DE1041535B - Magnetische Speicherkernmatrix mit einer Vielzahl von magnetischen Speicherkernen - Google Patents
Magnetische Speicherkernmatrix mit einer Vielzahl von magnetischen SpeicherkernenInfo
- Publication number
- DE1041535B DE1041535B DEW17296A DEW0017296A DE1041535B DE 1041535 B DE1041535 B DE 1041535B DE W17296 A DEW17296 A DE W17296A DE W0017296 A DEW0017296 A DE W0017296A DE 1041535 B DE1041535 B DE 1041535B
- Authority
- DE
- Germany
- Prior art keywords
- line
- memory
- cores
- memory core
- signal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000015654 memory Effects 0.000 title claims description 133
- 239000011159 matrix material Substances 0.000 title claims description 47
- WYTGDNHDOZPMIW-RCBQFDQVSA-N alstonine Natural products C1=CC2=C3C=CC=CC3=NC2=C2N1C[C@H]1[C@H](C)OC=C(C(=O)OC)[C@H]1C2 WYTGDNHDOZPMIW-RCBQFDQVSA-N 0.000 description 5
- 238000004804 winding Methods 0.000 description 5
- 239000000696 magnetic material Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 3
- 239000011810 insulating material Substances 0.000 description 3
- 230000006378 damage Effects 0.000 description 2
- 230000010354 integration Effects 0.000 description 2
- 230000005415 magnetization Effects 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 101100350187 Caenorhabditis elegans odd-2 gene Proteins 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- SDIXRDNYIMOKSG-UHFFFAOYSA-L disodium methyl arsenate Chemical compound [Na+].[Na+].C[As]([O-])([O-])=O SDIXRDNYIMOKSG-UHFFFAOYSA-L 0.000 description 1
- 238000011549 displacement method Methods 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 230000000873 masking effect Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
Classifications
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11C—STATIC STORES
- G11C11/00—Digital stores characterised by the use of particular electric or magnetic storage elements; Storage elements therefor
- G11C11/02—Digital stores characterised by the use of particular electric or magnetic storage elements; Storage elements therefor using magnetic elements
- G11C11/06—Digital stores characterised by the use of particular electric or magnetic storage elements; Storage elements therefor using magnetic elements using single-aperture storage elements, e.g. ring core; using multi-aperture plates in which each individual aperture forms a storage element
- G11C11/06007—Digital stores characterised by the use of particular electric or magnetic storage elements; Storage elements therefor using magnetic elements using single-aperture storage elements, e.g. ring core; using multi-aperture plates in which each individual aperture forms a storage element using a single aperture or single magnetic closed circuit
- G11C11/06014—Digital stores characterised by the use of particular electric or magnetic storage elements; Storage elements therefor using magnetic elements using single-aperture storage elements, e.g. ring core; using multi-aperture plates in which each individual aperture forms a storage element using a single aperture or single magnetic closed circuit using one such element per bit
- G11C11/06021—Digital stores characterised by the use of particular electric or magnetic storage elements; Storage elements therefor using magnetic elements using single-aperture storage elements, e.g. ring core; using multi-aperture plates in which each individual aperture forms a storage element using a single aperture or single magnetic closed circuit using one such element per bit with destructive read-out
- G11C11/06028—Matrixes
- G11C11/06035—Bit core selection for writing or reading, by at least two coincident partial currents, e.g. "bit"- organised, 2L/2D, or 3D
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10T—TECHNICAL SUBJECTS COVERED BY FORMER US CLASSIFICATION
- Y10T29/00—Metal working
- Y10T29/49—Method of mechanical manufacture
- Y10T29/49002—Electrical device making
- Y10T29/4902—Electromagnet, transformer or inductor
- Y10T29/49069—Data storage inductor or core
Landscapes
- Engineering & Computer Science (AREA)
- Computer Hardware Design (AREA)
- Recording Or Reproducing By Magnetic Means (AREA)
- Financial Or Insurance-Related Operations Such As Payment And Settlement (AREA)
- Coils Or Transformers For Communication (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US45565954A | 1954-09-13 | 1954-09-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1041535B true DE1041535B (de) | 1958-10-23 |
Family
ID=23809723
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEW17296A Pending DE1041535B (de) | 1954-09-13 | 1955-08-12 | Magnetische Speicherkernmatrix mit einer Vielzahl von magnetischen Speicherkernen |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2732542A (enExample) |
| BE (1) | BE541151A (enExample) |
| DE (1) | DE1041535B (enExample) |
| FR (1) | FR1132925A (enExample) |
| GB (1) | GB785897A (enExample) |
| NL (1) | NL198419A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5260892A (en) * | 1991-11-21 | 1993-11-09 | Sun Microsystems, Inc. | High speed electrical signal interconnect structure |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2920312A (en) * | 1953-08-13 | 1960-01-05 | Lab For Electronics Inc | Magnetic symbol generator |
| US2814792A (en) * | 1955-08-25 | 1957-11-26 | Ibm | Magnetic core storage device |
| NL195575A (enExample) * | 1954-03-16 | |||
| US2825046A (en) * | 1954-06-24 | 1958-02-25 | Plessey Co Ltd | Production of magnetic material for use in computers or magnetic memory systems |
| NL96795C (enExample) * | 1954-08-19 | |||
| US3056114A (en) * | 1954-09-13 | 1962-09-25 | Rca Corp | Magnetic storage device |
| US3110886A (en) * | 1954-09-13 | 1963-11-12 | Rca Corp | Magnetic storage device |
| US2942240A (en) * | 1954-09-13 | 1960-06-21 | Rca Corp | Magnetic memory systems using multiapertured storage elements |
| US2824294A (en) * | 1954-12-31 | 1958-02-18 | Rca Corp | Magnetic core arrays |
| US2970296A (en) * | 1955-05-10 | 1961-01-31 | Ibm | Printed circuit ferrite core memory assembly |
| NL207426A (enExample) * | 1955-05-25 | |||
| GB849264A (en) * | 1955-09-13 | 1960-09-21 | Burroughs Corp | Bistable state magnetic core device |
| NL215595A (enExample) * | 1956-03-22 | |||
| BE558441A (enExample) * | 1956-06-18 | |||
| US2980892A (en) * | 1956-06-27 | 1961-04-18 | Rca Corp | Magnetic switching systems |
| US2882519A (en) * | 1956-07-02 | 1959-04-14 | Rca Corp | Magnetic device |
| US3012231A (en) * | 1956-10-10 | 1961-12-05 | Honeywell Regulator Co | Electrical apparatus for storing digital information |
| US3045228A (en) * | 1956-12-10 | 1962-07-17 | Ibm | Magnetic core storage device |
| DE1069681B (enExample) * | 1957-02-22 | 1959-11-26 | ||
| NL225182A (enExample) * | 1957-02-23 | |||
| US3258584A (en) * | 1957-04-09 | 1966-06-28 | Data transfer and conversion system | |
| NL229257A (enExample) * | 1957-07-24 | |||
| NL230021A (enExample) * | 1957-08-01 | |||
| US3159821A (en) * | 1957-09-25 | 1964-12-01 | Sperry Rand Corp | Magnetic core matrix |
| US3111651A (en) * | 1957-10-10 | 1963-11-19 | Bell Telephone Labor Inc | Magnetic core matrix apparatus |
| US3060410A (en) * | 1957-10-11 | 1962-10-23 | Ford Motor Co | Logic system gating circuit |
| US3142049A (en) * | 1961-08-25 | 1964-07-21 | Ibm | Memory array sensing |
| BE629612A (enExample) * | 1962-03-15 | |||
| US3479655A (en) * | 1964-10-26 | 1969-11-18 | Burroughs Corp | Magnetic storage devices with shielding between input and output |
-
0
- NL NL198419D patent/NL198419A/xx unknown
- BE BE541151D patent/BE541151A/xx unknown
- US US2732542D patent/US2732542A/en not_active Expired - Lifetime
-
1955
- 1955-06-10 FR FR1132925D patent/FR1132925A/fr not_active Expired
- 1955-08-12 DE DEW17296A patent/DE1041535B/de active Pending
- 1955-09-02 GB GB25277/55A patent/GB785897A/en not_active Expired
Non-Patent Citations (1)
| Title |
|---|
| None * |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5260892A (en) * | 1991-11-21 | 1993-11-09 | Sun Microsystems, Inc. | High speed electrical signal interconnect structure |
Also Published As
| Publication number | Publication date |
|---|---|
| NL198419A (enExample) | |
| FR1132925A (fr) | 1957-03-19 |
| BE541151A (enExample) | |
| GB785897A (en) | 1957-11-06 |
| US2732542A (en) | 1956-01-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1041535B (de) | Magnetische Speicherkernmatrix mit einer Vielzahl von magnetischen Speicherkernen | |
| DE2556273C2 (de) | Gruppenweise zu einer logischen Schaltung zusammengefaßte logische Schaltkreise | |
| DE1034689B (de) | Magnetische Speicherschaltung mit einer Platte aus magnetischem Material | |
| DE1275131B (de) | Anordnung zur UEbertragung von Information auf ein Magnetschichtelement axialer Anisotropie | |
| DE1091783B (de) | Verfahren und Einrichtung zur Darstellung von Schriftzeichen auf dem Bildschirm einer Kathodenstrahlroehre | |
| DE2333812C3 (de) | Magnetkopf in Dünnschichttechnik und Verfahren zu seiner Herstellung | |
| DE1197929C2 (de) | Halbfestwertspeicher | |
| DE1186244B (de) | Vergleichsschaltung | |
| DE1549936B1 (de) | Elektronischer schriftzeichen und zeichengenerator | |
| DE2257842C3 (de) | Matrixspeicher mit Störungsausgleich | |
| DE1488031B2 (de) | Wicklung für eine mehrpolige elektrische Maschine | |
| DE1146107B (de) | Verfahren und Einrichtung zur Abfuehlung des bistabilen Zustandes eines Magnetschichtelementes | |
| DE1474045C3 (de) | Vorrichtung zum Absuchen von Wörtern nach Suchbegriffen | |
| DE1122754B (de) | Verfahren und Vorrichtung zur automatischen Zeichenerkennung | |
| DE1174836C2 (de) | Magnetischer festwertspeicher | |
| DE2551179A1 (de) | Impedanztransformator mit ungeradzahligem uebersetzungsverhaeltnis | |
| DE1488031C (de) | Wicklung fur eine mehrpolige elektn sehe Maschine | |
| DE1474352C (de) | Matrixspeicher | |
| DE1574763C (de) | Speichermatnx aus magnetischen Kern elementen | |
| DE1213482B (de) | Auf einen hohen oder niedrigen Wert umschaltbarer induktiver Blindwiderstand | |
| AT256312B (de) | Doppelflächige Strick- oder Wirkware | |
| DE1271770B (de) | Verschieberegister aus duennen magnetischen Schichten | |
| DE1413700C (de) | Drehmelder | |
| DE1512890A1 (de) | Schaltungsanordnung mit einer Anzahl von Relaisvorrichtungen | |
| DE2448051A1 (de) | Logische universalbaugruppen mit einem josephson-tunnelkontakt |