DE1085595B - Schaltkontaktanordnung fuer Leistungsschalter - Google Patents
Schaltkontaktanordnung fuer LeistungsschalterInfo
- Publication number
- DE1085595B DE1085595B DEM25953A DEM0025953A DE1085595B DE 1085595 B DE1085595 B DE 1085595B DE M25953 A DEM25953 A DE M25953A DE M0025953 A DEM0025953 A DE M0025953A DE 1085595 B DE1085595 B DE 1085595B
- Authority
- DE
- Germany
- Prior art keywords
- contact
- parallel
- conductor
- plane
- conductors
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000004020 conductor Substances 0.000 claims description 46
- 238000000926 separation method Methods 0.000 claims description 5
- 239000011888 foil Substances 0.000 description 4
- 239000002184 metal Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 2
- 230000005520 electrodynamics Effects 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 241000272186 Falco columbarius Species 0.000 description 1
- GJAARPKBDFKHFS-UHFFFAOYSA-N Gerin Natural products COC(=O)C(=C)C1CC2C(=C)C(=O)C=CC2(C)CC1OC(=O)C GJAARPKBDFKHFS-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H1/00—Contacts
- H01H1/50—Means for increasing contact pressure, preventing vibration of contacts, holding contacts together after engagement, or biasing contacts to the open position
- H01H1/54—Means for increasing contact pressure, preventing vibration of contacts, holding contacts together after engagement, or biasing contacts to the open position by magnetic force
Landscapes
- Breakers (AREA)
- Arc-Extinguishing Devices That Are Switches (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR1085595X | 1954-02-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1085595B true DE1085595B (de) | 1960-07-21 |
Family
ID=9612309
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEM25953A Pending DE1085595B (de) | 1954-02-04 | 1955-01-31 | Schaltkontaktanordnung fuer Leistungsschalter |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2821594A (OSRAM) |
| BE (1) | BE534764A (OSRAM) |
| CH (1) | CH325639A (OSRAM) |
| DE (1) | DE1085595B (OSRAM) |
| FR (1) | FR1097288A (OSRAM) |
| NL (1) | NL194469A (OSRAM) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1198909B (de) * | 1962-10-24 | 1965-08-19 | Siemens Ag | Niederspannungsschalter |
| DE4026425C1 (OSRAM) * | 1990-08-21 | 1992-02-27 | Siemens Ag, 8000 Muenchen, De |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2911492A (en) * | 1957-02-25 | 1959-11-03 | Gen Electric | Operating mechanism for a fluid blast circuit breaker |
| FR1225685A (fr) * | 1958-12-23 | 1960-07-04 | Merlin Gerin | Perfectionnements aux contacts à pression compensés électrodynamiquement |
| US3115560A (en) * | 1959-03-31 | 1963-12-24 | John C Davis | Electromagnetic contact device |
| FR1285301A (fr) * | 1960-12-20 | 1962-02-23 | Merlin Gerin | Dispositif de contacts électriques pour disjoncteurs |
| US3249729A (en) * | 1963-10-18 | 1966-05-03 | Gen Electric | Electric circuit breaker wherein the operation of separable arcing contacts is dependent on the magnitude of current in the main contacts |
| US3593227A (en) * | 1968-02-28 | 1971-07-13 | Gennady Fedosievich Mitskevich | Automatic electrodynamic blowoff breaker with stationary contact form of two series wound u-shaped members |
| GB1312156A (en) * | 1970-10-29 | 1973-04-04 | Dorman Smith Switchgear Ltd | Electrical circuit breakers and isolators |
| US4032870A (en) * | 1975-09-15 | 1977-06-28 | General Electric Company | Electric circuit breaker with electromagnetic-assist means for opposing magnetic contact-separating forces |
| US4255636A (en) * | 1976-12-30 | 1981-03-10 | Westinghouse Electric Corp. | Circuit breaker with current carrying conductor system utilizing eddy current repulsion |
| US4240053A (en) * | 1976-12-30 | 1980-12-16 | Westinghouse Electric Corp. | Circuit breaker utilizing improved current carrying conductor system |
| US4320820A (en) * | 1980-07-28 | 1982-03-23 | Harvey Hubbell Incorporated | Section insulator with improved arc control |
| US4454395A (en) * | 1981-02-27 | 1984-06-12 | Mitsubishi Denki Kabushiki Kaisha | Circuit breaker |
| DE3337515A1 (de) * | 1983-10-14 | 1985-05-02 | Siemens AG, 1000 Berlin und 8000 München | Schaltstueck fuer elektrische schaltgeraete |
| FR2569304B1 (fr) * | 1984-08-15 | 1990-12-28 | Mitsubishi Electric Corp | Interrupteur de circuit |
| US4849590A (en) * | 1988-04-01 | 1989-07-18 | Kohler Company | Electric switch with counteracting electro-electro-dynamic forces |
| US4804933A (en) * | 1988-04-01 | 1989-02-14 | Brown Industrial Gas, Inc. | Automatic transfer switch |
| US5072203A (en) * | 1989-09-18 | 1991-12-10 | Allen-Bradley Company, Inc. | Method and device for protecting starters from fault currents |
| US4991050A (en) * | 1989-09-18 | 1991-02-05 | Allen-Bradley Company, Inc. | Method and device for protecting starters from fault currents |
| US5093988A (en) * | 1991-01-24 | 1992-03-10 | Kohler Co. | Method for attaching a flexible connector |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH106324A (de) * | 1922-11-06 | 1924-08-16 | Bbc Brown Boveri & Cie | Schalter für grosse Momentan-Stromstärken. |
| FR692268A (fr) * | 1929-06-18 | 1930-11-04 | Siemens Ag | Dispositif conjoncteur-disjoncteur |
| DE587047C (de) * | 1930-03-28 | 1933-10-28 | Const Electr De Delle Sa Atel | Trennschalter mit Stromschleifen an den Enden des Messers |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1762604A (en) * | 1927-12-27 | 1930-06-10 | Condit Electrical Mfg Corp | Electric switch and contact structure therefor |
| DE508684C (de) * | 1928-06-19 | 1930-10-01 | Siemens Schuckertwerke Akt Ges | Schalterkontakt, bestehend aus zwei oder mehr parallel geschalteten Einzelkontakten |
| DE560368C (de) * | 1928-09-21 | 1932-10-01 | Const Electr De Delle Sa Atel | Schalter in Schleifenform mit zwei Paaren von Hauptkontakten und nebengeschalteten Funkenziehkontakten |
| US1854990A (en) * | 1929-07-01 | 1932-04-19 | Gen Electric | Electric switch |
| USRE18257E (en) * | 1929-09-20 | 1931-11-24 | Dscult interrupting device |
-
0
- BE BE534764D patent/BE534764A/xx unknown
- NL NL194469D patent/NL194469A/xx unknown
-
1954
- 1954-02-04 FR FR1097288D patent/FR1097288A/fr not_active Expired
-
1955
- 1955-01-10 US US480952A patent/US2821594A/en not_active Expired - Lifetime
- 1955-01-11 CH CH325639D patent/CH325639A/fr unknown
- 1955-01-31 DE DEM25953A patent/DE1085595B/de active Pending
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH106324A (de) * | 1922-11-06 | 1924-08-16 | Bbc Brown Boveri & Cie | Schalter für grosse Momentan-Stromstärken. |
| FR692268A (fr) * | 1929-06-18 | 1930-11-04 | Siemens Ag | Dispositif conjoncteur-disjoncteur |
| DE587047C (de) * | 1930-03-28 | 1933-10-28 | Const Electr De Delle Sa Atel | Trennschalter mit Stromschleifen an den Enden des Messers |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1198909B (de) * | 1962-10-24 | 1965-08-19 | Siemens Ag | Niederspannungsschalter |
| DE4026425C1 (OSRAM) * | 1990-08-21 | 1992-02-27 | Siemens Ag, 8000 Muenchen, De |
Also Published As
| Publication number | Publication date |
|---|---|
| US2821594A (en) | 1958-01-28 |
| CH325639A (fr) | 1957-11-15 |
| FR1097288A (fr) | 1955-07-04 |
| NL194469A (OSRAM) | |
| BE534764A (OSRAM) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1085595B (de) | Schaltkontaktanordnung fuer Leistungsschalter | |
| DE69304374T2 (de) | Schutzschalter mit Pressformgehäuse mit Verzögerung am Bewegungsende der Kontaktbrückenabstossung | |
| DE4337344B4 (de) | Strombegrenzendes Kontaktsystem für Leistungsschalter | |
| DE3302884C2 (OSRAM) | ||
| DE102019103298A1 (de) | Relais | |
| DE3517659C2 (de) | Leistungsschalter | |
| DE1563842C3 (de) | Selbstschalter | |
| DE1143567B (de) | Leistungsschalter mit einem beweglichen und einem ortsfesten Kontaktstueck | |
| DE1262404B (de) | Elektrischer Leistungsschalter | |
| EP0606264A1 (de) | Vakuumschalter mit einer antriebsvorrichtung und einer polantriebseinheit. | |
| DE69316265T2 (de) | Erdungsschalter mit senkrechter Kontaktöffnung | |
| DE1258957B (de) | Kontaktbrueckenanordnung fuer ein Wechselkontaktrelais | |
| DE2708841A1 (de) | Anschlussklemme fuer isolierte elektrische leiter | |
| DE591600C (de) | Elektrischer Fluessigkeitsschalter | |
| DE3413555A1 (de) | Loescheinrichtung fuer elektrische schalter | |
| DE102008049789A1 (de) | Kontaktvorrichtung mit unterschiedlichen Kontaktkräften in unterschiedlichen Betriebszuständen | |
| DE69932493T2 (de) | Elektrisches Schaltgerät mit einem geschlitzten Kontakt | |
| DE60110595T2 (de) | Schalter mit vor- und hauptkontakten | |
| DE947812C (de) | Schalteinrichtung zur Beeinflussung elektrischer Stromkreise, insbesondere Starkstromkreise, mit durch ein Magnetfeld betaetigtem Schaltelement | |
| EP1423862B1 (de) | Schaltkontaktanordnung mit einer einrichtung zur verstärkung einer zwischen schaltkontakten wirkenden kontaktkraft | |
| EP0177437B1 (de) | Kontaktanordnung für einen Leistungsschalter mit stromabhängiger Öffnung | |
| DE515094C (de) | Elektrischer Stromunterbrecher, bei dem elektromotorische Kraefte eine Verlaengerungdes Lichtbogens herbeifuehren | |
| DE10048659A1 (de) | Schaltkontaktanordnung eines Niederspannungs-Leistungsschalter mit Kontaktkraftfedern | |
| DE1042120B (de) | Relais mit zwangsweiser Fuehrung der beweglichen Kontaktfedern und gemeinsamer Abstuetzung der Kontaktgegenfedern | |
| DE1044219B (de) | Elektrischer Schalter, insbesondere fuer hohe Spannungen mit im Einschaltzustand flach aufeinander liegenden klotzfoermigen Kontaktstuecken |