CZ283594A3 - Process for preparing substituted aromatic amines - Google Patents
Process for preparing substituted aromatic amines Download PDFInfo
- Publication number
- CZ283594A3 CZ283594A3 CZ942835A CZ283594A CZ283594A3 CZ 283594 A3 CZ283594 A3 CZ 283594A3 CZ 942835 A CZ942835 A CZ 942835A CZ 283594 A CZ283594 A CZ 283594A CZ 283594 A3 CZ283594 A3 CZ 283594A3
- Authority
- CZ
- Czechia
- Prior art keywords
- group
- substituted
- groups
- aniline
- derivatives
- Prior art date
Links
- 150000004982 aromatic amines Chemical class 0.000 title claims abstract description 60
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 28
- 150000001875 compounds Chemical class 0.000 claims abstract description 135
- 238000006243 chemical reaction Methods 0.000 claims abstract description 112
- -1 aromatic azo compound Chemical class 0.000 claims abstract description 98
- 239000000463 material Substances 0.000 claims abstract description 95
- 230000000269 nucleophilic effect Effects 0.000 claims abstract description 77
- 239000002904 solvent Substances 0.000 claims abstract description 56
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 208
- 238000000034 method Methods 0.000 claims description 129
- 239000002585 base Substances 0.000 claims description 115
- DMLAVOWQYNRWNQ-UHFFFAOYSA-N azobenzene Chemical compound C1=CC=CC=C1N=NC1=CC=CC=C1 DMLAVOWQYNRWNQ-UHFFFAOYSA-N 0.000 claims description 97
- 125000003118 aryl group Chemical group 0.000 claims description 94
- 125000000217 alkyl group Chemical group 0.000 claims description 65
- ATGUVEKSASEFFO-UHFFFAOYSA-N p-aminodiphenylamine Chemical compound C1=CC(N)=CC=C1NC1=CC=CC=C1 ATGUVEKSASEFFO-UHFFFAOYSA-N 0.000 claims description 57
- 150000004820 halides Chemical class 0.000 claims description 56
- 150000001448 anilines Chemical class 0.000 claims description 51
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 claims description 46
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 41
- 150000001408 amides Chemical class 0.000 claims description 40
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical group [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 39
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 34
- 125000003545 alkoxy group Chemical group 0.000 claims description 33
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 claims description 29
- VXLFYNFOITWQPM-UHFFFAOYSA-N n-phenyl-4-phenyldiazenylaniline Chemical compound C=1C=C(N=NC=2C=CC=CC=2)C=CC=1NC1=CC=CC=C1 VXLFYNFOITWQPM-UHFFFAOYSA-N 0.000 claims description 27
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 claims description 26
- 239000000203 mixture Substances 0.000 claims description 26
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical group [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 claims description 25
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims description 24
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 24
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 24
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 24
- 150000008431 aliphatic amides Chemical class 0.000 claims description 24
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 24
- 229910052794 bromium Inorganic materials 0.000 claims description 24
- 239000000460 chlorine Substances 0.000 claims description 24
- 229910052801 chlorine Inorganic materials 0.000 claims description 24
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical class OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 claims description 24
- 239000011737 fluorine Substances 0.000 claims description 24
- 229910052731 fluorine Inorganic materials 0.000 claims description 24
- 150000008430 aromatic amides Chemical class 0.000 claims description 22
- 239000001257 hydrogen Substances 0.000 claims description 22
- 229910052739 hydrogen Inorganic materials 0.000 claims description 22
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 19
- 125000001931 aliphatic group Chemical group 0.000 claims description 19
- 125000003342 alkenyl group Chemical group 0.000 claims description 19
- 125000005337 azoxy group Chemical group [N+]([O-])(=N*)* 0.000 claims description 19
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 19
- 239000003795 chemical substances by application Substances 0.000 claims description 16
- 125000001424 substituent group Chemical group 0.000 claims description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 15
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 15
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 15
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 claims description 12
- 238000005932 reductive alkylation reaction Methods 0.000 claims description 10
- VSRBKQFNFZQRBM-UHFFFAOYSA-N tuaminoheptane Chemical compound CCCCCC(C)N VSRBKQFNFZQRBM-UHFFFAOYSA-N 0.000 claims description 10
- YBQZXXMEJHZYMB-UHFFFAOYSA-N 1,2-diphenylhydrazine Chemical compound C=1C=CC=CC=1NNC1=CC=CC=C1 YBQZXXMEJHZYMB-UHFFFAOYSA-N 0.000 claims description 9
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 9
- 229910052783 alkali metal Inorganic materials 0.000 claims description 9
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 9
- 238000005691 oxidative coupling reaction Methods 0.000 claims description 9
- 150000004989 p-phenylenediamines Chemical class 0.000 claims description 9
- 239000003444 phase transfer catalyst Substances 0.000 claims description 9
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 claims description 8
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 claims description 8
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 claims description 8
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 claims description 8
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 claims description 8
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 claims description 8
- UHBGYFCCKRAEHA-UHFFFAOYSA-N P-toluamide Chemical compound CC1=CC=C(C(N)=O)C=C1 UHBGYFCCKRAEHA-UHFFFAOYSA-N 0.000 claims description 8
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 8
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 8
- GAUZCKBSTZFWCT-UHFFFAOYSA-N azoxybenzene Chemical compound C=1C=CC=CC=1[N+]([O-])=NC1=CC=CC=C1 GAUZCKBSTZFWCT-UHFFFAOYSA-N 0.000 claims description 8
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 claims description 8
- 239000002274 desiccant Substances 0.000 claims description 8
- 150000001470 diamides Chemical class 0.000 claims description 8
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 claims description 8
- WFKAJVHLWXSISD-UHFFFAOYSA-N isobutyramide Chemical compound CC(C)C(N)=O WFKAJVHLWXSISD-UHFFFAOYSA-N 0.000 claims description 8
- 229910021529 ammonia Inorganic materials 0.000 claims description 7
- 238000011065 in-situ storage Methods 0.000 claims description 7
- 150000007529 inorganic bases Chemical class 0.000 claims description 7
- 150000007530 organic bases Chemical class 0.000 claims description 7
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 claims description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 6
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 claims description 6
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 claims description 5
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 5
- 150000001340 alkali metals Chemical class 0.000 claims description 5
- 239000004202 carbamide Substances 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 150000003983 crown ethers Chemical class 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- BHRZNVHARXXAHW-UHFFFAOYSA-N sec-butylamine Chemical compound CCC(C)N BHRZNVHARXXAHW-UHFFFAOYSA-N 0.000 claims description 5
- 150000005622 tetraalkylammonium hydroxides Chemical group 0.000 claims description 5
- AVYGCQXNNJPXSS-UHFFFAOYSA-N 2,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC=C1Cl AVYGCQXNNJPXSS-UHFFFAOYSA-N 0.000 claims description 4
- JCBPETKZIGVZRE-UHFFFAOYSA-N 2-aminobutan-1-ol Chemical compound CCC(N)CO JCBPETKZIGVZRE-UHFFFAOYSA-N 0.000 claims description 4
- BKMMTJMQCTUHRP-UHFFFAOYSA-N 2-aminopropan-1-ol Chemical compound CC(N)CO BKMMTJMQCTUHRP-UHFFFAOYSA-N 0.000 claims description 4
- UVRRJILIXQAAFK-UHFFFAOYSA-N 2-bromo-4-methylaniline Chemical compound CC1=CC=C(N)C(Br)=C1 UVRRJILIXQAAFK-UHFFFAOYSA-N 0.000 claims description 4
- XXUNIGZDNWWYED-UHFFFAOYSA-N 2-methylbenzamide Chemical compound CC1=CC=CC=C1C(N)=O XXUNIGZDNWWYED-UHFFFAOYSA-N 0.000 claims description 4
- ZPVFWPFBNIEHGJ-UHFFFAOYSA-N 2-octanone Chemical compound CCCCCCC(C)=O ZPVFWPFBNIEHGJ-UHFFFAOYSA-N 0.000 claims description 4
- DHYHYLGCQVVLOQ-UHFFFAOYSA-N 3-bromoaniline Chemical compound NC1=CC=CC(Br)=C1 DHYHYLGCQVVLOQ-UHFFFAOYSA-N 0.000 claims description 4
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical compound C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 claims description 4
- IJUKXLYWNIOUOH-UHFFFAOYSA-N 4-(4-carbamoylphenyl)benzamide Chemical compound C1=CC(C(=O)N)=CC=C1C1=CC=C(C(N)=O)C=C1 IJUKXLYWNIOUOH-UHFFFAOYSA-N 0.000 claims description 4
- QIKYZXDTTPVVAC-UHFFFAOYSA-N 4-Aminobenzamide Chemical compound NC(=O)C1=CC=C(N)C=C1 QIKYZXDTTPVVAC-UHFFFAOYSA-N 0.000 claims description 4
- BLNVISNJTIRAHF-UHFFFAOYSA-N 4-chlorobenzamide Chemical compound NC(=O)C1=CC=C(Cl)C=C1 BLNVISNJTIRAHF-UHFFFAOYSA-N 0.000 claims description 4
- GUCPYIYFQVTFSI-UHFFFAOYSA-N 4-methoxybenzamide Chemical compound COC1=CC=C(C(N)=O)C=C1 GUCPYIYFQVTFSI-UHFFFAOYSA-N 0.000 claims description 4
- UNBMPKNTYKDYCG-UHFFFAOYSA-N 4-methylpentan-2-amine Chemical compound CC(C)CC(C)N UNBMPKNTYKDYCG-UHFFFAOYSA-N 0.000 claims description 4
- ZESWUEBPRPGMTP-UHFFFAOYSA-N 4-nitrobenzamide Chemical compound NC(=O)C1=CC=C([N+]([O-])=O)C=C1 ZESWUEBPRPGMTP-UHFFFAOYSA-N 0.000 claims description 4
- AJMNDPOSKIBVGX-UHFFFAOYSA-N 4-phenyldiazenylbenzenesulfonic acid Chemical compound C1=CC(S(=O)(=O)O)=CC=C1N=NC1=CC=CC=C1 AJMNDPOSKIBVGX-UHFFFAOYSA-N 0.000 claims description 4
- FFWSICBKRCICMR-UHFFFAOYSA-N 5-methyl-2-hexanone Chemical compound CC(C)CCC(C)=O FFWSICBKRCICMR-UHFFFAOYSA-N 0.000 claims description 4
- HGEQWMSHDSUEJA-UHFFFAOYSA-N 5-methylheptan-3-amine Chemical compound CCC(C)CC(N)CC HGEQWMSHDSUEJA-UHFFFAOYSA-N 0.000 claims description 4
- IZCBXLKODYZSDJ-UHFFFAOYSA-N 5-methylhexan-2-amine Chemical compound CC(C)CCC(C)N IZCBXLKODYZSDJ-UHFFFAOYSA-N 0.000 claims description 4
- SLXKOJJOQWFEFD-UHFFFAOYSA-N 6-aminohexanoic acid Chemical compound NCCCCCC(O)=O SLXKOJJOQWFEFD-UHFFFAOYSA-N 0.000 claims description 4
- GVNWZKBFMFUVNX-UHFFFAOYSA-N Adipamide Chemical compound NC(=O)CCCCC(N)=O GVNWZKBFMFUVNX-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 229910000102 alkali metal hydride Inorganic materials 0.000 claims description 4
- 150000008046 alkali metal hydrides Chemical class 0.000 claims description 4
- 150000004791 alkyl magnesium halides Chemical class 0.000 claims description 4
- 229960002684 aminocaproic acid Drugs 0.000 claims description 4
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 4
- 125000005018 aryl alkenyl group Chemical group 0.000 claims description 4
- RPHKINMPYFJSCF-UHFFFAOYSA-N benzene-1,3,5-triamine Chemical compound NC1=CC(N)=CC(N)=C1 RPHKINMPYFJSCF-UHFFFAOYSA-N 0.000 claims description 4
- WGBBUURBHXLGFM-UHFFFAOYSA-N hexan-2-amine Chemical compound CCCCC(C)N WGBBUURBHXLGFM-UHFFFAOYSA-N 0.000 claims description 4
- 229940047889 isobutyramide Drugs 0.000 claims description 4
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 claims description 4
- 150000002576 ketones Chemical class 0.000 claims description 4
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 claims description 4
- IOQPZZOEVPZRBK-UHFFFAOYSA-N octan-1-amine Chemical compound CCCCCCCCN IOQPZZOEVPZRBK-UHFFFAOYSA-N 0.000 claims description 4
- HBXNJMZWGSCKPW-UHFFFAOYSA-N octan-2-amine Chemical compound CCCCCCC(C)N HBXNJMZWGSCKPW-UHFFFAOYSA-N 0.000 claims description 4
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 claims description 4
- 239000003586 protic polar solvent Substances 0.000 claims description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 4
- HSXSYIPRDYGYDZ-UHFFFAOYSA-N (3-chlorophenyl)-(4-chlorophenyl)diazene Chemical compound C1=CC(Cl)=CC=C1N=NC1=CC=CC(Cl)=C1 HSXSYIPRDYGYDZ-UHFFFAOYSA-N 0.000 claims description 3
- VOZKAJLKRJDJLL-UHFFFAOYSA-N 2,4-diaminotoluene Chemical compound CC1=CC=C(N)C=C1N VOZKAJLKRJDJLL-UHFFFAOYSA-N 0.000 claims description 3
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 claims description 3
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 claims description 3
- 238000010533 azeotropic distillation Methods 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 3
- 150000001299 aldehydes Chemical class 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 12
- YIKSCQDJHCMVMK-UHFFFAOYSA-N Oxamide Chemical compound NC(=O)C(N)=O YIKSCQDJHCMVMK-UHFFFAOYSA-N 0.000 claims 3
- 125000005210 alkyl ammonium group Chemical group 0.000 claims 3
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 claims 3
- 229940092714 benzenesulfonic acid Drugs 0.000 claims 3
- 238000001944 continuous distillation Methods 0.000 claims 3
- MHSKRLJMQQNJNC-UHFFFAOYSA-N terephthalamide Chemical compound NC(=O)C1=CC=C(C(N)=O)C=C1 MHSKRLJMQQNJNC-UHFFFAOYSA-N 0.000 claims 3
- WUPZNKGVDMHMBS-UHFFFAOYSA-N azane;dihydrate Chemical group [NH4+].[NH4+].[OH-].[OH-] WUPZNKGVDMHMBS-UHFFFAOYSA-N 0.000 claims 1
- 150000004985 diamines Chemical class 0.000 abstract 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 56
- 238000004128 high performance liquid chromatography Methods 0.000 description 31
- 229910052757 nitrogen Inorganic materials 0.000 description 28
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- 238000002360 preparation method Methods 0.000 description 24
- 125000004432 carbon atom Chemical group C* 0.000 description 14
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000003153 chemical reaction reagent Substances 0.000 description 7
- 150000002431 hydrogen Chemical class 0.000 description 7
- 150000001768 cations Chemical class 0.000 description 6
- PHTQWCKDNZKARW-UHFFFAOYSA-N isoamylol Chemical compound CC(C)CCO PHTQWCKDNZKARW-UHFFFAOYSA-N 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 5
- XXYMSQQCBUKFHE-UHFFFAOYSA-N 4-nitro-n-phenylaniline Chemical compound C1=CC([N+](=O)[O-])=CC=C1NC1=CC=CC=C1 XXYMSQQCBUKFHE-UHFFFAOYSA-N 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- RDSFGYBJMBTKMN-UHFFFAOYSA-N 1,4,7,10,13-pentaoxacyclooctadecane Chemical compound C1CCOCCOCCOCCOCCOCC1 RDSFGYBJMBTKMN-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 239000003963 antioxidant agent Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 150000004679 hydroxides Chemical class 0.000 description 3
- 239000012038 nucleophile Substances 0.000 description 3
- 239000012434 nucleophilic reagent Substances 0.000 description 3
- 230000002940 repellent Effects 0.000 description 3
- 239000005871 repellent Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000002699 waste material Substances 0.000 description 3
- 102100027324 2-hydroxyacyl-CoA lyase 1 Human genes 0.000 description 2
- SDTMFDGELKWGFT-UHFFFAOYSA-N 2-methylpropan-2-olate Chemical compound CC(C)(C)[O-] SDTMFDGELKWGFT-UHFFFAOYSA-N 0.000 description 2
- CZGCEKJOLUNIFY-UHFFFAOYSA-N 4-Chloronitrobenzene Chemical class [O-][N+](=O)C1=CC=C(Cl)C=C1 CZGCEKJOLUNIFY-UHFFFAOYSA-N 0.000 description 2
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 101001009252 Homo sapiens 2-hydroxyacyl-CoA lyase 1 Proteins 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000010960 commercial process Methods 0.000 description 2
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 229940043265 methyl isobutyl ketone Drugs 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 238000007339 nucleophilic aromatic substitution reaction Methods 0.000 description 2
- OIJHFHYPXWSVPF-UHFFFAOYSA-N para-Nitrosodiphenylamine Chemical compound C1=CC(N=O)=CC=C1NC1=CC=CC=C1 OIJHFHYPXWSVPF-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- NHGXDBSUJJNIRV-UHFFFAOYSA-M tetrabutylammonium chloride Chemical compound [Cl-].CCCC[N+](CCCC)(CCCC)CCCC NHGXDBSUJJNIRV-UHFFFAOYSA-M 0.000 description 2
- VDZOOKBUILJEDG-UHFFFAOYSA-M tetrabutylammonium hydroxide Chemical compound [OH-].CCCC[N+](CCCC)(CCCC)CCCC VDZOOKBUILJEDG-UHFFFAOYSA-M 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- MFGOFGRYDNHJTA-UHFFFAOYSA-N 2-amino-1-(2-fluorophenyl)ethanol Chemical compound NCC(O)C1=CC=CC=C1F MFGOFGRYDNHJTA-UHFFFAOYSA-N 0.000 description 1
- MHKGJUOEEHNBLE-UHFFFAOYSA-N 4-[(2,4-dihydroxyphenyl)azo]benzenesulfonic acid Chemical compound OC1=CC(O)=CC=C1N=NC1=CC=C(S(O)(=O)=O)C=C1 MHKGJUOEEHNBLE-UHFFFAOYSA-N 0.000 description 1
- XLBKHHIFBGBHLM-UHFFFAOYSA-N 4-methoxyaniline;4-methylaniline Chemical compound CC1=CC=C(N)C=C1.COC1=CC=C(N)C=C1 XLBKHHIFBGBHLM-UHFFFAOYSA-N 0.000 description 1
- QZHXKQKKEBXYRG-UHFFFAOYSA-N 4-n-(4-aminophenyl)benzene-1,4-diamine Chemical compound C1=CC(N)=CC=C1NC1=CC=C(N)C=C1 QZHXKQKKEBXYRG-UHFFFAOYSA-N 0.000 description 1
- HVVSVTFAYLHSRS-UHFFFAOYSA-L 6-azaniumylhexyl-dibutyl-ethylazanium tetrahydroxide Chemical compound [OH-].C(CCC)[N+](CCCCCC[NH3+])(CC)CCCC.C(CCC)[N+](CCCCCC[NH3+])(CC)CCCC.[OH-].[OH-].[OH-] HVVSVTFAYLHSRS-UHFFFAOYSA-L 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000007824 aliphatic compounds Chemical class 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- HUCVOHYBFXVBRW-UHFFFAOYSA-M caesium hydroxide Inorganic materials [OH-].[Cs+] HUCVOHYBFXVBRW-UHFFFAOYSA-M 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000006471 dimerization reaction Methods 0.000 description 1
- 229910001882 dioxygen Inorganic materials 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- DYDNPESBYVVLBO-UHFFFAOYSA-N formanilide Chemical compound O=CNC1=CC=CC=C1 DYDNPESBYVVLBO-UHFFFAOYSA-N 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- RIBSIXLJGIEVSH-UHFFFAOYSA-N n-phenyl-n-phenyldiazenylaniline Chemical compound C1=CC=CC=C1N=NN(C=1C=CC=CC=1)C1=CC=CC=C1 RIBSIXLJGIEVSH-UHFFFAOYSA-N 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- NLRKCXQQSUWLCH-UHFFFAOYSA-N nitrosobenzene Chemical compound O=NC1=CC=CC=C1 NLRKCXQQSUWLCH-UHFFFAOYSA-N 0.000 description 1
- SOWBFZRMHSNYGE-UHFFFAOYSA-N oxamic acid Chemical compound NC(=O)C(O)=O SOWBFZRMHSNYGE-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 150000004686 pentahydrates Chemical class 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- CUQOHAYJWVTKDE-UHFFFAOYSA-N potassium;butan-1-olate Chemical compound [K+].CCCC[O-] CUQOHAYJWVTKDE-UHFFFAOYSA-N 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 238000004007 reversed phase HPLC Methods 0.000 description 1
- 150000005619 secondary aliphatic amines Chemical group 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- LXMSZDCAJNLERA-ZHYRCANASA-N spironolactone Chemical compound C([C@@H]1[C@]2(C)CC[C@@H]3[C@@]4(C)CCC(=O)C=C4C[C@H]([C@@H]13)SC(=O)C)C[C@@]21CCC(=O)O1 LXMSZDCAJNLERA-ZHYRCANASA-N 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 1
- LCUPHFXVMQLGJB-UHFFFAOYSA-M tetramethylazanium;hydroxide;dihydrate Chemical compound O.O.[OH-].C[N+](C)(C)C LCUPHFXVMQLGJB-UHFFFAOYSA-M 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
- HADKRTWCOYPCPH-UHFFFAOYSA-M trimethylphenylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C1=CC=CC=C1 HADKRTWCOYPCPH-UHFFFAOYSA-M 0.000 description 1
- 238000000825 ultraviolet detection Methods 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/02—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of hydrogen atoms by amino groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/30—Preparation of compounds containing amino groups bound to a carbon skeleton by reduction of nitrogen-to-oxygen or nitrogen-to-nitrogen bonds
- C07C209/42—Preparation of compounds containing amino groups bound to a carbon skeleton by reduction of nitrogen-to-oxygen or nitrogen-to-nitrogen bonds by reduction of nitrogen-to-nitrogen bonds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/43—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C211/44—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having amino groups bound to only one six-membered aromatic ring
- C07C211/49—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having amino groups bound to only one six-membered aromatic ring having at least two amino groups bound to the carbon skeleton
- C07C211/50—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having amino groups bound to only one six-membered aromatic ring having at least two amino groups bound to the carbon skeleton with at least two amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C245/00—Compounds containing chains of at least two nitrogen atoms with at least one nitrogen-to-nitrogen multiple bond
- C07C245/02—Azo compounds, i.e. compounds having the free valencies of —N=N— groups attached to different atoms, e.g. diazohydroxides
- C07C245/06—Azo compounds, i.e. compounds having the free valencies of —N=N— groups attached to different atoms, e.g. diazohydroxides with nitrogen atoms of azo groups bound to carbon atoms of six-membered aromatic rings
- C07C245/08—Azo compounds, i.e. compounds having the free valencies of —N=N— groups attached to different atoms, e.g. diazohydroxides with nitrogen atoms of azo groups bound to carbon atoms of six-membered aromatic rings with the two nitrogen atoms of azo groups bound to carbon atoms of six-membered aromatic rings, e.g. azobenzene
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US88706092A | 1992-05-22 | 1992-05-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CZ283594A3 true CZ283594A3 (en) | 1995-03-15 |
Family
ID=25390367
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CZ942835A CZ283594A3 (en) | 1992-05-22 | 1993-04-13 | Process for preparing substituted aromatic amines |
Country Status (18)
| Country | Link |
|---|---|
| US (3) | US5552531A (enExample) |
| EP (1) | EP0641313B1 (enExample) |
| JP (1) | JP3476818B2 (enExample) |
| KR (1) | KR0164628B1 (enExample) |
| AT (1) | ATE148100T1 (enExample) |
| BR (1) | BR9306401A (enExample) |
| CA (1) | CA2135491C (enExample) |
| CZ (1) | CZ283594A3 (enExample) |
| DE (1) | DE69307699T2 (enExample) |
| EE (1) | EE03056B1 (enExample) |
| ES (1) | ES2099440T3 (enExample) |
| GE (1) | GEP19991703B (enExample) |
| HU (1) | HUT70869A (enExample) |
| PL (1) | PL176660B1 (enExample) |
| RU (1) | RU2126380C1 (enExample) |
| TW (1) | TW239118B (enExample) |
| UA (1) | UA44224C2 (enExample) |
| WO (1) | WO1993024450A1 (enExample) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5552531A (en) * | 1992-05-22 | 1996-09-03 | Monsanto Company | Process for preparing substituted aromatic azo compounds |
| US5451702A (en) * | 1993-04-26 | 1995-09-19 | Monsanto Company | Process for preparing substituted aromatic amines |
| JPH07149695A (ja) * | 1993-09-30 | 1995-06-13 | Seiko Kagaku Kk | 4−アミノジフェニルアミン類の製造方法 |
| US5382691A (en) * | 1993-11-05 | 1995-01-17 | Monsanto Company | Process for preparing substituted aromatic amines |
| DE19709124A1 (de) * | 1997-03-06 | 1998-09-10 | Bayer Ag | Verfahren zur Herstellung von 4-Aminodiphenylamin |
| TW500712B (en) * | 1997-08-06 | 2002-09-01 | Bayer Ag | Process for the preparation of 4-aminodiphenylamine |
| DE19810929A1 (de) * | 1998-03-13 | 1999-09-16 | Bayer Ag | Verfahren zur Herstellung von 4-Aminodiphenylamin |
| DE10055221A1 (de) | 2000-11-08 | 2002-05-29 | Bayer Ag | Verfahren zur Herstellung von 4-Aminodiphenylamin |
| US20040039181A1 (en) * | 2002-07-29 | 2004-02-26 | Rains Roger Keranen | Process for preparing aromatic azo and hydrazo compounds, aromatic amides and aromatic amines |
| US8686188B2 (en) | 2003-07-04 | 2014-04-01 | Jiangsu Sinorgchem Technology Co., Ltd. | Process for preparing 4-aminodiphenylamine |
| BRPI0412101A (pt) * | 2003-07-04 | 2006-08-15 | Nongyue Wang | processo para a preparação da 4-aminodifenilamina |
| US8486223B2 (en) * | 2003-07-04 | 2013-07-16 | Jiangsu Sinorgchem Technology Co., Ltd. | Falling film evaporator |
| EP2368558A1 (en) * | 2010-03-23 | 2011-09-28 | Mdc Max-Delbrück-Centrum Für Molekulare Medizin Berlin - Buch | Azo compounds reducing formation and toxicity of amyloid beta aggregation intermediates |
| CN102259029B (zh) | 2010-05-24 | 2014-12-10 | 江苏圣奥化学科技有限公司 | 固体碱催化剂 |
| KR101358519B1 (ko) | 2010-12-21 | 2014-02-05 | 금호석유화학 주식회사 | 복합염기촉매를 이용한 4,4'-디니트로디페닐아민 및 4,4'-비스(알킬아미노)디페닐아민의 제조방법 |
| KR101358605B1 (ko) | 2010-12-21 | 2014-02-04 | 금호석유화학 주식회사 | 4-니트로아닐린을 이용한 4,4'-디니트로디페닐아민 및 4,4'-비스(알킬아미노)디페닐아민의 제조방법 |
| CN102796011A (zh) * | 2012-08-25 | 2012-11-28 | 山西翔宇化工有限公司 | 一种对氨基二苯胺的制备方法 |
| WO2014098775A1 (en) | 2012-12-19 | 2014-06-26 | Slovenská Technická Univerzita V Bratislave, Strojnícka Fakulta | Automobile bodies and their manufacturing processes |
| CN111039822B (zh) * | 2018-10-12 | 2022-11-11 | 北京工商大学 | 一种芳香族偶氮化合物的光化学催化合成方法 |
| CN117466890A (zh) * | 2023-10-31 | 2024-01-30 | 安徽美诺华药物化学有限公司 | 一种抗血栓栓塞性疾病药物中间体的制备方法 |
Family Cites Families (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE275068C (enExample) * | ||||
| US2822395A (en) * | 1954-03-05 | 1958-02-04 | Ici Ltd | Production of amines |
| GB770299A (en) * | 1954-03-05 | 1957-03-20 | Ici Ltd | Improvements in and relating to the production of amines |
| US3340302A (en) * | 1964-04-01 | 1967-09-05 | Hercules Inc | Process for manufacture of p-nitroson-phenylanilines |
| BE789273A (fr) * | 1971-09-28 | 1973-03-26 | Bayer Ag | Procede de preparation de derives de nitrodiphenylamine |
| GB1440767A (en) * | 1972-11-24 | 1976-06-23 | Ici Ltd | Oxidation process for the manufacture of 4-aminodiphenylamine and related higher amines |
| SU517582A1 (ru) * | 1974-04-17 | 1976-06-15 | Московский Ордена Ленина И Ордена Трудового Красного Знамени Химикотехнологический Институт Имени Д.И.Менделеева | Способ получени 4-аминодифениламина |
| DE2633811C2 (de) * | 1976-07-28 | 1983-11-10 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Nitrodiphenylaminen |
| DE2713602C3 (de) * | 1977-03-28 | 1980-03-20 | Akzo Gmbh, 5600 Wuppertal | Verfahren zur Herstellung von Nitrosobenzol |
| US4187248A (en) * | 1977-11-23 | 1980-02-05 | Monsanto Company | Making a nitrodiarylamine by reacting an alkali metal salt of a formamide with a nitrohaloarene |
| US4187249A (en) * | 1977-12-27 | 1980-02-05 | Monsanto Company | Promoting the reaction of sodium salts of formyl derivatives of aromatic amines to form nitrodiarylamines |
| US4209463A (en) * | 1977-12-27 | 1980-06-24 | Monsanto Company | Promoting the formation of nitrodiarylamines from nitrohaloarenes, activated aryl amines and sodium carbonates |
| US4140716A (en) * | 1978-01-05 | 1979-02-20 | Monsanto Company | Process for making an amide of formic acid and forming nitrodiarylamine therefrom |
| US4155936A (en) * | 1978-03-08 | 1979-05-22 | The Goodyear Tire & Rubber Company | Para-nitrodiphenylamines synthesis using Polyethers and macrocyclic esters as solubilizing agents |
| US4196146A (en) * | 1978-03-13 | 1980-04-01 | Monsanto Company | Making nitrodiarylamines from formyl derivatives of aromatic amines and nitrohaloarenes by admixing with certain aqueous salt solutions |
| US4404401A (en) * | 1979-02-23 | 1983-09-13 | Akzona Incorporated | Process for the preparation of para-amino-diphenylamine |
| EP0035815B1 (en) * | 1980-03-12 | 1983-06-08 | Akzo N.V. | Process for the preparation of p-aminoazobenzene from aniline |
| US4900868A (en) * | 1982-01-18 | 1990-02-13 | Monsanto Company | Process for producing N,N'-disubstituted paraphenylene diamine mixtures by sequential reductive alkylation |
| US4518803A (en) * | 1982-09-30 | 1985-05-21 | Uniroyal, Inc. | Process for the preparation of p-nitrosodiphenylamine |
| US4479008A (en) * | 1982-09-30 | 1984-10-23 | Uniroyal, Inc. | Preparation of p-nitrosodiphenylamine |
| US4614817A (en) * | 1983-12-19 | 1986-09-30 | Monsanto Company | Making nitrodiarylamines |
| DE3504479A1 (de) * | 1985-02-09 | 1986-08-14 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 4-nitrodiphenylaminen |
| US4683332A (en) * | 1985-05-20 | 1987-07-28 | The Goodyear Tire & Rubber Company | Para-nitrodiphenylamine synthesis |
| DE3609342A1 (de) * | 1986-03-20 | 1987-09-24 | Bayer Ag | Verfahren zur herstellung von azoverbindungen |
| US4760186A (en) * | 1986-09-15 | 1988-07-26 | Monsanto Company | Preparation of substituted aromatic amines |
| DD275068A1 (de) * | 1988-08-22 | 1990-01-10 | Tech Hochschule C Schorlemmer | Verfahren zur herstellung von n-monosubstituierten 4-aryl-azo-1-naphthylaminen |
| DE4021960A1 (de) * | 1990-07-10 | 1992-01-16 | Basf Ag | Thiophenazofarbstoffe |
| US5117063A (en) * | 1991-06-21 | 1992-05-26 | Monsanto Company | Method of preparing 4-aminodiphenylamine |
| US5252737A (en) * | 1992-05-22 | 1993-10-12 | Monsanto Company | Process for preparing N-aliphatic substituted p-phenylenediamines |
| US5331099A (en) * | 1992-05-22 | 1994-07-19 | Monsanto Company | Process for preparing p-nitroaromatic amides and products thereof |
| US5552531A (en) * | 1992-05-22 | 1996-09-03 | Monsanto Company | Process for preparing substituted aromatic azo compounds |
| US5451702A (en) * | 1993-04-26 | 1995-09-19 | Monsanto Company | Process for preparing substituted aromatic amines |
-
1993
- 1993-04-06 US US08/038,047 patent/US5552531A/en not_active Expired - Fee Related
- 1993-04-13 DE DE69307699T patent/DE69307699T2/de not_active Expired - Fee Related
- 1993-04-13 KR KR1019940704180A patent/KR0164628B1/ko not_active Expired - Fee Related
- 1993-04-13 BR BR9306401A patent/BR9306401A/pt not_active IP Right Cessation
- 1993-04-13 AT AT93911630T patent/ATE148100T1/de not_active IP Right Cessation
- 1993-04-13 HU HU9403339A patent/HUT70869A/hu unknown
- 1993-04-13 GE GEAP19932486A patent/GEP19991703B/en unknown
- 1993-04-13 CA CA002135491A patent/CA2135491C/en not_active Expired - Fee Related
- 1993-04-13 JP JP50051794A patent/JP3476818B2/ja not_active Expired - Fee Related
- 1993-04-13 ES ES93911630T patent/ES2099440T3/es not_active Expired - Lifetime
- 1993-04-13 UA UA94119076A patent/UA44224C2/uk unknown
- 1993-04-13 WO PCT/US1993/003456 patent/WO1993024450A1/en not_active Ceased
- 1993-04-13 CZ CZ942835A patent/CZ283594A3/cs unknown
- 1993-04-13 EP EP93911630A patent/EP0641313B1/en not_active Expired - Lifetime
- 1993-04-13 PL PL93306767A patent/PL176660B1/pl unknown
- 1993-04-13 RU RU94046135A patent/RU2126380C1/ru active
- 1993-04-17 TW TW082102947A patent/TW239118B/zh active
-
1994
- 1994-11-22 EE EE9400352A patent/EE03056B1/xx unknown
-
1995
- 1995-05-18 US US08/444,325 patent/US5633407A/en not_active Expired - Fee Related
- 1995-05-18 US US08/443,796 patent/US5618979A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| JP3476818B2 (ja) | 2003-12-10 |
| RU2126380C1 (ru) | 1999-02-20 |
| DE69307699T2 (de) | 1997-06-05 |
| US5618979A (en) | 1997-04-08 |
| HU9403339D0 (en) | 1995-02-28 |
| BR9306401A (pt) | 1995-07-11 |
| EE03056B1 (et) | 1997-12-15 |
| ES2099440T3 (es) | 1997-05-16 |
| PL176660B1 (pl) | 1999-07-30 |
| GEP19991703B (en) | 1999-08-05 |
| KR950701616A (ko) | 1995-04-28 |
| ATE148100T1 (de) | 1997-02-15 |
| EP0641313A1 (en) | 1995-03-08 |
| US5552531A (en) | 1996-09-03 |
| JPH07507297A (ja) | 1995-08-10 |
| HUT70869A (en) | 1995-11-28 |
| KR0164628B1 (ko) | 1999-03-20 |
| CA2135491C (en) | 2004-06-22 |
| RU94046135A (ru) | 1996-11-27 |
| UA44224C2 (uk) | 2002-02-15 |
| US5633407A (en) | 1997-05-27 |
| DE69307699D1 (de) | 1997-03-06 |
| TW239118B (enExample) | 1995-01-21 |
| EP0641313B1 (en) | 1997-01-22 |
| WO1993024450A1 (en) | 1993-12-09 |
| CA2135491A1 (en) | 1993-12-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CZ283594A3 (en) | Process for preparing substituted aromatic amines | |
| EP0590053B2 (en) | Method of preparing 4-aminodiphenylamine | |
| EP0696269B1 (en) | Process for preparing substituted aromatic amines | |
| EP0641308B1 (en) | Process for preparing n-aliphatic substituted p-phenylenediamines | |
| EP0726889B1 (en) | Process for preparing substituted aromatic amines | |
| KR0182064B1 (ko) | 치환된 방향족 아민의 제조방법 |