DD213217A5 - Verfahren zur herstellung von beta-carbolinen - Google Patents
Verfahren zur herstellung von beta-carbolinen Download PDFInfo
- Publication number
- DD213217A5 DD213217A5 DD83256042A DD25604283A DD213217A5 DD 213217 A5 DD213217 A5 DD 213217A5 DD 83256042 A DD83256042 A DD 83256042A DD 25604283 A DD25604283 A DD 25604283A DD 213217 A5 DD213217 A5 DD 213217A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- carboline
- formula
- alkyl
- meaning
- carboxylic acid
- Prior art date
Links
- 238000000034 method Methods 0.000 title abstract description 35
- 238000002360 preparation method Methods 0.000 title abstract description 16
- 230000008569 process Effects 0.000 title abstract description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 21
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 10
- 239000001257 hydrogen Substances 0.000 claims abstract description 10
- 150000002367 halogens Chemical class 0.000 claims abstract description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 7
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims abstract description 5
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims abstract description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 109
- 150000001875 compounds Chemical class 0.000 claims description 47
- -1 copper (I) halide Chemical class 0.000 claims description 39
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 14
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 13
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 13
- 229910052799 carbon Inorganic materials 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 11
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 claims description 10
- 125000003118 aryl group Chemical group 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 9
- 239000012442 inert solvent Substances 0.000 claims description 9
- 229910052783 alkali metal Inorganic materials 0.000 claims description 8
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 claims description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 7
- 229910000564 Raney nickel Inorganic materials 0.000 claims description 6
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 claims description 6
- 150000001340 alkali metals Chemical class 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 239000007868 Raney catalyst Substances 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 5
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 claims description 5
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 claims description 5
- UGMPOJSWOINMDE-UHFFFAOYSA-N 9h-pyrido[3,4-b]indol-3-amine Chemical compound N1C2=CC=CC=C2C2=C1C=NC(N)=C2 UGMPOJSWOINMDE-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 230000015556 catabolic process Effects 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 238000006731 degradation reaction Methods 0.000 claims description 4
- 230000026030 halogenation Effects 0.000 claims description 4
- 238000005658 halogenation reaction Methods 0.000 claims description 4
- 229910052740 iodine Inorganic materials 0.000 claims description 4
- GFISDBXSWQMOND-UHFFFAOYSA-N 2,5-dimethoxyoxolane Chemical compound COC1CCC(OC)O1 GFISDBXSWQMOND-UHFFFAOYSA-N 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 3
- 239000003153 chemical reaction reagent Substances 0.000 claims description 3
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 claims description 3
- 150000002828 nitro derivatives Chemical class 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims description 2
- IBODDUNKEPPBKW-UHFFFAOYSA-N 1,5-dibromopentane Chemical compound BrCCCCCBr IBODDUNKEPPBKW-UHFFFAOYSA-N 0.000 claims description 2
- 238000000297 Sandmeyer reaction Methods 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 150000001408 amides Chemical class 0.000 claims description 2
- 150000005690 diesters Chemical class 0.000 claims description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 claims description 2
- 239000012948 isocyanate Substances 0.000 claims description 2
- 150000002513 isocyanates Chemical class 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 229910000510 noble metal Inorganic materials 0.000 claims description 2
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims description 2
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 2
- ULTHEAFYOOPTTB-UHFFFAOYSA-N 1,4-dibromobutane Chemical compound BrCCCCBr ULTHEAFYOOPTTB-UHFFFAOYSA-N 0.000 claims 1
- CFTOTSJVQRFXOF-UHFFFAOYSA-N 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole Chemical compound N1C2=CC=CC=C2C2=C1CNCC2 CFTOTSJVQRFXOF-UHFFFAOYSA-N 0.000 claims 1
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 125000005265 dialkylamine group Chemical group 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 239000012433 hydrogen halide Substances 0.000 claims 1
- 229910000039 hydrogen halide Inorganic materials 0.000 claims 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 claims 1
- ZXLDQJLIBNPEFJ-UHFFFAOYSA-N tetrahydro-beta-carboline Natural products C1CNC(C)C2=C1C1=CC=C(OC)C=C1N2 ZXLDQJLIBNPEFJ-UHFFFAOYSA-N 0.000 claims 1
- AIFRHYZBTHREPW-UHFFFAOYSA-N β-carboline Chemical class N1=CC=C2C3=CC=CC=C3NC2=C1 AIFRHYZBTHREPW-UHFFFAOYSA-N 0.000 abstract description 17
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract description 6
- 210000003169 central nervous system Anatomy 0.000 abstract description 5
- 239000003814 drug Substances 0.000 abstract description 4
- 125000001424 substituent group Chemical group 0.000 abstract description 3
- 150000002431 hydrogen Chemical class 0.000 abstract 3
- 230000005923 long-lasting effect Effects 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 87
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 84
- 238000002844 melting Methods 0.000 description 64
- 230000008018 melting Effects 0.000 description 64
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- 239000000243 solution Substances 0.000 description 34
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 31
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 26
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 24
- 239000000741 silica gel Substances 0.000 description 22
- 229910002027 silica gel Inorganic materials 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 22
- 238000006243 chemical reaction Methods 0.000 description 21
- 239000000203 mixture Substances 0.000 description 20
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 17
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 14
- 229960000583 acetic acid Drugs 0.000 description 14
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 13
- 239000007858 starting material Substances 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 238000001704 evaporation Methods 0.000 description 12
- 239000012074 organic phase Substances 0.000 description 12
- 238000001816 cooling Methods 0.000 description 11
- 230000008020 evaporation Effects 0.000 description 11
- 239000012362 glacial acetic acid Substances 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 10
- 239000003921 oil Substances 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 9
- 150000002148 esters Chemical class 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 229910052757 nitrogen Inorganic materials 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 9
- 238000010992 reflux Methods 0.000 description 9
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 238000009835 boiling Methods 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- 238000001914 filtration Methods 0.000 description 8
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 8
- DSUBZVLNKPDONN-UHFFFAOYSA-N 1-(9h-pyrido[3,4-b]indol-3-yl)ethanol Chemical compound N1C2=CC=CC=C2C2=C1C=NC(C(O)C)=C2 DSUBZVLNKPDONN-UHFFFAOYSA-N 0.000 description 7
- 241000699670 Mus sp. Species 0.000 description 7
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 7
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 7
- 239000013078 crystal Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- 239000008096 xylene Substances 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 6
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 6
- 238000004587 chromatography analysis Methods 0.000 description 6
- 238000000354 decomposition reaction Methods 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 239000003480 eluent Substances 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- ARLVFKCLBYUINL-UHFFFAOYSA-N 9h-pyrido[3,4-b]indole-3-carboxylic acid Chemical compound N1C2=CC=CC=C2C2=C1C=NC(C(=O)O)=C2 ARLVFKCLBYUINL-UHFFFAOYSA-N 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 5
- 238000006073 displacement reaction Methods 0.000 description 5
- 229910017604 nitric acid Inorganic materials 0.000 description 5
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 5
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 description 4
- XOHBPUCYRSORIZ-UHFFFAOYSA-N 3-methyl-9h-pyrido[3,4-b]indole Chemical compound N1C2=CC=CC=C2C2=C1C=NC(C)=C2 XOHBPUCYRSORIZ-UHFFFAOYSA-N 0.000 description 4
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- 238000006356 dehydrogenation reaction Methods 0.000 description 4
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 4
- IIJKHXNPDNDYJV-UHFFFAOYSA-N ethyl 9h-pyrido[3,4-b]indole-4-carboxylate Chemical compound N1C2=CC=CC=C2C2=C1C=NC=C2C(=O)OCC IIJKHXNPDNDYJV-UHFFFAOYSA-N 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 229960002200 flunitrazepam Drugs 0.000 description 4
- 150000002475 indoles Chemical class 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 238000006396 nitration reaction Methods 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 238000005809 transesterification reaction Methods 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- NBTKOJDJAKQGEG-UHFFFAOYSA-N 1-(9h-pyrido[3,4-b]indol-5-yl)ethanone Chemical compound N1C2=CN=CC=C2C2=C1C=CC=C2C(=O)C NBTKOJDJAKQGEG-UHFFFAOYSA-N 0.000 description 3
- VEBURLGGACYRBL-UHFFFAOYSA-N 3-(2-phenylethenyl)-9h-pyrido[3,4-b]indole Chemical compound C=1C(C2=CC=CC=C2N2)=C2C=NC=1C=CC1=CC=CC=C1 VEBURLGGACYRBL-UHFFFAOYSA-N 0.000 description 3
- VHCZZCXMIBIJIN-UHFFFAOYSA-N 3-(chloromethyl)-9h-pyrido[3,4-b]indole Chemical compound N1C2=CC=CC=C2C2=C1C=NC(CCl)=C2 VHCZZCXMIBIJIN-UHFFFAOYSA-N 0.000 description 3
- WADSJYLPJPTMLN-UHFFFAOYSA-N 3-(cycloundecen-1-yl)-1,2-diazacycloundec-2-ene Chemical compound C1CCCCCCCCC=C1C1=NNCCCCCCCC1 WADSJYLPJPTMLN-UHFFFAOYSA-N 0.000 description 3
- DUVJFXSQMXNUBO-UHFFFAOYSA-N 3-bromo-9h-pyrido[3,4-b]indole Chemical compound N1C2=CC=CC=C2C2=C1C=NC(Br)=C2 DUVJFXSQMXNUBO-UHFFFAOYSA-N 0.000 description 3
- XKCXIUDPGSNQIQ-UHFFFAOYSA-N 3-hydroxymethyl-beta-carboline Natural products C12=CC=CC=C2NC2=C1C=CN=C2CO XKCXIUDPGSNQIQ-UHFFFAOYSA-N 0.000 description 3
- PKDNEEZFQROQRV-UHFFFAOYSA-N 3-methylsulfanyl-9h-pyrido[3,4-b]indole Chemical compound N1C2=CC=CC=C2C2=C1C=NC(SC)=C2 PKDNEEZFQROQRV-UHFFFAOYSA-N 0.000 description 3
- OLZWIRPIGQYPES-UHFFFAOYSA-N 3-piperidin-1-yl-9h-pyrido[3,4-b]indole Chemical compound C1CCCCN1C1=CC(C2=CC=CC=C2N2)=C2C=N1 OLZWIRPIGQYPES-UHFFFAOYSA-N 0.000 description 3
- ZWZNGOCCOYPAHW-UHFFFAOYSA-N 3-pyrrol-1-yl-9h-pyrido[3,4-b]indole Chemical compound C1=CC=CN1C1=CC(C2=CC=CC=C2N2)=C2C=N1 ZWZNGOCCOYPAHW-UHFFFAOYSA-N 0.000 description 3
- CPBYHTDUBNSBQM-UHFFFAOYSA-N 9H-pyrido[3,4-b]indol-3-ylmethanol Chemical compound N1C2=CC=CC=C2C2=C1C=NC(CO)=C2 CPBYHTDUBNSBQM-UHFFFAOYSA-N 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 102000004300 GABA-A Receptors Human genes 0.000 description 3
- 108090000839 GABA-A Receptors Proteins 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 235000011054 acetic acid Nutrition 0.000 description 3
- 230000016571 aggressive behavior Effects 0.000 description 3
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 235000019445 benzyl alcohol Nutrition 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 210000004556 brain Anatomy 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- LYTAPBYVKHCGDT-UHFFFAOYSA-N ethyl 3-(2-nitroethenyl)-1h-indole-4-carboxylate Chemical compound CCOC(=O)C1=CC=CC2=C1C(C=C[N+]([O-])=O)=CN2 LYTAPBYVKHCGDT-UHFFFAOYSA-N 0.000 description 3
- ZIWVTUPCCMLZCL-UHFFFAOYSA-N ethyl 8-nitro-9h-pyrido[3,4-b]indole-4-carboxylate Chemical compound N1C2=C([N+]([O-])=O)C=CC=C2C2=C1C=NC=C2C(=O)OCC ZIWVTUPCCMLZCL-UHFFFAOYSA-N 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 3
- OMHPZNCEZBPYQP-UHFFFAOYSA-N n,n-diethyl-9h-pyrido[3,4-b]indol-6-amine Chemical compound N1=CC=C2C3=CC(N(CC)CC)=CC=C3NC2=C1 OMHPZNCEZBPYQP-UHFFFAOYSA-N 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 2
- NFDXQGNDWIPXQL-UHFFFAOYSA-N 1-cyclooctyldiazocane Chemical compound C1CCCCCCC1N1NCCCCCC1 NFDXQGNDWIPXQL-UHFFFAOYSA-N 0.000 description 2
- UDTDJSXOXQLKGM-UHFFFAOYSA-N 2,9-dihydropyrido[3,4-b]indol-3-one Chemical compound N1C2=CC=CC=C2C2=C1C=NC(O)=C2 UDTDJSXOXQLKGM-UHFFFAOYSA-N 0.000 description 2
- LFGIFFKBGBOPIK-UHFFFAOYSA-N 2-(5,6-dimethoxy-1h-indol-3-yl)butan-1-amine Chemical compound COC1=C(OC)C=C2C(C(CN)CC)=CNC2=C1 LFGIFFKBGBOPIK-UHFFFAOYSA-N 0.000 description 2
- CXKIVOPYNYGDCA-UHFFFAOYSA-N 3-(1-chloroethyl)-9h-pyrido[3,4-b]indole Chemical compound N1C2=CC=CC=C2C2=C1C=NC(C(Cl)C)=C2 CXKIVOPYNYGDCA-UHFFFAOYSA-N 0.000 description 2
- GCIIQUJZTFUXQG-UHFFFAOYSA-N 3-(9h-pyrido[3,4-b]indol-3-yl)pentan-3-ol Chemical compound N1C2=CC=CC=C2C2=C1C=NC(C(O)(CC)CC)=C2 GCIIQUJZTFUXQG-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- SGJQMRQYHMXDTI-UHFFFAOYSA-N 3-hydroxy-beta-carboline Natural products C12=CC=CC=C2NC2=C1C=CNC2=O SGJQMRQYHMXDTI-UHFFFAOYSA-N 0.000 description 2
- BKESVYGRKNXQCK-UHFFFAOYSA-N 3-methylsulfanyl-9h-pyrido[3,4-b]indol-6-amine Chemical compound N1C2=CC=C(N)C=C2C2=C1C=NC(SC)=C2 BKESVYGRKNXQCK-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- CDOVJGXGLBOZEB-UHFFFAOYSA-N 4-methyl-6-piperidin-1-yl-9h-pyrido[3,4-b]indole Chemical compound C1=C2C=3C(C)=CN=CC=3NC2=CC=C1N1CCCCC1 CDOVJGXGLBOZEB-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- MJZDGKWRTOURCE-UHFFFAOYSA-N 9H-pyrido[3,4-b]indole-5-carbonitrile Chemical compound N1C2=CN=CC=C2C2=C1C=CC=C2C#N MJZDGKWRTOURCE-UHFFFAOYSA-N 0.000 description 2
- PPCJCNSRVOYTKC-UHFFFAOYSA-N 9h-pyrido[3,4-b]indol-6-amine Chemical compound N1=CC=C2C3=CC(N)=CC=C3NC2=C1 PPCJCNSRVOYTKC-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- QIVBCDIJIAJPQS-VIFPVBQESA-N L-tryptophane Chemical class C1=CC=C2C(C[C@H](N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-VIFPVBQESA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 2
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- PPTYJKAXVCCBDU-UHFFFAOYSA-N Rohypnol Chemical compound N=1CC(=O)N(C)C2=CC=C([N+]([O-])=O)C=C2C=1C1=CC=CC=C1F PPTYJKAXVCCBDU-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QSXOSDZVXZMJFH-UHFFFAOYSA-N [9-(methylcarbamoyl)pyrido[3,4-b]indol-3-yl]methyl n-methylcarbamate Chemical compound CNC(=O)N1C2=CC=CC=C2C2=C1C=NC(COC(=O)NC)=C2 QSXOSDZVXZMJFH-UHFFFAOYSA-N 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 230000002539 anti-aggressive effect Effects 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 229940049706 benzodiazepine Drugs 0.000 description 2
- 150000001557 benzodiazepines Chemical class 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 description 2
- 239000004359 castor oil Substances 0.000 description 2
- 235000019438 castor oil Nutrition 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 2
- 239000012973 diazabicyclooctane Substances 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 2
- JASDBRNWKRMNML-UHFFFAOYSA-N ethyl 3-(2-aminoethyl)-1h-indole-4-carboxylate Chemical compound CCOC(=O)C1=CC=CC2=C1C(CCN)=CN2 JASDBRNWKRMNML-UHFFFAOYSA-N 0.000 description 2
- VUNRCNRUMYHDTI-UHFFFAOYSA-N ethyl 9h-pyrido[3,4-b]indole-4-carboxylate;hydrochloride Chemical compound Cl.N1C2=CC=CC=C2C2=C1C=NC=C2C(=O)OCC VUNRCNRUMYHDTI-UHFFFAOYSA-N 0.000 description 2
- OPMLJCJJIAWDNO-UHFFFAOYSA-N ethyl 9h-pyrido[3,4-b]indole-5-carboxylate Chemical compound N1C2=CN=CC=C2C2=C1C=CC=C2C(=O)OCC OPMLJCJJIAWDNO-UHFFFAOYSA-N 0.000 description 2
- JOFPUXRLUHVQKT-UHFFFAOYSA-N ethyl 9h-pyrido[3,4-b]indole-6-carboxylate Chemical compound N1=CC=C2C3=CC(C(=O)OCC)=CC=C3NC2=C1 JOFPUXRLUHVQKT-UHFFFAOYSA-N 0.000 description 2
- 239000002024 ethyl acetate extract Substances 0.000 description 2
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethyl cyclohexane Natural products CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 description 2
- MJEMIOXXNCZZFK-UHFFFAOYSA-N ethylone Chemical group CCNC(C)C(=O)C1=CC=C2OCOC2=C1 MJEMIOXXNCZZFK-UHFFFAOYSA-N 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- 125000001475 halogen functional group Chemical group 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- OWFXIOWLTKNBAP-UHFFFAOYSA-N isoamyl nitrite Chemical compound CC(C)CCON=O OWFXIOWLTKNBAP-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- AUHZEENZYGFFBQ-UHFFFAOYSA-N mesitylene Substances CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 2
- 125000001827 mesitylenyl group Chemical group [H]C1=C(C(*)=C(C([H])=C1C([H])([H])[H])C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 2
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 210000004129 prosencephalon Anatomy 0.000 description 2
- 229940001470 psychoactive drug Drugs 0.000 description 2
- 239000004089 psychotropic agent Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 230000009870 specific binding Effects 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 125000004187 tetrahydropyran-2-yl group Chemical group [H]C1([H])OC([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- OTPQTPCBJWSXCK-UHFFFAOYSA-N (4-propyl-9h-pyrido[3,4-b]indol-3-yl)methanol Chemical compound N1C2=CC=CC=C2C2=C1C=NC(CO)=C2CCC OTPQTPCBJWSXCK-UHFFFAOYSA-N 0.000 description 1
- MPTGYNGVQLGRFI-UHFFFAOYSA-N (6-amino-9h-pyrido[3,4-b]indol-3-yl)methanol Chemical compound N1=C(CO)C=C2C3=CC(N)=CC=C3NC2=C1 MPTGYNGVQLGRFI-UHFFFAOYSA-N 0.000 description 1
- PPNSEFZUOGDRJE-UHFFFAOYSA-N (6-bromo-9h-pyrido[3,4-b]indol-3-yl)methanol Chemical compound N1C2=CC=C(Br)C=C2C2=C1C=NC(CO)=C2 PPNSEFZUOGDRJE-UHFFFAOYSA-N 0.000 description 1
- LNZLXHMOALDZNG-UHFFFAOYSA-N (6-chloro-9h-pyrido[3,4-b]indol-3-yl)methanol Chemical compound N1C2=CC=C(Cl)C=C2C2=C1C=NC(CO)=C2 LNZLXHMOALDZNG-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical group ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- RUBNGGWBJUGNNA-UHFFFAOYSA-N 1-(1h-indol-4-yl)ethanone Chemical compound CC(=O)C1=CC=CC2=C1C=CN2 RUBNGGWBJUGNNA-UHFFFAOYSA-N 0.000 description 1
- ZAOXYLUTKQQVJN-UHFFFAOYSA-N 1-(9h-pyrido[3,4-b]indol-4-yl)ethanone Chemical compound N1C2=CC=CC=C2C2=C1C=NC=C2C(=O)C ZAOXYLUTKQQVJN-UHFFFAOYSA-N 0.000 description 1
- SDBHVQYVFASOTM-UHFFFAOYSA-N 1-(methylsulfanylmethyl)-9h-pyrido[3,4-b]indole Chemical compound C12=CC=CC=C2NC2=C1C=CN=C2CSC SDBHVQYVFASOTM-UHFFFAOYSA-N 0.000 description 1
- GNQCZGRKMZXRFI-UHFFFAOYSA-N 1-[3-(2-nitroethenyl)-1h-indol-4-yl]ethanone Chemical compound CC(=O)C1=CC=CC2=C1C(C=C[N+]([O-])=O)=CN2 GNQCZGRKMZXRFI-UHFFFAOYSA-N 0.000 description 1
- NQLHJJXRNKGLOH-UHFFFAOYSA-N 1-amino-n,n-dimethylmethanesulfonamide Chemical compound CN(C)S(=O)(=O)CN NQLHJJXRNKGLOH-UHFFFAOYSA-N 0.000 description 1
- 125000001478 1-chloroethyl group Chemical group [H]C([H])([H])C([H])(Cl)* 0.000 description 1
- VZAWCLCJGSBATP-UHFFFAOYSA-N 1-cycloundecyl-1,2-diazacycloundecane Chemical compound C1CCCCCCCCCC1N1NCCCCCCCCC1 VZAWCLCJGSBATP-UHFFFAOYSA-N 0.000 description 1
- ZVAPWJGRRUHKGP-UHFFFAOYSA-N 1h-1,5-benzodiazepine Chemical class N1C=CC=NC2=CC=CC=C12 ZVAPWJGRRUHKGP-UHFFFAOYSA-N 0.000 description 1
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- GLVYLTSKTCWWJR-UHFFFAOYSA-N 2-carbonoperoxoylbenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1C(O)=O GLVYLTSKTCWWJR-UHFFFAOYSA-N 0.000 description 1
- ZRJAVMUIXBUFFM-UHFFFAOYSA-N 3-(1-ethoxyethyl)-9h-pyrido[3,4-b]indole Chemical compound N1C2=CC=CC=C2C2=C1C=NC(C(C)OCC)=C2 ZRJAVMUIXBUFFM-UHFFFAOYSA-N 0.000 description 1
- JMDUICVPFBDARK-UHFFFAOYSA-N 3-(1-methoxyethoxy)-9h-pyrido[3,4-b]indole Chemical compound N1C2=CC=CC=C2C2=C1C=NC(OC(C)OC)=C2 JMDUICVPFBDARK-UHFFFAOYSA-N 0.000 description 1
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 1
- IUKPYBUDDWCXLN-UHFFFAOYSA-N 3-(methylsulfanylmethyl)-9h-pyrido[3,4-b]indole Chemical compound N1C2=CC=CC=C2C2=C1C=NC(CSC)=C2 IUKPYBUDDWCXLN-UHFFFAOYSA-N 0.000 description 1
- KKYCELUYTDIDMR-UHFFFAOYSA-N 3-(methylsulfinylmethyl)-9h-pyrido[3,4-b]indole Chemical compound N1C2=CC=CC=C2C2=C1C=NC(CS(=O)C)=C2 KKYCELUYTDIDMR-UHFFFAOYSA-N 0.000 description 1
- YCOXMTVFRSSILJ-UHFFFAOYSA-N 3-(methylsulfonylmethyl)-9h-pyrido[3,4-b]indole Chemical compound N1C2=CC=CC=C2C2=C1C=NC(CS(=O)(=O)C)=C2 YCOXMTVFRSSILJ-UHFFFAOYSA-N 0.000 description 1
- VGUWZCUCNQXGBU-UHFFFAOYSA-N 3-[(4-methylpiperazin-1-yl)methyl]-5-nitro-1h-indole Chemical compound C1CN(C)CCN1CC1=CNC2=CC=C([N+]([O-])=O)C=C12 VGUWZCUCNQXGBU-UHFFFAOYSA-N 0.000 description 1
- UARMCWOWRLFTFP-UHFFFAOYSA-N 3-butoxy-9h-pyrido[3,4-b]indole Chemical compound N1C2=CC=CC=C2C2=C1C=NC(OCCCC)=C2 UARMCWOWRLFTFP-UHFFFAOYSA-N 0.000 description 1
- JDYLMOJCIKYTGV-UHFFFAOYSA-N 3-chloro-9h-pyrido[3,4-b]indole Chemical compound N1C2=CC=CC=C2C2=C1C=NC(Cl)=C2 JDYLMOJCIKYTGV-UHFFFAOYSA-N 0.000 description 1
- NBAQUEFHXBSZRV-UHFFFAOYSA-N 3-ethylsulfanyl-9h-pyrido[3,4-b]indole Chemical compound N1C2=CC=CC=C2C2=C1C=NC(SCC)=C2 NBAQUEFHXBSZRV-UHFFFAOYSA-N 0.000 description 1
- UFGGNIMGPVLCJZ-UHFFFAOYSA-N 3-methoxy-9h-pyrido[3,4-b]indole Chemical compound N1C2=CC=CC=C2C2=C1C=NC(OC)=C2 UFGGNIMGPVLCJZ-UHFFFAOYSA-N 0.000 description 1
- XYCZFWWTSVTKTI-UHFFFAOYSA-N 3-methylsulfanyl-9h-pyrido[3,4-b]indole-6,8-disulfonyl chloride Chemical compound N1C2=C(S(Cl)(=O)=O)C=C(S(Cl)(=O)=O)C=C2C2=C1C=NC(SC)=C2 XYCZFWWTSVTKTI-UHFFFAOYSA-N 0.000 description 1
- OISSBXHDUOEYHP-UHFFFAOYSA-N 3-phenyl-9h-pyrido[3,4-b]indole Chemical compound C1=CC=CC=C1C1=CC(C2=CC=CC=C2N2)=C2C=N1 OISSBXHDUOEYHP-UHFFFAOYSA-N 0.000 description 1
- AKHQVIZELNFWSQ-UHFFFAOYSA-N 3-propan-2-yloxy-9h-pyrido[3,4-b]indole Chemical compound N1C2=CC=CC=C2C2=C1C=NC(OC(C)C)=C2 AKHQVIZELNFWSQ-UHFFFAOYSA-N 0.000 description 1
- SFLATSAUCILSFJ-UHFFFAOYSA-N 4-(ethoxymethyl)-1h-indole Chemical compound CCOCC1=CC=CC2=C1C=CN2 SFLATSAUCILSFJ-UHFFFAOYSA-N 0.000 description 1
- IWSIEVAHVMHYBQ-UHFFFAOYSA-N 4-methyl-3-methylsulfanyl-9h-pyrido[3,4-b]indole Chemical compound C1=CC=C2C3=C(C)C(SC)=NC=C3NC2=C1 IWSIEVAHVMHYBQ-UHFFFAOYSA-N 0.000 description 1
- NJEAVORLXZIEAV-UHFFFAOYSA-N 4-methyl-6-piperidin-1-yl-9h-pyrido[3,4-b]indole-3-carboxylic acid Chemical compound C1=C2C=3C(C)=C(C(O)=O)N=CC=3NC2=CC=C1N1CCCCC1 NJEAVORLXZIEAV-UHFFFAOYSA-N 0.000 description 1
- LJFVSIDBFJPKLD-UHFFFAOYSA-N 4-phenylmethoxy-1h-indole Chemical compound C=1C=CC=2NC=CC=2C=1OCC1=CC=CC=C1 LJFVSIDBFJPKLD-UHFFFAOYSA-N 0.000 description 1
- ALQWVTKDHHDBLB-UHFFFAOYSA-N 5,6-dimethoxy-3-(1-nitrobutan-2-yl)-1h-indole Chemical compound COC1=C(OC)C=C2C(C(C[N+]([O-])=O)CC)=CNC2=C1 ALQWVTKDHHDBLB-UHFFFAOYSA-N 0.000 description 1
- WRTBTFCBCDDGQQ-UHFFFAOYSA-N 5-ethoxycarbonyl-2,3,4,9-tetrahydro-1h-pyrido[3,4-b]indole-1-carboxylic acid Chemical compound OC(=O)C1NCCC2=C1NC1=C2C(C(=O)OCC)=CC=C1 WRTBTFCBCDDGQQ-UHFFFAOYSA-N 0.000 description 1
- ALJLMMIEQRTSKU-UHFFFAOYSA-N 9h-pyrido[3,4-b]indole-3-carbonyl azide Chemical compound N1C2=CC=CC=C2C2=C1C=NC(C(=O)N=[N+]=[N-])=C2 ALJLMMIEQRTSKU-UHFFFAOYSA-N 0.000 description 1
- YDQHHZTYPPUDLH-UHFFFAOYSA-N 9h-pyrido[3,4-b]indole-4-carboxylic acid Chemical compound N1C2=CC=CC=C2C2=C1C=NC=C2C(=O)O YDQHHZTYPPUDLH-UHFFFAOYSA-N 0.000 description 1
- 229920000856 Amylose Polymers 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical compound [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- PNKUSGQVOMIXLU-UHFFFAOYSA-N Formamidine Chemical compound NC=N PNKUSGQVOMIXLU-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 1
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 1
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 1
- 238000006929 Pictet-Spengler synthesis reaction Methods 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 241000251539 Vertebrata <Metazoa> Species 0.000 description 1
- 238000007239 Wittig reaction Methods 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- GEFXBWSREYXFIC-UHFFFAOYSA-N [3-(hydroxymethyl)-1-(oxan-2-yl)-9H-pyrido[3,4-b]indol-6-yl] hypobromite Chemical compound BrOC=1C=C2C=3C=C(N=C(C=3NC2=CC=1)C1OCCCC1)CO GEFXBWSREYXFIC-UHFFFAOYSA-N 0.000 description 1
- YUSBMYNAQTWWLP-UHFFFAOYSA-N [4-(methoxymethyl)-5-phenylmethoxy-9h-pyrido[3,4-b]indol-3-yl]methanol Chemical compound C=12C=3C(COC)=C(CO)N=CC=3NC2=CC=CC=1OCC1=CC=CC=C1 YUSBMYNAQTWWLP-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000004848 alkoxyethyl group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 238000005937 allylation reaction Methods 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000005899 aromatization reaction Methods 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- CLBDATFGDWGQKF-UHFFFAOYSA-N beta-Carbolin Natural products N1=CC=C2CC3=CC=CC=C3NC2=C1 CLBDATFGDWGQKF-UHFFFAOYSA-N 0.000 description 1
- 230000027455 binding Effects 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- GUGRBFQNXVKOGR-UHFFFAOYSA-N butyl hypochlorite Chemical compound CCCCOCl GUGRBFQNXVKOGR-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001731 carboxylic acid azides Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 238000004200 deflagration Methods 0.000 description 1
- 229960003529 diazepam Drugs 0.000 description 1
- WLXALCKAKGDNAT-UHFFFAOYSA-N diazoethane Chemical compound CC=[N+]=[N-] WLXALCKAKGDNAT-UHFFFAOYSA-N 0.000 description 1
- UZBQIPPOMKBLAS-UHFFFAOYSA-N diethylazanide Chemical compound CC[N-]CC UZBQIPPOMKBLAS-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 125000006263 dimethyl aminosulfonyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- QKIUAMUSENSFQQ-UHFFFAOYSA-N dimethylazanide Chemical compound C[N-]C QKIUAMUSENSFQQ-UHFFFAOYSA-N 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000002481 ethanol extraction Methods 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- ZIUDZKABRXGZFO-UHFFFAOYSA-N ethyl 1h-indole-4-carboxylate Chemical compound CCOC(=O)C1=CC=CC2=C1C=CN2 ZIUDZKABRXGZFO-UHFFFAOYSA-N 0.000 description 1
- APFFXMCQBJDNBG-UHFFFAOYSA-N ethyl 6-nitro-9h-pyrido[3,4-b]indole-4-carboxylate;nitric acid Chemical compound O[N+]([O-])=O.N1C2=CC=C([N+]([O-])=O)C=C2C2=C1C=NC=C2C(=O)OCC APFFXMCQBJDNBG-UHFFFAOYSA-N 0.000 description 1
- MNBIRKRECCVLBI-UHFFFAOYSA-N ethyl 8-amino-9h-pyrido[3,4-b]indole-4-carboxylate Chemical compound N1C2=C(N)C=CC=C2C2=C1C=NC=C2C(=O)OCC MNBIRKRECCVLBI-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 235000011389 fruit/vegetable juice Nutrition 0.000 description 1
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- UQEAIHBTYFGYIE-UHFFFAOYSA-N hexamethyldisiloxane Chemical compound C[Si](C)(C)O[Si](C)(C)C UQEAIHBTYFGYIE-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 229920003063 hydroxymethyl cellulose Polymers 0.000 description 1
- 229940031574 hydroxymethyl cellulose Drugs 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- WCNHWQATGLIDEY-UHFFFAOYSA-N methyl n-(9h-pyrido[3,4-b]indol-3-yl)carbamate Chemical compound N1C2=CC=CC=C2C2=C1C=NC(NC(=O)OC)=C2 WCNHWQATGLIDEY-UHFFFAOYSA-N 0.000 description 1
- UFEJKYYYVXYMMS-UHFFFAOYSA-N methylcarbamic acid Chemical compound CNC(O)=O UFEJKYYYVXYMMS-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- JZIFOHJMLBAWQZ-UHFFFAOYSA-N n-(9h-pyrido[3,4-b]indol-3-yl)acetamide Chemical compound N1C2=CC=CC=C2C2=C1C=NC(NC(=O)C)=C2 JZIFOHJMLBAWQZ-UHFFFAOYSA-N 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000004967 organic peroxy acids Chemical class 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- PWXJULSLLONQHY-UHFFFAOYSA-N phenylcarbamic acid Chemical compound OC(=O)NC1=CC=CC=C1 PWXJULSLLONQHY-UHFFFAOYSA-N 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229940068917 polyethylene glycols Drugs 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- HHFOOWPWAXNJNY-UHFFFAOYSA-N promoxolane Chemical compound CC(C)C1(C(C)C)OCC(CO)O1 HHFOOWPWAXNJNY-UHFFFAOYSA-N 0.000 description 1
- 229950008352 promoxolane Drugs 0.000 description 1
- WGDRAVMHLDKGGA-UHFFFAOYSA-N prop-2-en-1-imine Chemical compound [CH2]C=C[NH] WGDRAVMHLDKGGA-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- VFTBEJYSQUHAGA-UHFFFAOYSA-N propyl 9H-pyrido[3,4-b]indole-1-carboxylate Chemical compound C(CC)OC(=O)C1=NC=CC2=C1NC1=CC=CC=C21 VFTBEJYSQUHAGA-UHFFFAOYSA-N 0.000 description 1
- SDYYCDVGYIPTOB-UHFFFAOYSA-N propyl 9h-pyrido[3,4-b]indole-4-carboxylate Chemical compound N1C2=CC=CC=C2C2=C1C=NC=C2C(=O)OCCC SDYYCDVGYIPTOB-UHFFFAOYSA-N 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 238000003345 scintillation counting Methods 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 125000005504 styryl group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003458 sulfonic acid derivatives Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- RQLKZZBMSWQOQJ-UHFFFAOYSA-N taraxacine-A Natural products C12=CC=CC=C2NC2=C1C=CN=C2OC RQLKZZBMSWQOQJ-UHFFFAOYSA-N 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/20—Hypnotics; Sedatives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/14—Radicals substituted by nitrogen atoms, not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/14—Radicals substituted by nitrogen atoms, not forming part of a nitro radical
- C07D209/16—Tryptamines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/40—Esters thereof
- C07F9/4003—Esters thereof the acid moiety containing a substituent or a structure which is considered as characteristic
- C07F9/4015—Esters of acyclic unsaturated acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/6561—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom containing systems of two or more relevant hetero rings condensed among themselves or condensed with a common carbocyclic ring or ring system, with or without other non-condensed hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Molecular Biology (AREA)
- Biochemistry (AREA)
- Neurosurgery (AREA)
- Bioinformatics & Cheminformatics (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Neurology (AREA)
- Pharmacology & Pharmacy (AREA)
- Biomedical Technology (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Engineering & Computer Science (AREA)
- Anesthesiology (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19823240514 DE3240514A1 (de) | 1982-10-29 | 1982-10-29 | Ss-carboline, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische praeparate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD213217A5 true DD213217A5 (de) | 1984-09-05 |
Family
ID=6177153
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD83256042A DD213217A5 (de) | 1982-10-29 | 1983-10-27 | Verfahren zur herstellung von beta-carbolinen |
Country Status (18)
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3240511A1 (de) * | 1982-10-29 | 1984-05-03 | Schering AG, 1000 Berlin und 4709 Bergkamen | Verfahren zur herstellung von ss-carbolinderivaten |
| DE3322895A1 (de) * | 1983-06-23 | 1985-01-03 | Schering AG, 1000 Berlin und 4709 Bergkamen | Neue ss-carboline, verfahren zur ihrer herstellung und ihre verwendung als arzneimittel (s) |
| US4631149A (en) * | 1983-07-25 | 1986-12-23 | University Of Illinois | Antiviral eudistomins from a marine tunicate |
| DE3504045A1 (de) * | 1985-02-04 | 1986-08-07 | Schering AG, 1000 Berlin und 4709 Bergkamen | Verfahren zur herstellung von ss-carbolinen durch dehydrierung |
| DE3535927A1 (de) * | 1985-10-04 | 1987-04-09 | Schering Ag | 3-vinyl- und 3-ethinyl-ss-carbolinderivate, ihre herstellung und ihre verwendung als arzneimittel |
| US4952584A (en) * | 1986-01-11 | 1990-08-28 | Beecham Group P.L.C. | 9H-pyrido[2,B-8]indole-3-carboxylic acid ester compounds having useful pharmaceutical activity |
| US4789676A (en) * | 1986-03-05 | 1988-12-06 | Merrell Dow Pharmaceuticals Inc. | Aromatic 2-aminoalkyl-1,2-benzoisothiazol-3(2H)one-1,1-dioxide derivatives, usefull as anxiolytic agents |
| EP0304223A3 (en) * | 1987-08-17 | 1990-10-24 | Merck & Co. Inc. | Beta-carbolines as cholecy-stokinin and gastrin antagonist |
| US5223509A (en) * | 1987-08-17 | 1993-06-29 | Merck & Co., Inc. | β-carbolines as cholecystokinin and gastrin antagonists |
| AU619203B2 (en) * | 1987-08-28 | 1992-01-23 | Schering Aktiengesellschaft | Isoxazole-beta-carboline derivatives |
| DE4029389A1 (de) * | 1990-09-13 | 1992-03-26 | Schering Ag | Verfahren zur herstellung von (beta)-carbolin-derivaten |
| US5350750A (en) * | 1991-04-27 | 1994-09-27 | Schering Aktiengesellschaft | β-carboline-3-hydroxyalkylcarboxylic acid ester derivatives, process for their production and their use in pharmaceutical agents |
| CN1148340A (zh) * | 1994-03-11 | 1997-04-23 | 伊莱利利公司 | 治疗与5htzb受体有关病症的方法 |
| ATE240955T1 (de) * | 1996-08-09 | 2003-06-15 | Boehringer Ingelheim Pharma | 4-substituierte beta-carboline als immunomodulatoren |
| HUP0300894A3 (en) | 2000-03-15 | 2008-05-28 | Sanofi Aventis Deutschland | Substituted beta-carbolines, process for their preparation, pharmaceutical compositions containing them and their use |
| EP1209158A1 (en) * | 2000-11-18 | 2002-05-29 | Aventis Pharma Deutschland GmbH | Substituted beta-carbolines |
| EP1134221A1 (en) * | 2000-03-15 | 2001-09-19 | Aventis Pharma Deutschland GmbH | Substituted beta-carbolines as lkB kinase inhibitors |
| US20030045541A1 (en) * | 2001-07-23 | 2003-03-06 | Christopher Bruckner | GABA-Receptor modulators with NMDA-Antagonistic activity |
| DE102007009264A1 (de) * | 2007-02-26 | 2008-08-28 | Ellneuroxx Ltd. | 9-Alkyl-ß-Carboline zur Behandlung von neurodegenerativen Erkrankungen |
| SG181599A1 (en) | 2009-12-28 | 2012-07-30 | Audiocure Pharma Gmbh | Beta-carbolines for use in the treatment of hearing loss and vertigo |
| CN102146080B (zh) * | 2010-02-10 | 2013-01-30 | 新疆华世丹药业股份有限公司 | β-咔啉碱衍生物类化合物及其应用 |
| EP2455378A1 (en) * | 2010-11-03 | 2012-05-23 | Philip Morris Products S.A. | Carbazole and carboline derivatives, and preparation and therapeutic applications thereof |
| CN102093347A (zh) * | 2010-12-17 | 2011-06-15 | 中国药科大学 | 1,3,6-三取代-β-咔啉类细胞周期蛋白依赖性激酶2抑制剂及其用途 |
| US11117893B2 (en) * | 2018-09-24 | 2021-09-14 | Union University | Methods for preparation of substituted pyridines and related novel compounds |
| EP3860996A4 (en) | 2018-10-02 | 2022-08-31 | Northwestern University | BETA-CARBOLINES AS POSITIVE ALLOSTERIC MODULATORS OF HUMAN SEROTONIN RECEPTOR 2C (5-HT2C) |
| CN115335046A (zh) * | 2020-03-25 | 2022-11-11 | 思研(Sri)国际顾问与咨询公司 | 脂肪氧合酶抑制剂 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ194747A (en) * | 1979-08-29 | 1988-11-29 | Schering Ag | 9h-pyrido(3,4-b)indol-3-ylcarboxylic acid derivatives |
| JPS57123180A (en) * | 1980-12-17 | 1982-07-31 | Schering Ag | 3-substituted beta-carboline, manufacture and psychotropic drug containing same |
| DE3240511A1 (de) * | 1982-10-29 | 1984-05-03 | Schering AG, 1000 Berlin und 4709 Bergkamen | Verfahren zur herstellung von ss-carbolinderivaten |
| DE3322895A1 (de) * | 1983-06-23 | 1985-01-03 | Schering AG, 1000 Berlin und 4709 Bergkamen | Neue ss-carboline, verfahren zur ihrer herstellung und ihre verwendung als arzneimittel (s) |
-
1982
- 1982-10-29 DE DE19823240514 patent/DE3240514A1/de not_active Withdrawn
-
1983
- 1983-10-13 NZ NZ205949A patent/NZ205949A/en unknown
- 1983-10-20 JP JP58195407A patent/JPH0633260B2/ja not_active Expired - Lifetime
- 1983-10-26 GR GR72789A patent/GR79637B/el unknown
- 1983-10-26 FI FI833918A patent/FI833918A7/fi not_active Application Discontinuation
- 1983-10-27 DE DE8383730103T patent/DE3380958D1/de not_active Expired - Lifetime
- 1983-10-27 DD DD83256042A patent/DD213217A5/de unknown
- 1983-10-27 AT AT83730103T patent/ATE48602T1/de not_active IP Right Cessation
- 1983-10-27 EP EP83730103A patent/EP0110814B1/de not_active Expired
- 1983-10-28 ZA ZA838072A patent/ZA838072B/xx unknown
- 1983-10-28 DK DK495683A patent/DK495683A/da not_active Application Discontinuation
- 1983-10-28 CA CA000439951A patent/CA1260475A/en not_active Expired
- 1983-10-28 AU AU20694/83A patent/AU568513B2/en not_active Ceased
- 1983-10-28 IL IL70077A patent/IL70077A0/xx unknown
- 1983-10-28 NO NO833942A patent/NO833942L/no unknown
- 1983-10-28 HU HU833711A patent/HU198208B/hu not_active IP Right Cessation
- 1983-10-28 ES ES526896A patent/ES8406477A1/es not_active Expired
- 1983-10-28 IE IE2529/83A patent/IE56155B1/en not_active IP Right Cessation
-
1986
- 1986-09-02 US US06/902,855 patent/US4731358A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| DE3380958D1 (de) | 1990-01-18 |
| IE56155B1 (en) | 1991-05-08 |
| DE3240514A1 (de) | 1984-05-03 |
| FI833918A0 (fi) | 1983-10-26 |
| DK495683D0 (da) | 1983-10-28 |
| DK495683A (da) | 1984-04-30 |
| EP0110814A3 (en) | 1985-07-24 |
| JPH0633260B2 (ja) | 1994-05-02 |
| ES526896A0 (es) | 1984-08-01 |
| CA1260475A (en) | 1989-09-26 |
| EP0110814B1 (de) | 1989-12-13 |
| AU568513B2 (en) | 1988-01-07 |
| AU2069483A (en) | 1984-05-03 |
| JPS5989678A (ja) | 1984-05-23 |
| NO833942L (no) | 1984-04-30 |
| HU198208B (en) | 1989-08-28 |
| ES8406477A1 (es) | 1984-08-01 |
| ATE48602T1 (de) | 1989-12-15 |
| FI833918A7 (fi) | 1984-04-30 |
| EP0110814A2 (de) | 1984-06-13 |
| US4731358A (en) | 1988-03-15 |
| ZA838072B (en) | 1984-06-27 |
| IE832529L (en) | 1984-04-29 |
| GR79637B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1984-10-31 |
| IL70077A0 (en) | 1984-01-31 |
| NZ205949A (en) | 1987-03-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DD213217A5 (de) | Verfahren zur herstellung von beta-carbolinen | |
| EP0115248B1 (de) | Substituierte 5H-Pyrimido(5,4-b)indole | |
| US3755340A (en) | Amino derivatives of pyrazolopyridine carboxylic acids and esters | |
| DD161210A5 (de) | Verfahren zur herstellung neuer 3-substituierter beta-carboline | |
| DE2614406A1 (de) | Tetracyclische verbindungen, verfahren zu deren herstellung und arzneimittel, enthaltend diese verbindungen | |
| EP0042100A1 (de) | Pyrazolopyridazin-Derivate, Zwischenprodukte und Verfahren zu deren Herstellung, sowie diese enthaltende Arzneimittel | |
| DE4034687C2 (de) | Isoindolderivate und ihre Salze, Verfahren zu deren Herstellung und deren Verwendung als Antitumor-Mittel | |
| DD223714A5 (de) | Verfahren zur herstellung von substituierten beta-carbolinderivaten | |
| EP0222693B1 (de) | Neue 3-Oxadiazol- und 3-Carbonsäure-beta-Carbolinderivate, ihre Herstellung und ihre Verwendung als Arzneimittel | |
| PL85030B1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| EP0386628B1 (de) | Verfahren zur Herstellung von Indolcarbonsäurederivaten | |
| DD158401A5 (de) | Verfahren zur herstellung eines 1-substituierten spiro[imidazolidin-4,3'-indolin]-2,2',5-trions | |
| EP0557497A1 (de) | NEUE $g(b)-CARBOLINDERIVATE, DEREN HERSTELLUNG UND VERWENDUNG IN ARZNEIMITTELN | |
| EP0130141A2 (de) | Neue beta-Carboline, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel (H) | |
| DD239794A5 (de) | Verfahren zur herstellung von 4-alkoxy-pyrido(2,3-d)-pyrimidin-derivaten | |
| NO831678L (no) | Fremgangsmaate for fremstilling av terapeutisk aktive pyrazolopyridin-derivater. | |
| EP0541757A1 (de) | NEUE HETARYLOXY-$g(b)-CARBOLINE, DEREN HERSTELLUNG UND VERWENDUNG IN ARZNEIMITTELN | |
| DE2740836A1 (de) | Anellierte indolderivate, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| US4012373A (en) | Pyrazolo[3',4'-2,3]pyrido[4,5-e]b-benzo-1,5-diazepinones | |
| CH644384A5 (de) | Imidazo(2',1':2,3)thiazolo(5,4-c)pyridine. | |
| DE2348149A1 (de) | Polycyclische verbindungen | |
| AU592637B2 (en) | Novel ergolene derivatives, pharmaceutical compositions containing them and process for preparing same | |
| DE3017564A1 (de) | Geminale dihalogenderivate kondensierter pyrimidin-4-on-verbindungen, verfahren zu deren herstellung und diese verbindungen enthaltende pharmazeutische kompositionen | |
| EP0115920A2 (en) | Pyrazino(2',3'-3,4)pyrido(1,2-a) indole derivatives | |
| EP0820454B1 (de) | Anellierte beta-carboline |