DE1052452B - Elektronische Schaltkreisanordnung - Google Patents
Elektronische SchaltkreisanordnungInfo
- Publication number
- DE1052452B DE1052452B DEG22518A DEG0022518A DE1052452B DE 1052452 B DE1052452 B DE 1052452B DE G22518 A DEG22518 A DE G22518A DE G0022518 A DEG0022518 A DE G0022518A DE 1052452 B DE1052452 B DE 1052452B
- Authority
- DE
- Germany
- Prior art keywords
- electro
- circuit
- voltage
- optical
- photoconductive
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000006073 displacement reaction Methods 0.000 claims description 65
- 230000001105 regulatory effect Effects 0.000 claims description 49
- 230000005855 radiation Effects 0.000 claims description 15
- 230000003287 optical effect Effects 0.000 claims description 5
- 239000000126 substance Substances 0.000 description 12
- 239000011521 glass Substances 0.000 description 7
- 239000013078 crystal Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000004020 luminiscence type Methods 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 3
- 230000005684 electric field Effects 0.000 description 3
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 2
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 2
- 230000003292 diminished effect Effects 0.000 description 2
- 235000011150 stannous chloride Nutrition 0.000 description 2
- 239000001119 stannous chloride Substances 0.000 description 2
- 230000001360 synchronised effect Effects 0.000 description 2
- WUPHOULIZUERAE-UHFFFAOYSA-N 3-(oxolan-2-yl)propanoic acid Chemical compound OC(=O)CCC1CCCO1 WUPHOULIZUERAE-UHFFFAOYSA-N 0.000 description 1
- 108700028369 Alleles Proteins 0.000 description 1
- 239000005083 Zinc sulfide Substances 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000000712 assembly Effects 0.000 description 1
- 238000000429 assembly Methods 0.000 description 1
- 230000002238 attenuated effect Effects 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 229910052980 cadmium sulfide Inorganic materials 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 230000031700 light absorption Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000013011 mating Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 230000001172 regenerating effect Effects 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 229910052984 zinc sulfide Inorganic materials 0.000 description 1
- UQMZPFKLYHOJDL-UHFFFAOYSA-N zinc;cadmium(2+);disulfide Chemical compound [S-2].[S-2].[Zn+2].[Cd+2] UQMZPFKLYHOJDL-UHFFFAOYSA-N 0.000 description 1
- DRDVZXDWVBGGMH-UHFFFAOYSA-N zinc;sulfide Chemical compound [S-2].[Zn+2] DRDVZXDWVBGGMH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K3/00—Circuits for generating electric pulses; Monostable, bistable or multistable circuits
- H03K3/02—Generators characterised by the type of circuit or by the means used for producing pulses
- H03K3/42—Generators characterised by the type of circuit or by the means used for producing pulses by the use, as active elements, of opto-electronic devices, i.e. light-emitting and photoelectric devices electrically- or optically-coupled
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11C—STATIC STORES
- G11C19/00—Digital stores in which the information is moved stepwise, e.g. shift registers
- G11C19/30—Digital stores in which the information is moved stepwise, e.g. shift registers using opto-electronic devices, i.e. light-emitting and photoelectric devices electrically- or optically-coupled
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K17/00—Electronic switching or gating, i.e. not by contact-making and –breaking
- H03K17/51—Electronic switching or gating, i.e. not by contact-making and –breaking characterised by the components used
- H03K17/78—Electronic switching or gating, i.e. not by contact-making and –breaking characterised by the components used using opto-electronic devices, i.e. light-emitting and photoelectric devices electrically- or optically-coupled
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K21/00—Details of pulse counters or frequency dividers
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K23/00—Pulse counters comprising counting chains; Frequency dividers comprising counting chains
- H03K23/78—Pulse counters comprising counting chains; Frequency dividers comprising counting chains using opto-electronic devices
Landscapes
- Control Of Indicators Other Than Cathode Ray Tubes (AREA)
- Devices For Indicating Variable Information By Combining Individual Elements (AREA)
- Electronic Switches (AREA)
- Electroluminescent Light Sources (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB21620/56A GB810506A (en) | 1956-07-12 | 1956-07-12 | Improvements in or relating to electrical switching circuits |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1052452B true DE1052452B (de) | 1959-03-12 |
Family
ID=10165996
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEG22518A Pending DE1052452B (de) | 1956-07-12 | 1957-07-11 | Elektronische Schaltkreisanordnung |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2949538A (enExample) |
| BE (1) | BE559126A (enExample) |
| DE (1) | DE1052452B (enExample) |
| ES (1) | ES236458A1 (enExample) |
| FR (1) | FR1178757A (enExample) |
| GB (1) | GB810506A (enExample) |
| NL (1) | NL218853A (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1079113B (de) * | 1957-07-09 | 1960-04-07 | Westinghouse Electric Corp | Gatter zur Verarbeitung von als Strahlung vorliegenden Eingangssignalen nach vorgeschriebenen logischen Funktionen |
| DE1123706B (de) * | 1959-07-24 | 1962-02-15 | Philips Nv | Schalter, bestehend aus einer bistabilen Kippstufe mit einem photoleitenden Element |
| DE1299706B (de) * | 1962-07-26 | 1969-07-24 | Friedrich Kurt | Kontaktloser Tastschalter |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3175090A (en) * | 1958-02-27 | 1965-03-23 | Hewlett Packard Co | Counter network including photoresponsive elements |
| DE1187669B (de) * | 1958-06-06 | 1965-02-25 | Standard Elektrik Lorenz Ag | Anordnung zur Erzielung eines wandernden Leuchtfleckes und Bildaufnahme- und Wiedergabevorrichtung mit einer derartigen Anordnung |
| US3020411A (en) * | 1958-07-07 | 1962-02-06 | Ibm | Photovoltaic devices |
| US3132325A (en) * | 1959-09-24 | 1964-05-05 | Gen Electric | Electro-optical shift register |
| US3038080A (en) * | 1960-03-14 | 1962-06-05 | Gen Telephone & Elect | Photoluminescent logic circuit for selectively energizing plural output lines in response to input voltage level |
| NL258241A (enExample) * | 1960-11-22 | |||
| US3160756A (en) * | 1961-02-20 | 1964-12-08 | Gen Telephone & Elect | Electro-optical pulse counter |
| US3222527A (en) * | 1961-07-24 | 1965-12-07 | Ibm | Photosensitive ring circuit |
| US3226553A (en) * | 1961-07-24 | 1965-12-28 | Ibm | Photosensitive multiple state circuit for computing and data processing systems |
| US3157791A (en) * | 1961-07-27 | 1964-11-17 | Indternat Business Machines Co | Multi-state photoconductive logic circuits |
| BE621562A (enExample) * | 1961-08-21 | |||
| US3150265A (en) * | 1961-08-30 | 1964-09-22 | Ibm | Light sensitive, multi-stable storage device |
| BE627617A (enExample) * | 1962-01-26 | |||
| US3193805A (en) * | 1962-06-04 | 1965-07-06 | Rca Corp | Bistable circuit |
| US3270187A (en) * | 1963-12-30 | 1966-08-30 | Bunker Ramo | Electro-optical computing system |
| US3384888A (en) * | 1964-12-30 | 1968-05-21 | Gen Electric | Optical apparatus |
| US3389389A (en) * | 1965-01-11 | 1968-06-18 | Neonix Inc | Moving message sign |
-
0
- NL NL218853D patent/NL218853A/xx unknown
- BE BE559126D patent/BE559126A/xx unknown
-
1956
- 1956-07-12 GB GB21620/56A patent/GB810506A/en not_active Expired
-
1957
- 1957-07-02 US US669585A patent/US2949538A/en not_active Expired - Lifetime
- 1957-07-09 ES ES0236458A patent/ES236458A1/es not_active Expired
- 1957-07-11 DE DEG22518A patent/DE1052452B/de active Pending
- 1957-07-11 FR FR1178757D patent/FR1178757A/fr not_active Expired
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1079113B (de) * | 1957-07-09 | 1960-04-07 | Westinghouse Electric Corp | Gatter zur Verarbeitung von als Strahlung vorliegenden Eingangssignalen nach vorgeschriebenen logischen Funktionen |
| DE1123706B (de) * | 1959-07-24 | 1962-02-15 | Philips Nv | Schalter, bestehend aus einer bistabilen Kippstufe mit einem photoleitenden Element |
| DE1299706B (de) * | 1962-07-26 | 1969-07-24 | Friedrich Kurt | Kontaktloser Tastschalter |
Also Published As
| Publication number | Publication date |
|---|---|
| ES236458A1 (es) | 1958-01-01 |
| GB810506A (en) | 1959-03-18 |
| BE559126A (enExample) | |
| US2949538A (en) | 1960-08-16 |
| NL218853A (enExample) | |
| FR1178757A (fr) | 1959-05-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1052452B (de) | Elektronische Schaltkreisanordnung | |
| DE971860C (de) | Wechselstrom-Steuerschaltung | |
| DE1497164B2 (de) | Verfahren zur Herstellung eines Ladungsbildes auf einer isolierenden Oberfläche | |
| DE1292002B (de) | Verfahren zur Erzeugung eines Ladungsbildes in einer photoleitfaehigen Schicht | |
| DE2531371A1 (de) | Elektro-optische anzeigevorrichtung | |
| DE1057168B (de) | Bistabile Kippschaltung | |
| DE1564223A1 (de) | Elektrooptische Anordnung zur Lichtsteuerung | |
| DE2731718A1 (de) | Elektrochromes anzeigeelement | |
| DE1614766A1 (de) | Festkoerper-Bildverstaerker | |
| DE1139545B (de) | Optische Verriegelungsschaltung | |
| DE2326566A1 (de) | Fluessigkeitskristall-anzeigereinrichtung | |
| DE3018452A1 (de) | Faksimile-schreibeinrichtung | |
| DE2734170A1 (de) | Anzeigevorrichtung mit leuchtdioden | |
| DE1119568B (de) | Bistabile Speichereinheit mit zwei ferroelektrischen Elementen | |
| DE2010509B2 (de) | Anordnung zum Speichern von Daten | |
| DE1149057B (de) | Schaltanordnung zur Realisierung logischer Funktionen, bei der die Eingangs-signale durch Lichtimpulse spannungs-abhaengiger Lichtquellen dargestellt werden | |
| DE1414963B2 (de) | Optoelektronische schaltung und daraus aufgebauter feststoff bildverstaerker | |
| DE1541413A1 (de) | Elektrischer Schockwellenleiter nach dem Gunn-Effekt | |
| DE1043882B (de) | Einrichtung zur UEbertragung eines Signals | |
| DE1004301B (de) | Strahlungsverstaerker mit fotoleitendem und elektrolumineszierendem Material | |
| DE2551960A1 (de) | Lichtmess- und lichtanzeige-einrichtung | |
| DE1021099B (de) | Vorrichtung zum Strahlungsnachweis, mit einem photoempfindlichen Teil und einem aufleuchtenden Teil, dessen Emission von dem photoempfindlichen Teil gesteuert wird | |
| DE1206473B (de) | Monostabile Kippschaltung aus photoleitenden und elektrolumineszierenden Elementen | |
| DE1132182B (de) | Elektrolumineszenzgeraet | |
| DE1961410C (de) | Vorrichtung zur Anzeige von Unterbrechungen bei der Wechselstromversorgung für elektrische Maschinen oder Geräte |