DE1137211B - Verfahren zur Herstellung von Katalysatoren fuer die Polymerisation von ª-Olefinen - Google Patents
Verfahren zur Herstellung von Katalysatoren fuer die Polymerisation von ª-OlefinenInfo
- Publication number
- DE1137211B DE1137211B DEF24238A DEF0024238A DE1137211B DE 1137211 B DE1137211 B DE 1137211B DE F24238 A DEF24238 A DE F24238A DE F0024238 A DEF0024238 A DE F0024238A DE 1137211 B DE1137211 B DE 1137211B
- Authority
- DE
- Germany
- Prior art keywords
- compounds
- mmol
- heavy metal
- main group
- titanium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000003054 catalyst Substances 0.000 title claims description 23
- 238000000034 method Methods 0.000 title claims description 12
- 230000008569 process Effects 0.000 title claims description 7
- 238000002360 preparation method Methods 0.000 title description 2
- 229910001385 heavy metal Inorganic materials 0.000 claims description 27
- 150000002736 metal compounds Chemical class 0.000 claims description 19
- 238000006116 polymerization reaction Methods 0.000 claims description 17
- 150000002902 organometallic compounds Chemical class 0.000 claims description 14
- 150000001875 compounds Chemical class 0.000 claims description 13
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 12
- 239000005977 Ethylene Substances 0.000 claims description 12
- -1 metal compound Titanium tetrachloride Chemical class 0.000 claims description 11
- 230000000737 periodic effect Effects 0.000 claims description 10
- 230000009467 reduction Effects 0.000 claims description 8
- 239000010936 titanium Substances 0.000 claims description 8
- 229910052751 metal Inorganic materials 0.000 claims description 7
- 239000002184 metal Substances 0.000 claims description 7
- 238000005406 washing Methods 0.000 claims description 7
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 5
- 239000007795 chemical reaction product Substances 0.000 claims description 5
- 229910052719 titanium Inorganic materials 0.000 claims description 5
- 229910052725 zinc Inorganic materials 0.000 claims description 5
- 239000011701 zinc Substances 0.000 claims description 5
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 4
- 239000012442 inert solvent Substances 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 150000002739 metals Chemical class 0.000 claims description 4
- 229910052776 Thorium Inorganic materials 0.000 claims description 3
- 229910052770 Uranium Inorganic materials 0.000 claims description 3
- 229910052804 chromium Inorganic materials 0.000 claims description 3
- 239000011651 chromium Substances 0.000 claims description 3
- 229910052735 hafnium Inorganic materials 0.000 claims description 3
- 229910052750 molybdenum Inorganic materials 0.000 claims description 3
- 229910052758 niobium Inorganic materials 0.000 claims description 3
- 239000010955 niobium Substances 0.000 claims description 3
- 229910052721 tungsten Inorganic materials 0.000 claims description 3
- 229910052720 vanadium Inorganic materials 0.000 claims description 3
- 229910052726 zirconium Inorganic materials 0.000 claims description 3
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 claims description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 2
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 2
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 2
- 230000004913 activation Effects 0.000 claims description 2
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 claims description 2
- 239000011733 molybdenum Substances 0.000 claims description 2
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 2
- 239000010937 tungsten Substances 0.000 claims description 2
- DNYWZCXLKNTFFI-UHFFFAOYSA-N uranium Chemical compound [U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U] DNYWZCXLKNTFFI-UHFFFAOYSA-N 0.000 claims description 2
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 claims description 2
- JBIQAPKSNFTACH-UHFFFAOYSA-K vanadium oxytrichloride Chemical compound Cl[V](Cl)(Cl)=O JBIQAPKSNFTACH-UHFFFAOYSA-K 0.000 claims description 2
- LCKIEQZJEYYRIY-UHFFFAOYSA-N Titanium ion Chemical compound [Ti+4] LCKIEQZJEYYRIY-UHFFFAOYSA-N 0.000 claims 1
- 229910021552 Vanadium(IV) chloride Inorganic materials 0.000 claims 1
- 150000004820 halides Chemical class 0.000 claims 1
- JTJFQBNJBPPZRI-UHFFFAOYSA-J vanadium tetrachloride Chemical compound Cl[V](Cl)(Cl)Cl JTJFQBNJBPPZRI-UHFFFAOYSA-J 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 22
- 238000006243 chemical reaction Methods 0.000 description 21
- 239000002244 precipitate Substances 0.000 description 20
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- 239000002283 diesel fuel Substances 0.000 description 12
- 239000007787 solid Substances 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 239000004698 Polyethylene Substances 0.000 description 8
- 229920000573 polyethylene Polymers 0.000 description 8
- 238000006722 reduction reaction Methods 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 238000009835 boiling Methods 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 229910052782 aluminium Inorganic materials 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 238000001556 precipitation Methods 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- JGHYBJVUQGTEEB-UHFFFAOYSA-M dimethylalumanylium;chloride Chemical compound C[Al](C)Cl JGHYBJVUQGTEEB-UHFFFAOYSA-M 0.000 description 3
- UAIZDWNSWGTKFZ-UHFFFAOYSA-L ethylaluminum(2+);dichloride Chemical compound CC[Al](Cl)Cl UAIZDWNSWGTKFZ-UHFFFAOYSA-L 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 3
- REDSKZBUUUQMSK-UHFFFAOYSA-N tributyltin Chemical compound CCCC[Sn](CCCC)CCCC.CCCC[Sn](CCCC)CCCC REDSKZBUUUQMSK-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 150000001336 alkenes Chemical group 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 238000005119 centrifugation Methods 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 description 2
- UAPQJVJCJITJET-UHFFFAOYSA-N triphenyltin Chemical compound C1=CC=CC=C1[Sn](C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1[Sn](C=1C=CC=CC=1)C1=CC=CC=C1 UAPQJVJCJITJET-UHFFFAOYSA-N 0.000 description 2
- 239000004711 α-olefin Substances 0.000 description 2
- KPZGRMZPZLOPBS-UHFFFAOYSA-N 1,3-dichloro-2,2-bis(chloromethyl)propane Chemical compound ClCC(CCl)(CCl)CCl KPZGRMZPZLOPBS-UHFFFAOYSA-N 0.000 description 1
- CMAOLVNGLTWICC-UHFFFAOYSA-N 2-fluoro-5-methylbenzonitrile Chemical compound CC1=CC=C(F)C(C#N)=C1 CMAOLVNGLTWICC-UHFFFAOYSA-N 0.000 description 1
- MJPVVBCULAOZQN-UHFFFAOYSA-N C(C)[Sn](CC)(CC)[Si](C)(C)[Sn](CC)(CC)CC Chemical compound C(C)[Sn](CC)(CC)[Si](C)(C)[Sn](CC)(CC)CC MJPVVBCULAOZQN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229910008355 Si-Sn Inorganic materials 0.000 description 1
- 229910006453 Si—Sn Inorganic materials 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000012295 chemical reaction liquid Substances 0.000 description 1
- 239000012084 conversion product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- HRLHOWWCFUKTIY-UHFFFAOYSA-L dichloroalumanylium Chemical compound Cl[Al+]Cl HRLHOWWCFUKTIY-UHFFFAOYSA-L 0.000 description 1
- YNLAOSYQHBDIKW-UHFFFAOYSA-M diethylaluminium chloride Chemical compound CC[Al](Cl)CC YNLAOSYQHBDIKW-UHFFFAOYSA-M 0.000 description 1
- DDIMPUQNMJIVKL-UHFFFAOYSA-N dimethyl-bis(trimethylsilyl)silane Chemical compound C[Si](C)(C)[Si](C)(C)[Si](C)(C)C DDIMPUQNMJIVKL-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000004445 quantitative analysis Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 150000003606 tin compounds Chemical class 0.000 description 1
- MZUUBYSIDDKUKE-UHFFFAOYSA-N tributyltin;trimethylsilicon Chemical compound C[Si](C)C.CCCC[Sn](CCCC)CCCC MZUUBYSIDDKUKE-UHFFFAOYSA-N 0.000 description 1
- ZBZJXHCVGLJWFG-UHFFFAOYSA-N trichloromethyl(.) Chemical compound Cl[C](Cl)Cl ZBZJXHCVGLJWFG-UHFFFAOYSA-N 0.000 description 1
- XEJUFRSVJVTIFW-UHFFFAOYSA-N triethyl(triethylsilyl)silane Chemical compound CC[Si](CC)(CC)[Si](CC)(CC)CC XEJUFRSVJVTIFW-UHFFFAOYSA-N 0.000 description 1
- LOAWHQCNQSFKDK-UHFFFAOYSA-N triethyltin Chemical compound CC[Sn](CC)CC.CC[Sn](CC)CC LOAWHQCNQSFKDK-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
Priority Applications (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE572307D BE572307A (enExample) | 1957-10-23 | ||
| DEF24238A DE1137211B (de) | 1957-10-23 | 1957-10-23 | Verfahren zur Herstellung von Katalysatoren fuer die Polymerisation von ª-Olefinen |
| US768572A US3067003A (en) | 1957-10-23 | 1958-10-21 | Process for the manufacture of catalysts suitable to polymerize ethylene and alpha-olefins |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF24238A DE1137211B (de) | 1957-10-23 | 1957-10-23 | Verfahren zur Herstellung von Katalysatoren fuer die Polymerisation von ª-Olefinen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1137211B true DE1137211B (de) | 1962-09-27 |
Family
ID=7091147
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF24238A Pending DE1137211B (de) | 1957-10-23 | 1957-10-23 | Verfahren zur Herstellung von Katalysatoren fuer die Polymerisation von ª-Olefinen |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US3067003A (enExample) |
| BE (1) | BE572307A (enExample) |
| DE (1) | DE1137211B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3347889A (en) * | 1963-07-31 | 1967-10-17 | M & T Chemicals Inc | Hexaorganotritin compounds and the preparation thereof |
| US6197713B1 (en) * | 1997-12-19 | 2001-03-06 | Bridgestone Corporation | Use of Lewis acids for the breakdown of gelatinous rare earth compounds in hydrocarbon solutions |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE543259A (enExample) * | 1954-12-03 | |||
| BE545968A (enExample) * | 1956-03-10 | |||
| BE546474A (enExample) * | 1955-03-29 | |||
| BE543082A (enExample) * | 1954-11-27 | |||
| BE545087A (enExample) * | 1955-02-09 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2899418A (en) * | 1959-08-11 | Polymerization of olefins by mechanical activation process | ||
| US2721189A (en) * | 1954-08-30 | 1955-10-18 | Du Pont | Polymeric bicyclo-(2, 2, 1)-2-heptene |
| US2862917A (en) * | 1955-12-06 | 1958-12-02 | Du Pont | Polymerization of ethylene |
| BE553652A (enExample) * | 1955-12-28 | |||
| US2910461A (en) * | 1956-05-14 | 1959-10-27 | Phillips Petroleum Co | Continuous process for the production of high molecular weight olefin polymers |
| NL217000A (enExample) * | 1956-06-16 | |||
| US2868772A (en) * | 1956-07-17 | 1959-01-13 | Ethyl Corp | Polymerization of olefins |
| US2928815A (en) * | 1956-10-08 | 1960-03-15 | Du Pont | Polymerization catalyst residue removal process |
| US2845414A (en) * | 1956-11-05 | 1958-07-29 | Exxon Research Engineering Co | Olefin polymerization process |
| US2921054A (en) * | 1957-06-25 | 1960-01-12 | Sun Oil Co | Process for polymerizing olefins |
-
0
- BE BE572307D patent/BE572307A/xx unknown
-
1957
- 1957-10-23 DE DEF24238A patent/DE1137211B/de active Pending
-
1958
- 1958-10-21 US US768572A patent/US3067003A/en not_active Expired - Lifetime
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE543082A (enExample) * | 1954-11-27 | |||
| BE543259A (enExample) * | 1954-12-03 | |||
| BE545087A (enExample) * | 1955-02-09 | |||
| BE546474A (enExample) * | 1955-03-29 | |||
| BE545968A (enExample) * | 1956-03-10 |
Also Published As
| Publication number | Publication date |
|---|---|
| US3067003A (en) | 1962-12-04 |
| BE572307A (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2844312C2 (de) | Verfahren zur Herstellung von pulverigen Copolymerisaten aus Äthylen und Propylen oder Buten-1 | |
| DE2626097C2 (enExample) | ||
| DE3213633A1 (de) | Feste olefin-polymerisations- und -copolymerisations-katalysatoren, deren herstellung und mit ihnen durchgefuehrte polymerisationsverfahren | |
| DE1420365A1 (de) | Verfahren zur Herstellung fester kristalliner Polymerisate aus Olefinen | |
| DE2003075A1 (de) | Verfahren zur Herstellung eines Olefinpolymers | |
| DE2500505A1 (de) | Polymerisationskatalysator und verfahren zur polymerisation von alphaolefinen | |
| DE2721263A1 (de) | Verfahren zur herstellung eines zieglerkatalysators | |
| DE2904598C2 (enExample) | ||
| DE2905455A1 (de) | Verfahren zur herstellung von pulverfoermigem isotaktischem polyolefin | |
| DE2901393A1 (de) | Verfahren zur stereospezifischen polymerisation von alpha -olefinen | |
| DE1667108C3 (de) | Verfahren zur Herstellung eines Polymerisationskatalysators | |
| DE2543219A1 (de) | Verfahren zum herstellen einer uebergangsmetall-katalysatorkomponente fuer ziegler-katalysatoren zur polymerisation von olefinen | |
| DE1137211B (de) | Verfahren zur Herstellung von Katalysatoren fuer die Polymerisation von ª-Olefinen | |
| DE2101391A1 (de) | Verfahren zur Herstellung von Athylenpolymerisaten | |
| DE69005122T2 (de) | Olefinpolymerisationskatalysatoren und verfahren zur herstellung eines polyolefins. | |
| DE1645282B2 (de) | Verfahren zum abtrennen eines polymerisats eines 1-olefins mit 4-10 kohlenstoffatomen aus einer loesung | |
| DE1958585C3 (de) | Verfahren zur Herstellung von Äthylenhomopolymerisaten oder -copolymerisaten mit a-Olefinen | |
| DE69209814T2 (de) | Katalysatoren, ihre Herstellung mit ihre Anwendungen für die Ethylenpolymerisation | |
| DE1570196A1 (de) | Verfahren zur Herstellung von festen kristallinen Polymeren durch Polymerisation von alpha-Olefinen | |
| DE2128760A1 (de) | Verfahren zur Polymerisation von Olefinen | |
| DE2709857C2 (enExample) | ||
| DE2433904C3 (de) | Katalysatorsystem für die Polymerisation von Äthylen und dessen Verwendung zur Polymerisation von Äthylen | |
| DE2109396A1 (de) | Katalysatoren und Herstellung von Polymeren unter Verwendung dieser Katalysatoren | |
| DE2350795A1 (de) | Verfahren zur polymerisation von aethylen unter verwendung eines neuen katalysators | |
| DE2037320A1 (de) | Katalysator und Verfahren zu seiner Her stellung |