DD206781A5 - Verfahren zur herstellung von purinderivaten - Google Patents
Verfahren zur herstellung von purinderivaten Download PDFInfo
- Publication number
- DD206781A5 DD206781A5 DD83247593A DD24759383A DD206781A5 DD 206781 A5 DD206781 A5 DD 206781A5 DD 83247593 A DD83247593 A DD 83247593A DD 24759383 A DD24759383 A DD 24759383A DD 206781 A5 DD206781 A5 DD 206781A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- propoxymethyl
- guanine
- hydrogen
- purine
- hydroxy
- Prior art date
Links
- 150000003212 purines Chemical class 0.000 title claims abstract description 7
- 229940083251 peripheral vasodilators purine derivative Drugs 0.000 title claims abstract description 6
- 238000004519 manufacturing process Methods 0.000 title abstract description 7
- -1 1-ADAMANTYL Chemical class 0.000 claims abstract description 185
- 239000001257 hydrogen Substances 0.000 claims abstract description 65
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 65
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 34
- 150000002431 hydrogen Chemical class 0.000 claims abstract description 31
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 28
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical class [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 20
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 14
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 12
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 12
- 150000002367 halogens Chemical class 0.000 claims abstract description 12
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims abstract description 10
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 8
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims abstract description 6
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 claims abstract description 3
- UYTPUPDQBNUYGX-UHFFFAOYSA-N guanine Chemical compound O=C1NC(N)=NC2=C1N=CN2 UYTPUPDQBNUYGX-UHFFFAOYSA-N 0.000 claims description 248
- 150000001875 compounds Chemical class 0.000 claims description 154
- 238000000034 method Methods 0.000 claims description 32
- 238000002360 preparation method Methods 0.000 claims description 18
- 239000002253 acid Substances 0.000 claims description 17
- 150000003839 salts Chemical class 0.000 claims description 17
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 13
- 125000004414 alkyl thio group Chemical group 0.000 claims description 9
- 230000008569 process Effects 0.000 claims description 8
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 4
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims description 4
- 125000000143 2-carboxyethyl group Chemical group [H]OC(=O)C([H])([H])C([H])([H])* 0.000 claims description 3
- COELUGODEFADMG-UHFFFAOYSA-N [2-[(2-amino-6-oxo-3h-purin-9-yl)methoxy]-3-octanoyloxypropyl] octanoate Chemical compound N1=C(N)NC(=O)C2=C1N(COC(COC(=O)CCCCCCC)COC(=O)CCCCCCC)C=N2 COELUGODEFADMG-UHFFFAOYSA-N 0.000 claims description 3
- NSZKHEYZLNPIEJ-UHFFFAOYSA-N [3-acetyloxy-2-[(2-amino-6-oxo-3h-purin-9-yl)methoxy]propyl] acetate Chemical compound N1C(N)=NC(=O)C2=C1N(COC(COC(C)=O)COC(=O)C)C=N2 NSZKHEYZLNPIEJ-UHFFFAOYSA-N 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- PJWVIYVXUNFHQK-UHFFFAOYSA-N [2-[(2-amino-6-oxo-3h-purin-9-yl)methoxy]-3-(2,2-dimethylpropanoyloxy)propyl] 2,2-dimethylpropanoate Chemical compound N1=C(N)NC(=O)C2=C1N(COC(COC(=O)C(C)(C)C)COC(=O)C(C)(C)C)C=N2 PJWVIYVXUNFHQK-UHFFFAOYSA-N 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 230000000840 anti-viral effect Effects 0.000 abstract description 6
- SCVJRXQHFJXZFZ-KVQBGUIXSA-N 2-amino-9-[(2r,4s,5r)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3h-purine-6-thione Chemical compound C1=2NC(N)=NC(=S)C=2N=CN1[C@H]1C[C@H](O)[C@@H](CO)O1 SCVJRXQHFJXZFZ-KVQBGUIXSA-N 0.000 abstract description 2
- DWPIPTNBOVJYAD-BQKDNTBBSA-N (5s,7r)-3-aminoadamantan-1-ol Chemical compound C([C@H](C1)C2)[C@@H]3CC2(N)CC1(O)C3 DWPIPTNBOVJYAD-BQKDNTBBSA-N 0.000 abstract 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 abstract 1
- DUAJIKVIRGATIW-UHFFFAOYSA-N trinitrogen(.) Chemical class [N]=[N+]=[N-] DUAJIKVIRGATIW-UHFFFAOYSA-N 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 90
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 47
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 45
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 42
- 239000000243 solution Substances 0.000 description 42
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- 239000000203 mixture Substances 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 20
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 19
- 241001529453 unidentified herpesvirus Species 0.000 description 19
- 239000002904 solvent Substances 0.000 description 17
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 13
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- 241000700605 Viruses Species 0.000 description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 10
- 208000015181 infectious disease Diseases 0.000 description 10
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 9
- 239000004480 active ingredient Substances 0.000 description 9
- 150000005690 diesters Chemical class 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 241000699670 Mus sp. Species 0.000 description 8
- 235000011114 ammonium hydroxide Nutrition 0.000 description 8
- 239000002585 base Substances 0.000 description 8
- 238000009472 formulation Methods 0.000 description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 8
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 229960000583 acetic acid Drugs 0.000 description 7
- 238000001953 recrystallisation Methods 0.000 description 7
- 239000004094 surface-active agent Substances 0.000 description 7
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 6
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical class OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 208000036142 Viral infection Diseases 0.000 description 6
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- IRSCQMHQWWYFCW-UHFFFAOYSA-N ganciclovir Chemical compound O=C1NC(N)=NC2=C1N=CN2COC(CO)CO IRSCQMHQWWYFCW-UHFFFAOYSA-N 0.000 description 6
- 125000000468 ketone group Chemical group 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 125000005767 propoxymethyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])[#8]C([H])([H])* 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 6
- 230000009385 viral infection Effects 0.000 description 6
- OBOHMJWDFPBPKD-UHFFFAOYSA-N 1-[chloro(diphenyl)methyl]-4-methoxybenzene Chemical compound C1=CC(OC)=CC=C1C(Cl)(C=1C=CC=CC=1)C1=CC=CC=C1 OBOHMJWDFPBPKD-UHFFFAOYSA-N 0.000 description 5
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 5
- 239000000908 ammonium hydroxide Substances 0.000 description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 239000003480 eluent Substances 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- IPCSVZSSVZVIGE-UHFFFAOYSA-N palmitic acid group Chemical group C(CCCCCCCCCCCCCCC)(=O)O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 5
- 239000003380 propellant Substances 0.000 description 5
- 239000000376 reactant Substances 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- 229930194542 Keto Natural products 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 241000699666 Mus <mouse, genus> Species 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 150000008065 acid anhydrides Chemical class 0.000 description 4
- 239000000443 aerosol Substances 0.000 description 4
- 239000003443 antiviral agent Substances 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 239000006071 cream Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 4
- 229920000053 polysorbate 80 Polymers 0.000 description 4
- 125000006239 protecting group Chemical group 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- 241000271566 Aves Species 0.000 description 3
- 241000283690 Bos taurus Species 0.000 description 3
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 241000282412 Homo Species 0.000 description 3
- 241000701074 Human alphaherpesvirus 2 Species 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 229930040373 Paraformaldehyde Natural products 0.000 description 3
- 241000286209 Phasianidae Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- MHSVUSZEHNVFKW-UHFFFAOYSA-N bis-4-nitrophenyl phosphate Chemical compound C=1C=C([N+]([O-])=O)C=CC=1OP(=O)(O)OC1=CC=C([N+]([O-])=O)C=C1 MHSVUSZEHNVFKW-UHFFFAOYSA-N 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 3
- GILZZWCROUGLIS-UHFFFAOYSA-N n-(9-acetyl-6-oxo-3h-purin-2-yl)acetamide Chemical compound N1C(NC(=O)C)=NC(=O)C2=C1N(C(C)=O)C=N2 GILZZWCROUGLIS-UHFFFAOYSA-N 0.000 description 3
- 239000002674 ointment Substances 0.000 description 3
- 229920002866 paraformaldehyde Polymers 0.000 description 3
- 239000008194 pharmaceutical composition Substances 0.000 description 3
- 229940068918 polyethylene glycol 400 Drugs 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 3
- 239000000375 suspending agent Substances 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- JBWKIWSBJXDJDT-UHFFFAOYSA-N triphenylmethyl chloride Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 JBWKIWSBJXDJDT-UHFFFAOYSA-N 0.000 description 3
- UBOXGVDOUJQMTN-UHFFFAOYSA-N 1,1,2-trichloroethane Chemical compound ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 2
- ARLSYSVVBAMYKA-UHFFFAOYSA-N 1,3-bis(phenylmethoxy)propan-2-ol Chemical compound C=1C=CC=CC=1COCC(O)COCC1=CC=CC=C1 ARLSYSVVBAMYKA-UHFFFAOYSA-N 0.000 description 2
- PGZVFRAEAAXREB-UHFFFAOYSA-N 2,2-dimethylpropanoyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OC(=O)C(C)(C)C PGZVFRAEAAXREB-UHFFFAOYSA-N 0.000 description 2
- CHDQAAHKXDWKRD-UHFFFAOYSA-N 2-[[2-(n-benzhydryl-4-methoxyanilino)purin-9-yl]methoxy]propane-1,3-diol Chemical compound C1=CC(OC)=CC=C1N(C=1N=C2N(COC(CO)CO)C=NC2=CN=1)C(C=1C=CC=CC=1)C1=CC=CC=C1 CHDQAAHKXDWKRD-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- 241000251468 Actinopterygii Species 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 239000004255 Butylated hydroxyanisole Substances 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 2
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 2
- 241000283073 Equus caballus Species 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 208000006758 Marek Disease Diseases 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- PRXRUNOAOLTIEF-ADSICKODSA-N Sorbitan trioleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)[C@H]1OC[C@H](O)[C@H]1OC(=O)CCCCCCC\C=C/CCCCCCCC PRXRUNOAOLTIEF-ADSICKODSA-N 0.000 description 2
- 241000282898 Sus scrofa Species 0.000 description 2
- MNOWAMSYLDJFFI-UHFFFAOYSA-N [2-[(2-amino-6-oxo-3h-purin-9-yl)methoxy]-3-hexadecanoyloxypropyl] hexadecanoate Chemical compound N1=C(N)NC(=O)C2=C1N(COC(COC(=O)CCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCC)C=N2 MNOWAMSYLDJFFI-UHFFFAOYSA-N 0.000 description 2
- GVTNFWQYTOTCCD-UHFFFAOYSA-N [2-[(2-aminopurin-9-yl)methoxy]-3-octanoyloxypropyl] octanoate Chemical compound N1=C(N)N=C2N(COC(COC(=O)CCCCCCC)COC(=O)CCCCCCC)C=NC2=C1 GVTNFWQYTOTCCD-UHFFFAOYSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 150000001540 azides Chemical group 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 235000019282 butylated hydroxyanisole Nutrition 0.000 description 2
- CZBZUDVBLSSABA-UHFFFAOYSA-N butylated hydroxyanisole Chemical compound COC1=CC=C(O)C(C(C)(C)C)=C1.COC1=CC=C(O)C=C1C(C)(C)C CZBZUDVBLSSABA-UHFFFAOYSA-N 0.000 description 2
- 229940043253 butylated hydroxyanisole Drugs 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 238000004113 cell culture Methods 0.000 description 2
- 239000012320 chlorinating reagent Substances 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000000850 deacetylating effect Effects 0.000 description 2
- 231100000517 death Toxicity 0.000 description 2
- 230000034994 death Effects 0.000 description 2
- 230000007123 defense Effects 0.000 description 2
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- ARBOVOVUTSQWSS-UHFFFAOYSA-N hexadecanoyl chloride Chemical compound CCCCCCCCCCCCCCCC(Cl)=O ARBOVOVUTSQWSS-UHFFFAOYSA-N 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 238000007912 intraperitoneal administration Methods 0.000 description 2
- 239000002502 liposome Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 239000012528 membrane Substances 0.000 description 2
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000001301 oxygen Chemical group 0.000 description 2
- 229910052760 oxygen Chemical group 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 2
- 229940068968 polysorbate 80 Drugs 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 2
- 239000003223 protective agent Substances 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- 230000004083 survival effect Effects 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- CUNWUEBNSZSNRX-RKGWDQTMSA-N (2r,3r,4r,5s)-hexane-1,2,3,4,5,6-hexol;(z)-octadec-9-enoic acid Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.CCCCCCCC\C=C/CCCCCCCC(O)=O.CCCCCCCC\C=C/CCCCCCCC(O)=O.CCCCCCCC\C=C/CCCCCCCC(O)=O CUNWUEBNSZSNRX-RKGWDQTMSA-N 0.000 description 1
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical compound FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- KTKJGIZXXLWQLE-UHFFFAOYSA-N 1-[(4-methoxyphenyl)-diphenylmethoxy]-2-[(6-methylsulfanylpurin-9-yl)methoxy]propane-1,3-diol Chemical compound C1=CC(OC)=CC=C1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)OC(O)C(CO)OCN1C2=NC=NC(SC)=C2N=C1 KTKJGIZXXLWQLE-UHFFFAOYSA-N 0.000 description 1
- VWCUMTCXBIRRSG-UHFFFAOYSA-N 1-[chloro(diphenyl)methyl]-2-methoxybenzene Chemical compound COC1=CC=CC=C1C(Cl)(C=1C=CC=CC=1)C1=CC=CC=C1 VWCUMTCXBIRRSG-UHFFFAOYSA-N 0.000 description 1
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical class CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- VRMNUBZQJCWRKA-UHFFFAOYSA-N 2-[(2,6-diaminopurin-9-yl)methoxy]propane-1,3-diol Chemical compound NC1=NC(N)=C2N=CN(COC(CO)CO)C2=N1 VRMNUBZQJCWRKA-UHFFFAOYSA-N 0.000 description 1
- WVIKNNBFRIACOB-UHFFFAOYSA-N 2-[(2-amino-6-chloropurin-9-yl)methoxy]propane-1,3-diol Chemical compound NC1=NC(Cl)=C2N=CN(COC(CO)CO)C2=N1 WVIKNNBFRIACOB-UHFFFAOYSA-N 0.000 description 1
- AGSBKXGTESVDMQ-UHFFFAOYSA-N 2-[(2-amino-6-methoxypurin-9-yl)methoxy]propane-1,3-diol Chemical compound COC1=NC(N)=NC2=C1N=CN2COC(CO)CO AGSBKXGTESVDMQ-UHFFFAOYSA-N 0.000 description 1
- ZADISRFYMTWQNC-UHFFFAOYSA-N 2-[(6-aminopurin-9-yl)methoxy]propane-1,3-diol Chemical compound NC1=NC=NC2=C1N=CN2COC(CO)CO ZADISRFYMTWQNC-UHFFFAOYSA-N 0.000 description 1
- HERMFBZDJRPBID-UHFFFAOYSA-N 2-[(6-methylsulfanylpurin-9-yl)methoxy]propane-1,3-diol Chemical compound CSC1=NC=NC2=C1N=CN2COC(CO)CO HERMFBZDJRPBID-UHFFFAOYSA-N 0.000 description 1
- JQMFQLVAJGZSQS-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-N-(2-oxo-3H-1,3-benzoxazol-6-yl)acetamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)NC1=CC2=C(NC(O2)=O)C=C1 JQMFQLVAJGZSQS-UHFFFAOYSA-N 0.000 description 1
- PJPNYJLQKMAPER-UHFFFAOYSA-N 2-[[2,6-bis(methylamino)purin-9-yl]methoxy]-3-[(4-methoxyphenyl)-diphenylmethoxy]propan-1-ol Chemical compound C12=NC(NC)=NC(NC)=C2N=CN1COC(CO)COC(C=1C=CC(OC)=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 PJPNYJLQKMAPER-UHFFFAOYSA-N 0.000 description 1
- PSEFMWCDYHTZAU-UHFFFAOYSA-N 2-[[2,6-bis(n-benzhydryl-4-methoxyanilino)purin-9-yl]methoxy]-3-[(4-methoxyphenyl)-diphenylmethoxy]propan-1-ol Chemical compound C1=CC(OC)=CC=C1N(C=1N=C2N(COC(CO)COC(C=3C=CC=CC=3)(C=3C=CC=CC=3)C=3C=CC(OC)=CC=3)C=NC2=C(N(C(C=2C=CC=CC=2)C=2C=CC=CC=2)C=2C=CC(OC)=CC=2)N=1)C(C=1C=CC=CC=1)C1=CC=CC=C1 PSEFMWCDYHTZAU-UHFFFAOYSA-N 0.000 description 1
- OEBPZMJQPBASLO-UHFFFAOYSA-N 2-[[2-(dimethylamino)-6-methylsulfanylpurin-9-yl]methoxy]-3-[(4-methoxyphenyl)-diphenylmethoxy]propan-1-ol Chemical compound C1=CC(OC)=CC=C1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)OCC(CO)OCN1C2=NC(N(C)C)=NC(SC)=C2N=C1 OEBPZMJQPBASLO-UHFFFAOYSA-N 0.000 description 1
- KBGRAWMZWCGEPK-UHFFFAOYSA-N 2-[[2-(dimethylamino)purin-9-yl]methoxy]-3-[(4-methoxyphenyl)-diphenylmethoxy]propan-1-ol Chemical compound C1=CC(OC)=CC=C1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)OCC(CO)OCN1C2=NC(N(C)C)=NC=C2N=C1 KBGRAWMZWCGEPK-UHFFFAOYSA-N 0.000 description 1
- SWPCCNUVYRMLSN-UHFFFAOYSA-N 2-[[2-(dimethylamino)purin-9-yl]methoxy]propane-1,3-diol Chemical compound CN(C)C1=NC=C2N=CN(COC(CO)CO)C2=N1 SWPCCNUVYRMLSN-UHFFFAOYSA-N 0.000 description 1
- ZVURVHMFDMXYGJ-UHFFFAOYSA-N 2-[[2-(methylamino)purin-9-yl]methoxy]propane-1,3-diol Chemical compound CNC1=NC=C2N=CN(COC(CO)CO)C2=N1 ZVURVHMFDMXYGJ-UHFFFAOYSA-N 0.000 description 1
- PQQCAQHNISSONG-UHFFFAOYSA-N 2-[[2-(n-benzhydryl-4-methoxyanilino)-6-(methylamino)purin-9-yl]methoxy]-3-[(4-methoxyphenyl)-diphenylmethoxy]propan-1-ol Chemical compound C1=NC=2C(NC)=NC(N(C(C=3C=CC=CC=3)C=3C=CC=CC=3)C=3C=CC(OC)=CC=3)=NC=2N1COC(CO)COC(C=1C=CC(OC)=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 PQQCAQHNISSONG-UHFFFAOYSA-N 0.000 description 1
- VNIFRVNKNGVCBP-UHFFFAOYSA-N 2-[[2-(n-benzhydryl-4-methoxyanilino)-6-chloropurin-9-yl]methoxy]propane-1,3-diol Chemical compound C1=CC(OC)=CC=C1N(C=1N=C2N(COC(CO)CO)C=NC2=C(Cl)N=1)C(C=1C=CC=CC=1)C1=CC=CC=C1 VNIFRVNKNGVCBP-UHFFFAOYSA-N 0.000 description 1
- MYPZPQOUGKYHIN-UHFFFAOYSA-N 2-[[2-(n-benzhydryl-4-methoxyanilino)-6-methoxypurin-9-yl]methoxy]propane-1,3-diol Chemical compound C1=CC(OC)=CC=C1N(C=1N=C2N(COC(CO)CO)C=NC2=C(OC)N=1)C(C=1C=CC=CC=1)C1=CC=CC=C1 MYPZPQOUGKYHIN-UHFFFAOYSA-N 0.000 description 1
- SGBNWLDNKOPKDU-UHFFFAOYSA-N 2-[[2-(n-benzhydryl-4-methoxyanilino)-6-methylsulfanylpurin-9-yl]methoxy]-3-[(4-methoxyphenyl)-diphenylmethoxy]propan-1-ol Chemical compound C1=CC(OC)=CC=C1N(C=1N=C2N(COC(CO)COC(C=3C=CC=CC=3)(C=3C=CC=CC=3)C=3C=CC(OC)=CC=3)C=NC2=C(SC)N=1)C(C=1C=CC=CC=1)C1=CC=CC=C1 SGBNWLDNKOPKDU-UHFFFAOYSA-N 0.000 description 1
- BTMMQRMBZNHAAE-UHFFFAOYSA-N 2-[[2-(n-benzhydryl-4-methoxyanilino)purin-9-yl]methoxy]-3-[(4-methoxyphenyl)-diphenylmethoxy]propan-1-ol Chemical compound C1=CC(OC)=CC=C1N(C=1N=C2N(COC(CO)COC(C=3C=CC=CC=3)(C=3C=CC=CC=3)C=3C=CC(OC)=CC=3)C=NC2=CN=1)C(C=1C=CC=CC=1)C1=CC=CC=C1 BTMMQRMBZNHAAE-UHFFFAOYSA-N 0.000 description 1
- XWQXSLLWQMHLIJ-UHFFFAOYSA-N 2-[[2-chloro-6-(methylamino)purin-9-yl]methoxy]-3-[(4-methoxyphenyl)-diphenylmethoxy]propan-1-ol Chemical compound C1=NC=2C(NC)=NC(Cl)=NC=2N1COC(CO)COC(C=1C=CC(OC)=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 XWQXSLLWQMHLIJ-UHFFFAOYSA-N 0.000 description 1
- SBYFQPLBKOATFC-UHFFFAOYSA-N 2-[[6-(dimethylamino)purin-9-yl]methoxy]propane-1,3-diol Chemical compound CN(C)C1=NC=NC2=C1N=CN2COC(CO)CO SBYFQPLBKOATFC-UHFFFAOYSA-N 0.000 description 1
- ZQLWLYZLVBOIGX-UHFFFAOYSA-N 2-[[6-(methylamino)purin-9-yl]methoxy]propane-1,3-diol Chemical compound CNC1=NC=NC2=C1N=CN2COC(CO)CO ZQLWLYZLVBOIGX-UHFFFAOYSA-N 0.000 description 1
- BXHQYOCFHDINSC-UHFFFAOYSA-N 2-[[6-(n-benzhydryl-4-methoxyanilino)-2-chloropurin-9-yl]methoxy]-3-[(4-methoxyphenyl)-diphenylmethoxy]propan-1-ol Chemical compound C1=CC(OC)=CC=C1N(C=1C=2N=CN(COC(CO)COC(C=3C=CC=CC=3)(C=3C=CC=CC=3)C=3C=CC(OC)=CC=3)C=2N=C(Cl)N=1)C(C=1C=CC=CC=1)C1=CC=CC=C1 BXHQYOCFHDINSC-UHFFFAOYSA-N 0.000 description 1
- UFGNNCAUWKHOAW-UHFFFAOYSA-N 2-[[6-(n-benzhydryl-4-methoxyanilino)purin-9-yl]methoxy]-3-[(4-methoxyphenyl)-diphenylmethoxy]propan-1-ol Chemical compound C1=CC(OC)=CC=C1N(C=1C=2N=CN(COC(CO)COC(C=3C=CC=CC=3)(C=3C=CC=CC=3)C=3C=CC(OC)=CC=3)C=2N=CN=1)C(C=1C=CC=CC=1)C1=CC=CC=C1 UFGNNCAUWKHOAW-UHFFFAOYSA-N 0.000 description 1
- GHJNHBOOSXMBMS-UHFFFAOYSA-N 2-[[6-(n-benzhydryl-4-methoxyanilino)purin-9-yl]methoxy]propane-1,3-diol Chemical compound C1=CC(OC)=CC=C1N(C=1C=2N=CN(COC(CO)CO)C=2N=CN=1)C(C=1C=CC=CC=1)C1=CC=CC=C1 GHJNHBOOSXMBMS-UHFFFAOYSA-N 0.000 description 1
- VHFXCPYKPAGPFG-UHFFFAOYSA-N 2-[[6-amino-2-(methylamino)purin-9-yl]methoxy]propane-1,3-diol Chemical compound CNC1=NC(N)=C2N=CN(COC(CO)CO)C2=N1 VHFXCPYKPAGPFG-UHFFFAOYSA-N 0.000 description 1
- KCEBRNWRXRDLCR-UHFFFAOYSA-N 2-[[6-ethoxy-2-(methylamino)purin-9-yl]methoxy]-3-[(4-methoxyphenyl)-diphenylmethoxy]propan-1-ol Chemical compound C1=NC=2C(OCC)=NC(NC)=NC=2N1COC(CO)COC(C=1C=CC(OC)=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 KCEBRNWRXRDLCR-UHFFFAOYSA-N 0.000 description 1
- WYMKFDWQHCEJEI-UHFFFAOYSA-N 2-[[6-ethoxy-2-(methylamino)purin-9-yl]methoxy]propane-1,3-diol Chemical compound CCOC1=NC(NC)=NC2=C1N=CN2COC(CO)CO WYMKFDWQHCEJEI-UHFFFAOYSA-N 0.000 description 1
- FTOUMHGWACRMQP-UHFFFAOYSA-N 2-amino-1,3-dihydroxy-2-(propoxymethyl)-7H-purin-6-one Chemical compound O=C1N(O)C(COCCC)(N)N(O)C2=C1NC=N2 FTOUMHGWACRMQP-UHFFFAOYSA-N 0.000 description 1
- CMSWTOFIMJXKIH-UHFFFAOYSA-N 3-[(4-methoxyphenyl)-diphenylmethoxy]-2-[[6-(methylamino)purin-9-yl]methoxy]propan-1-ol Chemical compound C1=NC=2C(NC)=NC=NC=2N1COC(CO)COC(C=1C=CC(OC)=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 CMSWTOFIMJXKIH-UHFFFAOYSA-N 0.000 description 1
- QISOBCMNUJQOJU-UHFFFAOYSA-N 4-bromo-1h-pyrazole-5-carboxylic acid Chemical compound OC(=O)C=1NN=CC=1Br QISOBCMNUJQOJU-UHFFFAOYSA-N 0.000 description 1
- DGGUDQTUJAPWME-UHFFFAOYSA-N 4-chlorobutane-1,2,3-triol Chemical compound OCC(O)C(O)CCl DGGUDQTUJAPWME-UHFFFAOYSA-N 0.000 description 1
- PXRKCOCTEMYUEG-UHFFFAOYSA-N 5-aminoisoindole-1,3-dione Chemical compound NC1=CC=C2C(=O)NC(=O)C2=C1 PXRKCOCTEMYUEG-UHFFFAOYSA-N 0.000 description 1
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- 235000011437 Amygdalus communis Nutrition 0.000 description 1
- 241000272525 Anas platyrhynchos Species 0.000 description 1
- 201000004569 Blindness Diseases 0.000 description 1
- 241000701066 Bovine gammaherpesvirus 4 Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- DHRSNYNSVKYTRS-UHFFFAOYSA-N C1=CC(OC)=CC=C1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)OCC(CO)OCN1C2=NC=NC(N(C)C)=C2N=C1 Chemical compound C1=CC(OC)=CC=C1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)OCC(CO)OCN1C2=NC=NC(N(C)C)=C2N=C1 DHRSNYNSVKYTRS-UHFFFAOYSA-N 0.000 description 1
- OEOSLZXNZSJSMS-UHFFFAOYSA-N CCNC1=NC(N=[N+]=[N-])=NC2=C1N=CN2COC(CO)CO Chemical compound CCNC1=NC(N=[N+]=[N-])=NC2=C1N=CN2COC(CO)CO OEOSLZXNZSJSMS-UHFFFAOYSA-N 0.000 description 1
- LNPZXTLCYMMFPH-UHFFFAOYSA-N CCNC1=NC(N=[N+]=[N-])=NC2=C1N=CN2COC(CO)COC(=O)CC Chemical compound CCNC1=NC(N=[N+]=[N-])=NC2=C1N=CN2COC(CO)COC(=O)CC LNPZXTLCYMMFPH-UHFFFAOYSA-N 0.000 description 1
- 241000680578 Canid alphaherpesvirus 1 Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- 241000701022 Cytomegalovirus Species 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- HEBKCHPVOIAQTA-QWWZWVQMSA-N D-arabinitol Chemical compound OC[C@@H](O)C(O)[C@H](O)CO HEBKCHPVOIAQTA-QWWZWVQMSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 239000006145 Eagle's minimal essential medium Substances 0.000 description 1
- 241001598169 Equid alphaherpesvirus 3 Species 0.000 description 1
- 239000004386 Erythritol Substances 0.000 description 1
- UNXHWFMMPAWVPI-UHFFFAOYSA-N Erythritol Natural products OCC(O)C(O)CO UNXHWFMMPAWVPI-UHFFFAOYSA-N 0.000 description 1
- 208000001860 Eye Infections Diseases 0.000 description 1
- 241000282324 Felis Species 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000287828 Gallus gallus Species 0.000 description 1
- 241000701085 Human alphaherpesvirus 3 Species 0.000 description 1
- 241000701044 Human gammaherpesvirus 4 Species 0.000 description 1
- XQFRJNBWHJMXHO-RRKCRQDMSA-N IDUR Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(I)=C1 XQFRJNBWHJMXHO-RRKCRQDMSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 241001502481 Meleagrid alphaherpesvirus 1 Species 0.000 description 1
- LRTXTMFBDHIPRY-UHFFFAOYSA-N N(=[N+]=[N-])C1=NC(=C2N=CN(C2=N1)COC(CO)C(O)OC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=C(C=C1)OC)N=[N+]=[N-] Chemical compound N(=[N+]=[N-])C1=NC(=C2N=CN(C2=N1)COC(CO)C(O)OC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=C(C=C1)OC)N=[N+]=[N-] LRTXTMFBDHIPRY-UHFFFAOYSA-N 0.000 description 1
- BJSUSRIMCDVLOC-UHFFFAOYSA-N N(=[N+]=[N-])C1=NC(=C2N=CN(C2=N1)COC(CO)COC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=C(C=C1)OC)NCC Chemical compound N(=[N+]=[N-])C1=NC(=C2N=CN(C2=N1)COC(CO)COC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=C(C=C1)OC)NCC BJSUSRIMCDVLOC-UHFFFAOYSA-N 0.000 description 1
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 1
- ZUPLCRVIIZBMQF-UHFFFAOYSA-N N1=C(N=[N+]=[N-])N=C2N(COC(CO)CO)C=NC2=C1N=[N+]=[N-] Chemical compound N1=C(N=[N+]=[N-])N=C2N(COC(CO)CO)C=NC2=C1N=[N+]=[N-] ZUPLCRVIIZBMQF-UHFFFAOYSA-N 0.000 description 1
- VBTSJSQCSBOLJK-UHFFFAOYSA-N N1=C(N=[N+]=[N-])N=C2N(COC(CO)COC(=O)CCCCCCCCCCCCCCCCC)C=NC2=C1N=[N+]=[N-] Chemical compound N1=C(N=[N+]=[N-])N=C2N(COC(CO)COC(=O)CCCCCCCCCCCCCCCCC)C=NC2=C1N=[N+]=[N-] VBTSJSQCSBOLJK-UHFFFAOYSA-N 0.000 description 1
- AXGVOQXLJCMQNJ-UHFFFAOYSA-N N1=C(N=[N+]=[N-])N=C2N(COC(COC(=O)CCCCC)COC(=O)CCCCC)C=NC2=C1N=[N+]=[N-] Chemical compound N1=C(N=[N+]=[N-])N=C2N(COC(COC(=O)CCCCC)COC(=O)CCCCC)C=NC2=C1N=[N+]=[N-] AXGVOQXLJCMQNJ-UHFFFAOYSA-N 0.000 description 1
- JUKRPGQRENYGPK-UHFFFAOYSA-N N1=C(N=[N+]=[N-])N=C2N(COC(COC(=O)CCCCC)COC(=O)CCCCC)C=NC2=C1NCC Chemical compound N1=C(N=[N+]=[N-])N=C2N(COC(COC(=O)CCCCC)COC(=O)CCCCC)C=NC2=C1NCC JUKRPGQRENYGPK-UHFFFAOYSA-N 0.000 description 1
- FFKHJSQZNRUAQQ-UHFFFAOYSA-N N1=C(N=[N+]=[N-])N=C2N(COC(COC(=O)CCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCC)C=NC2=C1NCC Chemical compound N1=C(N=[N+]=[N-])N=C2N(COC(COC(=O)CCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCC)C=NC2=C1NCC FFKHJSQZNRUAQQ-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000004264 Petrolatum Substances 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- 241000220304 Prunus dulcis Species 0.000 description 1
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 1
- 241000700584 Simplexvirus Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- NWGKJDSIEKMTRX-AAZCQSIUSA-N Sorbitan monooleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O NWGKJDSIEKMTRX-AAZCQSIUSA-N 0.000 description 1
- HVUMOYIDDBPOLL-XWVZOOPGSA-N Sorbitan monostearate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O HVUMOYIDDBPOLL-XWVZOOPGSA-N 0.000 description 1
- 239000004147 Sorbitan trioleate Substances 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- NWGKJDSIEKMTRX-BFWOXRRGSA-N [(2r)-2-[(3r,4s)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] (z)-octadec-9-enoate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](O)C1OC[C@H](O)[C@H]1O NWGKJDSIEKMTRX-BFWOXRRGSA-N 0.000 description 1
- GDBPXOZUOLBXAR-UHFFFAOYSA-N [2-(chloromethoxy)-3-phenylmethoxypropoxy]methylbenzene Chemical compound C=1C=CC=CC=1COCC(OCCl)COCC1=CC=CC=C1 GDBPXOZUOLBXAR-UHFFFAOYSA-N 0.000 description 1
- OGFKWDVEHYLOKX-UHFFFAOYSA-N [2-[(2,6-diaminopurin-9-yl)methoxy]-3-(2,2-dimethylpropanoyloxy)propyl] 2,2-dimethylpropanoate Chemical compound N1=C(N)N=C2N(COC(COC(=O)C(C)(C)C)COC(=O)C(C)(C)C)C=NC2=C1N OGFKWDVEHYLOKX-UHFFFAOYSA-N 0.000 description 1
- SLFYVGWILNLDNU-UHFFFAOYSA-N [2-[(2,6-diaminopurin-9-yl)methoxy]-3-hydroxypropyl] 2-methylpropanoate Chemical compound N1=C(N)N=C2N(COC(CO)COC(=O)C(C)C)C=NC2=C1N SLFYVGWILNLDNU-UHFFFAOYSA-N 0.000 description 1
- PAGKFSGGNFXAOG-UHFFFAOYSA-N [2-[(2,6-diaminopurin-9-yl)methoxy]-3-octanoyloxypropyl] octanoate Chemical compound N1=C(N)N=C2N(COC(COC(=O)CCCCCCC)COC(=O)CCCCCCC)C=NC2=C1N PAGKFSGGNFXAOG-UHFFFAOYSA-N 0.000 description 1
- SIRVRCGRMGIHPA-UHFFFAOYSA-N [2-[(2-amino-6-methoxypurin-9-yl)methoxy]-3-(2,2-dimethylpropanoyloxy)propyl] 2,2-dimethylpropanoate Chemical compound COC1=NC(N)=NC2=C1N=CN2COC(COC(=O)C(C)(C)C)COC(=O)C(C)(C)C SIRVRCGRMGIHPA-UHFFFAOYSA-N 0.000 description 1
- SORMQPONPNOLGY-UHFFFAOYSA-N [2-[(2-amino-6-methylsulfanylpurin-9-yl)methoxy]-3-heptanoyloxypropyl] heptanoate Chemical compound N1=C(N)N=C2N(COC(COC(=O)CCCCCC)COC(=O)CCCCCC)C=NC2=C1SC SORMQPONPNOLGY-UHFFFAOYSA-N 0.000 description 1
- RNTGTCKIQKBCJJ-UHFFFAOYSA-N [2-[(2-amino-6-methylsulfanylpurin-9-yl)methoxy]-3-hydroxypropyl] 2,2-dimethylpropanoate Chemical compound CSC1=NC(N)=NC2=C1N=CN2COC(CO)COC(=O)C(C)(C)C RNTGTCKIQKBCJJ-UHFFFAOYSA-N 0.000 description 1
- GQQBHJWZQPSMSC-UHFFFAOYSA-N [2-[(2-amino-6-oxo-3h-purin-9-yl)methoxy]-3-octanoyloxypropyl] octanoate;hydrochloride Chemical compound Cl.N1=C(N)NC(=O)C2=C1N(COC(COC(=O)CCCCCCC)COC(=O)CCCCCCC)C=N2 GQQBHJWZQPSMSC-UHFFFAOYSA-N 0.000 description 1
- MRZKBHMECFXXNA-UHFFFAOYSA-N [2-[(2-aminopurin-9-yl)methoxy]-3-(2,2-dimethylpropanoyloxy)propyl] 2,2-dimethylpropanoate Chemical compound N1=C(N)N=C2N(COC(COC(=O)C(C)(C)C)COC(=O)C(C)(C)C)C=NC2=C1 MRZKBHMECFXXNA-UHFFFAOYSA-N 0.000 description 1
- UAGAYVCIZRWLNM-UHFFFAOYSA-N [2-[(2-aminopurin-9-yl)methoxy]-3-hydroxypropyl] octanoate Chemical compound N1=C(N)N=C2N(COC(CO)COC(=O)CCCCCCC)C=NC2=C1 UAGAYVCIZRWLNM-UHFFFAOYSA-N 0.000 description 1
- LDPWZJVMBNIFCP-UHFFFAOYSA-N [2-[(6-amino-2-chloropurin-9-yl)methoxy]-3-hydroxypropyl] heptanoate Chemical compound N1=C(Cl)N=C2N(COC(CO)COC(=O)CCCCCC)C=NC2=C1N LDPWZJVMBNIFCP-UHFFFAOYSA-N 0.000 description 1
- YGHXNJSGLDNOMU-UHFFFAOYSA-N [2-[(6-aminopurin-9-yl)methoxy]-3-(2-methylpropanoyloxy)propyl] 2-methylpropanoate Chemical compound N1=CN=C2N(COC(COC(=O)C(C)C)COC(=O)C(C)C)C=NC2=C1N YGHXNJSGLDNOMU-UHFFFAOYSA-N 0.000 description 1
- WTYMAHDCYGSHHG-UHFFFAOYSA-N [2-[(6-aminopurin-9-yl)methoxy]-3-dodecanoyloxypropyl] dodecanoate Chemical compound N1=CN=C2N(COC(COC(=O)CCCCCCCCCCC)COC(=O)CCCCCCCCCCC)C=NC2=C1N WTYMAHDCYGSHHG-UHFFFAOYSA-N 0.000 description 1
- UXZMHGQCZIZFJE-UHFFFAOYSA-N [2-[(6-aminopurin-9-yl)methoxy]-3-oct-4-enoyloxypropyl] oct-4-enoate Chemical compound N1=CN=C2N(COC(COC(=O)CCC=CCCC)COC(=O)CCC=CCCC)C=NC2=C1N UXZMHGQCZIZFJE-UHFFFAOYSA-N 0.000 description 1
- KMCJYRALPHJSNE-UHFFFAOYSA-N [2-[(6-aminopurin-9-yl)methoxy]-3-octadecanoyloxypropyl] octadecanoate Chemical compound N1=CN=C2N(COC(COC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCC)C=NC2=C1N KMCJYRALPHJSNE-UHFFFAOYSA-N 0.000 description 1
- UBVPASYOQAEYPN-UHFFFAOYSA-N [2-[[2,6-bis(methylamino)purin-9-yl]methoxy]-3-decanoyloxypropyl] decanoate Chemical compound N1=C(NC)N=C2N(COC(COC(=O)CCCCCCCCC)COC(=O)CCCCCCCCC)C=NC2=C1NC UBVPASYOQAEYPN-UHFFFAOYSA-N 0.000 description 1
- LKSWGABTHOARGH-UHFFFAOYSA-N [2-[[2-(dimethylamino)-6-(methylamino)purin-9-yl]methoxy]-3-hydroxypropyl] hexadecanoate Chemical compound N1=C(N(C)C)N=C2N(COC(CO)COC(=O)CCCCCCCCCCCCCCC)C=NC2=C1NC LKSWGABTHOARGH-UHFFFAOYSA-N 0.000 description 1
- VDHBEUVVZLHUMH-UHFFFAOYSA-N [2-[[2-(dimethylamino)-6-methylsulfanylpurin-9-yl]methoxy]-3-(2,2-dimethylpropanoyloxy)propyl] 2,2-dimethylpropanoate Chemical compound CSC1=NC(N(C)C)=NC2=C1N=CN2COC(COC(=O)C(C)(C)C)COC(=O)C(C)(C)C VDHBEUVVZLHUMH-UHFFFAOYSA-N 0.000 description 1
- ISFQSKSVNQVRFO-UHFFFAOYSA-N [2-[[2-(dimethylamino)purin-9-yl]methoxy]-3-nonanoyloxypropyl] nonanoate Chemical compound N1=C(N(C)C)N=C2N(COC(COC(=O)CCCCCCCC)COC(=O)CCCCCCCC)C=NC2=C1 ISFQSKSVNQVRFO-UHFFFAOYSA-N 0.000 description 1
- JHRVWPYTOLEEIT-UHFFFAOYSA-N [2-[[2-(methylamino)purin-9-yl]methoxy]-3-propanoyloxypropyl] propanoate Chemical compound N1=C(NC)N=C2N(COC(COC(=O)CC)COC(=O)CC)C=NC2=C1 JHRVWPYTOLEEIT-UHFFFAOYSA-N 0.000 description 1
- AVQXVCFJHABKRK-UHFFFAOYSA-N [2-[[2-(n-benzhydryl-4-methoxyanilino)-6-(methylamino)purin-9-yl]methoxy]-3-hexadecanoyloxypropyl] hexadecanoate Chemical compound N1=C2N(COC(COC(=O)CCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCC)C=NC2=C(NC)N=C1N(C=1C=CC(OC)=CC=1)C(C=1C=CC=CC=1)C1=CC=CC=C1 AVQXVCFJHABKRK-UHFFFAOYSA-N 0.000 description 1
- JNMYQAXQBDXTBS-UHFFFAOYSA-N [2-[[2-(n-benzhydryl-4-methoxyanilino)-6-methoxypurin-9-yl]methoxy]-3-butanoyloxypropyl] butanoate Chemical compound N1=C2N(COC(COC(=O)CCC)COC(=O)CCC)C=NC2=C(OC)N=C1N(C=1C=CC(OC)=CC=1)C(C=1C=CC=CC=1)C1=CC=CC=C1 JNMYQAXQBDXTBS-UHFFFAOYSA-N 0.000 description 1
- DXYIZJMZLHTAIM-UHFFFAOYSA-N [2-[[2-amino-6-(methylamino)purin-9-yl]methoxy]-3-butanoyloxypropyl] butanoate Chemical compound N1=C(N)N=C2N(COC(COC(=O)CCC)COC(=O)CCC)C=NC2=C1NC DXYIZJMZLHTAIM-UHFFFAOYSA-N 0.000 description 1
- WDXZEJACTQZLMI-UHFFFAOYSA-N [2-[[2-amino-6-(methylamino)purin-9-yl]methoxy]-3-hydroxypropyl] hexanoate Chemical compound N1=C(N)N=C2N(COC(CO)COC(=O)CCCCC)C=NC2=C1NC WDXZEJACTQZLMI-UHFFFAOYSA-N 0.000 description 1
- MMYICWJTFVXNJR-UHFFFAOYSA-N [2-[[2-chloro-6-(methylamino)purin-9-yl]methoxy]-3-hydroxypropyl] acetate Chemical compound CNC1=NC(Cl)=NC2=C1N=CN2COC(CO)COC(C)=O MMYICWJTFVXNJR-UHFFFAOYSA-N 0.000 description 1
- BZWWMXJUQQSZCS-UHFFFAOYSA-N [2-[[2-chloro-6-(methylamino)purin-9-yl]methoxy]-3-pentanoyloxypropyl] pentanoate Chemical compound N1=C(Cl)N=C2N(COC(COC(=O)CCCC)COC(=O)CCCC)C=NC2=C1NC BZWWMXJUQQSZCS-UHFFFAOYSA-N 0.000 description 1
- HNQTVUFXRUVXKT-UHFFFAOYSA-N [2-[[6-(dimethylamino)purin-9-yl]methoxy]-3-(2,2-dimethylpropanoyloxy)propyl] 2,2-dimethylpropanoate Chemical compound CN(C)C1=NC=NC2=C1N=CN2COC(COC(=O)C(C)(C)C)COC(=O)C(C)(C)C HNQTVUFXRUVXKT-UHFFFAOYSA-N 0.000 description 1
- XEXGCZBZSWZFCV-UHFFFAOYSA-N [2-[[6-(dimethylamino)purin-9-yl]methoxy]-3-dodecanoyloxypropyl] dodecanoate Chemical compound N1=CN=C2N(COC(COC(=O)CCCCCCCCCCC)COC(=O)CCCCCCCCCCC)C=NC2=C1N(C)C XEXGCZBZSWZFCV-UHFFFAOYSA-N 0.000 description 1
- KYMWTQBJHZLVAC-UHFFFAOYSA-N [2-[[6-(methylamino)purin-9-yl]methoxy]-3-pentanoyloxypropyl] pentanoate Chemical compound N1=CN=C2N(COC(COC(=O)CCCC)COC(=O)CCCC)C=NC2=C1NC KYMWTQBJHZLVAC-UHFFFAOYSA-N 0.000 description 1
- GDJUFKFGUYJBCF-UHFFFAOYSA-N [2-[[6-(n-benzhydryl-4-methoxyanilino)-2-(methylamino)purin-9-yl]methoxy]-3-tetradecanoyloxypropyl] tetradecanoate Chemical compound N1=C(NC)N=C2N(COC(COC(=O)CCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCC)C=NC2=C1N(C=1C=CC(OC)=CC=1)C(C=1C=CC=CC=1)C1=CC=CC=C1 GDJUFKFGUYJBCF-UHFFFAOYSA-N 0.000 description 1
- VOFNWKAMNNAFFL-UHFFFAOYSA-N [2-[[6-amino-2-(methylamino)purin-9-yl]methoxy]-3-hydroxypropyl] pentanoate Chemical compound N1=C(NC)N=C2N(COC(CO)COC(=O)CCCC)C=NC2=C1N VOFNWKAMNNAFFL-UHFFFAOYSA-N 0.000 description 1
- YLVQQDWPJDWPTA-UHFFFAOYSA-N [2-[[6-amino-2-(methylamino)purin-9-yl]methoxy]-3-propanoyloxypropyl] propanoate Chemical compound N1=C(NC)N=C2N(COC(COC(=O)CC)COC(=O)CC)C=NC2=C1N YLVQQDWPJDWPTA-UHFFFAOYSA-N 0.000 description 1
- HQUJGASNFXDFOV-UHFFFAOYSA-N [2-[[6-amino-2-(methylamino)purin-9-yl]methoxy]-3-tetradecanoyloxypropyl] tetradecanoate Chemical compound N1=C(NC)N=C2N(COC(COC(=O)CCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCC)C=NC2=C1N HQUJGASNFXDFOV-UHFFFAOYSA-N 0.000 description 1
- XZNRFPUDBAIJBT-UHFFFAOYSA-N [3-acetyloxy-2-[(2,6-diaminopurin-9-yl)methoxy]propyl] acetate Chemical compound N1=C(N)N=C2N(COC(COC(C)=O)COC(=O)C)C=NC2=C1N XZNRFPUDBAIJBT-UHFFFAOYSA-N 0.000 description 1
- FPEPQAXZXQNIHT-UHFFFAOYSA-N [3-acetyloxy-2-[(2-amino-6-chloropurin-9-yl)methoxy]propyl] acetate Chemical compound N1=C(N)N=C2N(COC(COC(C)=O)COC(=O)C)C=NC2=C1Cl FPEPQAXZXQNIHT-UHFFFAOYSA-N 0.000 description 1
- QPWOPRMODAKWRJ-UHFFFAOYSA-N [3-acetyloxy-2-[(6-methylsulfanylpurin-9-yl)methoxy]propyl] acetate Chemical compound CSC1=NC=NC2=C1N=CN2COC(COC(C)=O)COC(C)=O QPWOPRMODAKWRJ-UHFFFAOYSA-N 0.000 description 1
- QCYDAPLEKYZLGG-UHFFFAOYSA-N [3-acetyloxy-2-[[2,6-bis(n-benzhydryl-4-methoxyanilino)purin-9-yl]methoxy]propyl] acetate Chemical compound C1=CC(OC)=CC=C1N(C=1N=C2N(COC(COC(C)=O)COC(C)=O)C=NC2=C(N(C(C=2C=CC=CC=2)C=2C=CC=CC=2)C=2C=CC(OC)=CC=2)N=1)C(C=1C=CC=CC=1)C1=CC=CC=C1 QCYDAPLEKYZLGG-UHFFFAOYSA-N 0.000 description 1
- ZSYZGRHGEZXXPM-UHFFFAOYSA-N [3-acetyloxy-2-[[2-(n-benzhydryl-4-methoxyanilino)-6-methoxypurin-9-yl]methoxy]propyl] acetate Chemical compound C1=CC(OC)=CC=C1N(C=1N=C2N(COC(COC(C)=O)COC(C)=O)C=NC2=C(OC)N=1)C(C=1C=CC=CC=1)C1=CC=CC=C1 ZSYZGRHGEZXXPM-UHFFFAOYSA-N 0.000 description 1
- ZHNYAJYWTNTKSR-UHFFFAOYSA-N [3-acetyloxy-2-[[2-(n-benzhydryl-4-methoxyanilino)-6-methylsulfanylpurin-9-yl]methoxy]propyl] acetate Chemical compound C1=CC(OC)=CC=C1N(C=1N=C2N(COC(COC(C)=O)COC(C)=O)C=NC2=C(SC)N=1)C(C=1C=CC=CC=1)C1=CC=CC=C1 ZHNYAJYWTNTKSR-UHFFFAOYSA-N 0.000 description 1
- ZCCABUWSZZJRKY-UHFFFAOYSA-N [3-acetyloxy-2-[[2-(n-benzhydryl-4-methoxyanilino)purin-9-yl]methoxy]propyl] acetate Chemical compound C1=CC(OC)=CC=C1N(C=1N=C2N(COC(COC(C)=O)COC(C)=O)C=NC2=CN=1)C(C=1C=CC=CC=1)C1=CC=CC=C1 ZCCABUWSZZJRKY-UHFFFAOYSA-N 0.000 description 1
- DAKIRGOGUUJUAB-UHFFFAOYSA-N [3-acetyloxy-2-[[6-(n-benzhydryl-4-methoxyanilino)-2-(methylamino)purin-9-yl]methoxy]propyl] acetate Chemical compound C=12N=CN(COC(COC(C)=O)COC(C)=O)C2=NC(NC)=NC=1N(C=1C=CC(OC)=CC=1)C(C=1C=CC=CC=1)C1=CC=CC=C1 DAKIRGOGUUJUAB-UHFFFAOYSA-N 0.000 description 1
- DRZKHMMLJOCALQ-UHFFFAOYSA-N [3-acetyloxy-2-[[6-(n-benzhydryl-4-methoxyanilino)purin-9-yl]methoxy]propyl] acetate Chemical compound C1=CC(OC)=CC=C1N(C=1C=2N=CN(COC(COC(C)=O)COC(C)=O)C=2N=CN=1)C(C=1C=CC=CC=1)C1=CC=CC=C1 DRZKHMMLJOCALQ-UHFFFAOYSA-N 0.000 description 1
- IRTCLSBZVIQYQC-UHFFFAOYSA-N [3-hexadecanoyloxy-2-[(6-methylsulfanylpurin-9-yl)methoxy]propyl] hexadecanoate Chemical compound N1=CN=C2N(COC(COC(=O)CCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCC)C=NC2=C1SC IRTCLSBZVIQYQC-UHFFFAOYSA-N 0.000 description 1
- KQQAASREQCQBEF-UHFFFAOYSA-N [3-hydroxy-2-[[2-(methylamino)purin-9-yl]methoxy]propyl] dodecanoate Chemical compound N1=C(NC)N=C2N(COC(CO)COC(=O)CCCCCCCCCCC)C=NC2=C1 KQQAASREQCQBEF-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- MIBQYWIOHFTKHD-UHFFFAOYSA-N adamantane-1-carbonyl chloride Chemical compound C1C(C2)CC3CC2CC1(C(=O)Cl)C3 MIBQYWIOHFTKHD-UHFFFAOYSA-N 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 235000020224 almond Nutrition 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- 235000012501 ammonium carbonate Nutrition 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 description 1
- WXBLLCUINBKULX-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1.OC(=O)C1=CC=CC=C1 WXBLLCUINBKULX-UHFFFAOYSA-N 0.000 description 1
- 125000006515 benzyloxy alkyl group Chemical group 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- UUCBJORVOQODID-UHFFFAOYSA-N bis(1-adamantyl) 3-[(2-aminopurin-9-yl)methoxy]pentanedioate Chemical compound C1C(C2)CC(C3)CC2CC13OC(=O)CC(CC(=O)OC12CC3CC(CC(C3)C1)C2)OCN1C=NC2=CN=C(N)N=C21 UUCBJORVOQODID-UHFFFAOYSA-N 0.000 description 1
- ZOUZMVDVDGNNMR-UHFFFAOYSA-N bis(1-adamantyl) 3-[[2-(n-benzhydryl-4-methoxyanilino)purin-9-yl]methoxy]pentanedioate Chemical compound C1=CC(OC)=CC=C1N(C=1N=C2N(COC(CC(=O)OC34CC5CC(CC(C5)C3)C4)CC(=O)OC34CC5CC(CC(C5)C3)C4)C=NC2=CN=1)C(C=1C=CC=CC=1)C1=CC=CC=C1 ZOUZMVDVDGNNMR-UHFFFAOYSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000005708 carbonyloxy group Chemical group [*:2]OC([*:1])=O 0.000 description 1
- 241001233037 catfish Species 0.000 description 1
- 239000006285 cell suspension Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 235000013330 chicken meat Nutrition 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 230000001010 compromised effect Effects 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 229960005215 dichloroacetic acid Drugs 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000005066 dodecenyl group Chemical group C(=CCCCCCCCCCC)* 0.000 description 1
- 239000003651 drinking water Substances 0.000 description 1
- 235000020188 drinking water Nutrition 0.000 description 1
- 238000012377 drug delivery Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- UNXHWFMMPAWVPI-ZXZARUISSA-N erythritol Chemical compound OC[C@H](O)[C@H](O)CO UNXHWFMMPAWVPI-ZXZARUISSA-N 0.000 description 1
- 235000019414 erythritol Nutrition 0.000 description 1
- 229940009714 erythritol Drugs 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000006232 ethoxy propyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000012737 fresh medium Substances 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000005826 halohydrocarbons Chemical class 0.000 description 1
- 208000002672 hepatitis B Diseases 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000008309 hydrophilic cream Substances 0.000 description 1
- 150000001261 hydroxy acids Chemical class 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- BWHLPLXXIDYSNW-UHFFFAOYSA-N ketorolac tromethamine Chemical compound OCC(N)(CO)CO.OC(=O)C1CCN2C1=CC=C2C(=O)C1=CC=CC=C1 BWHLPLXXIDYSNW-UHFFFAOYSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 231100000518 lethal Toxicity 0.000 description 1
- 230000001665 lethal effect Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N mandelic acid Chemical compound OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- HEBKCHPVOIAQTA-UHFFFAOYSA-N meso ribitol Natural products OCC(O)C(O)C(O)CO HEBKCHPVOIAQTA-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 150000003956 methylamines Chemical group 0.000 description 1
- 229960002216 methylparaben Drugs 0.000 description 1
- YACKEPLHDIMKIO-UHFFFAOYSA-N methylphosphonic acid Chemical compound CP(O)(O)=O YACKEPLHDIMKIO-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001298 n-hexoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 125000004712 n-pentylthio group Chemical group C(CCCC)S* 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- REEZZSHJLXOIHL-UHFFFAOYSA-N octanoyl chloride Chemical compound CCCCCCCC(Cl)=O REEZZSHJLXOIHL-UHFFFAOYSA-N 0.000 description 1
- 239000003883 ointment base Substances 0.000 description 1
- 235000021313 oleic acid Nutrition 0.000 description 1
- 150000002889 oleic acids Chemical class 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- NXJCBFBQEVOTOW-UHFFFAOYSA-L palladium(2+);dihydroxide Chemical compound O[Pd]O NXJCBFBQEVOTOW-UHFFFAOYSA-L 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 229940066842 petrolatum Drugs 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical group [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Chemical group 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- 229960004063 propylene glycol Drugs 0.000 description 1
- 229960003415 propylparaben Drugs 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000001593 sorbitan monooleate Substances 0.000 description 1
- 235000011069 sorbitan monooleate Nutrition 0.000 description 1
- 229940035049 sorbitan monooleate Drugs 0.000 description 1
- 229960005078 sorbitan sesquioleate Drugs 0.000 description 1
- 235000019337 sorbitan trioleate Nutrition 0.000 description 1
- 229960000391 sorbitan trioleate Drugs 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 239000007916 tablet composition Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 239000012049 topical pharmaceutical composition Substances 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
- 230000001018 virulence Effects 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/02—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/03—Ethers having all ether-oxygen atoms bound to acyclic carbon atoms
- C07C43/14—Unsaturated ethers
- C07C43/178—Unsaturated ethers containing hydroxy or O-metal groups
- C07C43/1785—Unsaturated ethers containing hydroxy or O-metal groups having more than one ether bound
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/03—Ethers having all ether-oxygen atoms bound to acyclic carbon atoms
- C07C43/14—Unsaturated ethers
- C07C43/178—Unsaturated ethers containing hydroxy or O-metal groups
- C07C43/1786—Unsaturated ethers containing hydroxy or O-metal groups containing halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US34470382A | 1982-02-01 | 1982-02-01 | |
| US07/451,262 US5250535A (en) | 1982-02-01 | 1982-12-22 | Substituted 9-(1 or 3-monoacyloxy or 1,3-diacyloxy-2-propoxymethyl) purines as antiviral agent |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD206781A5 true DD206781A5 (de) | 1984-02-08 |
Family
ID=26994067
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD83247593A DD206781A5 (de) | 1982-02-01 | 1983-01-31 | Verfahren zur herstellung von purinderivaten |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US5250535A (enExample) |
| EP (1) | EP0085424A3 (enExample) |
| KR (1) | KR890000191B1 (enExample) |
| AU (2) | AU572777B2 (enExample) |
| BR (1) | BR8300475A (enExample) |
| DD (1) | DD206781A5 (enExample) |
| DK (1) | DK29183A (enExample) |
| ES (1) | ES8504194A1 (enExample) |
| FI (1) | FI79851C (enExample) |
| GR (1) | GR81321B (enExample) |
| HU (1) | HU193874B (enExample) |
| IL (1) | IL67791A0 (enExample) |
| IN (1) | IN157856B (enExample) |
| NO (1) | NO161372C (enExample) |
| NZ (1) | NZ203128A (enExample) |
| PH (5) | PH19203A (enExample) |
| PL (1) | PL140556B1 (enExample) |
| PT (1) | PT76149B (enExample) |
| RO (3) | RO86234B (enExample) |
| ZW (1) | ZW2583A1 (enExample) |
Families Citing this family (52)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES8403128A1 (es) * | 1981-08-11 | 1983-10-01 | Wellcome Found | "un procedimiento para preparar derivados de purina". |
| US4816447A (en) * | 1981-08-26 | 1989-03-28 | Merck & Co., Inc. | Anti-viral guanine compounds |
| NZ205955A (en) * | 1982-10-14 | 1988-02-29 | Wellcome Found | 2-amino-9-(2-hydroxyethoxymethyl)-9h-purine |
| US4609662A (en) * | 1982-10-14 | 1986-09-02 | Burroughs Wellcome Co. | Method for using purine derivatives |
| US4544634A (en) * | 1982-10-14 | 1985-10-01 | Burroughs Wellcome Co. | Method of producing acyclovir |
| US4880820A (en) * | 1983-06-24 | 1989-11-14 | Merck & Co., Inc. | Guanine derivatives |
| EP0138683A3 (en) * | 1983-09-30 | 1988-01-20 | Merck & Co. Inc. | Purine derivatives, their application in anti-viral compositions |
| US4897479A (en) * | 1983-09-30 | 1990-01-30 | Merck & Co., Inc. | Arylsulfonyloxy purine intermediates |
| IE842642L (en) * | 1983-10-31 | 1985-04-30 | Harvard College | Purine Derivatives |
| IL73682A (en) * | 1983-12-20 | 1991-08-16 | Medivir Ab | Antiviral pharmaceutical compositions containing 9-hydroxy aliphatic derivatives of guanine,some new such derivatives and process for their preparation |
| DE3571810D1 (en) * | 1984-01-26 | 1989-08-31 | Merck & Co Inc | Substituted butyl guanines and their utilization in antiviral compositions |
| US4579849A (en) * | 1984-04-06 | 1986-04-01 | Merck & Co., Inc. | N-alkylguanine acyclonucleosides as antiviral agents |
| EP0190123A1 (en) * | 1984-07-20 | 1986-08-13 | GAUNTT, Charles, O. | Immunoregulatory and anti-viral compound |
| DK168213B1 (da) * | 1984-12-12 | 1994-02-28 | Syntex Inc | Alkoxymethylether- og alkoxymethylesterderivater af glycerol og fremgangsmåde til fremstilling af 9-(1,3-dihydroxy-2-propoxymethyl)guanin og ethere og estere deraf |
| NZ216172A (en) * | 1985-05-15 | 1989-08-29 | Wellcome Found | Nucleosides and pharmaceutical compositions |
| DE3627024A1 (de) * | 1985-09-24 | 1987-04-02 | Hoechst Ag | In 6- und 9-stellung substituierte 2-aminopurine, ihre verwendung, diese purine enthaltende arzneimittel und verfahren zur herstellung der purine |
| US4966895A (en) * | 1989-02-02 | 1990-10-30 | Merck & Co. Inc. | Cyclic monophosphates of purine and pyrimidine acyclonucleosides as anti-retroviral agents |
| IE980216A1 (en) * | 1989-04-17 | 2000-02-23 | Scotia Holdings Plc | Anti-virals |
| GB2260319B (en) | 1991-10-07 | 1995-12-06 | Norsk Hydro As | Acyl derivatives of nucleosides and nucleoside analogues having anti-viral activity |
| US5670506A (en) * | 1993-04-05 | 1997-09-23 | Cell Therapeutics, Inc. | Halogen, isothiocyanate or azide substituted xanthines |
| US5565565A (en) * | 1994-08-04 | 1996-10-15 | Syntex (U.S.A.) Inc. | Preparation of N-9 substituted guanine compounds |
| US6200980B1 (en) | 1995-06-07 | 2001-03-13 | Cell Pathways, Inc. | Method of treating a patient having precancerous lesions with phenyl purinone derivatives |
| US6060477A (en) * | 1995-06-07 | 2000-05-09 | Cell Pathways, Inc. | Method of treating a patient having precancerous lesions with phenyl cycloamino pyrimidinone derivatives |
| US6046216A (en) * | 1995-06-07 | 2000-04-04 | Cell Pathways, Inc. | Method of treating a patient having precancerous lesions with phenyl pyridinone derivatives |
| US6262059B1 (en) | 1995-06-07 | 2001-07-17 | Cell Pathways, Inc. | Method of treating a patient having precancerous lesions with quinazoline derivatives |
| US6046206A (en) * | 1995-06-07 | 2000-04-04 | Cell Pathways, Inc. | Method of treating a patient having a precancerous lesions with amide quinazoline derivatives |
| US6232312B1 (en) | 1995-06-07 | 2001-05-15 | Cell Pathways, Inc. | Method for treating patient having precancerous lesions with a combination of pyrimidopyrimidine derivatives and esters and amides of substituted indenyl acetic acides |
| US5874440A (en) * | 1995-06-07 | 1999-02-23 | Cell Pathways, Inc. | Method of treating a patient having precancerous lesions with phenyl pyrimidinone derivatives |
| US5840890A (en) * | 1996-01-26 | 1998-11-24 | Syntex (U.S.A.) Inc. | Process for preparing a 2-(2-amino-1,6-dihydro-6-oxo-purin-9-yl)methoxy-1,3-propanediol derivative |
| CA2238283C (en) | 1997-05-30 | 2002-08-20 | Cell Pathways, Inc. | Method for identifying compounds for inhibition of neoplastic lesions, pharmaceutical compositions from such compounds and uses of such compounds and compositions for treating neoplastic lesions |
| US5858694A (en) * | 1997-05-30 | 1999-01-12 | Cell Pathways, Inc. | Method for identifying compounds for inhibition of cancerous lesions |
| US5852035A (en) * | 1997-12-12 | 1998-12-22 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells and related conditions by exposure to substituted N- arylmethyl and heterocyclmethyl-1H-pyrazolo (3,4-B) quinolin-4-amines |
| US6410584B1 (en) * | 1998-01-14 | 2002-06-25 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells with indole derivatives |
| US6046199A (en) * | 1998-01-14 | 2000-04-04 | Cell Pathways, Inc. | Method of inhibiting neoplastic cells with tetracyclic pyrido[3,4-B]indole derivatives |
| US5942520A (en) * | 1998-01-27 | 1999-08-24 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells by exposure to substituted N-cycloalkylmethyl-1-H-pyrazolo (3,4-B) quinolone-4 amines |
| US5990117A (en) * | 1998-04-15 | 1999-11-23 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells and related conditions by exposure to quinazoline derivatives |
| US6180629B1 (en) | 1998-08-14 | 2001-01-30 | Cell Pathways, Inc. | [4,5]-Fused-1,3-disubstituted-1,2-diazine-6-one derivatives with nitrogen containing substitutents in position one for the treatment of neoplasia |
| US6268372B1 (en) | 1998-09-11 | 2001-07-31 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells and related conditions by exposure to 2,9-disubstituted purin-6-ones |
| US6124303A (en) * | 1998-09-11 | 2000-09-26 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells and related conditions by exposure to 9-substituted 2-(2-N-aloxyphenyl) purin-6-ones |
| US6200771B1 (en) | 1998-10-15 | 2001-03-13 | Cell Pathways, Inc. | Method of using a novel phosphodiesterase in pharmaceutical screeing to identify compounds for treatment of neoplasia |
| US6130053A (en) * | 1999-08-03 | 2000-10-10 | Cell Pathways, Inc. | Method for selecting compounds for inhibition of neoplastic lesions |
| US6133271A (en) * | 1998-11-19 | 2000-10-17 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells and related conditions by exposure thienopyrimidine derivatives |
| US6187779B1 (en) | 1998-11-20 | 2001-02-13 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells and related conditions by exposure to 2,8-disubstituted quinazoline derivatives |
| US6369092B1 (en) | 1998-11-23 | 2002-04-09 | Cell Pathways, Inc. | Method for treating neoplasia by exposure to substituted benzimidazole derivatives |
| US6486155B1 (en) | 1998-11-24 | 2002-11-26 | Cell Pathways Inc | Method of inhibiting neoplastic cells with isoquinoline derivatives |
| US6077842A (en) * | 1998-11-24 | 2000-06-20 | Cell Pathways, Inc. | Method of inhibiting neoplastic cells with pyrazolopyridylpyridazinone derivatives |
| US6034099A (en) * | 1998-11-24 | 2000-03-07 | Cell Pathways, Inc. | Method for inhibiting neoplastic lesions by administering 4-(arylmethylene)- 2, 3- dihydro-pyrazol-3-ones |
| US6025394A (en) | 1999-01-29 | 2000-02-15 | Cell Pathways, Inc. | Method for treating patients with acne by administering substituted sulfonyl indenyl acetic acids, amides and alcohols |
| US6020379A (en) * | 1999-02-19 | 2000-02-01 | Cell Pathways, Inc. | Position 7 substituted indenyl-3-acetic acid derivatives and amides thereof for the treatment of neoplasia |
| US6555547B1 (en) | 2000-02-28 | 2003-04-29 | Cell Pathways, Inc. | Method for treating a patient with neoplasia by treatment with a vinca alkaloid derivative |
| US6569638B1 (en) | 2000-03-03 | 2003-05-27 | Cell Pathways, Inc | Method for screening compounds for the treatment of neoplasia |
| GB0708258D0 (en) * | 2007-04-27 | 2007-06-06 | Katholleke Universiteit Leuven | New anti-viral nulceoside analogs |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1523865A (en) * | 1974-09-02 | 1978-09-06 | Wellcome Found | Purine compunds and salts thereof |
| US4199574A (en) * | 1974-09-02 | 1980-04-22 | Burroughs Wellcome Co. | Methods and compositions for treating viral infections and guanine acyclic nucleosides |
| US4347360A (en) * | 1980-09-16 | 1982-08-31 | Ens Bio Logicals Inc. | Ring open nucleoside analogues |
| US4355032B2 (en) * | 1981-05-21 | 1990-10-30 | 9-(1,3-dihydroxy-2-propoxymethyl)guanine as antiviral agent | |
| ES8403128A1 (es) * | 1981-08-11 | 1983-10-01 | Wellcome Found | "un procedimiento para preparar derivados de purina". |
| NZ201662A (en) * | 1981-08-26 | 1986-07-11 | Merck & Co Inc | 9-(1,3-(and 2,3)-dihydroxy-1-(and 2)-propoxy-methyl)guanine derivatives and methods for their preparation |
| US4816447A (en) * | 1981-08-26 | 1989-03-28 | Merck & Co., Inc. | Anti-viral guanine compounds |
-
1982
- 1982-12-22 US US07/451,262 patent/US5250535A/en not_active Expired - Fee Related
-
1983
- 1983-01-25 DK DK29183A patent/DK29183A/da not_active Application Discontinuation
- 1983-01-26 FI FI830254A patent/FI79851C/fi not_active IP Right Cessation
- 1983-01-27 PT PT76149A patent/PT76149B/pt unknown
- 1983-01-27 PH PH28429A patent/PH19203A/en unknown
- 1983-01-31 IN IN113/CAL/83A patent/IN157856B/en unknown
- 1983-01-31 RO RO109871A patent/RO86234B/ro unknown
- 1983-01-31 RO RO83114877A patent/RO89142A/ro unknown
- 1983-01-31 KR KR1019830000360A patent/KR890000191B1/ko not_active Expired
- 1983-01-31 DD DD83247593A patent/DD206781A5/de not_active IP Right Cessation
- 1983-01-31 NZ NZ203128A patent/NZ203128A/en unknown
- 1983-01-31 BR BR8300475A patent/BR8300475A/pt unknown
- 1983-01-31 NO NO830316A patent/NO161372C/no unknown
- 1983-01-31 ES ES519423A patent/ES8504194A1/es not_active Expired
- 1983-01-31 RO RO83114876A patent/RO89143A/ro unknown
- 1983-01-31 PL PL1983240367A patent/PL140556B1/pl unknown
- 1983-01-31 GR GR70365A patent/GR81321B/el unknown
- 1983-01-31 EP EP83100886A patent/EP0085424A3/en not_active Withdrawn
- 1983-01-31 ZW ZW25/83A patent/ZW2583A1/xx unknown
- 1983-01-31 HU HU83314A patent/HU193874B/hu not_active IP Right Cessation
- 1983-01-31 IL IL67791A patent/IL67791A0/xx unknown
- 1983-02-01 AU AU10961/83A patent/AU572777B2/en not_active Ceased
-
1984
- 1984-06-19 PH PH30839A patent/PH20099A/en unknown
- 1984-06-19 PH PH30840A patent/PH20360A/en unknown
- 1984-06-19 PH PH30841A patent/PH22817A/en unknown
-
1985
- 1985-05-13 PH PH32259A patent/PH22824A/en unknown
-
1988
- 1988-03-03 AU AU12614/88A patent/AU1261488A/en not_active Withdrawn
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DD206781A5 (de) | Verfahren zur herstellung von purinderivaten | |
| EP0072027B1 (en) | Antiviral compounds | |
| CA1305140C (en) | Protected n -9-(1,3-dihydroxy-2-propoxymethyl) guanine derivatives | |
| DE69426904T2 (de) | Phosphonat-Nukleotid Ester-Derivate | |
| DE69025723T2 (de) | N-(Pyrrolo(2-3-d)pyrimidin-3-ylacyl)-Glutaminsäurederivate | |
| DD264924A5 (de) | Verfahren zur herstellung von pyrimidin-nucleosiden | |
| GB2130204A (en) | Antiviral purines | |
| DD296927A5 (de) | Verfahren zur herstellung von 4(3h)-pteridinonen | |
| EP0089028B1 (de) | Neue Theophyllin-Derivate und Verfahren zu ihrer Herstellung | |
| US4556659A (en) | Substituted 9-(1-0- or 3-0-monosubstituted or 1,3-Di-0-substituted propoxymethyl)-purines as antiviral agents | |
| US4423050A (en) | 9-(1,3-Dihydroxy-2-propoxymethyl)guanine as antiviral agent | |
| DE3786109T2 (de) | Pyrido[2,3-d]pyrimidin-Derivate. | |
| US4612314A (en) | Substituted 9-(1 or 3-monoacyloxy or 1,3-diacyloxy-2-propoxymethyl) purines as antiviral agent | |
| US4609661A (en) | Substituted 9-(1-O- or 3-O-monosubstituted or 1,3-di-O-substituted propoxymethyl)purines as antiviral agents | |
| US4565868A (en) | Process for preparing guanine derivatives | |
| EP0452680B1 (de) | Substituierte Purine, Verfahren zu ihrer Herstellung sowie ihre Verwendung als antivirale Mittel | |
| DE2708828A1 (de) | Purine, verfahren zu ihrer herstellung und pharmazeutische zubereitungen | |
| US4603219A (en) | 1,3-dibenzyloxy-2-acetoxymethoxypropane, intermediate for 9-(1,3-dihydroxy-2-propoxymethyl)guanine | |
| DE3785076T2 (de) | Pyrido(4,3-d)pyrimidin-derivate. | |
| US4803271A (en) | Process for preparing guanine derivatives | |
| DE69029547T2 (de) | Purinverbindungen, Verfahren zu ihrer Herstellung, pharmazeutische Präparate und Zwischenverbindungen | |
| SU1553012A3 (ru) | Способ получени производных 9-(2-пропоксиметил)гуанина | |
| US5252575A (en) | Antiviral purine derivatives with improved gastrointestinal absorption | |
| NO874782L (no) | Guaninderivater. | |
| KR100290533B1 (ko) | 항바이러스 활성을 가지는 2-아미노퓨린 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ENJ | Ceased due to non-payment of renewal fee |