DE1072285B - - Google Patents
Info
- Publication number
- DE1072285B DE1072285B DENDAT1072285D DE1072285DA DE1072285B DE 1072285 B DE1072285 B DE 1072285B DE NDAT1072285 D DENDAT1072285 D DE NDAT1072285D DE 1072285D A DE1072285D A DE 1072285DA DE 1072285 B DE1072285 B DE 1072285B
- Authority
- DE
- Germany
- Prior art keywords
- particles
- embedding
- housing
- thermal conductivity
- silicone resin
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000002245 particle Substances 0.000 claims description 26
- 239000000463 material Substances 0.000 claims description 15
- 229920002050 silicone resin Polymers 0.000 claims description 10
- PNEYBMLMFCGWSK-UHFFFAOYSA-N AI2O3 Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 9
- SFZCNBIFKDRMGX-UHFFFAOYSA-N Sulfur hexafluoride Chemical compound FS(F)(F)(F)(F)F SFZCNBIFKDRMGX-UHFFFAOYSA-N 0.000 claims description 3
- 229960000909 sulfur hexafluoride Drugs 0.000 claims description 3
- 229910018072 Al 2 O 3 Inorganic materials 0.000 claims description 2
- 229920005989 resin Polymers 0.000 description 8
- 239000011347 resin Substances 0.000 description 8
- 239000011248 coating agent Substances 0.000 description 7
- 238000000576 coating method Methods 0.000 description 7
- 229920001296 polysiloxane Polymers 0.000 description 6
- 238000005266 casting Methods 0.000 description 4
- 239000004927 clay Substances 0.000 description 4
- 229910052570 clay Inorganic materials 0.000 description 4
- 239000000945 filler Substances 0.000 description 3
- 238000009413 insulation Methods 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- GYZLOYUZLJXAJU-UHFFFAOYSA-N Diglycidyl ether Chemical class C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M Potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003822 epoxy resin Substances 0.000 description 2
- 230000017525 heat dissipation Effects 0.000 description 2
- 230000001771 impaired Effects 0.000 description 2
- 230000001788 irregular Effects 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 229920000647 polyepoxide Polymers 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 238000007789 sealing Methods 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 235000002639 sodium chloride Nutrition 0.000 description 2
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 1
- PZZYQPZGQPZBDN-UHFFFAOYSA-N Aluminium silicate Chemical compound O=[Al]O[Si](=O)O[Al]=O PZZYQPZGQPZBDN-UHFFFAOYSA-N 0.000 description 1
- WUKWITHWXAAZEY-UHFFFAOYSA-L Calcium fluoride Chemical compound [F-].[F-].[Ca+2] WUKWITHWXAAZEY-UHFFFAOYSA-L 0.000 description 1
- 230000037250 Clearance Effects 0.000 description 1
- 210000003608 Feces Anatomy 0.000 description 1
- 239000006004 Quartz sand Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000010426 asphalt Substances 0.000 description 1
- 229910001634 calcium fluoride Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000035512 clearance Effects 0.000 description 1
- 238000005056 compaction Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000000875 corresponding Effects 0.000 description 1
- 230000001419 dependent Effects 0.000 description 1
- 230000003467 diminishing Effects 0.000 description 1
- PVAONLSZTBKFKM-UHFFFAOYSA-N diphenylmethanediol Chemical compound C=1C=CC=CC=1C(O)(O)C1=CC=CC=C1 PVAONLSZTBKFKM-UHFFFAOYSA-N 0.000 description 1
- 238000005538 encapsulation Methods 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 231100000989 no adverse effect Toxicity 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N o-xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 229910052904 quartz Inorganic materials 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 230000000717 retained Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000011775 sodium fluoride Substances 0.000 description 1
- 235000013024 sodium fluoride Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01F—MAGNETS; INDUCTANCES; TRANSFORMERS; SELECTION OF MATERIALS FOR THEIR MAGNETIC PROPERTIES
- H01F27/00—Details of transformers or inductances, in general
- H01F27/02—Casings
- H01F27/022—Encapsulation
Landscapes
- Engineering & Computer Science (AREA)
- Power Engineering (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Insulating Of Coils (AREA)
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1072285B true DE1072285B (fr) | 1959-12-31 |
Family
ID=596789
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT1072285D Pending DE1072285B (fr) |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE1072285B (fr) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2103928A1 (de) * | 1970-01-29 | 1971-08-05 | Gen Electric | Dynamoelektrische Maschine und Ver fahren zur Herstellung |
| DE3106285A1 (de) * | 1980-02-25 | 1981-12-17 | General Electric Co., Schenectady, N.Y. | Elektrooptische vorrichtung |
| DE3912874A1 (de) * | 1988-04-22 | 1989-11-09 | France Transfo Sa | Trockentransformator mit ummantelten wicklungen, leiter sowie analoge elektrische installationen und verfahren zur herstellung des harzes fuer die ummantelung |
| DE3843807A1 (de) * | 1988-12-24 | 1990-07-12 | Lahmeyer Ag Fuer Energiewirtsc | Selbstgekuehlter hochspannungstransformator |
| DE102007006160A1 (de) * | 2007-02-07 | 2008-08-14 | Siemens Ag | Elektrische Spule |
-
0
- DE DENDAT1072285D patent/DE1072285B/de active Pending
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2103928A1 (de) * | 1970-01-29 | 1971-08-05 | Gen Electric | Dynamoelektrische Maschine und Ver fahren zur Herstellung |
| DE3106285A1 (de) * | 1980-02-25 | 1981-12-17 | General Electric Co., Schenectady, N.Y. | Elektrooptische vorrichtung |
| DE3912874A1 (de) * | 1988-04-22 | 1989-11-09 | France Transfo Sa | Trockentransformator mit ummantelten wicklungen, leiter sowie analoge elektrische installationen und verfahren zur herstellung des harzes fuer die ummantelung |
| DE3843807A1 (de) * | 1988-12-24 | 1990-07-12 | Lahmeyer Ag Fuer Energiewirtsc | Selbstgekuehlter hochspannungstransformator |
| DE102007006160A1 (de) * | 2007-02-07 | 2008-08-14 | Siemens Ag | Elektrische Spule |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2347049C2 (de) | Verfahren zum Einkapseln von miniaturisierten Schaltungen, insbesondere Hybridschaltungen | |
| GB1493322A (en) | Intermediate layer for encapsulated electrical devices | |
| DE1072285B (fr) | ||
| DE1943978U (de) | Kunststoffdurchfuehrung fuer elektrische geraete. | |
| EP3381051A1 (fr) | Dispositif électrique comprenant une matière d'enrobage | |
| DE2003772A1 (de) | Stuetzanordnung zur Befestigung eines Isolierkoerpers | |
| DE102015223439A1 (de) | Verfahren zur Herstellung einer elektrischen Vorrichtung mit einer Umhüllmasse | |
| DE2445659C2 (de) | Metalloxid-Varistor | |
| US2253360A (en) | Coated lighting-arrester block | |
| DE594815C (de) | Elektrischer Isolierstoff | |
| DE902029C (de) | Verfahren zur Verfestigung von Verdrahtungen | |
| DE102015223467A1 (de) | Elektrische Vorrichtung mit einer Umhüllmasse | |
| US798260A (en) | Method of insulating electrical conductors. | |
| CH338522A (de) | Gekapseltes elektrisches Gerät | |
| EP3642581A1 (fr) | Thermomètre présentant un temps de réponse amélioré | |
| DE1172329B (de) | Mit einer elastischen, organischen Isolierstoffeinbettung versehenes elektrisches Geraet | |
| DE968124C (de) | Verfahren zum Einbau von elektrischen Bauelementen, z.B. Kondensatoren, in ein Metallgehaeuse | |
| DE1569317C2 (de) | Verwendung einer Füllmasse für Transistorgehäuse | |
| DE1540902C2 (de) | Verfahren zum Schutz der Isolierenden Füllmassen für Mantelrohrheizstäbe gegen Feuchtigkeitsaufnahme | |
| AT326790B (de) | Verfahren zur herstellung elektrothermischer, wärmeerzeugender strukturen | |
| DE2220831A1 (de) | Nichtentflammbare UEberzugsmasse fuer elektronische Teile | |
| DE843863C (de) | Elektrischer Schichtwiderstand | |
| US1423985A (en) | Cementing and protecting composition | |
| DE2030185C2 (de) | Verfahren zur Herstellung einer für Röntgenstrahlen empfindlichen Widerstandszelle | |
| DE1540408C3 (de) | Verfahren zur Ummantelung eines Halbleitergleichrichters |