DE1260627B - Natriumdampfentladungslampe - Google Patents
NatriumdampfentladungslampeInfo
- Publication number
- DE1260627B DE1260627B DEN27625A DEN0027625A DE1260627B DE 1260627 B DE1260627 B DE 1260627B DE N27625 A DEN27625 A DE N27625A DE N0027625 A DEN0027625 A DE N0027625A DE 1260627 B DE1260627 B DE 1260627B
- Authority
- DE
- Germany
- Prior art keywords
- layers
- discharge lamp
- layer
- sodium
- vapor discharge
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 title claims description 22
- 229910052708 sodium Inorganic materials 0.000 title claims description 22
- 239000011734 sodium Substances 0.000 title claims description 22
- 239000010410 layer Substances 0.000 claims description 55
- 229910003437 indium oxide Inorganic materials 0.000 claims description 7
- PJXISJQVUVHSOJ-UHFFFAOYSA-N indium(iii) oxide Chemical compound [O-2].[O-2].[O-2].[In+3].[In+3] PJXISJQVUVHSOJ-UHFFFAOYSA-N 0.000 claims description 7
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 3
- 239000011247 coating layer Substances 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 230000005855 radiation Effects 0.000 claims description 3
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 23
- 238000002310 reflectometry Methods 0.000 description 14
- 239000011521 glass Substances 0.000 description 8
- 238000004519 manufacturing process Methods 0.000 description 8
- 230000035699 permeability Effects 0.000 description 8
- 238000007792 addition Methods 0.000 description 7
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 7
- 239000010931 gold Substances 0.000 description 7
- 229910052737 gold Inorganic materials 0.000 description 7
- 239000002800 charge carrier Substances 0.000 description 5
- 229910021617 Indium monochloride Inorganic materials 0.000 description 4
- APHGZSBLRQFRCA-UHFFFAOYSA-M indium(1+);chloride Chemical compound [In]Cl APHGZSBLRQFRCA-UHFFFAOYSA-M 0.000 description 4
- 238000005507 spraying Methods 0.000 description 4
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 3
- 230000004907 flux Effects 0.000 description 3
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 3
- 229910052738 indium Inorganic materials 0.000 description 3
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 3
- 150000002472 indium compounds Chemical class 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 229910006404 SnO 2 Inorganic materials 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 229910044991 metal oxide Inorganic materials 0.000 description 2
- 150000004706 metal oxides Chemical class 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 229910006724 SnOa Inorganic materials 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- OTLGFUHTYPXTTG-UHFFFAOYSA-M indium(3+);oxygen(2-);hydroxide Chemical compound [OH-].[O-2].[In+3] OTLGFUHTYPXTTG-UHFFFAOYSA-M 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 239000003595 mist Substances 0.000 description 1
- 229910052754 neon Inorganic materials 0.000 description 1
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
- 125000004436 sodium atom Chemical group 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 229910001887 tin oxide Inorganic materials 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/30—Vessels; Containers
- H01J61/35—Vessels; Containers provided with coatings on the walls thereof; Selection of materials for the coatings
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
- Surface Treatment Of Glass (AREA)
- Discharge Lamp (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEN27625A DE1260627B (de) | 1965-11-13 | 1965-11-13 | Natriumdampfentladungslampe |
| US592859A US3400288A (en) | 1965-11-13 | 1966-11-08 | Sodium vapor discharge lamp with infrared reflecting coating |
| NL666615717A NL155128B (nl) | 1965-11-13 | 1966-11-08 | Natriumdampontladingslamp. |
| GB50454/66A GB1140613A (en) | 1965-11-13 | 1966-11-10 | Improvements in or relating to sodium vapour discharge lamps |
| CH1623866A CH460948A (de) | 1965-11-13 | 1966-11-10 | Natriumdampfentladungslampe |
| NO165531A NO118500B (enrdf_load_stackoverflow) | 1965-11-13 | 1966-11-10 | |
| AT1039666A AT263938B (de) | 1965-11-13 | 1966-11-10 | Natriumdampfentladungslampe |
| BE689623D BE689623A (enrdf_load_stackoverflow) | 1965-11-13 | 1966-11-10 | |
| DK584266AA DK120348B (da) | 1965-11-13 | 1966-11-10 | Natriumdamplampe. |
| ES0333267A ES333267A1 (es) | 1965-11-13 | 1966-11-11 | Dispositivo de lampara de descarga de vapor de sodio. |
| FR83513A FR1503022A (fr) | 1965-11-13 | 1966-11-14 | Lampe à décharge contenant de la vapeur de sodium |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEN27625A DE1260627B (de) | 1965-11-13 | 1965-11-13 | Natriumdampfentladungslampe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1260627B true DE1260627B (de) | 1968-02-08 |
Family
ID=7344332
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEN27625A Withdrawn DE1260627B (de) | 1965-11-13 | 1965-11-13 | Natriumdampfentladungslampe |
Country Status (11)
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2746413A1 (de) * | 1976-10-29 | 1978-05-03 | Philips Nv | Niederdrucknatriumdampfentladungslampe |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3546520A (en) * | 1967-12-20 | 1970-12-08 | Bell Telephone Labor Inc | Vidicon target comprising infrared absorber |
| US3932783A (en) * | 1969-01-02 | 1976-01-13 | Sylvania Electric Products Inc. | Fluorescent lamp containing indium oxide |
| US3662203A (en) * | 1969-05-20 | 1972-05-09 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | High pressure saturated metal vapor, preferably sodium or metal halide vapor discharge lamp |
| US3662208A (en) * | 1970-01-27 | 1972-05-09 | Tokyo Shibaura Electric Co | Reflector type incandescent lamps |
| US3949259A (en) * | 1973-08-17 | 1976-04-06 | U.S. Philips Corporation | Light-transmitting, thermal-radiation reflecting filter |
| NL7405071A (nl) * | 1974-04-16 | 1975-10-20 | Philips Nv | Gloeilamp met infrarood filter. |
| US3931536A (en) * | 1974-07-15 | 1976-01-06 | Gte Sylvania Incorporated | Efficiency arc discharge lamp |
| NL166818C (nl) * | 1974-11-14 | 1981-09-15 | Philips Nv | Lagedruknatriumdampontladingslamp. |
| US4109175A (en) * | 1976-03-19 | 1978-08-22 | Matsushita Electronics Corporation | High pressure sodium vapor discharge lamp |
| US4140385A (en) * | 1976-03-22 | 1979-02-20 | Xerox Corporation | Low pressure metal or metal halide lamps for photocopying applications |
| JPS5473818A (en) * | 1977-11-24 | 1979-06-13 | Tokyo Denshi Kagaku Kk | Coating solution for forming transparent electric conductive layer and method of coating same |
| US4467238A (en) * | 1981-09-03 | 1984-08-21 | General Electric Company | High-pressure sodium lamp with improved IR reflector |
| US4391743A (en) * | 1981-11-30 | 1983-07-05 | Nippon Soda Company Limited | Composition for depositing metallic oxide film coatings |
| US4490649A (en) * | 1982-10-20 | 1984-12-25 | General Electric Company | Thermal baffle inside a discharge lamp |
| WO1986002775A1 (en) * | 1984-10-23 | 1986-05-09 | Duro-Test Corporation | Variable index film for transparent heat mirrors |
| US4678960A (en) * | 1985-08-01 | 1987-07-07 | General Electric Company | Metallic halide electric discharge lamps |
| DE10204691C1 (de) * | 2002-02-06 | 2003-04-24 | Philips Corp Intellectual Pty | Quecksilberfreie Hochdruckgasentladungslampe und Beleuchtungseinheit mit einer solchen Hochdruckgasentladungslampe |
| US20080048541A1 (en) * | 2004-12-20 | 2008-02-28 | Sumrall Ernest N | Polymer-thermal shield for ultra-violet lamp |
| CN102568978B (zh) * | 2012-01-18 | 2014-08-13 | 山东布莱特辉煌新能源有限公司 | 一种纳米金属氧化物的使用方法 |
| KR20190045154A (ko) * | 2016-06-30 | 2019-05-02 | 예히 오아 라이트 크리에이션 리미티드 | 고효율 조명 시스템 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2564708A (en) * | 1947-09-03 | 1951-08-21 | Corning Glass Works | Heat screen |
| NL269925A (enrdf_load_stackoverflow) * | 1961-10-04 | |||
| US3295002A (en) * | 1963-12-27 | 1966-12-27 | Gen Electric | Light transmitting electrode including nu-type semiconductive in2o3 |
-
1965
- 1965-11-13 DE DEN27625A patent/DE1260627B/de not_active Withdrawn
-
1966
- 1966-11-08 US US592859A patent/US3400288A/en not_active Expired - Lifetime
- 1966-11-08 NL NL666615717A patent/NL155128B/xx not_active IP Right Cessation
- 1966-11-10 GB GB50454/66A patent/GB1140613A/en not_active Expired
- 1966-11-10 DK DK584266AA patent/DK120348B/da unknown
- 1966-11-10 CH CH1623866A patent/CH460948A/de unknown
- 1966-11-10 BE BE689623D patent/BE689623A/xx unknown
- 1966-11-10 AT AT1039666A patent/AT263938B/de active
- 1966-11-10 NO NO165531A patent/NO118500B/no unknown
- 1966-11-11 ES ES0333267A patent/ES333267A1/es not_active Expired
- 1966-11-14 FR FR83513A patent/FR1503022A/fr not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2746413A1 (de) * | 1976-10-29 | 1978-05-03 | Philips Nv | Niederdrucknatriumdampfentladungslampe |
Also Published As
| Publication number | Publication date |
|---|---|
| NL155128B (nl) | 1977-11-15 |
| FR1503022A (fr) | 1967-11-24 |
| GB1140613A (en) | 1969-01-22 |
| BE689623A (enrdf_load_stackoverflow) | 1967-05-10 |
| DK120348B (da) | 1971-05-17 |
| AT263938B (de) | 1968-08-12 |
| ES333267A1 (es) | 1967-07-16 |
| US3400288A (en) | 1968-09-03 |
| NO118500B (enrdf_load_stackoverflow) | 1970-01-05 |
| CH460948A (de) | 1968-08-15 |
| NL6615717A (enrdf_load_stackoverflow) | 1967-05-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1260627B (de) | Natriumdampfentladungslampe | |
| DE69323026T2 (de) | Hochdruckentladungslampe | |
| DE2514494C3 (de) | Gasgefüllte elektrische Glühlampe | |
| DE2431128C2 (de) | Quecksilberdampf-Hochdrucklampe | |
| DE3038993C2 (de) | Metalldampfentladungslampe | |
| DE69731374T2 (de) | Niederdruckentladunglampe | |
| DE1596851A1 (de) | Widerstandsmaterial und aus diesem Widerstandsmaterial hergestellter Widerstand | |
| DE2042577A1 (de) | Hochdruckmetalldampfentladungsrohre | |
| DE2947230A1 (de) | Elektrische lampe | |
| DE2803926B2 (de) | Leitfähige Zusammensetzung auf der Basis von Aluminium und Glas und Verwendung für Leiteranordnungen auf einem Substrat | |
| DE2624781A1 (de) | Elektronenemittierende elektrode | |
| DE2422576C3 (de) | Quecksilberdampflampe | |
| DE3876158T2 (de) | Duennfilm-elektrolumineszenzgeraet. | |
| DE69201183T2 (de) | Röntgenbildverstärkerröhre. | |
| DE1166366B (de) | Natriumdampfentladungslampe | |
| DE1489527B2 (de) | Quecksilberdampfhochdrucklampe | |
| DE3149337A1 (de) | Oxyhalogenidleuchtstoff, damit hergestellter roentgenbildwandler und-schirm und verfahren zum herstellen von oxyhalogenidleuchtstoffkristallen | |
| DE944621C (de) | Anktivierungsmaterial fuer Elektroden von elektrischen Entladungsgefaessen | |
| DE1496590C3 (de) | Verfahren zur Herstellung von warme reflektierenden SnO tief 2 Schichten mit reproduzierbaren optischen und elektrischen Eigenschaften auf Tragern | |
| DE1113407B (de) | Verfahren zur Herstellung eines keramischen, dielektrischen Materials | |
| DE3922865A1 (de) | Quecksilber-niederdruckentladungslampe mit einer festkoerper-rekombinationsstruktur | |
| DE3233966A1 (de) | Entladungslampe hoher intensitaet mit einer einrichtung zum reflektieren von infrarot zur verbesserung der wirksamkeit | |
| DE2711733C2 (de) | Natriumdampf-Hochdruckentladungslampe | |
| DE2100295A1 (de) | Transparenter, Wärme strahlen reflektierender Glasgegenstand und Verfahren zu seiner Herstellung | |
| DE605675C (de) | Elektrodensystem mit unsymmetrischer Leitfaehigkeit |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| E77 | Valid patent as to the heymanns-index 1977 | ||
| 8339 | Ceased/non-payment of the annual fee |