CS273314B2 - Method of polycyclic aromatic alkanol derivatives preparation - Google Patents
Method of polycyclic aromatic alkanol derivatives preparation Download PDFInfo
- Publication number
- CS273314B2 CS273314B2 CS364584A CS364584A CS273314B2 CS 273314 B2 CS273314 B2 CS 273314B2 CS 364584 A CS364584 A CS 364584A CS 364584 A CS364584 A CS 364584A CS 273314 B2 CS273314 B2 CS 273314B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- methyl
- mixture
- amino
- grams
- nitro
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 56
- 238000002360 preparation method Methods 0.000 title claims abstract description 16
- 150000001875 compounds Chemical class 0.000 claims abstract description 98
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 77
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical class CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims abstract description 54
- -1 hydroxy, methyl Chemical group 0.000 claims abstract description 44
- 239000001257 hydrogen Substances 0.000 claims abstract description 23
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 105
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 claims description 84
- 239000000243 solution Substances 0.000 claims description 70
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 69
- 239000000203 mixture Substances 0.000 claims description 68
- 229910052799 carbon Inorganic materials 0.000 claims description 54
- 239000002904 solvent Substances 0.000 claims description 51
- 238000000921 elemental analysis Methods 0.000 claims description 48
- 239000000047 product Substances 0.000 claims description 40
- 238000002844 melting Methods 0.000 claims description 38
- 230000008018 melting Effects 0.000 claims description 38
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 37
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 32
- 239000000460 chlorine Substances 0.000 claims description 32
- 239000007787 solid Substances 0.000 claims description 31
- 239000011541 reaction mixture Substances 0.000 claims description 29
- 229910004298 SiO 2 Inorganic materials 0.000 claims description 28
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 27
- 235000019439 ethyl acetate Nutrition 0.000 claims description 27
- 229910052757 nitrogen Inorganic materials 0.000 claims description 27
- 238000006243 chemical reaction Methods 0.000 claims description 24
- 239000000463 material Substances 0.000 claims description 24
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 20
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 18
- 238000000746 purification Methods 0.000 claims description 13
- 238000001914 filtration Methods 0.000 claims description 12
- 239000007788 liquid Substances 0.000 claims description 12
- 239000000706 filtrate Substances 0.000 claims description 10
- 239000007810 chemical reaction solvent Substances 0.000 claims description 9
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 claims description 8
- 229960000583 acetic acid Drugs 0.000 claims description 8
- 238000003756 stirring Methods 0.000 claims description 8
- 239000000126 substance Substances 0.000 claims description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 7
- 238000001035 drying Methods 0.000 claims description 7
- 239000012362 glacial acetic acid Substances 0.000 claims description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 6
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 claims description 6
- 239000013078 crystal Substances 0.000 claims description 6
- 238000001953 recrystallisation Methods 0.000 claims description 6
- 239000003054 catalyst Substances 0.000 claims description 5
- 238000004128 high performance liquid chromatography Methods 0.000 claims description 5
- 239000012299 nitrogen atmosphere Substances 0.000 claims description 5
- 239000006188 syrup Substances 0.000 claims description 5
- 235000020357 syrup Nutrition 0.000 claims description 5
- 230000015572 biosynthetic process Effects 0.000 claims description 4
- 238000003786 synthesis reaction Methods 0.000 claims description 4
- 239000001569 carbon dioxide Substances 0.000 claims description 3
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 3
- 238000004587 chromatography analysis Methods 0.000 claims description 3
- 238000003818 flash chromatography Methods 0.000 claims description 3
- 230000022244 formylation Effects 0.000 claims description 3
- 238000006170 formylation reaction Methods 0.000 claims description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 claims description 3
- 235000019341 magnesium sulphate Nutrition 0.000 claims description 3
- 229910052763 palladium Inorganic materials 0.000 claims description 3
- 238000000926 separation method Methods 0.000 claims description 3
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 claims description 2
- 244000309464 bull Species 0.000 claims description 2
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 claims description 2
- 239000000920 calcium hydroxide Substances 0.000 claims description 2
- 229910001861 calcium hydroxide Inorganic materials 0.000 claims description 2
- 239000002027 dichloromethane extract Substances 0.000 claims description 2
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 claims description 2
- KREJIEGRPQSQAG-UHFFFAOYSA-N 4-ethylfluoranthene-3-carbaldehyde Chemical compound C12=CC=CC=C2C2=CC=C(C=O)C3=C2C1=CC=C3CC KREJIEGRPQSQAG-UHFFFAOYSA-N 0.000 claims 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims 3
- JXUOLJXLPIIRTP-UHFFFAOYSA-N 3-ethylfluoranthene Chemical compound C12=CC=CC=C2C2=CC=CC3=C2C1=CC=C3CC JXUOLJXLPIIRTP-UHFFFAOYSA-N 0.000 claims 2
- VFXDNQYXLCNZGA-UHFFFAOYSA-N 3-methyl-3-nitropentane-2,4-diol Chemical compound CC(O)C(C)(C(C)O)[N+]([O-])=O VFXDNQYXLCNZGA-UHFFFAOYSA-N 0.000 claims 2
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (1R)-1,3-butanediol Natural products CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 claims 1
- PCNWBUOSTLGPMI-UHFFFAOYSA-N 2-nitro-1-propanol Chemical compound OCC(C)[N+]([O-])=O PCNWBUOSTLGPMI-UHFFFAOYSA-N 0.000 claims 1
- KFSOKSKYVDCQOY-UHFFFAOYSA-N 3-amino-3-methylpentane-2,4-diol Chemical compound CC(O)C(C)(N)C(C)O KFSOKSKYVDCQOY-UHFFFAOYSA-N 0.000 claims 1
- AHCOSHUPTJVUDA-UHFFFAOYSA-N 3-ethylfluoranthene-7-carbaldehyde Chemical compound C12=CC=CC(C=O)=C2C2=CC=CC3=C2C1=CC=C3CC AHCOSHUPTJVUDA-UHFFFAOYSA-N 0.000 claims 1
- OJVOGABFNZDOOZ-UHFFFAOYSA-N 3-nitrobutan-2-ol Chemical compound CC(O)C(C)[N+]([O-])=O OJVOGABFNZDOOZ-UHFFFAOYSA-N 0.000 claims 1
- FBUPBJQUGLBFFY-UHFFFAOYSA-N 4-ethylfluoranthene-7-carbaldehyde Chemical compound C1=CC=C(C=O)C2=C1C1=CC=CC3=C1C2=CC=C3CC FBUPBJQUGLBFFY-UHFFFAOYSA-N 0.000 claims 1
- MMKZTXUXSPHNRG-UHFFFAOYSA-N 4-ethylfluoranthene-8-carbaldehyde Chemical compound C12=CC(C=O)=CC=C2C2=CC=CC3=C2C1=CC=C3CC MMKZTXUXSPHNRG-UHFFFAOYSA-N 0.000 claims 1
- 239000012267 brine Substances 0.000 claims 1
- 230000000704 physical effect Effects 0.000 claims 1
- XOJVVFBFDXDTEG-UHFFFAOYSA-N pristane Chemical compound CC(C)CCCC(C)CCCC(C)CCCC(C)C XOJVVFBFDXDTEG-UHFFFAOYSA-N 0.000 claims 1
- 239000012264 purified product Substances 0.000 claims 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 claims 1
- 239000003039 volatile agent Substances 0.000 claims 1
- 238000010626 work up procedure Methods 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract description 33
- 125000004432 carbon atom Chemical group C* 0.000 abstract description 20
- 150000003839 salts Chemical class 0.000 abstract description 19
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract description 18
- 125000001424 substituent group Chemical group 0.000 abstract description 17
- 150000002148 esters Chemical class 0.000 abstract description 14
- 125000000217 alkyl group Chemical group 0.000 abstract description 13
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 abstract description 11
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract description 10
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 abstract description 10
- 230000000259 anti-tumor effect Effects 0.000 abstract description 9
- 125000003545 alkoxy group Chemical group 0.000 abstract description 7
- 150000002170 ethers Chemical class 0.000 abstract description 6
- 239000003814 drug Substances 0.000 abstract description 5
- 230000003115 biocidal effect Effects 0.000 abstract description 4
- 125000005843 halogen group Chemical group 0.000 abstract description 4
- 239000008194 pharmaceutical composition Substances 0.000 abstract description 4
- 125000004093 cyano group Chemical group *C#N 0.000 abstract description 3
- 125000002837 carbocyclic group Chemical group 0.000 abstract description 2
- 230000000694 effects Effects 0.000 abstract description 2
- 125000005842 heteroatom Chemical group 0.000 abstract description 2
- 125000000623 heterocyclic group Chemical group 0.000 abstract description 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 abstract 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 47
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 28
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 27
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 22
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 22
- 239000000741 silica gel Substances 0.000 description 20
- 229910002027 silica gel Inorganic materials 0.000 description 20
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 17
- 206010028980 Neoplasm Diseases 0.000 description 16
- 239000003921 oil Substances 0.000 description 14
- 239000003480 eluent Substances 0.000 description 13
- 238000010992 reflux Methods 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 12
- 239000002253 acid Substances 0.000 description 11
- 239000010410 layer Substances 0.000 description 10
- 239000003153 chemical reaction reagent Substances 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- 150000001299 aldehydes Chemical class 0.000 description 8
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 8
- SHYBXXMECBHHFH-UHFFFAOYSA-N 10-chloroanthracene-9-carbaldehyde Chemical compound C1=CC=C2C(Cl)=C(C=CC=C3)C3=C(C=O)C2=C1 SHYBXXMECBHHFH-UHFFFAOYSA-N 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 6
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 6
- 125000003118 aryl group Chemical group 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 6
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 6
- 239000011591 potassium Substances 0.000 description 6
- 229910052700 potassium Inorganic materials 0.000 description 6
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 5
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 201000011510 cancer Diseases 0.000 description 5
- 239000003638 chemical reducing agent Substances 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000013058 crude material Substances 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- 229910052717 sulfur Inorganic materials 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- CCFAKBRKTKVJPO-UHFFFAOYSA-N 1-anthroic acid Chemical compound C1=CC=C2C=C3C(C(=O)O)=CC=CC3=CC2=C1 CCFAKBRKTKVJPO-UHFFFAOYSA-N 0.000 description 4
- SIEYYGAWDCFHPO-UHFFFAOYSA-N 10-methylsulfanylanthracene-9-carbaldehyde Chemical compound C1=CC=C2C(SC)=C(C=CC=C3)C3=C(C=O)C2=C1 SIEYYGAWDCFHPO-UHFFFAOYSA-N 0.000 description 4
- DDMHWNHZNBNNAN-UHFFFAOYSA-N 4-chloroanthracene-9-carbaldehyde Chemical compound C1=CC=C2C=C3C(Cl)=CC=CC3=C(C=O)C2=C1 DDMHWNHZNBNNAN-UHFFFAOYSA-N 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 4
- 241000124008 Mammalia Species 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 4
- WDECIBYCCFPHNR-UHFFFAOYSA-N chrysene Chemical compound C1=CC=CC2=CC=C3C4=CC=CC=C4C=CC3=C21 WDECIBYCCFPHNR-UHFFFAOYSA-N 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- GVEPBJHOBDJJJI-UHFFFAOYSA-N fluoranthene Chemical compound C1=CC(C2=CC=CC=C22)=C3C2=CC=CC3=C1 GVEPBJHOBDJJJI-UHFFFAOYSA-N 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 4
- 239000012280 lithium aluminium hydride Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 125000005575 polycyclic aromatic hydrocarbon group Chemical group 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- 210000004881 tumor cell Anatomy 0.000 description 4
- LGZWQUKBPLPMLI-UHFFFAOYSA-N (10-bromoanthracen-1-yl)methanol Chemical compound C1=CC=C2C=C3C(CO)=CC=CC3=C(Br)C2=C1 LGZWQUKBPLPMLI-UHFFFAOYSA-N 0.000 description 3
- NCYGRBUUKZQQSE-UHFFFAOYSA-N (10-chloroanthracen-1-yl)methanol Chemical compound C1=CC=C2C=C3C(CO)=CC=CC3=C(Cl)C2=C1 NCYGRBUUKZQQSE-UHFFFAOYSA-N 0.000 description 3
- FXKASOSOVAVXTA-UHFFFAOYSA-N 2-(2-iodoethoxy)oxane Chemical compound ICCOC1CCCCO1 FXKASOSOVAVXTA-UHFFFAOYSA-N 0.000 description 3
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 3
- YMGMUMVXYIDTGO-UHFFFAOYSA-N 3-chloroanthracene-9-carbaldehyde Chemical compound C1=CC=CC2=CC3=CC(Cl)=CC=C3C(C=O)=C21 YMGMUMVXYIDTGO-UHFFFAOYSA-N 0.000 description 3
- RSHAKWUMVHQORJ-UHFFFAOYSA-N 3-nitropentane-2,4-diol Chemical compound CC(O)C(C(C)O)[N+]([O-])=O RSHAKWUMVHQORJ-UHFFFAOYSA-N 0.000 description 3
- SAGGALJEKVRKJT-UHFFFAOYSA-N 4,10-dichloroanthracene-9-carbaldehyde Chemical compound C1=CC=C2C(Cl)=C3C(Cl)=CC=CC3=C(C=O)C2=C1 SAGGALJEKVRKJT-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 3
- 239000004215 Carbon black (E152) Substances 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- XCCCHWWMLSAIOH-UHFFFAOYSA-N anthracen-1-ylmethanol Chemical compound C1=CC=C2C=C3C(CO)=CC=CC3=CC2=C1 XCCCHWWMLSAIOH-UHFFFAOYSA-N 0.000 description 3
- XJDFBLQCLSBCGQ-UHFFFAOYSA-N anthracene-1-carbaldehyde Chemical compound C1=CC=C2C=C3C(C=O)=CC=CC3=CC2=C1 XJDFBLQCLSBCGQ-UHFFFAOYSA-N 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 3
- 229910010277 boron hydride Inorganic materials 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 210000004027 cell Anatomy 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- DEZRYPDIMOWBDS-UHFFFAOYSA-N dcm dichloromethane Chemical compound ClCCl.ClCCl DEZRYPDIMOWBDS-UHFFFAOYSA-N 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 3
- 239000003937 drug carrier Substances 0.000 description 3
- GPJKGQJJBMLUHM-UHFFFAOYSA-N ethyl 2-(benzylideneamino)-2-methyl-4-(oxan-2-yloxy)butanoate Chemical compound C=1C=CC=CC=1C=NC(C)(C(=O)OCC)CCOC1CCCCO1 GPJKGQJJBMLUHM-UHFFFAOYSA-N 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 238000007911 parenteral administration Methods 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 238000004262 preparative liquid chromatography Methods 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 3
- GHOKWGTUZJEAQD-ZETCQYMHSA-N (D)-(+)-Pantothenic acid Chemical compound OCC(C)(C)[C@@H](O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-ZETCQYMHSA-N 0.000 description 2
- RHUHWUPHSJGTMK-UHFFFAOYSA-N 1,10-dichloroanthracene-9-carbaldehyde Chemical compound C1=CC=C2C(C=O)=C3C(Cl)=CC=CC3=C(Cl)C2=C1 RHUHWUPHSJGTMK-UHFFFAOYSA-N 0.000 description 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- SRIHSAFSOOUEGL-UHFFFAOYSA-N 1-chloroanthracene Chemical compound C1=CC=C2C=C3C(Cl)=CC=CC3=CC2=C1 SRIHSAFSOOUEGL-UHFFFAOYSA-N 0.000 description 2
- BOCJQSFSGAZAPQ-UHFFFAOYSA-N 1-chloroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2Cl BOCJQSFSGAZAPQ-UHFFFAOYSA-N 0.000 description 2
- KXPHJJLTQLXDNN-UHFFFAOYSA-N 1-chloroanthracene-9-carbaldehyde Chemical compound C1=CC=C2C(C=O)=C3C(Cl)=CC=CC3=CC2=C1 KXPHJJLTQLXDNN-UHFFFAOYSA-N 0.000 description 2
- QGJMBESZSDSIPI-UHFFFAOYSA-N 10-(2-chloroethyl)anthracene-9-carbaldehyde Chemical compound C1=CC=C2C(CCCl)=C(C=CC=C3)C3=C(C=O)C2=C1 QGJMBESZSDSIPI-UHFFFAOYSA-N 0.000 description 2
- YHYBYHMUFTWZRR-UHFFFAOYSA-N 10-(2-hydroxyethoxy)anthracene-9-carbaldehyde Chemical compound C1=CC=C2C(OCCO)=C(C=CC=C3)C3=C(C=O)C2=C1 YHYBYHMUFTWZRR-UHFFFAOYSA-N 0.000 description 2
- SGILCUWMMCJIFM-UHFFFAOYSA-N 10-bromoanthracene-1-carbaldehyde Chemical compound C1=CC=C2C(Br)=C(C=CC=C3)C3=CC2=C1C=O SGILCUWMMCJIFM-UHFFFAOYSA-N 0.000 description 2
- YPRQOJZRPXMBMQ-UHFFFAOYSA-N 10-bromoanthracene-9-carbaldehyde Chemical compound C1=CC=C2C(Br)=C(C=CC=C3)C3=C(C=O)C2=C1 YPRQOJZRPXMBMQ-UHFFFAOYSA-N 0.000 description 2
- LEDNEHJWUBEXMD-UHFFFAOYSA-N 10-chloroanthracene-1-carbaldehyde Chemical compound C1=CC=C2C(Cl)=C(C=CC=C3)C3=CC2=C1C=O LEDNEHJWUBEXMD-UHFFFAOYSA-N 0.000 description 2
- UBBCCUWEPZLHFQ-UHFFFAOYSA-N 10-ethoxyanthracene-9-carbaldehyde Chemical compound C1=CC=C2C(OCC)=C(C=CC=C3)C3=C(C=O)C2=C1 UBBCCUWEPZLHFQ-UHFFFAOYSA-N 0.000 description 2
- MPCPUZXOKSGSPD-UHFFFAOYSA-N 10-ethylsulfanylanthracene-9-carbaldehyde Chemical compound C1=CC=C2C(SCC)=C(C=CC=C3)C3=C(C=O)C2=C1 MPCPUZXOKSGSPD-UHFFFAOYSA-N 0.000 description 2
- WQPWBUMSUOZDCQ-UHFFFAOYSA-N 10-formylanthracene-9-carbonitrile Chemical compound C1=CC=C2C(C=O)=C(C=CC=C3)C3=C(C#N)C2=C1 WQPWBUMSUOZDCQ-UHFFFAOYSA-N 0.000 description 2
- GSEDVPCKYAIRDW-UHFFFAOYSA-N 10-imidazol-1-ylanthracene-9-carbaldehyde Chemical compound C12=CC=CC=C2C(C=O)=C2C=CC=CC2=C1N1C=CN=C1 GSEDVPCKYAIRDW-UHFFFAOYSA-N 0.000 description 2
- YIEZXZOBPXOWKF-UHFFFAOYSA-N 10-methoxyanthracene-9-carbaldehyde Chemical compound C1=CC=C2C(OC)=C(C=CC=C3)C3=C(C=O)C2=C1 YIEZXZOBPXOWKF-UHFFFAOYSA-N 0.000 description 2
- AFTPZMZVMBEKII-UHFFFAOYSA-N 10-methylsulfinylanthracene-9-carbaldehyde Chemical compound C1=CC=C2C(S(=O)C)=C(C=CC=C3)C3=C(C=O)C2=C1 AFTPZMZVMBEKII-UHFFFAOYSA-N 0.000 description 2
- BYSQINLNQYQXJM-UHFFFAOYSA-N 10-methylsulfonylanthracene-9-carbaldehyde Chemical compound C1=CC=C2C(S(=O)(=O)C)=C(C=CC=C3)C3=C(C=O)C2=C1 BYSQINLNQYQXJM-UHFFFAOYSA-N 0.000 description 2
- OTJPFEOGCOPJFC-UHFFFAOYSA-N 12-ethoxychrysene-6-carbaldehyde Chemical compound C1=CC=C2C(OCC)=CC3=C(C=CC=C4)C4=C(C=O)C=C3C2=C1 OTJPFEOGCOPJFC-UHFFFAOYSA-N 0.000 description 2
- UMWGLDQKHSVSOX-UHFFFAOYSA-N 2-(benzylamino)-2-methylbutane-1,4-diol Chemical compound OCCC(CO)(C)NCC1=CC=CC=C1 UMWGLDQKHSVSOX-UHFFFAOYSA-N 0.000 description 2
- UXFQFBNBSPQBJW-UHFFFAOYSA-N 2-amino-2-methylpropane-1,3-diol Chemical compound OCC(N)(C)CO UXFQFBNBSPQBJW-UHFFFAOYSA-N 0.000 description 2
- FPKCTSIVDAWGFA-UHFFFAOYSA-N 2-chloroanthracene-9,10-dione Chemical compound C1=CC=C2C(=O)C3=CC(Cl)=CC=C3C(=O)C2=C1 FPKCTSIVDAWGFA-UHFFFAOYSA-N 0.000 description 2
- VHNJYJXDQKORPF-UHFFFAOYSA-N 2-chloroanthracene-9-carbaldehyde Chemical compound C1=CC=CC2=C(C=O)C3=CC(Cl)=CC=C3C=C21 VHNJYJXDQKORPF-UHFFFAOYSA-N 0.000 description 2
- ZXAGXLDEMUNQSH-UHFFFAOYSA-N 2-ethylanthracene Chemical compound C1=CC=CC2=CC3=CC(CC)=CC=C3C=C21 ZXAGXLDEMUNQSH-UHFFFAOYSA-N 0.000 description 2
- QSECPQCFCWVBKM-UHFFFAOYSA-N 2-iodoethanol Chemical compound OCCI QSECPQCFCWVBKM-UHFFFAOYSA-N 0.000 description 2
- WXXMKLFCLAUKPH-UHFFFAOYSA-N 3,10-dichloroanthracene-9-carbaldehyde Chemical compound C1=CC=CC2=C(Cl)C3=CC(Cl)=CC=C3C(C=O)=C21 WXXMKLFCLAUKPH-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- XENSVBQRWCELNY-UHFFFAOYSA-N 4,5-dichloroanthracene-9-carbaldehyde Chemical compound C1=CC(Cl)=C2C=C3C(Cl)=CC=CC3=C(C=O)C2=C1 XENSVBQRWCELNY-UHFFFAOYSA-N 0.000 description 2
- POPBYCBXVLHSKO-UHFFFAOYSA-N 9,10-dioxoanthracene-1-carboxylic acid Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2C(=O)O POPBYCBXVLHSKO-UHFFFAOYSA-N 0.000 description 2
- 206010003445 Ascites Diseases 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 208000028018 Lymphocytic leukaemia Diseases 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 2
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- 239000003139 biocide Substances 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 150000001722 carbon compounds Chemical class 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 208000029742 colonic neoplasm Diseases 0.000 description 2
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 2
- YKGMKSIHIVVYKY-UHFFFAOYSA-N dabrafenib mesylate Chemical compound CS(O)(=O)=O.S1C(C(C)(C)C)=NC(C=2C(=C(NS(=O)(=O)C=3C(=CC=CC=3F)F)C=CC=2)F)=C1C1=CC=NC(N)=N1 YKGMKSIHIVVYKY-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 208000003747 lymphoid leukemia Diseases 0.000 description 2
- 238000001819 mass spectrum Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 125000003367 polycyclic group Chemical group 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- 238000011160 research Methods 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 238000007711 solidification Methods 0.000 description 2
- 230000008023 solidification Effects 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- YGIUYXOOOGQGIS-UHFFFAOYSA-N 1,8-dichloroanthracene Chemical compound C1=CC(Cl)=C2C=C3C(Cl)=CC=CC3=CC2=C1 YGIUYXOOOGQGIS-UHFFFAOYSA-N 0.000 description 1
- YZTNDBZNPCMJCE-UHFFFAOYSA-N 1-aminocyclohexane-1,3-diol Chemical compound NC1(O)CCCC(O)C1 YZTNDBZNPCMJCE-UHFFFAOYSA-N 0.000 description 1
- DOGCTUGYGZGSFX-UHFFFAOYSA-N 1-aminopropane-1,3-diol Chemical compound NC(O)CCO DOGCTUGYGZGSFX-UHFFFAOYSA-N 0.000 description 1
- BUQBVPIMMILONF-UHFFFAOYSA-N 10-(2-hydroxyethylsulfanyl)anthracene-9-carbaldehyde Chemical compound C1=CC=C2C(SCCO)=C(C=CC=C3)C3=C(C=O)C2=C1 BUQBVPIMMILONF-UHFFFAOYSA-N 0.000 description 1
- QGPBHHUPMLKZHR-UHFFFAOYSA-N 10-(2-methoxyethoxy)anthracene-9-carbaldehyde Chemical compound C1=CC=C2C(OCCOC)=C(C=CC=C3)C3=C(C=O)C2=C1 QGPBHHUPMLKZHR-UHFFFAOYSA-N 0.000 description 1
- SKQMFIOVXMVNGO-UHFFFAOYSA-N 10-bromoanthracene-1-carboxylic acid Chemical compound C1=CC=C2C=C3C(C(=O)O)=CC=CC3=C(Br)C2=C1 SKQMFIOVXMVNGO-UHFFFAOYSA-N 0.000 description 1
- YGNCGOICLFEGFB-UHFFFAOYSA-N 10-chloroanthracene-1-carboxylic acid Chemical compound C1=CC=C2C=C3C(C(=O)O)=CC=CC3=C(Cl)C2=C1 YGNCGOICLFEGFB-UHFFFAOYSA-N 0.000 description 1
- VFTFKUDGYRBSAL-UHFFFAOYSA-N 15-crown-5 Chemical compound C1COCCOCCOCCOCCO1 VFTFKUDGYRBSAL-UHFFFAOYSA-N 0.000 description 1
- MVTFFWQWQSODFI-UHFFFAOYSA-N 2,10-dichloroanthracene-1-carbaldehyde Chemical compound C1=CC=CC2=CC3=C(C=O)C(Cl)=CC=C3C(Cl)=C21 MVTFFWQWQSODFI-UHFFFAOYSA-N 0.000 description 1
- MXSTTZLDRATHFI-UHFFFAOYSA-N 2,10-dichloroanthracene-9-carbaldehyde Chemical compound C1=CC=CC2=C(C=O)C3=CC(Cl)=CC=C3C(Cl)=C21 MXSTTZLDRATHFI-UHFFFAOYSA-N 0.000 description 1
- NHZLLKNRTDIFAD-UHFFFAOYSA-N 2,5-dihydro-1,3-oxazole Chemical compound C1OCN=C1 NHZLLKNRTDIFAD-UHFFFAOYSA-N 0.000 description 1
- KUPZBMGVLLMQLO-UHFFFAOYSA-N 2-(anthracen-1-ylmethylamino)-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C=C3C(CNC(CO)(CO)C)=CC=CC3=CC2=C1 KUPZBMGVLLMQLO-UHFFFAOYSA-N 0.000 description 1
- YLTDJZLNMZYFHJ-UHFFFAOYSA-N 2-(anthracen-9-ylmethylamino)-2-methylbutane-1,4-diol Chemical compound C1=CC=C2C(CNC(CO)(CCO)C)=C(C=CC=C3)C3=CC2=C1 YLTDJZLNMZYFHJ-UHFFFAOYSA-N 0.000 description 1
- UGDRMTMZEDLLHA-UHFFFAOYSA-N 2-(anthracen-9-ylmethylamino)-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=CC2=C1 UGDRMTMZEDLLHA-UHFFFAOYSA-N 0.000 description 1
- WPHAPIVXSNDMCJ-UHFFFAOYSA-N 2-(anthracen-9-ylmethylamino)-2-propan-2-ylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C(C)C)=C(C=CC=C3)C3=CC2=C1 WPHAPIVXSNDMCJ-UHFFFAOYSA-N 0.000 description 1
- KKZVNNFFJBMXGC-UHFFFAOYSA-N 2-(benzylamino)-2-methylpropane-1,3-diol Chemical compound OCC(C)(CO)NCC1=CC=CC=C1 KKZVNNFFJBMXGC-UHFFFAOYSA-N 0.000 description 1
- RSKQOKZNWYKUJW-UHFFFAOYSA-N 2-(chrysen-6-ylmethylamino)-2-(hydroxymethyl)propane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)CO)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 RSKQOKZNWYKUJW-UHFFFAOYSA-N 0.000 description 1
- RHVZHNWDLMQNSM-UHFFFAOYSA-N 2-(chrysen-6-ylmethylamino)-2-ethylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)CC)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 RHVZHNWDLMQNSM-UHFFFAOYSA-N 0.000 description 1
- FTMGTRJRGPVIET-UHFFFAOYSA-N 2-(chrysen-6-ylmethylamino)-2-methylbutane-1,4-diol Chemical compound C1=CC=C2C(CNC(CO)(CCO)C)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 FTMGTRJRGPVIET-UHFFFAOYSA-N 0.000 description 1
- JDIJCKDUNDZTNF-UHFFFAOYSA-N 2-(chrysen-6-ylmethylamino)-2-propan-2-ylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C(C)C)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 JDIJCKDUNDZTNF-UHFFFAOYSA-N 0.000 description 1
- RXLAXYFAPBVQSC-UHFFFAOYSA-N 2-(chrysen-6-ylmethylamino)propane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)CO)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 RXLAXYFAPBVQSC-UHFFFAOYSA-N 0.000 description 1
- YTHQUBIKIOUZBQ-UHFFFAOYSA-N 2-(fluoranthen-3-ylmethylamino)-2-methylpropane-1,3-diol Chemical compound C12=CC=CC=C2C2=CC=CC3=C2C1=CC=C3CNC(CO)(CO)C YTHQUBIKIOUZBQ-UHFFFAOYSA-N 0.000 description 1
- YRPIHRJWPZDYRJ-UHFFFAOYSA-N 2-[(10-bromoanthracen-1-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C=C3C(CNC(CO)(CO)C)=CC=CC3=C(Br)C2=C1 YRPIHRJWPZDYRJ-UHFFFAOYSA-N 0.000 description 1
- QNPUBCKESMIONV-UHFFFAOYSA-N 2-[(10-bromoanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=C(Br)C2=C1 QNPUBCKESMIONV-UHFFFAOYSA-N 0.000 description 1
- CIQMBZLADJZUNL-UHFFFAOYSA-N 2-[(10-butoxyanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(OCCCC)=C(C=CC=C3)C3=C(CNC(C)(CO)CO)C2=C1 CIQMBZLADJZUNL-UHFFFAOYSA-N 0.000 description 1
- GXVOYRCRFDCVSK-UHFFFAOYSA-N 2-[(10-butylanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(CCCC)=C(C=CC=C3)C3=C(CNC(C)(CO)CO)C2=C1 GXVOYRCRFDCVSK-UHFFFAOYSA-N 0.000 description 1
- FJELJMMDWGUYBQ-UHFFFAOYSA-N 2-[(10-chloroanthracen-9-yl)methylamino]-2-ethylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)CC)=C(C=CC=C3)C3=C(Cl)C2=C1 FJELJMMDWGUYBQ-UHFFFAOYSA-N 0.000 description 1
- NBGCGUCYBRJVPZ-UHFFFAOYSA-N 2-[(10-chloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=C(Cl)C2=C1 NBGCGUCYBRJVPZ-UHFFFAOYSA-N 0.000 description 1
- BRSCLDCWSJQDBL-UHFFFAOYSA-N 2-[(10-ethoxyanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(OCC)=C(C=CC=C3)C3=C(CNC(C)(CO)CO)C2=C1 BRSCLDCWSJQDBL-UHFFFAOYSA-N 0.000 description 1
- UMULQAMTVAVTNV-UHFFFAOYSA-N 2-[(10-ethylsulfanylanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(SCC)=C(C=CC=C3)C3=C(CNC(C)(CO)CO)C2=C1 UMULQAMTVAVTNV-UHFFFAOYSA-N 0.000 description 1
- SURDAPZTZUEGAK-UHFFFAOYSA-N 2-[(10-methoxyanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(OC)=C(C=CC=C3)C3=C(CNC(C)(CO)CO)C2=C1 SURDAPZTZUEGAK-UHFFFAOYSA-N 0.000 description 1
- YEPNBWHDORAILR-UHFFFAOYSA-N 2-[(2,10-dichloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=C(Cl)C=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=C(Cl)C2=C1 YEPNBWHDORAILR-UHFFFAOYSA-N 0.000 description 1
- NHOYESBPDHDFTQ-UHFFFAOYSA-N 2-[(2-chloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=C(Cl)C=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=CC2=C1 NHOYESBPDHDFTQ-UHFFFAOYSA-N 0.000 description 1
- XHFUJQYVAWTRMZ-UHFFFAOYSA-N 2-[(2-ethylanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=CC2=C(CNC(C)(CO)CO)C3=CC(CC)=CC=C3C=C21 XHFUJQYVAWTRMZ-UHFFFAOYSA-N 0.000 description 1
- XHROJVNSSRZGGM-UHFFFAOYSA-N 2-[(2-tert-butyl-10-chloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=CC2=C(CNC(C)(CO)CO)C3=CC(C(C)(C)C)=CC=C3C(Cl)=C21 XHROJVNSSRZGGM-UHFFFAOYSA-N 0.000 description 1
- GMODCAAYPNUSCX-UHFFFAOYSA-N 2-[(3,10-dichloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound ClC1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=C(Cl)C2=C1 GMODCAAYPNUSCX-UHFFFAOYSA-N 0.000 description 1
- JHNVCROHVHJQAR-UHFFFAOYSA-N 2-[(3-ethylanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=CC2=CC3=CC(CC)=CC=C3C(CNC(C)(CO)CO)=C21 JHNVCROHVHJQAR-UHFFFAOYSA-N 0.000 description 1
- ZUPVHOQXYSUXEU-UHFFFAOYSA-N 2-[(3-fluoroanthracen-1-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C=C3C(CNC(CO)(CO)C)=CC(F)=CC3=CC2=C1 ZUPVHOQXYSUXEU-UHFFFAOYSA-N 0.000 description 1
- KZKARGOFKJKKOE-UHFFFAOYSA-N 2-[(4,10-dichloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=C(Cl)C2=C1Cl KZKARGOFKJKKOE-UHFFFAOYSA-N 0.000 description 1
- MONFNQXOIYGSIS-UHFFFAOYSA-N 2-[(4,5-dichloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3Cl)C3=CC2=C1Cl MONFNQXOIYGSIS-UHFFFAOYSA-N 0.000 description 1
- ZPNAVMQQUZZOEK-UHFFFAOYSA-N 2-[(4-chloroanthracen-9-yl)methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=CC2=C1Cl ZPNAVMQQUZZOEK-UHFFFAOYSA-N 0.000 description 1
- CXAMVLZXHNOZHR-UHFFFAOYSA-N 2-[[10-(2-chloroethyl)anthracen-9-yl]methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=C(CCCl)C2=C1 CXAMVLZXHNOZHR-UHFFFAOYSA-N 0.000 description 1
- JPCHHZXQVHSGGC-UHFFFAOYSA-N 2-[[10-(2-hydroxyethoxy)anthracen-9-yl]methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=C(OCCO)C2=C1 JPCHHZXQVHSGGC-UHFFFAOYSA-N 0.000 description 1
- SJFSASLYGFJMEJ-UHFFFAOYSA-N 2-[[10-(2-hydroxyethylsulfanyl)anthracen-9-yl]methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=C(SCCO)C2=C1 SJFSASLYGFJMEJ-UHFFFAOYSA-N 0.000 description 1
- OKJBWGMSPYNWLX-UHFFFAOYSA-N 2-[[10-(2-methoxyethoxy)anthracen-9-yl]methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(OCCOC)=C(C=CC=C3)C3=C(CNC(C)(CO)CO)C2=C1 OKJBWGMSPYNWLX-UHFFFAOYSA-N 0.000 description 1
- NXLBUKRIMCDLFX-UHFFFAOYSA-N 2-[[10-(hydroxymethyl)anthracen-9-yl]methylamino]-2-methylpropane-1,3-diol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=C(C=CC=C3)C3=C(CO)C2=C1 NXLBUKRIMCDLFX-UHFFFAOYSA-N 0.000 description 1
- OSAIYSGZYRAWDH-UHFFFAOYSA-N 2-amino-2-(ethoxymethoxy)propane-1,3-diol hydrochloride Chemical compound Cl.NC(CO)(CO)OCOCC OSAIYSGZYRAWDH-UHFFFAOYSA-N 0.000 description 1
- RMHPQKBFEKOKFV-UHFFFAOYSA-N 2-amino-2-(ethoxymethyl)propane-1,3-diol Chemical compound CCOCC(N)(CO)CO RMHPQKBFEKOKFV-UHFFFAOYSA-N 0.000 description 1
- CYANGXSDERFYLF-UHFFFAOYSA-N 2-amino-2-methylbutane-1,4-diol Chemical compound OCC(N)(C)CCO CYANGXSDERFYLF-UHFFFAOYSA-N 0.000 description 1
- OHCOQXRUHRFRNM-UHFFFAOYSA-N 2-amino-2-methylbutane-1,4-diol;hydrochloride Chemical compound Cl.OCC(N)(C)CCO OHCOQXRUHRFRNM-UHFFFAOYSA-N 0.000 description 1
- XMBFYOWTPIQTEV-UHFFFAOYSA-N 2-amino-3-methoxy-2-methylpropan-1-ol Chemical compound COCC(C)(N)CO XMBFYOWTPIQTEV-UHFFFAOYSA-N 0.000 description 1
- CXDOZVCBIJMGPS-UHFFFAOYSA-N 2-amino-4-methoxybutan-1-ol Chemical compound COCCC(N)CO CXDOZVCBIJMGPS-UHFFFAOYSA-N 0.000 description 1
- AHIGMTHEFHHTFJ-UHFFFAOYSA-N 2-chloro-3,4-dihydro-2h-chromene;pyridine Chemical compound C1=CC=NC=C1.C1=CC=C2OC(Cl)CCC2=C1 AHIGMTHEFHHTFJ-UHFFFAOYSA-N 0.000 description 1
- OWFINXQLBMJDJQ-UHFFFAOYSA-N 2-chloroanthracene Chemical compound C1=CC=CC2=CC3=CC(Cl)=CC=C3C=C21 OWFINXQLBMJDJQ-UHFFFAOYSA-N 0.000 description 1
- XPOCRPKQQDATAQ-UHFFFAOYSA-N 2-ethyl-2-(fluoranthen-3-ylmethylamino)propane-1,3-diol Chemical compound C12=CC=CC=C2C2=CC=CC3=C2C1=CC=C3CNC(CO)(CO)CC XPOCRPKQQDATAQ-UHFFFAOYSA-N 0.000 description 1
- SJEBAWHUJDUKQK-UHFFFAOYSA-N 2-ethylanthraquinone Chemical compound C1=CC=C2C(=O)C3=CC(CC)=CC=C3C(=O)C2=C1 SJEBAWHUJDUKQK-UHFFFAOYSA-N 0.000 description 1
- XFXRMDNWSGXSNJ-UHFFFAOYSA-N 2-methyl-1-nitropropane Chemical compound CC(C)C[N+]([O-])=O XFXRMDNWSGXSNJ-UHFFFAOYSA-N 0.000 description 1
- JKWATNMPEICJJM-UHFFFAOYSA-N 2-methyl-2-(triphenylen-2-ylmethylamino)propane-1,3-diol Chemical compound C1=CC=C2C3=CC(CNC(CO)(CO)C)=CC=C3C3=CC=CC=C3C2=C1 JKWATNMPEICJJM-UHFFFAOYSA-N 0.000 description 1
- XBAPQUQVMYMKTP-UHFFFAOYSA-N 2-methyl-2-[(10-methylsulfanylanthracen-9-yl)methylamino]propane-1,3-diol Chemical compound C1=CC=C2C(SC)=C(C=CC=C3)C3=C(CNC(C)(CO)CO)C2=C1 XBAPQUQVMYMKTP-UHFFFAOYSA-N 0.000 description 1
- UREFUUVULNQGAM-UHFFFAOYSA-N 2-nitro-2-propan-2-ylpropane-1,3-diol Chemical compound CC(C)C(CO)(CO)[N+]([O-])=O UREFUUVULNQGAM-UHFFFAOYSA-N 0.000 description 1
- BUKJXNPBUFZYIY-UHFFFAOYSA-N 3,5-diphenyl-1,3-oxazolidine Chemical compound C1OC(C=2C=CC=CC=2)CN1C1=CC=CC=C1 BUKJXNPBUFZYIY-UHFFFAOYSA-N 0.000 description 1
- UOQHWNPVNXSDDO-UHFFFAOYSA-N 3-bromoimidazo[1,2-a]pyridine-6-carbonitrile Chemical compound C1=CC(C#N)=CN2C(Br)=CN=C21 UOQHWNPVNXSDDO-UHFFFAOYSA-N 0.000 description 1
- JXQCUCDXLSGQNZ-UHFFFAOYSA-N 3-tert-butyl-2-hydroxy-6-methylbenzoic acid Chemical compound CC1=CC=C(C(C)(C)C)C(O)=C1C(O)=O JXQCUCDXLSGQNZ-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- DEWWXAQHKMIDNZ-UHFFFAOYSA-N 4-chloro-10-(2-hydroxyethoxy)anthracene-9-carbaldehyde Chemical compound C1=CC(Cl)=C2C(OCCO)=C(C=CC=C3)C3=C(C=O)C2=C1 DEWWXAQHKMIDNZ-UHFFFAOYSA-N 0.000 description 1
- LVKLJLYFIFXBKM-UHFFFAOYSA-N 6-chlorochrysene Chemical compound C1=CC=C2C(Cl)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 LVKLJLYFIFXBKM-UHFFFAOYSA-N 0.000 description 1
- YGRBDDWMMUTWEI-UHFFFAOYSA-N 6-ethoxychrysene Chemical compound C1=CC=C2C(OCC)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 YGRBDDWMMUTWEI-UHFFFAOYSA-N 0.000 description 1
- ZJSYTTGSPQNXKT-UHFFFAOYSA-N 6-ethylchrysene Chemical compound C1=CC=C2C(CC)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 ZJSYTTGSPQNXKT-UHFFFAOYSA-N 0.000 description 1
- HUKPVYBUJRAUAG-UHFFFAOYSA-N 7-benzo[a]phenalenone Chemical compound C1=CC(C(=O)C=2C3=CC=CC=2)=C2C3=CC=CC2=C1 HUKPVYBUJRAUAG-UHFFFAOYSA-N 0.000 description 1
- KULLJOPUZUWTMF-UHFFFAOYSA-N 9-chloroanthracene Chemical compound C1=CC=C2C(Cl)=C(C=CC=C3)C3=CC2=C1 KULLJOPUZUWTMF-UHFFFAOYSA-N 0.000 description 1
- OGOYZCQQQFAGRI-UHFFFAOYSA-N 9-ethenylanthracene Chemical compound C1=CC=C2C(C=C)=C(C=CC=C3)C3=CC2=C1 OGOYZCQQQFAGRI-UHFFFAOYSA-N 0.000 description 1
- 229910016467 AlCl 4 Inorganic materials 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 206010069747 Burkholderia mallei infection Diseases 0.000 description 1
- 241000222122 Candida albicans Species 0.000 description 1
- DLGOEMSEDOSKAD-UHFFFAOYSA-N Carmustine Chemical compound ClCCNC(=O)N(N=O)CCCl DLGOEMSEDOSKAD-UHFFFAOYSA-N 0.000 description 1
- GHOKWGTUZJEAQD-UHFFFAOYSA-N Chick antidermatitis factor Natural products OCC(C)(C)C(O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-UHFFFAOYSA-N 0.000 description 1
- SBASUVWVUMGEEU-UHFFFAOYSA-N ClC1=CC2=CC3=C(C=CC=C3C=C2C=C1)C=O Chemical compound ClC1=CC2=CC3=C(C=CC=C3C=C2C=C1)C=O SBASUVWVUMGEEU-UHFFFAOYSA-N 0.000 description 1
- LVYADFIOICAIBZ-UHFFFAOYSA-N ClC=1C=CC2=C(C3=CC=CC=C3C=C2C1)CC(C(CO)C)(O)N Chemical compound ClC=1C=CC2=C(C3=CC=CC=C3C=C2C1)CC(C(CO)C)(O)N LVYADFIOICAIBZ-UHFFFAOYSA-N 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- UHDGCWIWMRVCDJ-CCXZUQQUSA-N Cytarabine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1 UHDGCWIWMRVCDJ-CCXZUQQUSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 108010092160 Dactinomycin Proteins 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- 241000223932 Eimeria tenella Species 0.000 description 1
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 238000005643 Gatterman-Koch carbonylation reaction Methods 0.000 description 1
- 201000003641 Glanders Diseases 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- XQFRJNBWHJMXHO-RRKCRQDMSA-N IDUR Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(I)=C1 XQFRJNBWHJMXHO-RRKCRQDMSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010022998 Irritability Diseases 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- 206010058467 Lung neoplasm malignant Diseases 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000204031 Mycoplasma Species 0.000 description 1
- 241001126260 Nippostrongylus Species 0.000 description 1
- JWIPGAFCGUDKEY-UHFFFAOYSA-L O[Cr](Cl)(=O)=O.C1=CC=NC=C1 Chemical compound O[Cr](Cl)(=O)=O.C1=CC=NC=C1 JWIPGAFCGUDKEY-UHFFFAOYSA-L 0.000 description 1
- 241000193996 Streptococcus pyogenes Species 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- SLGBZMMZGDRARJ-UHFFFAOYSA-N Triphenylene Natural products C1=CC=C2C3=CC=CC=C3C3=CC=CC=C3C2=C1 SLGBZMMZGDRARJ-UHFFFAOYSA-N 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- NVBAWZJWKSEHPJ-UHFFFAOYSA-N [2-amino-2-(hydroxymethyl)-3-methylbutyl] acetate Chemical compound CC(C)C(N)(CO)COC(C)=O NVBAWZJWKSEHPJ-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 159000000021 acetate salts Chemical class 0.000 description 1
- 229930183665 actinomycin Natural products 0.000 description 1
- 125000003172 aldehyde group Chemical group 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000000538 analytical sample Substances 0.000 description 1
- 229910052925 anhydrite Inorganic materials 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000002051 biphasic effect Effects 0.000 description 1
- 210000001185 bone marrow Anatomy 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- XZBRRWOZPRSTGO-UHFFFAOYSA-L calcium;sulfate;pentahydrate Chemical compound O.O.O.O.O.[Ca+2].[O-]S([O-])(=O)=O XZBRRWOZPRSTGO-UHFFFAOYSA-L 0.000 description 1
- 229940095731 candida albicans Drugs 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 description 1
- 229960004316 cisplatin Drugs 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 201000010897 colon adenocarcinoma Diseases 0.000 description 1
- 230000005757 colony formation Effects 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 229910000366 copper(II) sulfate Inorganic materials 0.000 description 1
- 238000010219 correlation analysis Methods 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- SBRXTSOCZITGQG-UHFFFAOYSA-N crisnatol Chemical compound C1=CC=C2C(CNC(CO)(CO)C)=CC3=C(C=CC=C4)C4=CC=C3C2=C1 SBRXTSOCZITGQG-UHFFFAOYSA-N 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- RLMGYIOTPQVQJR-UHFFFAOYSA-N cyclohexane-1,3-diol Chemical compound OC1CCCC(O)C1 RLMGYIOTPQVQJR-UHFFFAOYSA-N 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 230000001066 destructive effect Effects 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- FHHZOYXKOICLGH-UHFFFAOYSA-N dichloromethane;ethanol Chemical compound CCO.ClCCl FHHZOYXKOICLGH-UHFFFAOYSA-N 0.000 description 1
- SPWVRYZQLGQKGK-UHFFFAOYSA-N dichloromethane;hexane Chemical compound ClCCl.CCCCCC SPWVRYZQLGQKGK-UHFFFAOYSA-N 0.000 description 1
- GRTGGSXWHGKRSB-UHFFFAOYSA-N dichloromethyl methyl ether Chemical compound COC(Cl)Cl GRTGGSXWHGKRSB-UHFFFAOYSA-N 0.000 description 1
- YNHIGQDRGKUECZ-UHFFFAOYSA-N dichloropalladium;triphenylphosphanium Chemical compound Cl[Pd]Cl.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-N 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- SPCNPOWOBZQWJK-UHFFFAOYSA-N dimethoxy-(2-propan-2-ylsulfanylethylsulfanyl)-sulfanylidene-$l^{5}-phosphane Chemical class COP(=S)(OC)SCCSC(C)C SPCNPOWOBZQWJK-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000012156 elution solvent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- OLAMWIPURJGSKE-UHFFFAOYSA-N et2o diethylether Chemical compound CCOCC.CCOCC OLAMWIPURJGSKE-UHFFFAOYSA-N 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-N ethanesulfonic acid Chemical class CCS(O)(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-N 0.000 description 1
- OCLXJTCGWSSVOE-UHFFFAOYSA-N ethanol etoh Chemical compound CCO.CCO OCLXJTCGWSSVOE-UHFFFAOYSA-N 0.000 description 1
- LYZBDHZAIXLWRM-JTQLQIEISA-N ethyl (2s)-2-(benzylideneamino)propanoate Chemical compound CCOC(=O)[C@H](C)N=CC1=CC=CC=C1 LYZBDHZAIXLWRM-JTQLQIEISA-N 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- PVZBGCMQMBTMSR-UHFFFAOYSA-N fluoranthene-3-carbaldehyde Chemical compound C12=CC=CC=C2C2=CC=CC3=C2C1=CC=C3C=O PVZBGCMQMBTMSR-UHFFFAOYSA-N 0.000 description 1
- 229960002949 fluorouracil Drugs 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 150000004687 hexahydrates Chemical class 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 229940045996 isethionic acid Drugs 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000003893 lactate salts Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229940099563 lactobionic acid Drugs 0.000 description 1
- 208000032839 leukemia Diseases 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 201000005202 lung cancer Diseases 0.000 description 1
- 208000020816 lung neoplasm Diseases 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 201000006512 mast cell neoplasm Diseases 0.000 description 1
- 208000006971 mastocytoma Diseases 0.000 description 1
- 201000001441 melanoma Diseases 0.000 description 1
- 230000000684 melanotic effect Effects 0.000 description 1
- SGDBTWWWUNNDEQ-LBPRGKRZSA-N melphalan Chemical compound OC(=O)[C@@H](N)CC1=CC=C(N(CCCl)CCCl)C=C1 SGDBTWWWUNNDEQ-LBPRGKRZSA-N 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000007932 molded tablet Substances 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- XZYHDXZNNDZXSR-UHFFFAOYSA-N n-(1,1-dioxothiolan-3-yl)-n-methyl-2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide Chemical compound N=1N=C(C=2C=CN=CC=2)N(C=2C=CC=CC=2)C=1SCC(=O)N(C)C1CCS(=O)(=O)C1 XZYHDXZNNDZXSR-UHFFFAOYSA-N 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-N naphthalene-2-sulfonic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-N 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 150000007523 nucleic acids Chemical class 0.000 description 1
- 102000039446 nucleic acids Human genes 0.000 description 1
- 108020004707 nucleic acids Proteins 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229940055726 pantothenic acid Drugs 0.000 description 1
- 235000019161 pantothenic acid Nutrition 0.000 description 1
- 239000011713 pantothenic acid Substances 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 244000052769 pathogen Species 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000011946 reduction process Methods 0.000 description 1
- 239000012744 reinforcing agent Substances 0.000 description 1
- 201000009410 rhabdomyosarcoma Diseases 0.000 description 1
- 238000010079 rubber tapping Methods 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 150000007944 thiolates Chemical class 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 125000005580 triphenylene group Chemical group 0.000 description 1
- NXDGVEYXRSKONY-UHFFFAOYSA-N triphenylene-2-carbaldehyde Chemical compound C1=CC=C2C3=CC(C=O)=CC=C3C3=CC=CC=C3C2=C1 NXDGVEYXRSKONY-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/045—Hydroxy compounds, e.g. alcohols; Salts thereof, e.g. alcoholates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/02—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C215/04—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated
- C07C215/20—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated the carbon skeleton being saturated and containing rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/13—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups
- C07C205/14—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups having nitro groups and hydroxy groups bound to acyclic carbon atoms
- C07C205/15—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups having nitro groups and hydroxy groups bound to acyclic carbon atoms of a saturated carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/02—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C215/04—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated
- C07C215/06—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated and acyclic
- C07C215/10—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated and acyclic with one amino group and at least two hydroxy groups bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/02—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C215/22—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being unsaturated
- C07C215/28—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being unsaturated and containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/42—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having amino groups or hydroxy groups bound to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/48—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being unsaturated and containing rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/54—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton
- C07C217/56—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains not further substituted by singly-bound oxygen atoms
- C07C217/58—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains not further substituted by singly-bound oxygen atoms with amino groups and the six-membered aromatic ring, or the condensed ring system containing that ring, bound to the same carbon atom of the carbon chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/49—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C255/58—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing cyano groups and singly-bound nitrogen atoms, not being further bound to other hetero atoms, bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/26—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C317/32—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/31—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton
- C07C323/32—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton having at least one of the nitrogen atoms bound to an acyclic carbon atom of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
- C07D263/62—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems having two or more ring systems containing condensed 1,3-oxazole rings
- C07D263/64—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems having two or more ring systems containing condensed 1,3-oxazole rings linked in positions 2 and 2' by chains containing six-membered aromatic rings or ring systems containing such rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/135—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/08—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D309/10—Oxygen atoms
- C07D309/12—Oxygen atoms only hydrogen atoms and one oxygen atom directly attached to ring carbon atoms, e.g. tetrahydropyranyl ethers
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/04—1,3-Dioxanes; Hydrogenated 1,3-dioxanes
- C07D319/06—1,3-Dioxanes; Hydrogenated 1,3-dioxanes not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07J—STEROIDS
- C07J63/00—Steroids in which the cyclopenta(a)hydrophenanthrene skeleton has been modified by expansion of only one ring by one or two atoms
- C07J63/008—Expansion of ring D by one atom, e.g. D homo steroids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/04—Ortho- or ortho- and peri-condensed systems containing three rings
- C07C2603/22—Ortho- or ortho- and peri-condensed systems containing three rings containing only six-membered rings
- C07C2603/24—Anthracenes; Hydrogenated anthracenes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/04—Ortho- or ortho- and peri-condensed systems containing three rings
- C07C2603/22—Ortho- or ortho- and peri-condensed systems containing three rings containing only six-membered rings
- C07C2603/26—Phenanthrenes; Hydrogenated phenanthrenes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/40—Ortho- or ortho- and peri-condensed systems containing four condensed rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/40—Ortho- or ortho- and peri-condensed systems containing four condensed rings
- C07C2603/42—Ortho- or ortho- and peri-condensed systems containing four condensed rings containing only six-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/40—Ortho- or ortho- and peri-condensed systems containing four condensed rings
- C07C2603/42—Ortho- or ortho- and peri-condensed systems containing four condensed rings containing only six-membered rings
- C07C2603/48—Chrysenes; Hydrogenated chrysenes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/40—Ortho- or ortho- and peri-condensed systems containing four condensed rings
- C07C2603/42—Ortho- or ortho- and peri-condensed systems containing four condensed rings containing only six-membered rings
- C07C2603/50—Pyrenes; Hydrogenated pyrenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Epidemiology (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Catalysts (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS108789A CS273347B2 (en) | 1983-05-17 | 1989-02-20 | Method of polycyclic aromatic alkanol derivatives preparation |
| CS108889A CS273348B2 (en) | 1983-05-17 | 1989-02-20 | Method of polycyclic aromatic alkanol derivatives preparation |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB838313571A GB8313571D0 (en) | 1983-05-17 | 1983-05-17 | Chemical compounds |
| APAP/P/1984/000003A AP1A (en) | 1983-05-17 | 1984-07-16 | Polycyclic aromatic compounds |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CS364584A2 CS364584A2 (en) | 1990-08-14 |
| CS273314B2 true CS273314B2 (en) | 1991-03-12 |
Family
ID=39791481
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS364584A CS273314B2 (en) | 1983-05-17 | 1984-05-16 | Method of polycyclic aromatic alkanol derivatives preparation |
Country Status (30)
| Country | Link |
|---|---|
| US (6) | US4530800A (show.php) |
| EP (2) | EP0125701B1 (show.php) |
| JP (3) | JPS59225149A (show.php) |
| KR (1) | KR910000854B1 (show.php) |
| AP (1) | AP1A (show.php) |
| AU (2) | AU572509B2 (show.php) |
| CA (1) | CA1222750A (show.php) |
| CS (1) | CS273314B2 (show.php) |
| CY (1) | CY1486A (show.php) |
| DD (1) | DD223439A5 (show.php) |
| DE (2) | DE3473141D1 (show.php) |
| DK (1) | DK242284A (show.php) |
| EG (1) | EG17595A (show.php) |
| ES (3) | ES532512A0 (show.php) |
| FI (1) | FI85263C (show.php) |
| GB (2) | GB8313571D0 (show.php) |
| GR (1) | GR82278B (show.php) |
| HK (1) | HK45089A (show.php) |
| HU (1) | HU197875B (show.php) |
| IE (1) | IE58416B1 (show.php) |
| IL (1) | IL71851A (show.php) |
| MC (1) | MC1595A1 (show.php) |
| NO (1) | NO157416C (show.php) |
| NZ (1) | NZ208168A (show.php) |
| PH (1) | PH22265A (show.php) |
| PL (3) | PL144294B1 (show.php) |
| PT (1) | PT78586A (show.php) |
| SG (1) | SG22389G (show.php) |
| SU (3) | SU1535377A3 (show.php) |
| ZA (1) | ZA843708B (show.php) |
Families Citing this family (51)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4803221A (en) * | 1977-03-15 | 1989-02-07 | Burroughs Wellcome Co. | Anthracene derivatives |
| US4719048A (en) * | 1983-05-17 | 1988-01-12 | Burroughs Wellcome Co. | Crysene compound |
| GB8313571D0 (en) * | 1983-05-17 | 1983-06-22 | Wellcome Found | Chemical compounds |
| US4808625A (en) * | 1983-05-17 | 1989-02-28 | Burroughs Wellcome Co. | Phenanthrene derivatives |
| US4719046A (en) * | 1983-05-17 | 1988-01-12 | Burroughs Wellcome Co. | Crysene derivatives |
| US4719055A (en) * | 1983-05-17 | 1988-01-12 | Burroughs Wellcome Co. | Phenanthrene derivatives |
| US4803222A (en) * | 1983-05-17 | 1989-02-07 | Burroughs Wellcome Co. | Fluoranthene derivatives |
| US4829090A (en) * | 1983-05-17 | 1989-05-09 | Burroughs Wellcome Co. | Chrysene derivatives |
| US4810727A (en) * | 1983-05-17 | 1989-03-07 | Burroughs Wellcome Co. | Chrysene compound |
| US4803226A (en) * | 1983-05-17 | 1989-02-07 | Burroughs Wellcome Co. | Anthracene derivatives |
| US4808632A (en) * | 1983-05-17 | 1989-02-28 | Burroughs Wellcome Co. | Fluoranthene derivatives |
| US4717729A (en) * | 1983-05-31 | 1988-01-05 | Burroughs Wellcome Co. | Triphenylene derivatives |
| GB8428931D0 (en) * | 1984-11-15 | 1984-12-27 | Wellcome Found | Polycyclic biocidal compounds |
| ES8702905A1 (es) * | 1984-11-15 | 1987-01-16 | Wellcome Found | Un procedimiento para preparar derivados de alcanoles hete- ropoliciclicos |
| GB8428932D0 (en) * | 1984-11-15 | 1984-12-27 | Wellcome Found | Polycyclic biocidal compounds |
| GB8428930D0 (en) * | 1984-11-15 | 1984-12-27 | Wellcome Found | Polycyclic biocidal compounds |
| US4827034A (en) * | 1985-11-22 | 1989-05-02 | Burroughs Wellcome Co. | Carbocyclic derivatives |
| US4808753A (en) * | 1985-11-22 | 1989-02-28 | Burroughs Wellcome Co. | Carbocyclic derivatives |
| US4791233A (en) * | 1985-11-22 | 1988-12-13 | Burroughs Wellcome Co. | Carbocyclic derivatives |
| US4882358A (en) * | 1985-11-22 | 1989-11-21 | Burroughs Wellcome Co. | Carbocyclic derivatives |
| US4791232A (en) * | 1985-11-22 | 1988-12-13 | Burroughs Wellcome Co. | Carbocyclic derivatives |
| US4810823A (en) * | 1985-11-22 | 1989-03-07 | Burroughs Wellcome Co. | Carbocyclic derivatives |
| US4814502A (en) * | 1985-11-22 | 1989-03-21 | Burroughs Wellcome Co. | Carbocyclic derivatives |
| US5008286A (en) * | 1985-11-22 | 1991-04-16 | Burroughs Wellcome Co. | Certain substituted naphthofurans with anti-tumor properties |
| US4791231A (en) * | 1985-11-22 | 1988-12-13 | Burroughs Wellcome Co. | Carbocyclic derivatives |
| US4818443A (en) * | 1985-11-22 | 1989-04-04 | Burroughs Wellcome Co. | Carbocyclic derivatives |
| US5435667A (en) * | 1986-02-20 | 1995-07-25 | Slickbar Products Corp. | Protection of piles |
| JP2735609B2 (ja) * | 1989-03-31 | 1998-04-02 | 協和醗酵工業株式会社 | Ucn―1028d誘導体 |
| US5416244A (en) * | 1991-09-30 | 1995-05-16 | Ohmeda Pharmaceutical Products Division Inc. | Preparation of isoflurane |
| JPH06329679A (ja) * | 1993-01-20 | 1994-11-29 | Nissan Chem Ind Ltd | 光学活性β−アミノアルコキシボラン錯体 |
| EP1021397A4 (en) * | 1997-03-05 | 2000-10-04 | Trimeris Inc | BENZANTHRONE COMPOUNDS AND THEIR USE AGAINST VIRUSES |
| FR2775286B1 (fr) * | 1998-02-20 | 2001-09-07 | Centre Nat Rech Scient | Derives du triphenylene contre le sida |
| US6015811A (en) * | 1998-10-27 | 2000-01-18 | Board Of Regents, The University Of Texas System | Antitumor Chrysene derivatives |
| MXPA02006539A (es) * | 1999-12-30 | 2002-12-09 | Kimberly Clark Co | Tisu con locion antiviral y metodos para hacer y usar el mismo. |
| US6372785B1 (en) * | 2000-05-04 | 2002-04-16 | Keith Chan, President Globoasia, Llc | Synthesis of 1,8-dichloro-anthracene analogues and pharmaceutical compositions based thereon |
| US20050107430A1 (en) * | 2003-10-29 | 2005-05-19 | Banik Bimal K. | Antimicrobial and antiviral compounds |
| US7625497B2 (en) * | 2003-11-21 | 2009-12-01 | Board Of Regents Of The Nevada System Of Higher Education On Behalf Of The University Of Nevada, Reno | Materials and methods for the preparation of anisotropically-ordered solids |
| US20050233465A1 (en) * | 2004-04-14 | 2005-10-20 | Bioprocessors Corp. | Compositions of matter useful as pH indicators and related methods |
| TWI348463B (en) * | 2006-03-06 | 2011-09-11 | Lg Chemical Ltd | Novel anthracene derivative and organic electronic device using the same |
| RU2349311C1 (ru) * | 2007-08-02 | 2009-03-20 | Михаил Владимирович Кутушов | Применение дериватов нафталина в качестве средств для лечения онкологических заболеваний |
| US7635791B2 (en) * | 2008-04-17 | 2009-12-22 | Tpat Ip Llc | Biological buffers with wide buffering ranges |
| US7939659B2 (en) * | 2008-04-17 | 2011-05-10 | Thomas Daly | Biological buffers with wide buffering ranges |
| US8034951B2 (en) | 2008-04-17 | 2011-10-11 | Thomas Daly | Biological buffers with wide buffering ranges |
| US8334402B2 (en) * | 2008-04-17 | 2012-12-18 | Thomas Daly | Biological buffers with wide buffering ranges |
| US8822728B2 (en) | 2008-04-17 | 2014-09-02 | Thomas Daly | Biological buffers with wide buffering ranges |
| US9090638B2 (en) | 2008-04-17 | 2015-07-28 | Thomas Daly | Biological buffers with wide buffering ranges |
| US20170313920A1 (en) | 2010-10-06 | 2017-11-02 | Thomas P. Daly | Biological Buffers with Wide Buffering Ranges |
| US8519141B2 (en) | 2008-04-17 | 2013-08-27 | Thomas Daly | Biological buffers with wide buffering ranges |
| US9447310B2 (en) | 2008-04-17 | 2016-09-20 | Thomas P. Daly | Biological buffers with wide buffering ranges |
| US9475754B2 (en) | 2011-10-06 | 2016-10-25 | Thomas P. Daly | Biological buffers with wide buffering ranges |
| CN103086975A (zh) * | 2013-02-05 | 2013-05-08 | 广西师范大学 | 9-羟甲基-10-咪蒽腙及其合成方法和应用 |
Family Cites Families (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2734920A (en) * | 1956-02-14 | New chemical compounds and their | ||
| CH135942A (de) * | 1927-02-02 | 1929-10-15 | Ig Farbenindustrie Ag | Verfahren zur Herstellung einer Aldehydverbindung. |
| US2194294A (en) * | 1938-07-16 | 1940-03-19 | Du Pont | Preparation of n-substituted alkylol amines |
| US2865925A (en) * | 1956-03-23 | 1958-12-23 | Sterling Drug Inc | Process for preparing n-(2-hydroxyethyl)-n-(lower-alkyl)-9-aminomethylanthracenes and intermediates therein |
| US3052722A (en) * | 1958-06-24 | 1962-09-04 | May & Baker Ltd | Aminophenoxyalkane derivatives |
| US3198794A (en) * | 1960-07-25 | 1965-08-03 | Sterling Drug Inc | Pyrenylmethyl quaternary ammonium salts |
| US3198835A (en) * | 1960-07-25 | 1965-08-03 | Sterling Drug Inc | Pyrenyl methyl tertiary amino amines |
| FR95908E (fr) * | 1963-11-09 | 1972-01-31 | Degussa | Procédé de préparation de nouvelles aminocétones et des alcools secondaires correspondants. |
| DE2123992C3 (de) * | 1971-05-14 | 1981-03-19 | Richardson-Merrell Inc., New York, N.Y. | 3,9-Bis-äther des Fluoranthens und deren Herstellung |
| US4034040A (en) * | 1971-05-24 | 1977-07-05 | Pfizer Inc. | Xylene-diamines as antiviral agents |
| US3882113A (en) * | 1972-12-21 | 1975-05-06 | Richardson Merrell Inc | Fluoranthene derivatives |
| US4197149A (en) * | 1975-11-05 | 1980-04-08 | Sigri Elektrographit Gmbh | Method for joining together shaped bodies of polytetrafluoroethylene |
| US4062958A (en) * | 1976-09-22 | 1977-12-13 | American Cyanamid Company | Method of treating anxiety and compositions therefor |
| US4197249A (en) * | 1977-08-15 | 1980-04-08 | American Cyanamid Company | 1,4-Bis(substituted-amino)-5,8-dihydroxyanthraquinones and leuco bases thereof |
| US4258181A (en) * | 1978-09-05 | 1981-03-24 | American Cyanamid Company | Substituted 9,10-anthracenebishydrazones |
| ATE3414T1 (de) * | 1979-02-02 | 1983-06-15 | Ciba-Geigy Ag | Neues rechts-drehendes, basisches derivat des 9,10-aethano-anthracens, verfahren zu dessen herstellung und dieses enthaltende pharmazeutische praeparate. |
| US4211726A (en) * | 1979-02-16 | 1980-07-08 | American Cyanamid Company | Synthesis of substituted 9,10-anthracene-dicarboxaldehydes and 9,10-dihydro-9,10-anthracenedicarboxaldehydes |
| JPS5999656A (ja) * | 1982-11-30 | 1984-06-08 | Toshiba Corp | 筒形空気電池 |
| US4511582A (en) * | 1983-06-01 | 1985-04-16 | Burroughs Wellcome Co. | Phenanthrene derivatives |
| GB8313571D0 (en) * | 1983-05-17 | 1983-06-22 | Wellcome Found | Chemical compounds |
| US4532344A (en) * | 1983-05-23 | 1985-07-30 | Burroughs Wellcome Co. | Fluoranthene derivatives |
| US4551282A (en) * | 1983-05-31 | 1985-11-05 | Burroughs Wellcome Co. | Triphenylene derivatives |
| US4997249A (en) * | 1990-02-26 | 1991-03-05 | The United States Of America As Represented By The Secretary Of The Navy | Variable weight fiber optic transversal filter |
-
1983
- 1983-05-17 GB GB838313571A patent/GB8313571D0/en active Pending
- 1983-06-01 US US06/499,813 patent/US4530800A/en not_active Expired - Lifetime
-
1984
- 1984-05-16 JP JP59099655A patent/JPS59225149A/ja active Pending
- 1984-05-16 EG EG315/84A patent/EG17595A/xx active
- 1984-05-16 JP JP59099656A patent/JPS59225150A/ja active Granted
- 1984-05-16 DD DD84263086A patent/DD223439A5/de not_active IP Right Cessation
- 1984-05-16 DE DE8484105584T patent/DE3473141D1/de not_active Expired
- 1984-05-16 GB GB08412485A patent/GB2140416B/en not_active Expired
- 1984-05-16 HU HU841886A patent/HU197875B/hu not_active IP Right Cessation
- 1984-05-16 DK DK242284A patent/DK242284A/da not_active Application Discontinuation
- 1984-05-16 CA CA000454514A patent/CA1222750A/en not_active Expired
- 1984-05-16 IE IE120384A patent/IE58416B1/en unknown
- 1984-05-16 PH PH30683A patent/PH22265A/en unknown
- 1984-05-16 GR GR74735A patent/GR82278B/el unknown
- 1984-05-16 NO NO841954A patent/NO157416C/no unknown
- 1984-05-16 MC MC841705A patent/MC1595A1/fr unknown
- 1984-05-16 CS CS364584A patent/CS273314B2/cs unknown
- 1984-05-16 IL IL71854A patent/IL71851A/xx not_active IP Right Cessation
- 1984-05-16 FI FI841966A patent/FI85263C/fi not_active IP Right Cessation
- 1984-05-16 PT PT78586A patent/PT78586A/pt not_active IP Right Cessation
- 1984-05-16 NZ NZ208168A patent/NZ208168A/en unknown
- 1984-05-16 SU SU843744951A patent/SU1535377A3/ru active
- 1984-05-16 EP EP84105584A patent/EP0125701B1/en not_active Expired
- 1984-05-16 ZA ZA843708A patent/ZA843708B/xx unknown
- 1984-05-16 KR KR1019840002647A patent/KR910000854B1/ko not_active Expired
- 1984-05-16 DE DE8484105585T patent/DE3465296D1/de not_active Expired
- 1984-05-16 AU AU28098/84A patent/AU572509B2/en not_active Ceased
- 1984-05-16 EP EP84105585A patent/EP0125702B1/en not_active Expired
- 1984-05-16 ES ES532512A patent/ES532512A0/es active Granted
- 1984-05-17 PL PL1984247759A patent/PL144294B1/pl unknown
- 1984-05-17 PL PL1984254245A patent/PL145421B1/pl unknown
- 1984-05-17 PL PL1984254244A patent/PL145420B1/pl unknown
- 1984-07-16 AP APAP/P/1984/000003A patent/AP1A/en active
- 1984-10-17 US US06/661,803 patent/US4719236A/en not_active Expired - Fee Related
- 1984-10-17 US US06/661,674 patent/US4720587A/en not_active Expired - Fee Related
- 1984-10-17 US US06/661,802 patent/US4719049A/en not_active Expired - Fee Related
-
1985
- 1985-02-06 ES ES540161A patent/ES540161A0/es active Granted
- 1985-02-06 ES ES540160A patent/ES8604487A1/es not_active Expired
- 1985-04-22 US US06/725,157 patent/US4719047A/en not_active Expired - Fee Related
- 1985-08-30 SU SU853947162A patent/SU1466648A3/ru active
- 1985-12-02 SU SU853982431A patent/SU1447277A3/ru active
-
1987
- 1987-09-28 US US07/102,275 patent/US4820873A/en not_active Expired - Fee Related
-
1988
- 1988-03-11 AU AU13052/88A patent/AU599215B2/en not_active Ceased
-
1989
- 1989-04-08 SG SG223/89A patent/SG22389G/en unknown
- 1989-06-01 HK HK450/89A patent/HK45089A/en not_active IP Right Cessation
- 1989-12-08 CY CY1486A patent/CY1486A/xx unknown
-
1990
- 1990-06-01 JP JP2144246A patent/JPH0684336B2/ja not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS273314B2 (en) | Method of polycyclic aromatic alkanol derivatives preparation | |
| JP3908270B2 (ja) | アシルフルベン類似体およびその医薬組成物 | |
| US4532344A (en) | Fluoranthene derivatives | |
| WO1998058901A1 (en) | 3-anilino-2-cycloalkenone derivates | |
| JP2021536492A (ja) | イルジン類似体、それらの使用、およびそれらを合成する方法 | |
| US4719055A (en) | Phenanthrene derivatives | |
| US4719046A (en) | Crysene derivatives | |
| RU2060249C1 (ru) | Полициклические биоцидные соединения и фармацевтическая композиция на их основе | |
| US4133877A (en) | Anthracycline ethers and use therefor | |
| CN110240539A (zh) | 一种氟取代二苯乙烷类化合物及制备方法和应用 | |
| Karataş et al. | Synthesis of indole and benzimidazole substituted novel 16-arylidene steroid derivatives | |
| CS273347B2 (en) | Method of polycyclic aromatic alkanol derivatives preparation | |
| CN102516066B (zh) | Ostopanic acid类似物及制备方法及用途 | |
| US4808625A (en) | Phenanthrene derivatives | |
| CN111617085B (zh) | 靶向hdac抑制剂及其在抗肿瘤治疗药物中的应用 | |
| EP3411366B1 (en) | Method for the production of pomalidomide | |
| US4808632A (en) | Fluoranthene derivatives | |
| US5241107A (en) | Carbocyclic derivatives | |
| JPH04297486A (ja) | 新規アンスラサイクリン系化合物、これを製造するための新規中間体、及びこれを含有する組成物 | |
| KR100501843B1 (ko) | 새로운 항암성 비타민 d₃유도체 | |
| JPS61158951A (ja) | 生物体殺滅活性を有する多環状化合物 | |
| CN101161629A (zh) | 4'-取代苄氧基-苯基丁二烯类衍生物及制备和用途 | |
| JPH0222291A (ja) | 5´−ベンジル−5−フルオロウリジン誘導体及びその中間体 | |
| JPH0631299B2 (ja) | 14−フルオロ−4−デメトキシダウノルビシン誘導体 | |
| KR20010113007A (ko) | 항암제로서 유용한 n-치환된 피페리디닐우레아 유도체 및그의 제조방법 |