CS244408B2 - Method of n-phosphonomethylglycine production - Google Patents
Method of n-phosphonomethylglycine production Download PDFInfo
- Publication number
- CS244408B2 CS244408B2 CS804861A CS486180A CS244408B2 CS 244408 B2 CS244408 B2 CS 244408B2 CS 804861 A CS804861 A CS 804861A CS 486180 A CS486180 A CS 486180A CS 244408 B2 CS244408 B2 CS 244408B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- glycine
- reacted
- formaldehyde
- phosphonomethylglycine
- reaction
- Prior art date
Links
- XDDAORKBJWWYJS-UHFFFAOYSA-N glyphosate Chemical compound OC(=O)CNCP(O)(O)=O XDDAORKBJWWYJS-UHFFFAOYSA-N 0.000 title claims abstract description 11
- 238000000034 method Methods 0.000 title claims description 40
- 238000004519 manufacturing process Methods 0.000 title description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 claims abstract description 87
- 239000004471 Glycine Substances 0.000 claims abstract description 44
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 45
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 24
- 238000006243 chemical reaction Methods 0.000 claims description 23
- 239000011541 reaction mixture Substances 0.000 claims description 23
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 claims description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 10
- -1 N-phosphonomethylglycine ester Chemical class 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 9
- 229930040373 Paraformaldehyde Natural products 0.000 claims description 7
- 229920002866 paraformaldehyde Polymers 0.000 claims description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 6
- 239000002585 base Substances 0.000 claims description 6
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 6
- 239000011707 mineral Substances 0.000 claims description 6
- 230000007062 hydrolysis Effects 0.000 claims description 5
- 238000006460 hydrolysis reaction Methods 0.000 claims description 5
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 125000005907 alkyl ester group Chemical group 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 239000003054 catalyst Substances 0.000 claims description 3
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 2
- UGJBHEZMOKVTIM-UHFFFAOYSA-N N-formylglycine Chemical compound OC(=O)CNC=O UGJBHEZMOKVTIM-UHFFFAOYSA-N 0.000 claims description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 2
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 239000011877 solvent mixture Substances 0.000 claims 1
- 238000003786 synthesis reaction Methods 0.000 claims 1
- 125000005270 trialkylamine group Chemical group 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 abstract description 5
- 150000002148 esters Chemical class 0.000 abstract description 2
- 239000000047 product Substances 0.000 description 16
- 239000000243 solution Substances 0.000 description 13
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 238000003756 stirring Methods 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- CZHYKKAKFWLGJO-UHFFFAOYSA-N dimethyl phosphite Chemical compound COP([O-])OC CZHYKKAKFWLGJO-UHFFFAOYSA-N 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 235000010755 mineral Nutrition 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 238000007086 side reaction Methods 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- FOUZISDNESEYLX-UHFFFAOYSA-N N-hydroxyethyl glycine Natural products OCCNCC(O)=O FOUZISDNESEYLX-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 238000005119 centrifugation Methods 0.000 description 2
- LXCYSACZTOKNNS-UHFFFAOYSA-N diethoxy(oxo)phosphanium Chemical compound CCO[P+](=O)OCC LXCYSACZTOKNNS-UHFFFAOYSA-N 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 235000011056 potassium acetate Nutrition 0.000 description 2
- 239000001103 potassium chloride Substances 0.000 description 2
- 235000011164 potassium chloride Nutrition 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- HZONRRHNQILCNO-UHFFFAOYSA-N 1-methyl-2h-pyridine Chemical compound CN1CC=CC=C1 HZONRRHNQILCNO-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- WBTIFBJEYFLFFW-UHFFFAOYSA-N 2-(hydroxymethylazaniumyl)acetate Chemical compound OCNCC(O)=O WBTIFBJEYFLFFW-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- 241000192700 Cyanobacteria Species 0.000 description 1
- NOQGZXFMHARMLW-UHFFFAOYSA-N Daminozide Chemical compound CN(C)NC(=O)CCC(O)=O NOQGZXFMHARMLW-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- MOFCYHDQWIZKMY-UHFFFAOYSA-N chloromethylphosphonic acid Chemical class OP(O)(=O)CCl MOFCYHDQWIZKMY-UHFFFAOYSA-N 0.000 description 1
- 230000003749 cleanliness Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- DLQDGVZAEYZNTG-UHFFFAOYSA-N dimethyl hydrogen phosphite Chemical compound COP(O)OC DLQDGVZAEYZNTG-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- ZUNGGJHBMLMRFJ-UHFFFAOYSA-O ethoxy-hydroxy-oxophosphanium Chemical compound CCO[P+](O)=O ZUNGGJHBMLMRFJ-UHFFFAOYSA-O 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 150000002332 glycine derivatives Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- NBZBKCUXIYYUSX-UHFFFAOYSA-N iminodiacetic acid Chemical compound OC(=O)CNCC(O)=O NBZBKCUXIYYUSX-UHFFFAOYSA-N 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000000386 microscopy Methods 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 230000009935 nitrosation Effects 0.000 description 1
- 238000007034 nitrosation reaction Methods 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 235000011118 potassium hydroxide Nutrition 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 210000000278 spinal cord Anatomy 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/3804—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)] not used, see subgroups
- C07F9/3808—Acyclic saturated acids which can have further substituents on alkyl
- C07F9/3813—N-Phosphonomethylglycine; Salts or complexes thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU79AA934A HU184601B (en) | 1979-07-09 | 1979-07-09 | Process for producing n-/phosphono-methyl/-glycine |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CS486180A2 CS486180A2 (en) | 1985-09-17 |
| CS244408B2 true CS244408B2 (en) | 1986-07-17 |
Family
ID=10993067
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS804861A CS244408B2 (en) | 1979-07-09 | 1980-07-08 | Method of n-phosphonomethylglycine production |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4486359A (de) |
| JP (1) | JPS5668688A (de) |
| AT (1) | AT377263B (de) |
| BR (1) | BR8004228A (de) |
| CH (1) | CH646180A5 (de) |
| CS (1) | CS244408B2 (de) |
| DD (1) | DD151945A5 (de) |
| DE (1) | DE3025657A1 (de) |
| DK (1) | DK171469B1 (de) |
| FR (1) | FR2460959A1 (de) |
| HU (1) | HU184601B (de) |
| PL (1) | PL122749B1 (de) |
| PT (1) | PT71518A (de) |
| SU (1) | SU1282820A3 (de) |
| YU (1) | YU42347B (de) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4422982A (en) * | 1982-06-30 | 1983-12-27 | Stauffer Chemical Company | Method for preparation of N-phosphonomethylglycine |
| US4946993A (en) * | 1988-11-23 | 1990-08-07 | American Cyanamid Company | 2-azabicyclo[2.2.1.]hept-5-ene-2-acetic acid, derivatives thereof and related compounds, process for the preparation of said compounds, and the use of said compounds for the manufacture of N-phosphonomethylglycine |
| US4889906A (en) * | 1988-11-25 | 1989-12-26 | Monsanto Company | Amine salts of 1,4,2-oxazaphospholidine-4-acetic acid, 2-alkoxy-2-oxides |
| HU206363B (en) * | 1989-04-11 | 1992-10-28 | Alkaloida Vegyeszeti Gyar | Process for selective, complexometric analysis of n-(phosphonomethyl)-glycine, n-(phosphonomethyl)-n-(carboxymethyl)-glycine and n,n-bis (phosphonomethyl)-glycine |
| EP0402887B2 (de) * | 1989-06-15 | 2000-10-04 | FINCHIMICA S.p.A. | Verfahren zur Herstellung von N-Phosphonomethylglycin |
| IL101539A (en) | 1991-04-16 | 1998-09-24 | Monsanto Europe Sa | Non-hygroscopic mono-ammonium salts of n-phosphonomethyl glycine derivatives their preparation and pesticidal compositons containing them |
| US5312972A (en) * | 1992-10-29 | 1994-05-17 | Hampshire Chemical Corp. | Conversion of hydroxymethyl-iminodiacetic acid to phosphonomethyl-iminodiacetic acid |
| US5312973A (en) * | 1993-03-25 | 1994-05-17 | Finchimica S.P.A. | Process for producing n-phosphono-methyl-imino-diacetic acid |
| RU2152397C1 (ru) * | 1994-07-01 | 2000-07-10 | Монсанто Компани | Способы получения n-гидроксиалкиламинометилфосфоновой кислоты, n-фосфонометиламинокарбоновой кислоты и n-фосфонометилглицина или их солей |
| JP3823330B2 (ja) * | 1994-11-09 | 2006-09-20 | 昭和電工株式会社 | N−ホスホノメチルグリシンの単離方法 |
| EP0806428B1 (de) * | 1994-11-09 | 2003-01-29 | Showa Denko Kabushiki Kaisha | Verfahren zur Abtrennung von N-Phosphonomethylglycin |
| AU6293001A (en) * | 2000-05-22 | 2001-12-11 | Monsanto Technology Llc | Reaction systems for making n-(phosphonomethyl)glycine compounds |
| DE10130136A1 (de) * | 2001-06-22 | 2003-01-02 | Basf Ag | Verfahren zur Gewinnung von N-Phosphonomethylglycin |
| AR045763A1 (es) * | 2003-09-17 | 2005-11-09 | Monsanto Technology Llc | Proceso para recuperar un producto de n-(fosfonometil) glicina de una solucion acuosa |
| TW200538459A (en) * | 2004-05-21 | 2005-12-01 | Dow Agrosciences Llc | Purification of n-(phosphonomethyl)glycine |
| WO2006096617A2 (en) * | 2005-03-04 | 2006-09-14 | Monsanto Technology Llc | Mitigating necrosis in transgenic glyphosate-tolerant cotton plants treated with herbicidal glyphosate formulations |
| US7429575B2 (en) * | 2006-01-10 | 2008-09-30 | Yu Ruey J | N-(phosphonoalkyl)-amino acids, derivatives thereof and compositions and methods of use |
| WO2010135141A1 (en) | 2009-05-18 | 2010-11-25 | Monsanto Technology Llc | Recovery of phosphorus values and salt impurities from aqueous waste streams |
| CN102766159B (zh) * | 2012-06-18 | 2016-03-16 | 印海平 | 草甘膦碱性母液处理方法 |
| EP3821470A1 (de) | 2018-06-20 | 2021-05-19 | Janusz Chupty Contissi | Mehrschichtiges fotovoltaisches paneel mit erhöhter solarstrahlungsenergie zu einer umwandlungsoberfläche von elektrischer energie |
| CN110862414B (zh) * | 2018-08-27 | 2022-07-01 | 湖北泰盛化工有限公司 | 一种催化合成草甘膦的工艺 |
| CN110862413A (zh) * | 2018-08-27 | 2020-03-06 | 湖北泰盛化工有限公司 | 一种草甘膦合成工艺及装置 |
| CN110860310B (zh) * | 2018-08-27 | 2023-03-31 | 湖北泰盛化工有限公司 | 一种合成草甘膦的有机催化剂及草甘膦合成工艺 |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA568570A (en) * | 1959-01-06 | C. Somogyi John | Formaldehyde derivatives of mono-amino dicarboxylic acids and their preparation | |
| US1910331A (en) * | 1931-06-24 | 1933-05-23 | Wacker Chemie Gmbh | Process of preparing alkali metal aliphatic monohydroxy alcoholates |
| US2451945A (en) * | 1945-05-25 | 1948-10-19 | Gen Aniline & Film Corp | Preparation of potassium alcoholates |
| CH336065A (de) * | 1954-03-05 | 1959-02-15 | Ciba Geigy | Verfahren zur Herstellung von neuen Stickstoff und Phosphor enthaltenden Verbindungen |
| US2796443A (en) * | 1956-03-12 | 1957-06-18 | Dow Chemical Co | Method for making anhydrous alkali metal alcoholates |
| US2877274A (en) * | 1958-01-21 | 1959-03-10 | Du Pont | Production of sodium methoxide |
| NL285361A (de) * | 1961-11-13 | 1900-01-01 | ||
| FR91049E (fr) * | 1966-02-14 | 1968-03-29 | Kuhlmann Ets | Polyols phosphorés et azotés, procédé pour leur obtention et leurs applications |
| NL7200247A (de) * | 1971-01-11 | 1972-07-13 | ||
| US4085134A (en) * | 1974-02-15 | 1978-04-18 | Petrolite Corporation | Amino-phosphonic-sulfonic acids |
| HU173170B (hu) * | 1974-06-27 | 1979-03-28 | Chinoin Gyogyszer Es Vegyeszet | Sposob poluchenija n-fosfonometil-glicina |
| US4053505A (en) * | 1976-01-05 | 1977-10-11 | Monsanto Company | Preparation of n-phosphonomethyl glycine |
| CH647528A5 (fr) * | 1978-10-27 | 1985-01-31 | Bcap Biolog Chem Act Pat | Procede pour la preparation de n-phosphonomethylglycine. |
-
1979
- 1979-07-09 HU HU79AA934A patent/HU184601B/hu unknown
-
1980
- 1980-07-07 DE DE19803025657 patent/DE3025657A1/de active Granted
- 1980-07-08 BR BR8004228A patent/BR8004228A/pt not_active IP Right Cessation
- 1980-07-08 PL PL1980225540A patent/PL122749B1/pl unknown
- 1980-07-08 DK DK294880A patent/DK171469B1/da not_active IP Right Cessation
- 1980-07-08 SU SU802948398A patent/SU1282820A3/ru active
- 1980-07-08 CS CS804861A patent/CS244408B2/cs unknown
- 1980-07-08 PT PT71518A patent/PT71518A/pt not_active IP Right Cessation
- 1980-07-08 YU YU1759/80A patent/YU42347B/xx unknown
- 1980-07-08 JP JP9321480A patent/JPS5668688A/ja active Granted
- 1980-07-08 FR FR8015160A patent/FR2460959A1/fr active Granted
- 1980-07-09 DD DD80222503A patent/DD151945A5/de not_active IP Right Cessation
- 1980-07-09 AT AT0357480A patent/AT377263B/de not_active IP Right Cessation
- 1980-07-09 CH CH525880A patent/CH646180A5/de not_active IP Right Cessation
-
1983
- 1983-10-20 US US06/543,795 patent/US4486359A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| HU184601B (en) | 1984-09-28 |
| ATA357480A (de) | 1984-07-15 |
| YU42347B (en) | 1988-08-31 |
| CH646180A5 (de) | 1984-11-15 |
| PL122749B1 (en) | 1982-08-31 |
| DK294880A (da) | 1981-01-10 |
| YU175980A (en) | 1983-01-21 |
| PL225540A1 (de) | 1981-06-19 |
| FR2460959B1 (de) | 1983-05-27 |
| CS486180A2 (en) | 1985-09-17 |
| AT377263B (de) | 1985-02-25 |
| DE3025657A1 (de) | 1981-04-09 |
| US4486359A (en) | 1984-12-04 |
| JPS6338035B2 (de) | 1988-07-28 |
| SU1282820A3 (ru) | 1987-01-07 |
| PT71518A (en) | 1980-08-01 |
| DK171469B1 (da) | 1996-11-11 |
| DE3025657C2 (de) | 1992-03-05 |
| FR2460959A1 (fr) | 1981-01-30 |
| DD151945A5 (de) | 1981-11-11 |
| JPS5668688A (en) | 1981-06-09 |
| BR8004228A (pt) | 1981-01-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS244408B2 (en) | Method of n-phosphonomethylglycine production | |
| US4080325A (en) | Synthesis of methotrexate | |
| US5324855A (en) | Preparation of N-acylaminomethylphosphonic acid | |
| EP0102694B1 (de) | Verfahren zur Herstellung von N-Phosphonomethylglycin | |
| HU196816B (en) | Process for producing alkali- and ammonium-salts of 4-/hydroxy-methyl-phosphinyl/-2-amino-butiric acid | |
| US5679842A (en) | Process for the preparation of aminomethanephosphonic acid and aminomethylphosphinic acids | |
| EP0341233B1 (de) | Verfahren zur Herstellung von N-Phosphonomethylglycin | |
| US5155257A (en) | Process for the preparation of acylaminomethanephosphonic acids | |
| HU177486B (en) | Process for preparing phosphonic acid derivatives | |
| HU203360B (en) | Process for producing n-acylamino methylphosphonates | |
| DD210055A5 (de) | Verfahren zur herstellung von n-phosphonomethylglycin | |
| US5432291A (en) | Preparation of acylaminomethanephosphonic acids and acylaminomethanephosphinic acids | |
| EP0104775B1 (de) | Herstellung von N-Phosphonomethylglyzin | |
| IL99203A (en) | Process for the preparation of aminomethylphosphonic acid and aminomethylphosphinic acid | |
| US6028209A (en) | Process for the preparation of alkylphosphocholines and the production thereof in pure form | |
| EP0107464B1 (de) | Verfahren zur Herstellung von N-Phosphonomethyglyzin | |
| CA2073126C (en) | Preparation of alkylphosphocholines | |
| SU589756A1 (ru) | Способ получени солей перфторалкилфосфиновых кислот | |
| KR860002109B1 (ko) | N-포스포노 메틸 글리신염의 제조방법 | |
| IL99201A (en) | Process for the preparation of aminomethylphosphonic acid and N-hydroxymethylaminophenic aminomethylphosphine acid | |
| DK169405B1 (da) | Fremgangsmåde til fremstilling af bis(ethoxythiocarbonyl)sulfid | |
| US5113001A (en) | Process for preparing sulfophenylalkylsiloxanes or sulfonaphthylalkylsiloxanes | |
| SU466242A1 (ru) | Способ получени эфиров дитиолфосфорных кислот | |
| SU296773A1 (ru) | Способ получения 0-хлоралкиламидотиолфосфатов | |
| JPS6155913B2 (de) |