DE1154089B - Verfahren zur Herstellung N-substituierter Imino-halogen-kohlensaeurethioester - Google Patents
Verfahren zur Herstellung N-substituierter Imino-halogen-kohlensaeurethioesterInfo
- Publication number
- DE1154089B DE1154089B DEF32512A DEF0032512A DE1154089B DE 1154089 B DE1154089 B DE 1154089B DE F32512 A DEF32512 A DE F32512A DE F0032512 A DEF0032512 A DE F0032512A DE 1154089 B DE1154089 B DE 1154089B
- Authority
- DE
- Germany
- Prior art keywords
- thionyl chloride
- halo
- carbonic acid
- acid
- preparation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 19
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 30
- -1 mercapto compound Chemical class 0.000 claims description 18
- 239000000460 chlorine Substances 0.000 claims description 10
- DYDNPESBYVVLBO-UHFFFAOYSA-N formanilide Chemical compound O=CNC1=CC=CC=C1 DYDNPESBYVVLBO-UHFFFAOYSA-N 0.000 claims description 5
- RLAROPIDCNCRNR-UHFFFAOYSA-N Cl.Cl.[C-]#N Chemical class Cl.Cl.[C-]#N RLAROPIDCNCRNR-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 150000002527 isonitriles Chemical class 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 4
- 150000003449 sulfenic acid halides Chemical class 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- 238000005684 Liebig rearrangement reaction Methods 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Chemical group 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 4
- RYFZYYUIAZYQLC-UHFFFAOYSA-N perchloromethyl mercaptan Chemical compound ClSC(Cl)(Cl)Cl RYFZYYUIAZYQLC-UHFFFAOYSA-N 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- 239000013078 crystal Substances 0.000 description 3
- 239000008164 mustard oil Substances 0.000 description 3
- 150000007970 thio esters Chemical class 0.000 description 3
- ZFULXOGYCDBCHD-UHFFFAOYSA-N (4-chlorophenyl)-methylidyneazanium Chemical compound ClC1=CC=C([N+]#C)C=C1 ZFULXOGYCDBCHD-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- ATHHXGZTWNVVOU-UHFFFAOYSA-N N-methylformamide Chemical compound CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- PXJJSXABGXMUSU-UHFFFAOYSA-N disulfur dichloride Chemical compound ClSSCl PXJJSXABGXMUSU-UHFFFAOYSA-N 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- 239000000575 pesticide Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- TTWWZVGVBRPHLE-UHFFFAOYSA-N 1,1-dichloro-n-phenylmethanimine Chemical compound ClC(Cl)=NC1=CC=CC=C1 TTWWZVGVBRPHLE-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- WQFPYEBGLBCQOY-UHFFFAOYSA-N 1-isocyano-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C([N+]#[C-])C=C1 WQFPYEBGLBCQOY-UHFFFAOYSA-N 0.000 description 1
- CHBIPFPNKXVVJN-UHFFFAOYSA-N 2,3,4,5,6-pentachlorobenzenethiol;sodium Chemical compound [Na].SC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl CHBIPFPNKXVVJN-UHFFFAOYSA-N 0.000 description 1
- WYZUHZWJNXXODF-UHFFFAOYSA-N Cl[C]=NC1=CC=CC=C1 Chemical compound Cl[C]=NC1=CC=CC=C1 WYZUHZWJNXXODF-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- MCIGNPLOOOVZAG-UHFFFAOYSA-N [Cl].ClS(Cl)=O Chemical compound [Cl].ClS(Cl)=O MCIGNPLOOOVZAG-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- ZOJBYZNEUISWFT-UHFFFAOYSA-N allyl isothiocyanate Chemical compound C=CCN=C=S ZOJBYZNEUISWFT-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical compound NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical compound OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- XYZMOVWWVXBHDP-UHFFFAOYSA-N cyclohexyl isocyanide Chemical compound [C-]#[N+]C1CCCCC1 XYZMOVWWVXBHDP-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 150000001990 dicarboxylic acid derivatives Chemical class 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- ZOOODBUHSVUZEM-UHFFFAOYSA-N ethoxymethanedithioic acid Chemical compound CCOC(S)=S ZOOODBUHSVUZEM-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 150000003948 formamides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- QIUBLANJVAOHHY-UHFFFAOYSA-N hydrogen isocyanide Chemical compound [NH+]#[C-] QIUBLANJVAOHHY-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- ZTCQFVRINYOPOH-UHFFFAOYSA-N n-(4-nitrophenyl)formamide Chemical compound [O-][N+](=O)C1=CC=C(NC=O)C=C1 ZTCQFVRINYOPOH-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- RCIBIGQXGCBBCT-UHFFFAOYSA-N phenyl isocyanide Chemical compound [C-]#[N+]C1=CC=CC=C1 RCIBIGQXGCBBCT-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical compound [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- RVEZZJVBDQCTEF-UHFFFAOYSA-N sulfenic acid Chemical compound SO RVEZZJVBDQCTEF-UHFFFAOYSA-N 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical compound ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000012991 xanthate Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/68—Benzothiazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D277/82—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/68—Benzothiazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D277/70—Sulfur atoms
- C07D277/74—Sulfur atoms substituted by carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL271263D NL271263A (cg-RX-API-DMAC10.html) | 1960-11-10 | ||
| DEF32512A DE1154089B (de) | 1960-11-10 | 1960-11-10 | Verfahren zur Herstellung N-substituierter Imino-halogen-kohlensaeurethioester |
| US150635A US3180890A (en) | 1960-11-10 | 1961-11-07 | Imino-halo compounds and process for their production |
| GB40229/61A GB927835A (en) | 1960-11-10 | 1961-11-09 | Imino-halo-carbonic acid thioesters |
| FR878625A FR1305875A (fr) | 1960-11-10 | 1961-11-10 | Nouveaux esters d'acides iminohalocarboniques et leur procédé de production |
| BE610175A BE610175A (fr) | 1960-11-10 | 1961-11-10 | Nouveaux esters d'acides iminohalocarboniques et leur procédé de production. |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF32512A DE1154089B (de) | 1960-11-10 | 1960-11-10 | Verfahren zur Herstellung N-substituierter Imino-halogen-kohlensaeurethioester |
| DEF32972A DE1157603B (de) | 1961-01-14 | 1961-01-14 | Verfahren zur Herstellung von Rhodanverbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1154089B true DE1154089B (de) | 1963-09-12 |
Family
ID=25974813
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF32512A Pending DE1154089B (de) | 1960-11-10 | 1960-11-10 | Verfahren zur Herstellung N-substituierter Imino-halogen-kohlensaeurethioester |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3180890A (cg-RX-API-DMAC10.html) |
| BE (1) | BE610175A (cg-RX-API-DMAC10.html) |
| DE (1) | DE1154089B (cg-RX-API-DMAC10.html) |
| GB (1) | GB927835A (cg-RX-API-DMAC10.html) |
| NL (1) | NL271263A (cg-RX-API-DMAC10.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4246200A (en) * | 1978-06-08 | 1981-01-20 | Agence Nationale De Valorisation De La Recherche (Anvar) | Perfluoro intermediates and processes for their preparation |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE612252A (cg-RX-API-DMAC10.html) * | 1961-01-05 | |||
| NL301905A (cg-RX-API-DMAC10.html) * | 1962-12-17 | |||
| NL301907A (cg-RX-API-DMAC10.html) * | 1962-12-17 | |||
| US3356726A (en) * | 1964-08-17 | 1967-12-05 | Olin Mathieson | S-(2-chloroethyl) isothiocarbamyl chlorides and process therefor |
| US3468655A (en) * | 1966-01-20 | 1969-09-23 | Rohm & Haas | Method of applying herbicidal imidates |
| CN115266977B (zh) * | 2022-07-25 | 2024-02-27 | 山东普洛汉兴医药有限公司 | 一种测定dl-对氯苯丝氨酸乙酯含量的hplc方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2201156A (en) * | 1939-04-22 | 1940-05-21 | Dow Chemical Co | Ethers |
| US2486090A (en) * | 1946-09-20 | 1949-10-25 | American Cyanamid Co | Preparation of organic thiocyanates |
| FR945947A (fr) * | 1947-02-22 | 1949-05-18 | Fabrication des dérivés et compositions inodores à partir de l'hexachlorocyclohexane technique | |
| US2863920A (en) * | 1956-07-26 | 1958-12-09 | Gen Aniline & Film Corp | Process of preparing hydrobenzamide |
| US2928876A (en) * | 1958-03-12 | 1960-03-15 | Geigy Chem Corp | Condensation products of n-substituted dialkylenetriamines and orthohydroxy aromatic carbonyls |
| DE1163600B (de) * | 1958-11-28 | 1964-02-20 | Diamond Alkali Co | Fungizides und nematozides Pflanzenschutzmittel |
-
0
- NL NL271263D patent/NL271263A/xx unknown
-
1960
- 1960-11-10 DE DEF32512A patent/DE1154089B/de active Pending
-
1961
- 1961-11-07 US US150635A patent/US3180890A/en not_active Expired - Lifetime
- 1961-11-09 GB GB40229/61A patent/GB927835A/en not_active Expired
- 1961-11-10 BE BE610175A patent/BE610175A/fr unknown
Non-Patent Citations (1)
| Title |
|---|
| None * |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4246200A (en) * | 1978-06-08 | 1981-01-20 | Agence Nationale De Valorisation De La Recherche (Anvar) | Perfluoro intermediates and processes for their preparation |
Also Published As
| Publication number | Publication date |
|---|---|
| BE610175A (fr) | 1962-05-10 |
| US3180890A (en) | 1965-04-27 |
| GB927835A (en) | 1963-06-06 |
| NL271263A (cg-RX-API-DMAC10.html) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0863133B1 (de) | Verfahren zur Herstellung von 2-Amino-ethansulfonylazid-säureadditionssalzen, 2-Aminoethansulfonylazid-hydrochlorid sowie dessen Verwendung | |
| DE1154089B (de) | Verfahren zur Herstellung N-substituierter Imino-halogen-kohlensaeurethioester | |
| DE848811C (de) | Verfahren zur Herstellung organischer Chlorthiophosphorsaeureester | |
| DE1187620B (de) | Verfahren zur Herstellung von Carbonsaeurechloriden der Thiazolreihe | |
| EP0044974B1 (de) | Verfahren zur Herstellung von 2-Aryloxy-2-halogenpropionsäureverbindungen | |
| EP0023976B1 (de) | N-Aryl-N'-acryloyl-ureide, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Mikrobizide | |
| EP0043573B1 (de) | Verfahren zur Herstellung von 2,6-Dichlorbenzoxazol bzw. 2,6-Dichlorbenzthiazol | |
| DE860051C (de) | Verfahren zur Herstellung aromatischer o-Cyansulfohalogenide | |
| DE2054342A1 (de) | Neue 1,2,4-Oxdiazole | |
| DE1545842C3 (de) | Verfahren zur Herstellung von N-substituierten 3-Halogen-benzisothiazoliumhalogeniden | |
| EP0013361B1 (de) | Substituierte N-Halogenmethylanilide und Verfahren zu ihrer Herstellung und Verwendung | |
| US3299134A (en) | Process for the preparation of sulphonyl isocyanide dichlorides | |
| DE1768003C3 (de) | Verfahren zur Herstellung von neuartigen Chlorsulfenylphenylisocyaniddichloriden | |
| DE1931054A1 (de) | Verfahren zur Herstellung von N-substituierten-N-Fluorcarbonyl-N-sulfenylhalogeniden | |
| EP0224849A1 (de) | Verfahren zur Herstellung von 4-Mercaptobenzonitrilen und neue 4-Mercaptobenzonitrile | |
| AT372940B (de) | Verfahren zur herstellung von (d)-(-)-phydroxyphenylglycylchlorid-hydrochlorid | |
| DE1445659C (de) | Pyndylphosphorverbindungen und Verfahren zu ihrer Herstellung | |
| EP0055430B1 (de) | N-(Sulfenamido)-acylisocyanate, Verfahren zu ihrer Herstellung und ihre Verwendung als Zwischenprodukte | |
| AT224647B (de) | Verfahren zur Herstellung von neuen Harnstoffdihalogeniden | |
| DE2137649B2 (cg-RX-API-DMAC10.html) | ||
| DE1063155B (de) | Verfahren zur Herstellung von Thiophosphorsaeureestern | |
| DE1668076A1 (de) | Isocyanatocarbonsaeuretrialkylsilylester und ein Verfahren zu ihrer Herstellung | |
| DE1187627B (de) | Verfahren zur Herstellung von N-Trifluormethylarylamin-N-sulfensaeurehalogeniden | |
| EP0156198A2 (de) | Verfahren zur Herstellung von Isocyanaten | |
| DE1005966B (de) | Verfahren zur Herstellung von N-Aryl-ª, ª'-dichlorsuccinimiden |