-03 | Singer Co | Cam and follower release mechanism for sewing machines |
| US3786769A (en) * | 1973-02-05 | 1974-01-22 | Singer Co | Pattern selection system |
| JPS5831945B2 (ja) * | 1975-03-05 | 1983-07-09 | ブラザー工業株式会社 | ジドウジグザグミシン |
| RU2136795C1 (ru) * | 1998-04-14 | 1999-09-10 | Конструкторское бюро приборостроения | Бытовая электромеханическая швейная машина с автоматической обратной подачей |
| AU2016201440A1 (en) | 2015-03-10 | 2016-09-29 | Aristocrat Technologies Australia Pty Limited | A method of gaming, a gaming system and a game controller |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2662417A (en) * | 1950-05-17 | 1953-12-15 | Mascherpa Antonio | Speed change gearing |
| CH317412A (de) * | 1954-05-04 | 1956-11-30 | Phoenix Naehmaschinen Ag Baer | Zickzack-Nähmaschine mit Ziersticheinrichtung |
| US2971482A (en) * | 1955-06-02 | 1961-02-14 | Nippon Sewing Machine Mfg Co L | Automatic zigzag-stitch sewing machine |
| US2939336A (en) * | 1956-12-07 | 1960-06-07 | Western Laundry Machinery Comp | Timing device |
| DE1038887B (de) * | 1957-06-15 | 1958-09-11 | Guenther Gude | Verfahren und Vorrichtung zum automatischen Naehen eines in sich geschlossenen Zierstichbildes |
| US2907221A (en) * | 1957-08-22 | 1959-10-06 | Kienzle App G M B H Fa | Adjustable transmissions |
-
0
- NL NL246544D patent/NL246544A/xx unknown
- NL NL246592D patent/NL246592A/xx unknown
-
1959
- 1959-06-13 DE DE19591410543 patent/DE1410543A1/de active Pending
- 1959-10-17 CH CH7959059A patent/CH379894A/de unknown
- 1959-10-29 ES ES0253007A patent/ES253007A1/es not_active Expired
- 1959-12-10 CH CH8167159A patent/CH375973A/de unknown
-
1960
- 1960-01-08 GB GB830/60A patent/GB945344A/en not_active Expired
- 1960-02-10 US US7938A patent/US3043252A/en not_active Expired - Lifetime
- 1960-03-23 BE BE588960A patent/BE588960A/fr unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3330928A1 (de) * | 1983-08-27 | 1985-03-21 | Dorina Nähmaschinen GmbH, 7500 Karlsruhe | Naehmaschine mit stichmustersteuerung |
Also Published As
| Publication number | Publication date |
|---|---|
| US3043252A (en) | 1962-07-10 |
| CH375973A (de) | 1964-03-15 |
| NL246544A (en:Method) | |
| NL246592A (en:Method) | |
| CH379894A (de) | 1964-07-15 |
| BE588960A (fr) | 1960-07-18 |
| GB945344A (en) | 1963-12-23 |
| ES253007A1 (es) | 1960-05-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1222772B (de) | Zickzacknaehmaschinen mit Zierstichautomatik | |
| DE1410543A1 (de) | Zickzacknaehmaschine mit Zierstichwaehleinrichtung | |
| DE2038505C3 (de) | Fehlstichmechanismus für Nähmaschinen | |
| DE2414191A1 (de) | Naehmaschine mit stichlaengen- und verhaeltnissteuermechanismus | |
| DE1131494B (de) | Einrichtung zum automatischen Naehen von Knopfloechern an Zickzacknaehmaschinen | |
| DE2132064A1 (de) | Einrichtung an einer zick-zack- oder automatik-naehmaschine zum einstellen von stichlage und stichbreite | |
| DE2404541C2 (de) | Nähmaschine mit Steuerscheiben für die Herstellung von Ziernähten | |
| DE1485229C3 (de) | Nähmaschine | |
| CH300900A (de) | Zickzack-Nähmaschine. | |
| DE7019257U (de) | Musterschablonen-vorrichtung fuer zick-zack-naehmaschinen. | |
| DE1760435B2 (de) | Nähmaschine | |
| DE1410544A1 (de) | Einrichtung zur Steuerung der Vorschubgroesse fuer Zickzacknaehmaschinen | |
| DE2921349A1 (de) | Zickzack-naehmaschine mit musterwahl- vorrichtung | |
| DE1894536U (de) | Zickzacknaehmaschine mit zierstichwaehleinrichtung. | |
| DE4225899C2 (de) | Nähmaschine | |
| DE1174601B (de) | Naehmaschine | |
| DE1001572B (de) | Nahmaschine mit Zickzack Ein richtung | |
| AT233928B (de) | Selbsttätige Steuervorrichtung zum Ausführen von Nahtbildern mit einer Nähmaschine | |
| AT201407B (de) | Vorrichtung zum wahlweisen und selbsttätigen Steuern der Nadelstange und bzw. oder des Stoffschiebers in Zick-Zack- bzw. Zierstich-Nähmaschinen | |
| DE2330369A1 (de) | Handstrickapparat | |
| DE943925C (de) | Blindstichnaehmaschine | |
| DE977017C (de) | Ziersticheinrichtung fuer Zickzacknaehmaschinen | |
| DE621835C (de) | Naehmaschine mit unterem Stoffschieber- und oberem Nadelvorschub | |
| AT237418B (de) | Nähmaschine zum Ausführen von Ziernähten | |
| DE1189838B (de) | Ziersticheinrichtung fuer Naehmaschinen |