CS214738B2 - Method for the production of racemic and optically active derivatives of 2-pyrrolidone - Google Patents
Method for the production of racemic and optically active derivatives of 2-pyrrolidone Download PDFInfo
- Publication number
- CS214738B2 CS214738B2 CS751860A CS186075A CS214738B2 CS 214738 B2 CS214738 B2 CS 214738B2 CS 751860 A CS751860 A CS 751860A CS 186075 A CS186075 A CS 186075A CS 214738 B2 CS214738 B2 CS 214738B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- formula
- pyrrolidone
- group
- alkyl
- solvent
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 24
- 150000003953 γ-lactams Chemical class 0.000 title claims description 4
- 238000004519 manufacturing process Methods 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims abstract description 35
- -1 4-(substituted phenyl)-2- pyrrolidone-3-carboxylic Chemical class 0.000 claims abstract description 33
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 27
- 238000009835 boiling Methods 0.000 claims abstract description 14
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 13
- 239000002904 solvent Substances 0.000 claims abstract description 13
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 11
- 239000001257 hydrogen Substances 0.000 claims abstract description 11
- 125000003118 aryl group Chemical group 0.000 claims abstract description 9
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims abstract description 8
- 239000002585 base Substances 0.000 claims abstract description 8
- 238000010438 heat treatment Methods 0.000 claims abstract description 7
- 239000002798 polar solvent Substances 0.000 claims abstract description 7
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 6
- 150000004820 halides Chemical class 0.000 claims abstract description 6
- 238000002360 preparation method Methods 0.000 claims abstract description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 5
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 5
- 239000001301 oxygen Substances 0.000 claims abstract description 5
- 125000002252 acyl group Chemical group 0.000 claims abstract description 4
- 239000003513 alkali Substances 0.000 claims abstract description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims abstract description 4
- 150000001266 acyl halides Chemical class 0.000 claims abstract description 3
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 3
- 125000005843 halogen group Chemical group 0.000 claims abstract description 3
- 239000012442 inert solvent Substances 0.000 claims abstract description 3
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 6
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical group [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 claims description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- 239000012312 sodium hydride Substances 0.000 claims description 5
- 229910000104 sodium hydride Inorganic materials 0.000 claims description 5
- 229910052717 sulfur Chemical group 0.000 claims description 5
- 239000011541 reaction mixture Substances 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 125000006730 (C2-C5) alkynyl group Chemical group 0.000 claims description 2
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 2
- 125000004473 dialkylaminocarbonyl group Chemical group 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 239000003586 protic polar solvent Substances 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 claims description 2
- 125000005958 tetrahydrothienyl group Chemical group 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- VKCLPVFDVVKEKU-UHFFFAOYSA-N S=[P] Chemical compound S=[P] VKCLPVFDVVKEKU-UHFFFAOYSA-N 0.000 claims 1
- SYXYWTXQFUUWLP-UHFFFAOYSA-N sodium;butan-1-olate Chemical compound [Na+].CCCC[O-] SYXYWTXQFUUWLP-UHFFFAOYSA-N 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 abstract description 39
- 239000003795 chemical substances by application Substances 0.000 abstract description 13
- 238000006243 chemical reaction Methods 0.000 abstract description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract description 9
- 239000007858 starting material Substances 0.000 abstract description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract description 7
- 150000003839 salts Chemical class 0.000 abstract description 6
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 abstract description 5
- 150000002148 esters Chemical class 0.000 abstract description 5
- 239000000725 suspension Substances 0.000 abstract description 5
- 239000002253 acid Substances 0.000 abstract description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract description 4
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzenecarboxaldehyde Natural products O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 abstract description 4
- JVTZFYYHCGSXJV-UHFFFAOYSA-N isovanillin Chemical compound COC1=CC=C(C=O)C=C1O JVTZFYYHCGSXJV-UHFFFAOYSA-N 0.000 abstract description 4
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 abstract description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 abstract description 3
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 abstract description 3
- 150000003935 benzaldehydes Chemical class 0.000 abstract description 3
- 238000001816 cooling Methods 0.000 abstract description 3
- 238000006114 decarboxylation reaction Methods 0.000 abstract description 3
- 125000001841 imino group Chemical group [H]N=* 0.000 abstract description 3
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 abstract description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 abstract description 3
- HLVFKOKELQSXIQ-UHFFFAOYSA-N 1-bromo-2-methylpropane Chemical compound CC(C)CBr HLVFKOKELQSXIQ-UHFFFAOYSA-N 0.000 abstract description 2
- OUIGCOUMOAUQOK-UHFFFAOYSA-N 4-(3,4-dihydroxyphenyl)pyrrolidin-2-one Chemical compound C1=C(O)C(O)=CC=C1C1CC(=O)NC1 OUIGCOUMOAUQOK-UHFFFAOYSA-N 0.000 abstract description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 abstract description 2
- 239000003054 catalyst Substances 0.000 abstract description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 abstract 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 abstract 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 abstract 3
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 abstract 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 abstract 2
- 239000005864 Sulphur Substances 0.000 abstract 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 abstract 2
- 125000005518 carboxamido group Chemical group 0.000 abstract 2
- 230000008030 elimination Effects 0.000 abstract 2
- 238000003379 elimination reaction Methods 0.000 abstract 2
- 125000001183 hydrocarbyl group Chemical group 0.000 abstract 2
- NQOFYFRKWDXGJP-UHFFFAOYSA-N 1,1,2-trimethylguanidine Chemical compound CN=C(N)N(C)C NQOFYFRKWDXGJP-UHFFFAOYSA-N 0.000 abstract 1
- VUGWJDGEPZNBKZ-UHFFFAOYSA-N 4-methoxy-3-(2-methylpropoxy)benzaldehyde Chemical compound COC1=CC=C(C=O)C=C1OCC(C)C VUGWJDGEPZNBKZ-UHFFFAOYSA-N 0.000 abstract 1
- 241001061127 Thione Species 0.000 abstract 1
- 239000000654 additive Substances 0.000 abstract 1
- 230000000996 additive effect Effects 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 abstract 1
- 125000003277 amino group Chemical group 0.000 abstract 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract 1
- 230000000911 decarboxylating effect Effects 0.000 abstract 1
- 150000005690 diesters Chemical class 0.000 abstract 1
- GZNWYWCUAKQMRM-UHFFFAOYSA-N diethyl 2-[(3-acetyloxy-4-methoxyphenyl)methylidene]propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)=CC1=CC=C(OC)C(OC(C)=O)=C1 GZNWYWCUAKQMRM-UHFFFAOYSA-N 0.000 abstract 1
- RKGDXSLYBJAUHD-UHFFFAOYSA-N diethyl 2-[(3-hydroxy-4-methoxyphenyl)methylidene]propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)=CC1=CC=C(OC)C(O)=C1 RKGDXSLYBJAUHD-UHFFFAOYSA-N 0.000 abstract 1
- 125000003106 haloaryl group Chemical group 0.000 abstract 1
- 125000000623 heterocyclic group Chemical group 0.000 abstract 1
- 238000006460 hydrolysis reaction Methods 0.000 abstract 1
- 230000003301 hydrolyzing effect Effects 0.000 abstract 1
- 230000004048 modification Effects 0.000 abstract 1
- 238000012986 modification Methods 0.000 abstract 1
- 239000003960 organic solvent Substances 0.000 abstract 1
- 229920001021 polysulfide Polymers 0.000 abstract 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 abstract 1
- 238000000926 separation method Methods 0.000 abstract 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 22
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- 238000002844 melting Methods 0.000 description 15
- 230000008018 melting Effects 0.000 description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- 230000000694 effects Effects 0.000 description 5
- 235000011181 potassium carbonates Nutrition 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- 235000002639 sodium chloride Nutrition 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- JNRKFSJWVCILHE-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C1CC(=O)NC1 JNRKFSJWVCILHE-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- ZPEIMTDSQAKGNT-UHFFFAOYSA-N chlorpromazine Chemical compound C1=C(Cl)C=C2N(CCCN(C)C)C3=CC=CC=C3SC2=C1 ZPEIMTDSQAKGNT-UHFFFAOYSA-N 0.000 description 3
- 229960001076 chlorpromazine Drugs 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- KYVBNYUBXIEUFW-UHFFFAOYSA-N 1,1,3,3-tetramethylguanidine Chemical compound CN(C)C(=N)N(C)C KYVBNYUBXIEUFW-UHFFFAOYSA-N 0.000 description 2
- IZTABMWLNKLGJV-UHFFFAOYSA-N 1-acetyl-4-(3,4-dimethoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C1CC(=O)N(C(C)=O)C1 IZTABMWLNKLGJV-UHFFFAOYSA-N 0.000 description 2
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 2
- ZCKTZHJPWNRWGC-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)-1-methylpyrrolidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C1CC(=O)N(C)C1 ZCKTZHJPWNRWGC-UHFFFAOYSA-N 0.000 description 2
- XDGPXVGLRZEIGQ-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)-1-phenylpyrrolidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C1CC(=O)N(C=2C=CC=CC=2)C1 XDGPXVGLRZEIGQ-UHFFFAOYSA-N 0.000 description 2
- ZYGZOBCBEYNOLS-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)pyrrolidine-2-thione Chemical compound C1=C(OC)C(OC)=CC=C1C1CC(=S)NC1 ZYGZOBCBEYNOLS-UHFFFAOYSA-N 0.000 description 2
- YJZMNJXUIXTKRD-UHFFFAOYSA-N 4-[4-methoxy-3-(2-methylpropoxy)phenyl]pyrrolidine-2-thione Chemical compound C1=C(OCC(C)C)C(OC)=CC=C1C1CC(=S)NC1 YJZMNJXUIXTKRD-UHFFFAOYSA-N 0.000 description 2
- FTOAOBMCPZCFFF-UHFFFAOYSA-N 5,5-diethylbarbituric acid Chemical compound CCC1(CC)C(=O)NC(=O)NC1=O FTOAOBMCPZCFFF-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- NOTFZGFABLVTIG-UHFFFAOYSA-N Cyclohexylethyl acetate Chemical compound CC(=O)OCCC1CCCCC1 NOTFZGFABLVTIG-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 150000001502 aryl halides Chemical class 0.000 description 2
- YCOXTKKNXUZSKD-UHFFFAOYSA-N as-o-xylenol Natural products CC1=CC=C(O)C=C1C YCOXTKKNXUZSKD-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 229910052681 coesite Inorganic materials 0.000 description 2
- 229910052906 cristobalite Inorganic materials 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- SNHMUERNLJLMHN-UHFFFAOYSA-N iodobenzene Chemical compound IC1=CC=CC=C1 SNHMUERNLJLMHN-UHFFFAOYSA-N 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000004040 pyrrolidinones Chemical class 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 229910052682 stishovite Inorganic materials 0.000 description 2
- 229910052905 tridymite Inorganic materials 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- JMVIVASFFKKFQK-UHFFFAOYSA-N 1-phenylpyrrolidin-2-one Chemical class O=C1CCCN1C1=CC=CC=C1 JMVIVASFFKKFQK-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- KXTAOXNYQGASTA-UHFFFAOYSA-N 2-benzylidenepropanedioic acid Chemical class OC(=O)C(C(O)=O)=CC1=CC=CC=C1 KXTAOXNYQGASTA-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- VGUWZCUCNQXGBU-UHFFFAOYSA-N 3-[(4-methylpiperazin-1-yl)methyl]-5-nitro-1h-indole Chemical compound C1CN(C)CCN1CC1=CNC2=CC=C([N+]([O-])=O)C=C12 VGUWZCUCNQXGBU-UHFFFAOYSA-N 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- IGOHZKUKFQBTNU-UHFFFAOYSA-N 4-(3,4-diethoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OCC)C(OCC)=CC=C1C1CC(=O)NC1 IGOHZKUKFQBTNU-UHFFFAOYSA-N 0.000 description 1
- CRNQILQOPIFQCI-UHFFFAOYSA-N 4-(3-butan-2-yloxy-4-methoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OC(C)CC)=CC(C2CC(=O)NC2)=C1 CRNQILQOPIFQCI-UHFFFAOYSA-N 0.000 description 1
- VRBRFUIIINZKKW-UHFFFAOYSA-N 4-(3-butoxy-4-methoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OCCCC)=CC(C2CC(=O)NC2)=C1 VRBRFUIIINZKKW-UHFFFAOYSA-N 0.000 description 1
- MDXHIURCBXYOAC-UHFFFAOYSA-N 4-(3-cyclobutyloxy-4-methoxyphenyl)pyrrolidin-2-one Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OC1CCC1 MDXHIURCBXYOAC-UHFFFAOYSA-N 0.000 description 1
- BPRUNKGOYXLKFB-UHFFFAOYSA-N 4-(3-cyclohexyloxy-4-methoxyphenyl)pyrrolidin-2-one Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OC1CCCCC1 BPRUNKGOYXLKFB-UHFFFAOYSA-N 0.000 description 1
- WFBUIWLAOBZOOS-UHFFFAOYSA-N 4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-2-thione Chemical compound COC1=CC=C(C2CC(=S)NC2)C=C1OC1CCCC1 WFBUIWLAOBZOOS-UHFFFAOYSA-N 0.000 description 1
- VTARTKPFBJOKKS-UHFFFAOYSA-N 4-(3-ethoxy-4-methoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OCC)=CC(C2CC(=O)NC2)=C1 VTARTKPFBJOKKS-UHFFFAOYSA-N 0.000 description 1
- DRYYWFMMNCCJKU-UHFFFAOYSA-N 4-(3-hexoxy-4-methoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OCCCCCC)=CC(C2CC(=O)NC2)=C1 DRYYWFMMNCCJKU-UHFFFAOYSA-N 0.000 description 1
- CHVNMUXAUGEMSU-UHFFFAOYSA-N 4-(4-cyclopentyloxy-3-methoxyphenyl)pyrrolidin-2-one Chemical compound COC1=CC(C2CC(=O)NC2)=CC=C1OC1CCCC1 CHVNMUXAUGEMSU-UHFFFAOYSA-N 0.000 description 1
- VDRLVVYETISUEM-UHFFFAOYSA-N 4-(4-ethoxy-3-methoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OCC)=CC=C1C1CC(=O)NC1 VDRLVVYETISUEM-UHFFFAOYSA-N 0.000 description 1
- YJLVXTXGBPWDEI-UHFFFAOYSA-N 4-(4-methoxy-3-phenoxyphenyl)pyrrolidin-2-one Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OC1=CC=CC=C1 YJLVXTXGBPWDEI-UHFFFAOYSA-N 0.000 description 1
- QLIBRFKGUKUNLP-UHFFFAOYSA-N 4-(4-methoxy-3-phenylmethoxyphenyl)pyrrolidin-2-one Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OCC1=CC=CC=C1 QLIBRFKGUKUNLP-UHFFFAOYSA-N 0.000 description 1
- ATZYNFBZYFJVNY-UHFFFAOYSA-N 4-(4-methoxy-3-prop-2-ynoxyphenyl)pyrrolidin-2-one Chemical compound C(C#C)OC=1C=C(C=CC=1OC)C1CC(NC1)=O ATZYNFBZYFJVNY-UHFFFAOYSA-N 0.000 description 1
- PBSUWVSCBKZZHH-UHFFFAOYSA-N 4-(4-methoxy-3-propoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OCCC)=CC(C2CC(=O)NC2)=C1 PBSUWVSCBKZZHH-UHFFFAOYSA-N 0.000 description 1
- FEHLYROWUSLMKU-UHFFFAOYSA-N 4-[3,4-bis(2-methylpropoxy)phenyl]pyrrolidin-2-one Chemical compound C1=C(OCC(C)C)C(OCC(C)C)=CC=C1C1CC(=O)NC1 FEHLYROWUSLMKU-UHFFFAOYSA-N 0.000 description 1
- MHNKGZBTMAFGRH-UHFFFAOYSA-N 4-[3-(2,2-dimethylpropoxy)-4-methoxyphenyl]pyrrolidin-2-one Chemical compound C1=C(OCC(C)(C)C)C(OC)=CC=C1C1CC(=O)NC1 MHNKGZBTMAFGRH-UHFFFAOYSA-N 0.000 description 1
- UMIFSCOVIJEDCV-UHFFFAOYSA-N 4-[3-(2-hydroxyethoxy)-4-methoxyphenyl]pyrrolidin-2-one Chemical compound C1=C(OCCO)C(OC)=CC=C1C1CC(=O)NC1 UMIFSCOVIJEDCV-UHFFFAOYSA-N 0.000 description 1
- MGZZYBSJWZKHES-UHFFFAOYSA-N 4-[3-(cyclopropylmethoxy)-4-methoxyphenyl]pyrrolidin-2-one Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OCC1CC1 MGZZYBSJWZKHES-UHFFFAOYSA-N 0.000 description 1
- HIGIQMONZQQMJP-UHFFFAOYSA-N 4-[4-methoxy-2-(thiolan-3-yl)phenyl]pyrrolidin-2-one Chemical compound S1CC(CC1)C1=C(C=CC(=C1)OC)C1CC(NC1)=O HIGIQMONZQQMJP-UHFFFAOYSA-N 0.000 description 1
- AGQGSLHQIUKIEO-UHFFFAOYSA-N 4-[4-methoxy-3-(2-methylpropoxy)phenyl]pyrrolidin-2-one Chemical compound C1=C(OCC(C)C)C(OC)=CC=C1C1CC(=O)NC1 AGQGSLHQIUKIEO-UHFFFAOYSA-N 0.000 description 1
- IQEKPGGRSNMTNX-UHFFFAOYSA-N 4-[4-methoxy-3-(3-methylbut-2-enoxy)phenyl]pyrrolidin-2-one Chemical compound C1=C(OCC=C(C)C)C(OC)=CC=C1C1CC(=O)NC1 IQEKPGGRSNMTNX-UHFFFAOYSA-N 0.000 description 1
- DQDNZEFMICOUFX-UHFFFAOYSA-N 4-[4-methoxy-3-(3-methylbutoxy)phenyl]pyrrolidin-2-one Chemical compound C1=C(OCCC(C)C)C(OC)=CC=C1C1CC(=O)NC1 DQDNZEFMICOUFX-UHFFFAOYSA-N 0.000 description 1
- VYSCSHURSSZQNL-UHFFFAOYSA-N 4-[4-methoxy-3-(methoxymethoxy)phenyl]pyrrolidin-2-one Chemical compound C1=C(OC)C(OCOC)=CC(C2CC(=O)NC2)=C1 VYSCSHURSSZQNL-UHFFFAOYSA-N 0.000 description 1
- LZXLMAKTQGXJOE-UHFFFAOYSA-N 4-[4-methoxy-3-(oxolan-3-yloxy)phenyl]pyrrolidin-2-one Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OC1CCOC1 LZXLMAKTQGXJOE-UHFFFAOYSA-N 0.000 description 1
- ODHCTXKNWHHXJC-VKHMYHEASA-N 5-oxo-L-proline Chemical compound OC(=O)[C@@H]1CCC(=O)N1 ODHCTXKNWHHXJC-VKHMYHEASA-N 0.000 description 1
- 241000220479 Acacia Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 1
- MPGYNIYMEVILPA-UHFFFAOYSA-N C(#CC)OC1=C(C=C(C=C1)C1CC(NC1)=O)OC Chemical compound C(#CC)OC1=C(C=C(C=C1)C1CC(NC1)=O)OC MPGYNIYMEVILPA-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 208000027776 Extrapyramidal disease Diseases 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 1
- 208000012902 Nervous system disease Diseases 0.000 description 1
- 208000025966 Neurological disease Diseases 0.000 description 1
- 238000010934 O-alkylation reaction Methods 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229940095564 anhydrous calcium sulfate Drugs 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 230000003356 anti-rheumatic effect Effects 0.000 description 1
- 230000000573 anti-seizure effect Effects 0.000 description 1
- 230000000949 anxiolytic effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 238000006254 arylation reaction Methods 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 229960002319 barbital Drugs 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- HUMNYLRZRPPJDN-KWCOIAHCSA-N benzaldehyde Chemical group O=[11CH]C1=CC=CC=C1 HUMNYLRZRPPJDN-KWCOIAHCSA-N 0.000 description 1
- 230000000035 biogenic effect Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000000881 depressing effect Effects 0.000 description 1
- ICZLTZWATFXDLP-UHFFFAOYSA-N diethyl 2-benzylpropanedioate Chemical compound CCOC(=O)C(C(=O)OCC)CC1=CC=CC=C1 ICZLTZWATFXDLP-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 235000019441 ethanol Nutrition 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- QDGPDPYUDAGVNV-UHFFFAOYSA-N n,n-diethyl-2-[2-methoxy-4-(5-oxopyrrolidin-3-yl)phenoxy]acetamide Chemical compound C1=C(OC)C(OCC(=O)N(CC)CC)=CC=C1C1CC(=O)NC1 QDGPDPYUDAGVNV-UHFFFAOYSA-N 0.000 description 1
- 230000003533 narcotic effect Effects 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000000926 neurological effect Effects 0.000 description 1
- 230000003557 neuropsychological effect Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 208000020016 psychiatric disease Diseases 0.000 description 1
- 230000002582 psychostimulating effect Effects 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 229940079889 pyrrolidonecarboxylic acid Drugs 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- HJORMJIFDVBMOB-UHFFFAOYSA-N rolipram Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OC1CCCC1 HJORMJIFDVBMOB-UHFFFAOYSA-N 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 230000004622 sleep time Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/273—2-Pyrrolidones with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to other ring carbon atoms
- C07D207/277—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/18—Antipsychotics, i.e. neuroleptics; Drugs for mania or schizophrenia
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/52—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings
- C07C47/575—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Neurosurgery (AREA)
- Animal Behavior & Ethology (AREA)
- Biomedical Technology (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Psychiatry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Neurology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pyrrole Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS802586A CS214739B2 (cs) | 1974-03-20 | 1980-04-14 | Způsob výroby racemických a opticky aktivních derivátů 2-pyrrolidonu |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2413935A DE2413935A1 (de) | 1974-03-20 | 1974-03-20 | 4-(polyalkoxy-phenyl)-2-pyrrolidone |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS214738B2 true CS214738B2 (en) | 1982-05-28 |
Family
ID=5910915
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS751860A CS214738B2 (en) | 1974-03-20 | 1975-03-19 | Method for the production of racemic and optically active derivatives of 2-pyrrolidone |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4012495A (show.php) |
| JP (1) | JPS6011028B2 (show.php) |
| AT (1) | AT347931B (show.php) |
| BE (1) | BE826923A (show.php) |
| CA (1) | CA1069517A (show.php) |
| CH (1) | CH621338A5 (show.php) |
| CS (1) | CS214738B2 (show.php) |
| DD (1) | DD119229A5 (show.php) |
| DE (1) | DE2413935A1 (show.php) |
| DK (1) | DK139965C (show.php) |
| ES (1) | ES435750A1 (show.php) |
| FR (1) | FR2264531B1 (show.php) |
| GB (1) | GB1498705A (show.php) |
| HU (1) | HU174074B (show.php) |
| IE (1) | IE40865B1 (show.php) |
| IL (1) | IL46883A (show.php) |
| NL (1) | NL7503367A (show.php) |
| SE (1) | SE402010B (show.php) |
| SU (1) | SU649312A3 (show.php) |
| YU (1) | YU40258B (show.php) |
Families Citing this family (114)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4193926A (en) | 1974-03-20 | 1980-03-18 | Schering Aktiengesellschaft | 4-(Polyalkoxy phenyl)-2-pyrrolidones |
| DE2541855A1 (de) * | 1975-09-18 | 1977-03-31 | Schering Ag | 4-(polyalkoxy-phenyl)-2-pyrrolidone ii |
| CU21107A3 (es) | 1978-02-10 | 1988-02-01 | Hoffmann La Roche | Pyrrolidines derivatives |
| IL57266A (en) * | 1978-06-12 | 1982-12-31 | Mundipharma Ag | Production of pyrrolidin-2-ones and of 3-pyrrolin-2-ones |
| CA1124247A (en) * | 1979-08-09 | 1982-05-25 | Hoffmann-La Roche Limited | Pyrrolidine derivatives |
| GB2123288A (en) * | 1982-07-16 | 1984-02-01 | Wellcome Found | Anti-thrombotic agent |
| US4548947A (en) * | 1984-05-07 | 1985-10-22 | Warner-Lambert Company | 1-(Substituted-aryl)-dihydro-1H-pyrrolizine-3,5-[2H,6H-]diones and use for reversing amnesia |
| US4584313A (en) * | 1984-05-07 | 1986-04-22 | Warner-Lambert Company | (Substituted-phenyl)-5-oxo-2-pyrrolidinepropanoic acids and esters thereof, and use for reversing electroconvulsive shock-induced amnesia |
| DE3438839A1 (de) * | 1984-10-19 | 1986-04-24 | Schering AG, 1000 Berlin und 4709 Bergkamen | Pharmazeutische praeparate |
| US5783591A (en) * | 1984-10-19 | 1998-07-21 | Schering Aktiengesellschaft | Administration of oxazolidinone and pyrolidinone compounds for the treatment of inflammation |
| FI875724L (fi) * | 1986-04-29 | 1987-12-28 | Pfizer | Av kalcium oberoende camp fosfodiesteras-inhibitordepressant. |
| US5459145A (en) * | 1988-01-19 | 1995-10-17 | Pfizer Inc. | Calcium independent camp phosphodiesterase inhibitor antidepressant |
| FI875101L (fi) * | 1986-12-03 | 1988-06-04 | Tanabe Seiyaku Co | Laktamderivat och preparat innehaollande dessa. |
| US5274002A (en) * | 1987-04-14 | 1993-12-28 | Warner-Lambert Company | Trisubstituted phenyl analogs having activity for congestive heart failure |
| US4971959A (en) * | 1987-04-14 | 1990-11-20 | Warner-Lambert Company | Trisubstituted phenyl analogs having activity for congestive heart failure |
| US4960457A (en) * | 1988-12-27 | 1990-10-02 | Ici Americas Inc. | Substituted 1,3-diphenyl pyrrolidones and their use as herbicides |
| DD295358A5 (de) * | 1989-06-28 | 1991-10-31 | �����@������������������k�� | Verfahren zur racemattrennung von 4-aryl-2-oxo-pyrrolidin-3-carbonsaeure-estern |
| JP2578001B2 (ja) * | 1989-12-11 | 1997-02-05 | 明治製菓株式会社 | 抗痴呆薬 |
| DE3943385A1 (de) * | 1989-12-27 | 1991-07-04 | Schering Ag | Mittel zur transdermalen applikation enthaltend rolipram |
| DD299058A5 (de) * | 1990-01-31 | 1992-03-26 | Arzneimittelwerk Dresden Gmbh,De | Verfahren zur herstellung von n-acyl-4-phenyl-pyrrolidin-2-onen mit cerebroprotektiver wirkung |
| GB9009395D0 (en) * | 1990-04-26 | 1990-06-20 | Orion Yhtymae Oy | Cyclic hydroxamic acids and their use |
| ATE161720T1 (de) * | 1990-08-03 | 1998-01-15 | Smithkline Beecham Corp | Tnf-inhibitoren |
| DE4032055A1 (de) * | 1990-10-05 | 1992-04-09 | Schering Ag | Verfahren zur herstellung von optisch aktiven 4-aryl-2-pyrrolidinonen |
| US5547979A (en) * | 1992-03-30 | 1996-08-20 | Smithkline Beecham | TNF inhibition |
| US5395935A (en) * | 1992-05-08 | 1995-03-07 | Pfizer Inc. | Endo-bicyclo[2.2.1]heptan-2-ol and derived pharmaceutical agents |
| GB9212673D0 (en) * | 1992-06-15 | 1992-07-29 | Celltech Ltd | Chemical compounds |
| GB9222253D0 (en) * | 1992-10-23 | 1992-12-09 | Celltech Ltd | Chemical compounds |
| GB9226830D0 (en) * | 1992-12-23 | 1993-02-17 | Celltech Ltd | Chemical compounds |
| US5622977A (en) * | 1992-12-23 | 1997-04-22 | Celltech Therapeutics Limited | Tri-substituted (aryl or heteroaryl) derivatives and pharmaceutical compositions containing the same |
| GB9304919D0 (en) * | 1993-03-10 | 1993-04-28 | Celltech Ltd | Chemical compounds |
| GB9304920D0 (en) * | 1993-03-10 | 1993-04-28 | Celltech Ltd | Chemical compounds |
| GB9312853D0 (en) | 1993-06-22 | 1993-08-04 | Euro Celtique Sa | Chemical compounds |
| US5477611A (en) * | 1993-09-20 | 1995-12-26 | Tessera, Inc. | Method of forming interface between die and chip carrier |
| US5665754A (en) * | 1993-09-20 | 1997-09-09 | Glaxo Wellcome Inc. | Substituted pyrrolidines |
| ATE260911T1 (de) * | 1993-12-22 | 2004-03-15 | Celltech R&D Ltd | Trisubstituierte phenyl-derivate, verfahren zu deren herstellung und deren verwendung als phosphodiesterase (typ iv) hemmstoffe |
| GB9326173D0 (en) * | 1993-12-22 | 1994-02-23 | Celltech Ltd | Chemical compounds and process |
| CA2143143A1 (en) * | 1994-03-08 | 1995-09-09 | Toshihiko Tanaka | 3-phenylpyrrolidine derivatives |
| US5338739A (en) * | 1994-03-10 | 1994-08-16 | Hoechst-Roussel Pharmaceuticals Inc. | (Pyrrolidinyl)phenyl carbamates, compositions and use |
| US5786354A (en) * | 1994-06-21 | 1998-07-28 | Celltech Therapeutics, Limited | Tri-substituted phenyl derivatives and processes for their preparation |
| US6245774B1 (en) | 1994-06-21 | 2001-06-12 | Celltech Therapeutics Limited | Tri-substituted phenyl or pyridine derivatives |
| GB9412573D0 (en) | 1994-06-22 | 1994-08-10 | Celltech Ltd | Chemical compounds |
| GB9412571D0 (en) | 1994-06-22 | 1994-08-10 | Celltech Ltd | Chemical compounds |
| GB9412672D0 (en) * | 1994-06-23 | 1994-08-10 | Celltech Ltd | Chemical compounds |
| US5591776A (en) * | 1994-06-24 | 1997-01-07 | Euro-Celtique, S.A. | Pheynl or benzyl-substituted rolipram-based compounds for and method of inhibiting phosphodiesterase IV |
| US5922751A (en) | 1994-06-24 | 1999-07-13 | Euro-Celtique, S.A. | Aryl pyrazole compound for inhibiting phosphodiesterase IV and methods of using same |
| US5665737B1 (en) * | 1994-10-12 | 1999-02-16 | Euro Celtique Sa | Substituted benzoxazoles |
| US6025361A (en) | 1994-12-13 | 2000-02-15 | Euro-Celtique, S.A. | Trisubstituted thioxanthines |
| CA2206287C (en) * | 1994-12-13 | 2001-03-20 | Mark Chasin | Aryl thioxanthines |
| JPH11500110A (ja) * | 1995-02-10 | 1999-01-06 | シエーリング アクチエンゲゼルシヤフト | Tnf−抑制用製剤 |
| US6268373B1 (en) | 1995-06-07 | 2001-07-31 | Euro-Celtique S.A. | Trisubstituted thioxanthines |
| US6166041A (en) | 1995-10-11 | 2000-12-26 | Euro-Celtique, S.A. | 2-heteroaryl and 2-heterocyclic benzoxazoles as PDE IV inhibitors for the treatment of asthma |
| DE19540475A1 (de) * | 1995-10-20 | 1997-04-24 | Schering Ag | Chirale Methylphenyloxazolidinone |
| GB9523675D0 (en) * | 1995-11-20 | 1996-01-24 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9526243D0 (en) * | 1995-12-21 | 1996-02-21 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9526245D0 (en) * | 1995-12-21 | 1996-02-21 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9526246D0 (en) * | 1995-12-21 | 1996-02-21 | Celltech Therapeutics Ltd | Chemical compounds |
| US6075016A (en) | 1996-04-10 | 2000-06-13 | Euro-Celtique S.A. | 6,5-fused aromatic ring systems having enhanced phosphodiesterase IV inhibitory activity |
| GB9608435D0 (en) * | 1996-04-24 | 1996-06-26 | Celltech Therapeutics Ltd | Chemical compounds |
| US5864037A (en) | 1996-06-06 | 1999-01-26 | Euro-Celtique, S.A. | Methods for the synthesis of chemical compounds having PDE-IV inhibitory activity |
| JP4017214B2 (ja) | 1996-06-11 | 2007-12-05 | 興和創薬株式会社 | 5−フェニル−3−ピリダジノン誘導体 |
| WO1998004534A1 (en) | 1996-07-31 | 1998-02-05 | Nikken Chemicals Co., Ltd. | 6-phenyltetrahydro-1,3-oxazin-2-one derivatives and medicinal compositions containing the same |
| US6265402B1 (en) | 1996-08-27 | 2001-07-24 | Nikken Chemicals Co., Ltd. | Use of 2-phenylmorpholin-5-one derivatives |
| US5744473A (en) * | 1996-09-16 | 1998-04-28 | Euro-Celtique, S.A. | PDE IV inhibitors: "bis-compounds" |
| GB9619284D0 (en) * | 1996-09-16 | 1996-10-30 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9622363D0 (en) * | 1996-10-28 | 1997-01-08 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9625184D0 (en) * | 1996-12-04 | 1997-01-22 | Celltech Therapeutics Ltd | Chemical compounds |
| WO1998028281A1 (en) | 1996-12-23 | 1998-07-02 | Celltech Therapeutics Limited | Fused polycyclic 2-aminopyrimidine derivatives, their preparation and their use as protein tyrosine kinase inhibitors |
| GB9705361D0 (en) * | 1997-03-14 | 1997-04-30 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9713087D0 (en) * | 1997-06-20 | 1997-08-27 | Celltech Therapeutics Ltd | Chemical compounds |
| EP0994100B1 (en) | 1997-06-24 | 2006-08-30 | Nikken Chemicals Company, Limited | 3-anilino-2-cycloalkenone derivates |
| KR100540046B1 (ko) | 1997-11-12 | 2006-01-10 | 미쓰비시 가가꾸 가부시키가이샤 | 퓨린유도체 및 이를 유효성분으로 함유하는 의약 |
| US7427606B2 (en) | 1999-02-01 | 2008-09-23 | University Of Virginia Patent Foundation | Method to reduce inflammatory response in transplanted tissue |
| US6232297B1 (en) * | 1999-02-01 | 2001-05-15 | University Of Virginia Patent Foundation | Methods and compositions for treating inflammatory response |
| US7378400B2 (en) | 1999-02-01 | 2008-05-27 | University Of Virginia Patent Foundation | Method to reduce an inflammatory response from arthritis |
| KR100747106B1 (ko) | 1999-05-11 | 2007-08-08 | 미쯔비시 가가꾸 가부시끼가이샤 | 퓨린 유도체 이수화물, 이를 유효성분으로 함유하는 의약및 이의 제조 중간체 |
| GB9914258D0 (en) | 1999-06-18 | 1999-08-18 | Celltech Therapeutics Ltd | Chemical compounds |
| PT1212089E (pt) | 1999-08-21 | 2006-08-31 | Altana Pharma Ag | Combinacao sinergica de roflumilast e salmeterol |
| GB9924862D0 (en) | 1999-10-20 | 1999-12-22 | Celltech Therapeutics Ltd | Chemical compounds |
| DE60125026T2 (de) * | 2000-03-23 | 2007-06-28 | Takeda Pharmaceutical Co. Ltd. | Fluorisochinolinderivate, verfahren zu ihrer herstellung und ihre anwendung |
| CA2449118A1 (en) * | 2001-05-29 | 2002-12-05 | Schering Aktiengesellschaft | Cdk inhibiting pyrimidines, production thereof and their use as medicaments |
| ES2272738T3 (es) * | 2001-07-16 | 2007-05-01 | Merck Patent Gmbh | Compuestos para proteccion solar organicos fotoestables con propiedades antioxidantes y composiciones obtenidas a partir de los mismos. |
| WO2003029264A2 (en) * | 2001-10-01 | 2003-04-10 | University Of Virginia Patent Foundation | 2-propynyl adenosine analogs having a2a agonist activity and compositions thereof |
| CA2463469A1 (en) * | 2001-10-16 | 2003-04-24 | Memory Pharmaceuticals Corporation | 4-(4-alkoxy-3-hydroxyphenyl)-2-pyrrolidone derivatives as pde-4 inhibitors for the treatment of neurological syndromes |
| JP2006515829A (ja) * | 2002-04-10 | 2006-06-08 | ユニバーシティ オブ バージニア パテント ファウンデーション | 炎症性疾病の処置のための、a2aアデノシン受容体アゴニストの使用 |
| WO2004011470A1 (ja) * | 2002-07-26 | 2004-02-05 | Takeda Pharmaceutical Company Limited | フロイソキノリン誘導体およびその用途 |
| WO2004037784A2 (en) * | 2002-10-21 | 2004-05-06 | Irm Llc | Pyrrolidones with anti-hiv activity |
| US7772188B2 (en) | 2003-01-28 | 2010-08-10 | Ironwood Pharmaceuticals, Inc. | Methods and compositions for the treatment of gastrointestinal disorders |
| AU2004226353A1 (en) | 2003-04-01 | 2004-10-14 | Laboratoires Serono Sa | Inhibitors of phosphodiesterases in infertility |
| JP2006523710A (ja) * | 2003-04-16 | 2006-10-19 | メモリー・ファーマシューティカルズ・コーポレイション | ホスホジエステラーゼ4インヒビター |
| CA2522687A1 (en) * | 2003-04-18 | 2004-11-04 | Memory Pharmaceuticals Corporation | Pyrazole derivatives as phosphodiesterase 4 inhibitors |
| AU2004234355A1 (en) * | 2003-04-25 | 2004-11-11 | Icos Corporation | Method of preparing a ring compound having two adjacent chiral centers |
| CN102816130B (zh) * | 2004-05-17 | 2015-05-06 | 大塚制药株式会社 | 噻唑化合物及其用途 |
| WO2006028618A1 (en) | 2004-08-02 | 2006-03-16 | University Of Virginia Patent Foundation | 2-polycyclic propynyl adenosine analogs with modified 5'-ribose groups having a2a agonist activity |
| WO2006023272A1 (en) | 2004-08-02 | 2006-03-02 | University Of Virginia Patent Foundation | 2-polycyclic propynyl adenosine analogs having a2a agonist activity |
| WO2006015357A2 (en) | 2004-08-02 | 2006-02-09 | University Of Virginia Patent Foundation | 2-propynyl adenosine analogs with modified 5'-ribose groups having a2a agonist activity |
| CA2584317A1 (en) * | 2004-10-15 | 2006-04-27 | Memory Pharmaceuticals Corporation | Pyrazole derivatives as phosphodiesterase 4 inhibitors |
| JP2008517066A (ja) * | 2004-10-20 | 2008-05-22 | メモリー ファーマシューティカルス コーポレーション | ホスホジエステラーゼ4阻害剤 |
| WO2007120972A2 (en) * | 2006-02-10 | 2007-10-25 | University Of Virginia Patent Foundation | Method to treat sickle cell disease |
| US8188063B2 (en) * | 2006-06-19 | 2012-05-29 | University Of Virginia Patent Foundation | Use of adenosine A2A modulators to treat spinal cord injury |
| EP2527360B1 (en) | 2007-06-04 | 2015-10-28 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase useful for the treatment of gastrointestinal disorders, inflammation, cancer and other disorders |
| US8969514B2 (en) | 2007-06-04 | 2015-03-03 | Synergy Pharmaceuticals, Inc. | Agonists of guanylate cyclase useful for the treatment of hypercholesterolemia, atherosclerosis, coronary heart disease, gallstone, obesity and other cardiovascular diseases |
| US8058259B2 (en) | 2007-12-20 | 2011-11-15 | University Of Virginia Patent Foundation | Substituted 4-{3-[6-amino-9-(3,4-dihydroxy-tetrahydro-furan-2-yl)-9H-purin-2-yl]-prop-2-ynyl}-piperidine-1-carboxylic acid esters as A2AR agonists |
| EP3239170B1 (en) | 2008-06-04 | 2019-03-20 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase useful for the treatment of gastrointestinal disorders, inflammation, cancer and other disorders |
| AU2009270833B2 (en) | 2008-07-16 | 2015-02-19 | Bausch Health Ireland Limited | Agonists of guanylate cyclase useful for the treatment of gastrointestinal, inflammation, cancer and other disorders |
| WO2010075086A2 (en) * | 2008-12-15 | 2010-07-01 | Auspex Pharmaceuticals, Inc. | Pyrrolidinone inhibitors of pde-4 |
| US9616097B2 (en) | 2010-09-15 | 2017-04-11 | Synergy Pharmaceuticals, Inc. | Formulations of guanylate cyclase C agonists and methods of use |
| CA3100941C (en) | 2011-03-01 | 2024-03-05 | Synergy Pharmaceuticals Inc. | Process of preparing guanylate cyclase c agonists |
| ES2395801B1 (es) | 2011-06-23 | 2014-06-06 | María Carmen PARDINA PALLEJÀ | "pentoxifilina por vía transvaginal para el tratamiento de la infertilidad" |
| EP3718557A3 (en) | 2013-02-25 | 2020-10-21 | Bausch Health Ireland Limited | Guanylate cyclase receptor agonist sp-333 for use in colonic cleansing |
| US9708367B2 (en) | 2013-03-15 | 2017-07-18 | Synergy Pharmaceuticals, Inc. | Agonists of guanylate cyclase and their uses |
| HK1220611A1 (zh) | 2013-03-15 | 2017-05-12 | Bausch Health Ireland Limited | 用於治疗胃肠道病症的组成物 |
| CN113388007A (zh) | 2013-06-05 | 2021-09-14 | 博士医疗爱尔兰有限公司 | 鸟苷酸环化酶c的超纯激动剂、制备和使用所述激动剂的方法 |
| KR20160042039A (ko) | 2013-08-09 | 2016-04-18 | 알데릭스, 인코포레이티드 | 인산염 수송을 억제하기 위한 화합물 및 방법 |
| US20200368223A1 (en) | 2019-05-21 | 2020-11-26 | Ardelyx, Inc. | Methods for inhibiting phosphate transport |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1516776A (fr) | 1966-07-21 | 1968-03-15 | Rhone Poulenc Sa | Nouveaux dérivés du pyrrole et leur préparation |
| GB1350582A (en) * | 1970-07-24 | 1974-04-18 | Ucb Sa | Cerivatives of 2-pyrrolidinone |
-
1974
- 1974-03-20 DE DE2413935A patent/DE2413935A1/de active Granted
-
1975
- 1975-03-10 SU SU752111302A patent/SU649312A3/ru active
- 1975-03-17 YU YU632/75A patent/YU40258B/xx unknown
- 1975-03-18 DD DD184858A patent/DD119229A5/xx unknown
- 1975-03-18 CH CH345775A patent/CH621338A5/de not_active IP Right Cessation
- 1975-03-18 DK DK110675A patent/DK139965C/da not_active IP Right Cessation
- 1975-03-18 ES ES435750A patent/ES435750A1/es not_active Expired
- 1975-03-19 SE SE7503157A patent/SE402010B/xx not_active IP Right Cessation
- 1975-03-19 CS CS751860A patent/CS214738B2/cs unknown
- 1975-03-19 AT AT210975A patent/AT347931B/de not_active IP Right Cessation
- 1975-03-19 HU HU75SCHE514A patent/HU174074B/hu unknown
- 1975-03-20 IE IE611/75A patent/IE40865B1/xx unknown
- 1975-03-20 US US05/560,193 patent/US4012495A/en not_active Expired - Lifetime
- 1975-03-20 BE BE154536A patent/BE826923A/xx not_active IP Right Cessation
- 1975-03-20 IL IL46883A patent/IL46883A/xx unknown
- 1975-03-20 NL NL7503367A patent/NL7503367A/xx not_active Application Discontinuation
- 1975-03-20 CA CA222,720A patent/CA1069517A/en not_active Expired
- 1975-03-20 JP JP50034220A patent/JPS6011028B2/ja not_active Expired
- 1975-03-20 GB GB11686/75A patent/GB1498705A/en not_active Expired
- 1975-03-20 FR FR7508701A patent/FR2264531B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IL46883A (en) | 1979-09-30 |
| IL46883A0 (en) | 1975-05-22 |
| DE2413935C2 (show.php) | 1988-05-26 |
| JPS6011028B2 (ja) | 1985-03-22 |
| DK139965B (da) | 1979-05-28 |
| JPS50157360A (show.php) | 1975-12-19 |
| SU649312A3 (ru) | 1979-02-25 |
| FR2264531B1 (show.php) | 1978-07-28 |
| IE40865B1 (en) | 1979-08-29 |
| ATA210975A (de) | 1978-06-15 |
| GB1498705A (en) | 1978-01-25 |
| AT347931B (de) | 1979-01-25 |
| DK110675A (show.php) | 1975-09-21 |
| BE826923A (fr) | 1975-09-22 |
| FR2264531A1 (show.php) | 1975-10-17 |
| CA1069517A (en) | 1980-01-08 |
| ES435750A1 (es) | 1976-12-16 |
| DK139965C (da) | 1979-10-29 |
| AU7931075A (en) | 1976-09-23 |
| DE2413935A1 (de) | 1975-10-16 |
| YU63275A (en) | 1982-06-30 |
| DD119229A5 (show.php) | 1976-04-12 |
| US4012495A (en) | 1977-03-15 |
| SE7503157L (sv) | 1975-11-28 |
| HU174074B (hu) | 1979-10-28 |
| IE40865L (en) | 1975-09-20 |
| NL7503367A (nl) | 1975-09-23 |
| CH621338A5 (show.php) | 1981-01-30 |
| SE402010B (sv) | 1978-06-12 |
| YU40258B (en) | 1985-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS214738B2 (en) | Method for the production of racemic and optically active derivatives of 2-pyrrolidone | |
| US4153713A (en) | 4-(Polyalkoxyphenyl)-2-pyrrolidones (II) | |
| US4193926A (en) | 4-(Polyalkoxy phenyl)-2-pyrrolidones | |
| US4329348A (en) | N-Oxacyclic-alkylpiperidines as psychostimulants | |
| US4837235A (en) | Indole and indazole keto sulphones as leukotriene antagonists | |
| DE3784253T2 (de) | Diphenylmethan-derivate, arzneimittel und verwendung. | |
| US4248884A (en) | 2-Pyrrolidine methanol derivatives utilizable as medicaments | |
| US3799932A (en) | Gamma-piperidinobutyrophenones | |
| US3665010A (en) | Substituted phenylacetic acids and esters thereof | |
| US4075346A (en) | CNS depressant γ-(secondary amino)-ortho-nitro-butyrophenones | |
| US4567180A (en) | Carboximide derivative and medicines containing same | |
| US4148796A (en) | γ-Piperidinobutyrophenones | |
| US5328931A (en) | N-alkylated 1,4-dihydropyridinedicarboxylic acid esters | |
| US4946862A (en) | Thiophene derivative and process for preparing the same | |
| DE3779813T2 (de) | 1,4-dihydropyridinderivate. | |
| EP0106276B1 (en) | 1,4-dihydropyridine derivatives | |
| US4663319A (en) | 3-(1,3-dithiol-2-ylidene)-2,4-dioxopyrrolidines, -piperidines, and -hexahydroazepines and use thereof against hepatic diseases | |
| US5364860A (en) | Naphthyridine compounds which inhibit tyrosine kinase and their pharmaceutical compositions | |
| US4806560A (en) | Imidazo[4,5-b]pyridin-2-one derivatives | |
| NO158019B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive imidazolinderivater. | |
| FR2707984A1 (fr) | Nouvelles pipérazines substituées, leur procédé de préparation et les compositions les contenant. | |
| US4906640A (en) | 3-sulfonyl-3,7-diazabicyclo[3,3,1]nonane compounds and medicaments containing said compounds | |
| CS214739B2 (cs) | Způsob výroby racemických a opticky aktivních derivátů 2-pyrrolidonu | |
| US3681365A (en) | Derivatives of acetic acid | |
| US3629433A (en) | Antidepressant compositions of cycloalkano(c)pyrazole ethers |