DE1058554B - Bistabiler Multivibrator - Google Patents
Bistabiler MultivibratorInfo
- Publication number
- DE1058554B DE1058554B DEW19392A DEW0019392A DE1058554B DE 1058554 B DE1058554 B DE 1058554B DE W19392 A DEW19392 A DE W19392A DE W0019392 A DEW0019392 A DE W0019392A DE 1058554 B DE1058554 B DE 1058554B
- Authority
- DE
- Germany
- Prior art keywords
- transistor
- base
- diode
- current
- transistors
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000004065 semiconductor Substances 0.000 claims description 28
- 230000000903 blocking effect Effects 0.000 claims description 26
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 17
- 229910052710 silicon Inorganic materials 0.000 claims description 17
- 239000010703 silicon Substances 0.000 claims description 17
- 230000008878 coupling Effects 0.000 claims description 10
- 238000010168 coupling process Methods 0.000 claims description 10
- 238000005859 coupling reaction Methods 0.000 claims description 10
- 230000003068 static effect Effects 0.000 claims description 10
- 230000000694 effects Effects 0.000 claims description 8
- 230000007704 transition Effects 0.000 claims description 8
- 230000008859 change Effects 0.000 claims description 4
- 239000002800 charge carrier Substances 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 3
- 230000008901 benefit Effects 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 230000035945 sensitivity Effects 0.000 claims description 2
- 238000000034 method Methods 0.000 claims 1
- 230000008569 process Effects 0.000 claims 1
- 238000011084 recovery Methods 0.000 claims 1
- 238000005513 bias potential Methods 0.000 description 5
- 239000004020 conductor Substances 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- BIIBYWQGRFWQKM-JVVROLKMSA-N (2S)-N-[4-(cyclopropylamino)-3,4-dioxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]-4,4-dimethylpentanamide Chemical compound CC(C)(C)C[C@@H](C(NC(C[C@H](CCN1)C1=O)C(C(NC1CC1)=O)=O)=O)NC(/C=C/C(C=CC(Cl)=C1)=C1Cl)=O BIIBYWQGRFWQKM-JVVROLKMSA-N 0.000 description 1
- 239000003990 capacitor Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K3/00—Circuits for generating electric pulses; Monostable, bistable or multistable circuits
- H03K3/02—Generators characterised by the type of circuit or by the means used for producing pulses
- H03K3/33—Generators characterised by the type of circuit or by the means used for producing pulses by the use, as active elements, of semiconductor devices exhibiting hole storage or enhancement effect
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K3/00—Circuits for generating electric pulses; Monostable, bistable or multistable circuits
- H03K3/01—Details
- H03K3/012—Modifications of generator to improve response time or to decrease power consumption
Landscapes
- Bipolar Integrated Circuits (AREA)
- Bipolar Transistors (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US532919A US2831986A (en) | 1955-09-07 | 1955-09-07 | Semiconductor trigger circuit |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1058554B true DE1058554B (de) | 1959-06-04 |
Family
ID=24123742
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEW19392A Pending DE1058554B (de) | 1955-09-07 | 1956-07-10 | Bistabiler Multivibrator |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2831986A (enExample) |
| BE (1) | BE549921A (enExample) |
| DE (1) | DE1058554B (enExample) |
| FR (1) | FR1149528A (enExample) |
| GB (1) | GB799560A (enExample) |
| NL (2) | NL112664C (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3098158A (en) * | 1955-06-06 | 1963-07-16 | Thompson Ramo Wooldridge Inc | Multivibrator circuits employing voltage break-down devices |
| NL202652A (enExample) * | 1955-12-07 | |||
| US2946898A (en) * | 1956-06-13 | 1960-07-26 | Monroe Calculating Machine | Bistable transistor circuit |
| US2981850A (en) * | 1956-08-08 | 1961-04-25 | North American Aviation Inc | Transistor pulse response circuit |
| US3100266A (en) * | 1957-02-11 | 1963-08-06 | Superior Electric Co | Transistor discriminating circuit with diode bypass means for the emitterbase circuit of each transistor |
| US3067336A (en) * | 1957-05-03 | 1962-12-04 | Honeywell Regulator Co | Bistable electronic switching circuitry for manipulating digital data |
| US2956272A (en) * | 1957-09-12 | 1960-10-11 | Sylvania Electric Prod | Digital to analog converter |
| US2990519A (en) * | 1957-11-04 | 1961-06-27 | Honeywell Regulator Co | Transistor oscillator |
| US2994784A (en) * | 1957-12-04 | 1961-08-01 | Westinghouse Electric Corp | Bistable control apparatus |
| US2913599A (en) * | 1958-01-27 | 1959-11-17 | Boeing Co | Bi-stable flip-flops |
| US3106644A (en) * | 1958-02-27 | 1963-10-08 | Litton Systems Inc | Logic circuits employing minority carrier storage diodes for adding booster charge to prevent input loading |
| US3054910A (en) * | 1959-05-27 | 1962-09-18 | Epsco Inc | Voltage comparator indicating two input signals equal employing constant current source and bistable trigger |
| US3100848A (en) * | 1959-06-25 | 1963-08-13 | Ibm | High speed multivibrator having cross coupling circuitry |
| US3271595A (en) * | 1963-05-14 | 1966-09-06 | Northern Electric Co | Switching circuit |
| DE1919540C3 (de) * | 1969-04-17 | 1975-07-31 | Deutsche Itt Industries Gmbh, 7800 Freiburg | Bistabile Kippschaltung |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1077707A (fr) * | 1952-07-22 | 1954-11-10 | Western Electric Co | Circuits bistables contenant des transistors |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2569345A (en) * | 1950-03-28 | 1951-09-25 | Gen Electric | Transistor multivibrator circuit |
| US2724780A (en) * | 1951-10-31 | 1955-11-22 | Bell Telephone Labor Inc | Inhibited trigger circuits |
-
0
- NL NL209116D patent/NL209116A/xx unknown
- NL NL112664D patent/NL112664C/xx active
- BE BE549921D patent/BE549921A/xx unknown
-
1955
- 1955-09-07 US US532919A patent/US2831986A/en not_active Expired - Lifetime
-
1956
- 1956-04-13 FR FR1149528D patent/FR1149528A/fr not_active Expired
- 1956-07-10 DE DEW19392A patent/DE1058554B/de active Pending
- 1956-08-31 GB GB26684/56A patent/GB799560A/en not_active Expired
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1077707A (fr) * | 1952-07-22 | 1954-11-10 | Western Electric Co | Circuits bistables contenant des transistors |
Also Published As
| Publication number | Publication date |
|---|---|
| US2831986A (en) | 1958-04-22 |
| BE549921A (enExample) | |
| NL112664C (enExample) | |
| FR1149528A (fr) | 1957-12-27 |
| NL209116A (enExample) | |
| GB799560A (en) | 1958-08-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1058554B (de) | Bistabiler Multivibrator | |
| DE2119764A1 (de) | Schaltungsanordnung zur Erzeugung einer Bezugsspannung und Feststellen eines Spannungspegels | |
| DE2323478A1 (de) | Datenuebertragungsanordnung | |
| DE1762172B2 (de) | Verknuepfungsschaltung mit stromuebernahmeschaltern | |
| DE2302137B2 (de) | Leseschaltung zum zerstörungsfreien Auslesen dynamischer Ladungs-Speicherzellen | |
| DE1035776B (de) | Transistor mit einem flachen Halbleiterkoerper und mehreren sperrfreien und sperrenden Elektroden | |
| DE1080605B (de) | Bistabiler Schaltkreis mit Transistoren und einer Stromzwangsschaltsteuerung | |
| DE1035942B (de) | Koinzidenz-Schaltkreise mit Transistoren | |
| DE2509732B2 (de) | Schaltungsanordnung zur Korrelation zweier Gruppen paralleler Binärsignale | |
| DE1153415B (de) | Bistabile Kippstufe mit Vorspannschaltung | |
| DE3135723C2 (de) | Integrierte Halbleiterschaltung | |
| DE1131269B (de) | Bistabile Kippschaltung | |
| DE1020672B (de) | Schaltung zum Ein- und Ausschalten des Stromes durch eine induktive Impedanz | |
| DE1199525B (de) | Addierschaltung | |
| DE2742361C2 (enExample) | ||
| DE1135038B (de) | Bistabile Kippanordnung mit Tunneldioden und Schalttransistoren | |
| DE1029872B (de) | Fremdgesteuerte Transistorkippschaltung mit kurzer Abfallzeit | |
| DE3437371C2 (enExample) | ||
| DE1039564B (de) | Bistabile Transistor-Schaltung mit Transistoren, welche die Eigenschaften gittergesteuerter Gasentladungsroehren aufweisen | |
| DE2004229A1 (de) | Impulsgenerator | |
| DE1058553B (de) | Bistabiler Transistor-Steuerkreis | |
| DE2626928A1 (de) | Logisch gesteuerte verriegelungsschaltung | |
| DE1180972B (de) | Logische UND-Schaltungsanordnung | |
| DE1292188B (de) | Schaltungsanordnung mit einem von Impulsen gesteuerten Transistorschaltkreis | |
| AT201113B (de) | Transistor |