DE1276022B - Verfahren zur Herstellung von Monoperphthalsaeure - Google Patents
Verfahren zur Herstellung von MonoperphthalsaeureInfo
- Publication number
- DE1276022B DE1276022B DEA53095A DEA0053095A DE1276022B DE 1276022 B DE1276022 B DE 1276022B DE A53095 A DEA53095 A DE A53095A DE A0053095 A DEA0053095 A DE A0053095A DE 1276022 B DE1276022 B DE 1276022B
- Authority
- DE
- Germany
- Prior art keywords
- acid
- solvent
- distillation
- phthalic anhydride
- hydrogen peroxide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- GLVYLTSKTCWWJR-UHFFFAOYSA-N 2-carbonoperoxoylbenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1C(O)=O GLVYLTSKTCWWJR-UHFFFAOYSA-N 0.000 title claims description 26
- 238000000034 method Methods 0.000 title claims description 19
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 30
- 239000002904 solvent Substances 0.000 claims description 26
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 claims description 14
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 11
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 8
- 238000004821 distillation Methods 0.000 claims description 8
- 230000020477 pH reduction Effects 0.000 claims description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 7
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 7
- 239000011707 mineral Substances 0.000 claims description 7
- UBOXGVDOUJQMTN-UHFFFAOYSA-N 1,1,2-trichloroethane Chemical compound ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 claims description 6
- 239000008346 aqueous phase Substances 0.000 claims description 6
- 238000005502 peroxidation Methods 0.000 claims description 6
- 239000003513 alkali Substances 0.000 claims description 5
- 239000007864 aqueous solution Substances 0.000 claims description 5
- 229960001701 chloroform Drugs 0.000 claims description 5
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 claims description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 4
- KNKRKFALVUDBJE-UHFFFAOYSA-N 1,2-dichloropropane Chemical compound CC(Cl)CCl KNKRKFALVUDBJE-UHFFFAOYSA-N 0.000 claims description 4
- 229910021529 ammonia Inorganic materials 0.000 claims description 4
- 238000010533 azeotropic distillation Methods 0.000 claims description 4
- 239000011541 reaction mixture Substances 0.000 claims description 4
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 150000001768 cations Chemical class 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- -1 compound Sodium hydroxide Chemical class 0.000 claims description 2
- 238000004064 recycling Methods 0.000 claims description 2
- AJDIZQLSFPQPEY-UHFFFAOYSA-N 1,1,2-Trichlorotrifluoroethane Chemical compound FC(F)(Cl)C(F)(Cl)Cl AJDIZQLSFPQPEY-UHFFFAOYSA-N 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 18
- 239000000843 powder Substances 0.000 description 15
- 150000004965 peroxy acids Chemical class 0.000 description 11
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 150000002978 peroxides Chemical class 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 2
- 238000013459 approach Methods 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000004880 explosion Methods 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- CUCXXSBYLSQIJF-UHFFFAOYSA-N 1,1-dichloroethane;hydrate Chemical compound O.CC(Cl)Cl CUCXXSBYLSQIJF-UHFFFAOYSA-N 0.000 description 1
- 229910052684 Cerium Inorganic materials 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000006735 epoxidation reaction Methods 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 229910001867 inorganic solvent Inorganic materials 0.000 description 1
- 239000003049 inorganic solvent Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 230000007096 poisonous effect Effects 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- ILVXOBCQQYKLDS-UHFFFAOYSA-N pyridine N-oxide Chemical compound [O-][N+]1=CC=CC=C1 ILVXOBCQQYKLDS-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C409/00—Peroxy compounds
- C07C409/24—Peroxy compounds the —O—O— group being bound between a >C=O group and hydrogen, i.e. peroxy acids
- C07C409/30—Peroxy compounds the —O—O— group being bound between a >C=O group and hydrogen, i.e. peroxy acids a >C=O group being bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C407/00—Preparation of peroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C407/00—Preparation of peroxy compounds
- C07C407/003—Separation; Purification; Stabilisation; Use of additives
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR26503A FR1452737A (fr) | 1965-07-29 | 1965-07-29 | Procédé de préparation d'acide monoperphtalique stable |
| FR64761A FR90139E (fr) | 1965-07-29 | 1966-06-09 | Procédé de préparation d'acide monoperphtalique stable |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1276022B true DE1276022B (de) | 1968-08-29 |
Family
ID=26165109
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEA53095A Pending DE1276022B (de) | 1965-07-29 | 1966-07-26 | Verfahren zur Herstellung von Monoperphthalsaeure |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3510512A (Direct) |
| BE (1) | BE684701A (Direct) |
| DE (1) | DE1276022B (Direct) |
| FR (2) | FR1452737A (Direct) |
| GB (1) | GB1121356A (Direct) |
| NL (1) | NL150783B (Direct) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4085133A (en) * | 1976-11-24 | 1978-04-18 | Ppg Industries, Inc. | Preparation of monoperoxyphthalic acid |
| DE3064301D1 (en) * | 1979-10-18 | 1983-08-25 | Interox Chemicals Ltd | Magnesium salts of peroxycarboxylic acids, processes for their preparation and their use as bleaching agents in washing compositions, and processes |
| ATE15771T1 (de) * | 1981-09-08 | 1985-10-15 | Interox Chemicals Ltd | Granulierung. |
| US4590286A (en) * | 1985-10-28 | 1986-05-20 | Fmc Corporation | Process for epoxidizing an olefin |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2284477A (en) * | 1940-02-05 | 1942-05-26 | Du Pont | Preparation of peracids |
| US2273774A (en) * | 1940-10-08 | 1942-02-17 | Du Pont | Manufacture of monoperphthalic acid |
| GB561180A (en) * | 1942-08-19 | 1944-05-09 | Du Pont | Improvements in or relating to the production of organic peracids and salts thereof |
| US2877266A (en) * | 1957-06-04 | 1959-03-10 | Columbia Southern Chem Corp | Preparation of peracids |
| GB891211A (en) * | 1959-08-20 | 1962-03-14 | Degussa | Process for the production of mono-per-carboxylic acids from acid anhydrides and hydrogen peroxide |
| US3247244A (en) * | 1962-05-24 | 1966-04-19 | Fmc Corp | Method for producing organic peroxyacids |
| FR1354160A (fr) * | 1963-01-11 | 1964-03-06 | Air Liquide | Procédé de préparation de mélanges oxydants à base d'acide monoperphtalique |
| FR1371865A (fr) * | 1963-07-08 | 1964-09-11 | Air Liquide | Procédé de fabrication de monoperoxyacides carboxyliques |
-
1965
- 1965-07-29 FR FR26503A patent/FR1452737A/fr not_active Expired
-
1966
- 1966-06-09 FR FR64761A patent/FR90139E/fr not_active Expired
- 1966-07-15 US US565403A patent/US3510512A/en not_active Expired - Lifetime
- 1966-07-26 DE DEA53095A patent/DE1276022B/de active Pending
- 1966-07-27 NL NL666610551A patent/NL150783B/xx not_active IP Right Cessation
- 1966-07-28 BE BE684701D patent/BE684701A/xx unknown
- 1966-07-29 GB GB34299/66A patent/GB1121356A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL150783B (nl) | 1976-09-15 |
| NL6610551A (Direct) | 1967-01-30 |
| FR90139E (fr) | 1967-10-20 |
| FR1452737A (fr) | 1966-04-15 |
| GB1121356A (en) | 1968-07-24 |
| BE684701A (Direct) | 1967-01-30 |
| US3510512A (en) | 1970-05-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1276022B (de) | Verfahren zur Herstellung von Monoperphthalsaeure | |
| DE1270028B (de) | Verfahren zur Herstellung von Peroxypolycarbonsaeuren bzw. ihrer Alkali- oder Ammonuimsalze | |
| EP0013551B1 (de) | Verfahren zur Entfernung von Jod aus einem Gemisch, das bei der oxidativen Acylierung von Olefinen erhalten wurde | |
| CH506469A (de) | Verfahren zur Herstellung von Vinylestern | |
| DE3706792A1 (de) | Verfahren zur herstellung von 7-chlor-chinolin-8-carbonsaeure | |
| DE3345223A1 (de) | Verfahren zur herstellung von chinolinsaeure aus chinolin | |
| DE3782591T2 (de) | Oxidationsverfahren. | |
| DE1064054B (de) | Verfahren zur Herstellung von Sorbinsaeure durch Umsetzung von Keten mit Crotonaldehyd | |
| DE1917032A1 (de) | Verfahren zur Herstellung von Percarbonsaeureloesungen | |
| DE1147934B (de) | Verfahren zur Herstellung von Benzoldicarbonsaeuren | |
| EP0123042B1 (de) | Verfahren zur Herstellung von Quadratsäure | |
| EP0078993A1 (de) | Verfahren zur Herstellung von Benzoylchlorid | |
| DE1917033A1 (de) | Verfahren zur Herstellung von Wasserstoffperoxyd | |
| DE2519301C2 (de) | Verfahren zur Herstellung von Lösungen von Percarbonsäuren in organischen Lösungsmitteln | |
| DE908135C (de) | Verfahren zur Herstellung von mehrwertigen Alkoholen | |
| EP0012214B1 (de) | Verfahren zur Herstellung von 3-Phenoxy-benzylalkoholen | |
| DE2034014C3 (de) | Verfahren zur Herstellung von geradkettigen aliphatischen Carbonsäuren | |
| DE854507C (de) | Verfahren zur Herstellung von Alkyladipinsaeuren | |
| DE3609827A1 (de) | Verfahren zur abtrennung von 2-benzoylbenzoesaeure aus gemischen mit 2-(alkylbenzoyl)-benzoesaeuren | |
| DE1667396C3 (de) | Verfahren zur Abtrennung von Brom aus stickoxidhaltigen Gasgemischen | |
| DE935968C (de) | Verfahren zur Herstellung von Diaceton-2-keto-l-gulonsaeure | |
| DE1102728B (de) | Verfahren zur Herstellung von Allylaethern aliphatischer, araliphatischer und cycloaliphatischer Alkohole | |
| DE1815863A1 (de) | Verfahren zur Reinigung von Aminosulfonsaeure-Kondensationsprodukten | |
| DE1262993B (de) | Verfahren zur Herstellung von Benzoesaeure | |
| DE1246705B (de) | Verfahren zur Herstellung von alpha, beta-aethylenisch ungesaettigten Carbonylverbindungen |