DD229697A5 - Verfahren zur herstellung von 3,4,6-trisubstituierten 3-alkylthio-1,2,4-triazin-5-on-derivaten - Google Patents
Verfahren zur herstellung von 3,4,6-trisubstituierten 3-alkylthio-1,2,4-triazin-5-on-derivaten Download PDFInfo
- Publication number
- DD229697A5 DD229697A5 DD84269011A DD26901184A DD229697A5 DD 229697 A5 DD229697 A5 DD 229697A5 DD 84269011 A DD84269011 A DD 84269011A DD 26901184 A DD26901184 A DD 26901184A DD 229697 A5 DD229697 A5 DD 229697A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- acid
- formula
- optionally substituted
- item
- esters
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 24
- 238000002360 preparation method Methods 0.000 title claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 25
- 239000002253 acid Substances 0.000 claims abstract description 24
- 239000002168 alkylating agent Substances 0.000 claims abstract description 16
- 229940100198 alkylating agent Drugs 0.000 claims abstract description 16
- 150000002148 esters Chemical class 0.000 claims abstract description 12
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 11
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 11
- 239000001301 oxygen Substances 0.000 claims abstract description 11
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 7
- 125000000304 alkynyl group Chemical group 0.000 claims abstract description 7
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 7
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims abstract description 7
- HZPZCLDCTLLJTF-UHFFFAOYSA-N 3-sulfanylidene-2h-1,2,4-triazin-5-one Chemical compound O=C1C=NNC(=S)N1 HZPZCLDCTLLJTF-UHFFFAOYSA-N 0.000 claims abstract description 5
- 125000001188 haloalkyl group Chemical group 0.000 claims abstract description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 5
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims abstract description 4
- 125000003282 alkyl amino group Chemical group 0.000 claims abstract description 4
- 125000003107 substituted aryl group Chemical group 0.000 claims abstract description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 23
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 12
- 230000002378 acidificating effect Effects 0.000 claims description 10
- 150000005690 diesters Chemical class 0.000 claims description 10
- 239000007858 starting material Substances 0.000 claims description 9
- 150000007513 acids Chemical class 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- 150000002926 oxygen Chemical class 0.000 claims description 7
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- 239000000203 mixture Substances 0.000 claims description 6
- 150000005691 triesters Chemical class 0.000 claims description 6
- -1 3-fchansulfonsäure Chemical compound 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 238000011065 in-situ storage Methods 0.000 claims description 4
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 3
- 239000011707 mineral Substances 0.000 claims description 3
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 claims description 3
- KIWBPDUYBMNFTB-UHFFFAOYSA-N Ethyl hydrogen sulfate Chemical compound CCOS(O)(=O)=O KIWBPDUYBMNFTB-UHFFFAOYSA-N 0.000 claims description 2
- 150000001298 alcohols Chemical class 0.000 claims description 2
- 150000001336 alkenes Chemical class 0.000 claims description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 2
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 claims description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 claims description 2
- 125000003963 dichloro group Chemical group Cl* 0.000 claims description 2
- 229960005215 dichloroacetic acid Drugs 0.000 claims description 2
- 150000002118 epoxides Chemical class 0.000 claims description 2
- 150000002170 ethers Chemical class 0.000 claims description 2
- 150000004715 keto acids Chemical class 0.000 claims description 2
- OPUAWDUYWRUIIL-UHFFFAOYSA-N methanedisulfonic acid Chemical compound OS(=O)(=O)CS(O)(=O)=O OPUAWDUYWRUIIL-UHFFFAOYSA-N 0.000 claims description 2
- JZMJDSHXVKJFKW-UHFFFAOYSA-N methyl sulfate Chemical compound COS(O)(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-N 0.000 claims description 2
- 150000003900 succinic acid esters Chemical class 0.000 claims description 2
- 150000003459 sulfonic acid esters Chemical class 0.000 claims description 2
- 125000003944 tolyl group Chemical group 0.000 claims description 2
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 claims description 2
- 150000003673 urethanes Chemical class 0.000 claims description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 claims 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical group OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 claims 1
- 229940098779 methanesulfonic acid Drugs 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 abstract description 15
- 238000004519 manufacturing process Methods 0.000 abstract description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 125000004432 carbon atom Chemical group C* 0.000 description 18
- 150000001875 compounds Chemical class 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 235000011121 sodium hydroxide Nutrition 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 239000012467 final product Substances 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- OFKAVNQBCRJBJE-UHFFFAOYSA-N 4-amino-6-tert-butyl-3-sulfanylidene-2h-1,2,4-triazin-5-one Chemical compound CC(C)(C)C1=NNC(=S)N(N)C1=O OFKAVNQBCRJBJE-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 125000003884 phenylalkyl group Chemical group 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 230000005588 protonation Effects 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- JAPPBBQNPHNVPC-UHFFFAOYSA-N 4-amino-6-tert-butyl-2-methyl-3-sulfanylidene-1,2,4-triazin-5-one Chemical compound CN1N=C(C(C)(C)C)C(=O)N(N)C1=S JAPPBBQNPHNVPC-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241000251730 Chondrichthyes Species 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- VFNGKCDDZUSWLR-UHFFFAOYSA-N disulfuric acid Chemical compound OS(=O)(=O)OS(O)(=O)=O VFNGKCDDZUSWLR-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 125000000951 phenoxy group Chemical class [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 239000002351 wastewater Substances 0.000 description 2
- QMNWYGTWTXOQTP-UHFFFAOYSA-N 1h-triazin-6-one Chemical class O=C1C=CN=NN1 QMNWYGTWTXOQTP-UHFFFAOYSA-N 0.000 description 1
- SXWKRTDBNNKYDQ-UHFFFAOYSA-N 4-amino-6-tert-butyl-2-ethyl-3-sulfanylidene-1,2,4-triazin-5-one Chemical compound CCN1N=C(C(C)(C)C)C(=O)N(N)C1=S SXWKRTDBNNKYDQ-UHFFFAOYSA-N 0.000 description 1
- ADZSGNDOZREKJK-UHFFFAOYSA-N 4-amino-6-tert-butyl-3-ethylsulfanyl-1,2,4-triazin-5-one Chemical compound CCSC1=NN=C(C(C)(C)C)C(=O)N1N ADZSGNDOZREKJK-UHFFFAOYSA-N 0.000 description 1
- IULZTDKMPBUWDF-UHFFFAOYSA-N 6-tert-butyl-3-sulfanylidene-2h-1,2,4-triazin-5-one Chemical compound CC(C)(C)C1=NNC(=S)NC1=O IULZTDKMPBUWDF-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- WCTKUENARPWTAY-UHFFFAOYSA-N ac1l9mss Chemical class OS(Cl)=O WCTKUENARPWTAY-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- KNVLCWQKYHCADB-UHFFFAOYSA-N chlorosulfonyloxymethane Chemical compound COS(Cl)(=O)=O KNVLCWQKYHCADB-UHFFFAOYSA-N 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 150000004816 dichlorobenzenes Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-N ethanesulfonic acid Chemical compound CCS(O)(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-N 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000003502 gasoline Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000004438 haloalkoxy group Chemical group 0.000 description 1
- 125000004995 haloalkylthio group Chemical group 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- FOXFZRUHNHCZPX-UHFFFAOYSA-N metribuzin Chemical compound CSC1=NN=C(C(C)(C)C)C(=O)N1N FOXFZRUHNHCZPX-UHFFFAOYSA-N 0.000 description 1
- 125000004971 nitroalkyl group Chemical group 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000003385 ring cleavage reaction Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 235000015096 spirit Nutrition 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D253/00—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00
- C07D253/02—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00 not condensed with other rings
- C07D253/06—1,2,4-Triazines
- C07D253/065—1,2,4-Triazines having three double bonds between ring members or between ring members and non-ring members
- C07D253/07—1,2,4-Triazines having three double bonds between ring members or between ring members and non-ring members with hetero atoms, or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D253/075—Two hetero atoms, in positions 3 and 5
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Warehouses Or Storage Devices (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833339859 DE3339859A1 (de) | 1983-11-04 | 1983-11-04 | Verfahren zur herstellung von 3,4,6-trisubstituierten 3-alkyl-thio-1,2,4-triazin-5-on-derivaten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD229697A5 true DD229697A5 (de) | 1985-11-13 |
Family
ID=6213416
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD84269011A DD229697A5 (de) | 1983-11-04 | 1984-11-01 | Verfahren zur herstellung von 3,4,6-trisubstituierten 3-alkylthio-1,2,4-triazin-5-on-derivaten |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4544744A (enExample) |
| EP (1) | EP0144668B1 (enExample) |
| JP (1) | JPS60112777A (enExample) |
| KR (1) | KR920001741B1 (enExample) |
| AT (1) | ATE31531T1 (enExample) |
| BG (1) | BG43687A3 (enExample) |
| BR (1) | BR8405603A (enExample) |
| CA (1) | CA1221695A (enExample) |
| DD (1) | DD229697A5 (enExample) |
| DE (2) | DE3339859A1 (enExample) |
| DK (1) | DK158153C (enExample) |
| HU (1) | HU196768B (enExample) |
| IL (1) | IL73393A (enExample) |
| ZA (1) | ZA848581B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3476201D1 (en) * | 1984-01-11 | 1989-02-23 | Ciba Geigy Ag | Herbicidal and insecticidal triazinones |
| US4659819A (en) * | 1984-07-18 | 1987-04-21 | Mobay Corporation | Production of S-substituted isothioureas |
| US4783531A (en) * | 1984-07-18 | 1988-11-08 | Mobay Corporation | Production of S-substituted isothioureas |
| DE3912508A1 (de) * | 1989-04-17 | 1990-10-18 | Bayer Ag | 3,4-disubstituierte 6-(1,1-dichlor-2-methyl-2-propyl)-1,2,4-triazin-5 (4h)-one, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| DE3917044A1 (de) * | 1989-05-25 | 1990-12-06 | Bayer Ag | 6-(pent-3-yl)-1,2,4-triazin-5(4h)-one, verfahren zu ihrer herstellung und ihre verwendung als herbizide und pflanzenwachstumsregulatoren |
| DE19835943A1 (de) * | 1998-08-08 | 2000-02-10 | Bayer Ag | Substituierte Triazinone |
| CN112010814A (zh) * | 2019-05-31 | 2020-12-01 | 辽宁众辉生物科技有限公司 | 一种嗪草酮合成方法 |
| CN110606832B (zh) * | 2019-09-30 | 2021-11-26 | 江苏七洲绿色化工股份有限公司 | 一种嗪草酮的制备方法 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4309538A (en) * | 1980-01-31 | 1982-01-05 | Bayer Aktiengesellschaft | Preparation of 4-amino-6-tert.-butyl-3-alkylthio-1,2,4-triazin-5(4H)-ones |
| DE3008921A1 (de) * | 1980-03-08 | 1981-09-24 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 4-amino-6-tert.-butyl-3-methylthio-1,2,4,-triazin-5(4h)-on |
| DE3009043A1 (de) * | 1980-03-08 | 1981-09-24 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 4-amino-6-tert.-butyl-3-methylthio-1,2,4-triazin-5(4h)-on |
| DE3037300A1 (de) * | 1980-10-02 | 1982-05-27 | Bayer Ag, 5090 Leverkusen | Substituierte 6-halogen-tert.-butyl-1,2,4-triazin-5-one, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide |
| DE3102318A1 (de) * | 1981-01-24 | 1982-08-26 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 3,6-disubstituierten 4-amino-1,2,4-triazin-5-onen |
| DE3106707A1 (de) * | 1981-02-23 | 1982-09-09 | Degussa Ag, 6000 Frankfurt | Herbizid wirksames 1,2,4-triazin-5-on-derivat |
| DE3135392A1 (de) * | 1981-09-07 | 1983-03-17 | Bayer Ag, 5090 Leverkusen | "substituierte 6-alkoxy-tert.-butyl-1,2,4-triazin-5-one, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide" |
| DE3201110A1 (de) * | 1982-01-15 | 1983-07-28 | Bayer Ag, 5090 Leverkusen | 3-alken(in)yl-mercapto(amino)-4-amino-6-tert.-butyl-1,2,4-triazin-5-one, verfahren zu ihrer herstellung sowie ihrer verwendung als herbizide |
-
1983
- 1983-11-04 DE DE19833339859 patent/DE3339859A1/de not_active Withdrawn
-
1984
- 1984-10-22 EP EP84112707A patent/EP0144668B1/de not_active Expired
- 1984-10-22 DE DE8484112707T patent/DE3468214D1/de not_active Expired
- 1984-10-22 AT AT84112707T patent/ATE31531T1/de not_active IP Right Cessation
- 1984-10-30 US US06/666,420 patent/US4544744A/en not_active Expired - Lifetime
- 1984-10-31 JP JP59228091A patent/JPS60112777A/ja active Granted
- 1984-11-01 DD DD84269011A patent/DD229697A5/de not_active IP Right Cessation
- 1984-11-01 IL IL73393A patent/IL73393A/xx unknown
- 1984-11-01 HU HU844055A patent/HU196768B/hu not_active IP Right Cessation
- 1984-11-01 BR BR8405603A patent/BR8405603A/pt not_active IP Right Cessation
- 1984-11-01 KR KR1019840006836A patent/KR920001741B1/ko not_active Expired
- 1984-11-02 CA CA000466907A patent/CA1221695A/en not_active Expired
- 1984-11-02 DK DK524084A patent/DK158153C/da not_active IP Right Cessation
- 1984-11-02 ZA ZA848581A patent/ZA848581B/xx unknown
- 1984-11-23 BG BG067652A patent/BG43687A3/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE3339859A1 (de) | 1985-05-15 |
| BR8405603A (pt) | 1985-09-10 |
| EP0144668A1 (de) | 1985-06-19 |
| CA1221695A (en) | 1987-05-12 |
| DK524084D0 (da) | 1984-11-02 |
| US4544744A (en) | 1985-10-01 |
| DK524084A (da) | 1985-05-05 |
| KR850003532A (ko) | 1985-06-20 |
| JPH0513151B2 (enExample) | 1993-02-19 |
| DK158153B (da) | 1990-04-02 |
| ATE31531T1 (de) | 1988-01-15 |
| IL73393A (en) | 1988-01-31 |
| ZA848581B (en) | 1985-06-26 |
| EP0144668B1 (de) | 1987-12-23 |
| DK158153C (da) | 1990-09-03 |
| IL73393A0 (en) | 1985-02-28 |
| HUT37132A (en) | 1985-11-28 |
| KR920001741B1 (ko) | 1992-02-24 |
| JPS60112777A (ja) | 1985-06-19 |
| BG43687A3 (en) | 1988-07-15 |
| DE3468214D1 (en) | 1988-02-04 |
| HU196768B (en) | 1989-01-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DD229697A5 (de) | Verfahren zur herstellung von 3,4,6-trisubstituierten 3-alkylthio-1,2,4-triazin-5-on-derivaten | |
| DE3132332C2 (enExample) | ||
| DD152545A5 (de) | Verfahren zur herstellung von 4,4'-dinitrostilben-2,2'-disulfonsaeure und deren salze | |
| EP0003562B1 (de) | Verfahren zur Herstellung von Hydroxyphenyläthern | |
| EP0206147B1 (de) | Verfahren zur Herstellung von 4,4'-Dinitrodibenzylen | |
| EP0059241A1 (de) | Verfahren zur Herstellung von aromatischen Sulfohalogeniden | |
| EP0603893B1 (de) | Verfahren zur Herstellung von 2-Ethoxy-4,6-dihydroxypyrimidin oder dessen Alkalisalz | |
| EP0069905B1 (de) | Verfahren zur Herstellung von Hydrazidinen | |
| EP0250897B1 (de) | Verfahren zur Herstellung von Hydroxybenzaldoxim-O-ethern | |
| EP0657437A1 (de) | Verfahren und neue Zwischenprodukte zur Herstellung von Triazolinonen | |
| EP0123087B1 (de) | Verfahren zur Herstellung heterocyclischer Phenylether | |
| DE1670711A1 (de) | Verfahren zur Herstellung von Thionothiolphosphor-(-phosphon-,-phosphin-)saeureestern | |
| DE3603100C2 (de) | Verfahren zur Herstellung von Nitromethylen-Derivaten | |
| EP0581147B1 (de) | Chlorthiazolderivate | |
| EP1162197B1 (de) | Verfahren zur Herstellung von Pyridinen durch Oxidation von Dihydropyridinen mittels Methylnitrit | |
| DE3323510A1 (de) | 2-ketosulfonamide und verfahren zu deren herstellung | |
| DD233373A5 (de) | Verfahren zur herstellung von imidazolidinderivaten | |
| EP0150411A1 (de) | Verfahren zur Herstellung substituierter Chinazolin-2.4(1H.3H)-dione | |
| DD279015A5 (de) | Verfahren zur herstellung von 1,2-disulfon-verbindungen | |
| EP0104352B1 (de) | Verfahren zur Herstellung von O,S-Dimethyl-thiolophosphorsäureamid | |
| EP0033476B1 (de) | Verfahren zur Herstellung von 4-Amino-6-tert.-butyl-3-methylthio-1,2,4-triazin-5(4H)-on | |
| EP0069883A1 (de) | Verfahren zur Herstellung von Hydrazidinen | |
| DE3324399A1 (de) | Verfahren zur herstellung von 2-alkylsulfonylalkylenpyrimidinen | |
| DE2460909A1 (de) | Verfahren zur herstellung von alphaoxothiodimethylamiden | |
| AT372940B (de) | Verfahren zur herstellung von (d)-(-)-phydroxyphenylglycylchlorid-hydrochlorid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ENJ | Ceased due to non-payment of renewal fee |