CS207698B2 - Insecticide means and method of making the active substances - Google Patents
Insecticide means and method of making the active substances Download PDFInfo
- Publication number
- CS207698B2 CS207698B2 CS795373A CS537379A CS207698B2 CS 207698 B2 CS207698 B2 CS 207698B2 CS 795373 A CS795373 A CS 795373A CS 537379 A CS537379 A CS 537379A CS 207698 B2 CS207698 B2 CS 207698B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- urea
- pyridinyl
- align
- chloro
- trifluoromethyl
- Prior art date
Links
- 239000002917 insecticide Substances 0.000 title abstract description 3
- 239000013543 active substance Substances 0.000 title description 4
- 238000004519 manufacturing process Methods 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 64
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 54
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 50
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 36
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims abstract description 34
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims abstract description 24
- 125000001309 chloro group Chemical group Cl* 0.000 claims abstract description 22
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 17
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 16
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims abstract description 12
- 150000003839 salts Chemical class 0.000 claims abstract description 11
- 239000001257 hydrogen Substances 0.000 claims abstract description 8
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 6
- 150000002367 halogens Chemical class 0.000 claims abstract description 6
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims abstract description 4
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims abstract description 4
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 4
- LURYMYITPCOQAU-UHFFFAOYSA-N benzoyl isocyanate Chemical compound O=C=NC(=O)C1=CC=CC=C1 LURYMYITPCOQAU-UHFFFAOYSA-N 0.000 claims abstract description 3
- 125000004438 haloalkoxy group Chemical group 0.000 claims abstract description 3
- 125000001188 haloalkyl group Chemical group 0.000 claims abstract description 3
- 125000006583 (C1-C3) haloalkyl group Chemical group 0.000 claims abstract 2
- 125000006564 (C4-C8) cycloalkyl group Chemical group 0.000 claims abstract 2
- -1 3,5-dimethylphenyl Chemical group 0.000 claims description 119
- 239000000203 mixture Substances 0.000 claims description 56
- 239000000460 chlorine Substances 0.000 claims description 25
- 238000000034 method Methods 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 13
- 229910052801 chlorine Inorganic materials 0.000 claims description 13
- 125000001424 substituent group Chemical group 0.000 claims description 11
- 239000004480 active ingredient Substances 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 150000003254 radicals Chemical class 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 7
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 230000000749 insecticidal effect Effects 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 244000061456 Solanum tuberosum Species 0.000 claims description 2
- 235000002595 Solanum tuberosum Nutrition 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- UUEVFMOUBSLVJW-UHFFFAOYSA-N oxo-[[1-[2-[2-[2-[4-(oxoazaniumylmethylidene)pyridin-1-yl]ethoxy]ethoxy]ethyl]pyridin-4-ylidene]methyl]azanium;dibromide Chemical group [Br-].[Br-].C1=CC(=C[NH+]=O)C=CN1CCOCCOCCN1C=CC(=C[NH+]=O)C=C1 UUEVFMOUBSLVJW-UHFFFAOYSA-N 0.000 claims 2
- FIARMZDBEGVMLV-UHFFFAOYSA-N 1,1,2,2,2-pentafluoroethanolate Chemical group [O-]C(F)(F)C(F)(F)F FIARMZDBEGVMLV-UHFFFAOYSA-N 0.000 claims 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 claims 1
- 150000001413 amino acids Chemical class 0.000 claims 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical group C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 claims 1
- 210000003041 ligament Anatomy 0.000 claims 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 abstract description 10
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 abstract description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract description 2
- 150000002431 hydrogen Chemical class 0.000 abstract description 2
- 229910052760 oxygen Inorganic materials 0.000 abstract description 2
- 239000001301 oxygen Substances 0.000 abstract description 2
- 229910052717 sulfur Chemical group 0.000 abstract description 2
- 239000011593 sulfur Chemical group 0.000 abstract description 2
- 150000001204 N-oxides Chemical class 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 150000002540 isothiocyanates Chemical class 0.000 abstract 1
- 239000004202 carbamide Substances 0.000 description 138
- 235000013877 carbamide Nutrition 0.000 description 130
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 126
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 102
- 229910052799 carbon Inorganic materials 0.000 description 42
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 39
- 238000012360 testing method Methods 0.000 description 39
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 35
- 239000000047 product Substances 0.000 description 34
- 239000011541 reaction mixture Substances 0.000 description 28
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 27
- 125000004098 2,6-dichlorobenzoyl group Chemical group O=C([*])C1=C(Cl)C([H])=C([H])C([H])=C1Cl 0.000 description 25
- 239000000126 substance Substances 0.000 description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 18
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 18
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 18
- 241001521235 Spodoptera eridania Species 0.000 description 16
- 238000002844 melting Methods 0.000 description 16
- 230000008018 melting Effects 0.000 description 16
- 239000002904 solvent Substances 0.000 description 16
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 14
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- 241000238631 Hexapoda Species 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 230000000694 effects Effects 0.000 description 12
- 241000462639 Epilachna varivestis Species 0.000 description 10
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- 125000004076 pyridyl group Chemical group 0.000 description 9
- 239000000741 silica gel Substances 0.000 description 8
- 229910002027 silica gel Inorganic materials 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- 235000019270 ammonium chloride Nutrition 0.000 description 7
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- 241001301805 Epilachna Species 0.000 description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 6
- 238000009472 formulation Methods 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 238000002425 crystallisation Methods 0.000 description 5
- 230000008025 crystallization Effects 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- JHKYTLZWWVOYCP-UHFFFAOYSA-N 2,6-dichlorobenzoyl isocyanate Chemical compound ClC1=CC=CC(Cl)=C1C(=O)N=C=O JHKYTLZWWVOYCP-UHFFFAOYSA-N 0.000 description 3
- BAZVFQBTJPBRTJ-UHFFFAOYSA-N 2-chloro-5-nitropyridine Chemical compound [O-][N+](=O)C1=CC=C(Cl)N=C1 BAZVFQBTJPBRTJ-UHFFFAOYSA-N 0.000 description 3
- 125000003541 2-chlorobenzoyl group Chemical group ClC1=C(C(=O)*)C=CC=C1 0.000 description 3
- WGOLHUGPTDEKCF-UHFFFAOYSA-N 5-bromopyridin-2-amine Chemical class NC1=CC=C(Br)C=N1 WGOLHUGPTDEKCF-UHFFFAOYSA-N 0.000 description 3
- MGGFMQJJHUULTL-UHFFFAOYSA-N 6-(4-chlorophenyl)sulfanylpyridin-3-amine Chemical compound N1=CC(N)=CC=C1SC1=CC=C(Cl)C=C1 MGGFMQJJHUULTL-UHFFFAOYSA-N 0.000 description 3
- 241000254173 Coleoptera Species 0.000 description 3
- 241000257159 Musca domestica Species 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 125000004793 2,2,2-trifluoroethoxy group Chemical group FC(CO*)(F)F 0.000 description 2
- NKIUKMIAYFVWLA-UHFFFAOYSA-N 2,6-dichloro-n-[[5-(4-chlorophenyl)sulfanylpyridin-2-yl]carbamoyl]benzamide Chemical compound C1=CC(Cl)=CC=C1SC(C=N1)=CC=C1NC(=O)NC(=O)C1=C(Cl)C=CC=C1Cl NKIUKMIAYFVWLA-UHFFFAOYSA-N 0.000 description 2
- RVIZNYIWLZDUJR-UHFFFAOYSA-N 2,6-dimethoxybenzoyl isocyanate Chemical compound COC1=CC=CC(OC)=C1C(=O)N=C=O RVIZNYIWLZDUJR-UHFFFAOYSA-N 0.000 description 2
- TWDGRPSAURHHTJ-UHFFFAOYSA-N 2-(4-chlorophenyl)sulfanyl-5-nitropyridine Chemical compound N1=CC([N+](=O)[O-])=CC=C1SC1=CC=C(Cl)C=C1 TWDGRPSAURHHTJ-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- TUAMRELNJMMDMT-UHFFFAOYSA-N 3,5-xylenol Chemical compound CC1=CC(C)=CC(O)=C1 TUAMRELNJMMDMT-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- VZXOZSQDJJNBRC-UHFFFAOYSA-N 4-chlorobenzenethiol Chemical compound SC1=CC=C(Cl)C=C1 VZXOZSQDJJNBRC-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 241000907661 Pieris rapae Species 0.000 description 2
- 241000382353 Pupa Species 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 241000256248 Spodoptera Species 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 231100000636 lethal dose Toxicity 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 150000003222 pyridines Chemical class 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 239000010409 thin film Substances 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- QDKWLJJOYIFEBS-UHFFFAOYSA-N 1-fluoro-4-$l^{1}-oxidanylbenzene Chemical group [O]C1=CC=C(F)C=C1 QDKWLJJOYIFEBS-UHFFFAOYSA-N 0.000 description 1
- HHNUVBZLBJPKLT-UHFFFAOYSA-N 2,6-dichloro-N-[[6-[3-(trifluoromethyl)phenyl]sulfonylpyridin-3-yl]carbamoyl]benzamide Chemical compound ClC1=C(C(=O)NC(=O)NC=2C=NC(=CC2)S(=O)(=O)C2=CC(=CC=C2)C(F)(F)F)C(=CC=C1)Cl HHNUVBZLBJPKLT-UHFFFAOYSA-N 0.000 description 1
- VNWQQYNLBYWRCE-UHFFFAOYSA-N 2,6-dichloro-n-[(6-methoxypyridin-3-yl)carbamoyl]benzamide Chemical compound C1=NC(OC)=CC=C1NC(=O)NC(=O)C1=C(Cl)C=CC=C1Cl VNWQQYNLBYWRCE-UHFFFAOYSA-N 0.000 description 1
- KAIPJPCNPYYKRZ-UHFFFAOYSA-N 2,6-dichloro-n-[[5-(3,4-dichlorophenoxy)pyridin-2-yl]carbamoyl]benzamide Chemical compound C1=C(Cl)C(Cl)=CC=C1OC(C=N1)=CC=C1NC(=O)NC(=O)C1=C(Cl)C=CC=C1Cl KAIPJPCNPYYKRZ-UHFFFAOYSA-N 0.000 description 1
- RIPJVPPTTYKWHK-UHFFFAOYSA-N 2,6-dichloro-n-[[5-(3,5-dichlorophenoxy)pyridin-2-yl]carbamoyl]benzamide Chemical compound ClC1=CC(Cl)=CC(OC=2C=NC(NC(=O)NC(=O)C=3C(=CC=CC=3Cl)Cl)=CC=2)=C1 RIPJVPPTTYKWHK-UHFFFAOYSA-N 0.000 description 1
- FFVRFISUJVAJAA-UHFFFAOYSA-N 2,6-dichloro-n-[[5-(3,5-dichlorophenyl)sulfanylpyridin-2-yl]carbamoyl]benzamide Chemical compound ClC1=CC(Cl)=CC(SC=2C=NC(NC(=O)NC(=O)C=3C(=CC=CC=3Cl)Cl)=CC=2)=C1 FFVRFISUJVAJAA-UHFFFAOYSA-N 0.000 description 1
- MYWIAPPZMPVBPJ-UHFFFAOYSA-N 2,6-dichloro-n-[[5-[(4-chlorophenyl)methylsulfanyl]pyridin-2-yl]carbamoyl]benzamide Chemical compound C1=CC(Cl)=CC=C1CSC(C=N1)=CC=C1NC(=O)NC(=O)C1=C(Cl)C=CC=C1Cl MYWIAPPZMPVBPJ-UHFFFAOYSA-N 0.000 description 1
- ZHEZERJKYVJSDH-UHFFFAOYSA-N 2,6-dichloro-n-[[5-chloro-6-(3,5-dichlorophenoxy)pyridin-3-yl]carbamoyl]benzamide Chemical compound ClC1=CC(Cl)=CC(OC=2C(=CC(NC(=O)NC(=O)C=3C(=CC=CC=3Cl)Cl)=CN=2)Cl)=C1 ZHEZERJKYVJSDH-UHFFFAOYSA-N 0.000 description 1
- SEOLNZPFJQLHJL-UHFFFAOYSA-N 2,6-dichloro-n-[[5-chloro-6-(4-chlorophenyl)sulfanylpyridin-3-yl]carbamoyl]benzamide Chemical compound C1=CC(Cl)=CC=C1SC(C(=C1)Cl)=NC=C1NC(=O)NC(=O)C1=C(Cl)C=CC=C1Cl SEOLNZPFJQLHJL-UHFFFAOYSA-N 0.000 description 1
- YLQIZBZQKVIMDG-UHFFFAOYSA-N 2,6-dichloro-n-[[6-(2,3,5,6-tetrafluorophenyl)sulfanylpyridin-3-yl]carbamoyl]benzamide Chemical compound FC1=CC(F)=C(F)C(SC=2N=CC(NC(=O)NC(=O)C=3C(=CC=CC=3Cl)Cl)=CC=2)=C1F YLQIZBZQKVIMDG-UHFFFAOYSA-N 0.000 description 1
- ZZTYOJUFMFERNR-UHFFFAOYSA-N 2,6-dichloro-n-[[6-(2-fluorophenoxy)pyridin-3-yl]carbamoyl]benzamide Chemical compound FC1=CC=CC=C1OC(N=C1)=CC=C1NC(=O)NC(=O)C1=C(Cl)C=CC=C1Cl ZZTYOJUFMFERNR-UHFFFAOYSA-N 0.000 description 1
- OAQSPHRVBFOUGL-UHFFFAOYSA-N 2,6-dichloro-n-[[6-(3,4-dichlorophenoxy)pyridin-3-yl]carbamoyl]benzamide Chemical compound C1=C(Cl)C(Cl)=CC=C1OC(N=C1)=CC=C1NC(=O)NC(=O)C1=C(Cl)C=CC=C1Cl OAQSPHRVBFOUGL-UHFFFAOYSA-N 0.000 description 1
- WNASNMLJVZEJPI-UHFFFAOYSA-N 2,6-dichloro-n-[[6-(3,5-dichlorophenoxy)-5-methylpyridin-3-yl]carbamoyl]benzamide Chemical compound C=1N=C(OC=2C=C(Cl)C=C(Cl)C=2)C(C)=CC=1NC(=O)NC(=O)C1=C(Cl)C=CC=C1Cl WNASNMLJVZEJPI-UHFFFAOYSA-N 0.000 description 1
- BTXSMEWVIRPBFJ-UHFFFAOYSA-N 2,6-dichloro-n-[[6-(3,5-dichlorophenoxy)pyridin-3-yl]carbamoyl]benzamide Chemical compound ClC1=CC(Cl)=CC(OC=2N=CC(NC(=O)NC(=O)C=3C(=CC=CC=3Cl)Cl)=CC=2)=C1 BTXSMEWVIRPBFJ-UHFFFAOYSA-N 0.000 description 1
- SHEPYDJNDCVPSO-UHFFFAOYSA-N 2,6-dichloro-n-[[6-(3,5-dimethylphenoxy)pyridin-3-yl]carbamoyl]benzamide Chemical compound CC1=CC(C)=CC(OC=2N=CC(NC(=O)NC(=O)C=3C(=CC=CC=3Cl)Cl)=CC=2)=C1 SHEPYDJNDCVPSO-UHFFFAOYSA-N 0.000 description 1
- KBGAUEOBPOPZHP-UHFFFAOYSA-N 2,6-dichloro-n-[[6-(3-chloro-5-methoxyphenoxy)pyridin-3-yl]carbamoyl]benzamide Chemical compound COC1=CC(Cl)=CC(OC=2N=CC(NC(=O)NC(=O)C=3C(=CC=CC=3Cl)Cl)=CC=2)=C1 KBGAUEOBPOPZHP-UHFFFAOYSA-N 0.000 description 1
- KNKILXSAKXLKBK-UHFFFAOYSA-N 2,6-dichloro-n-[[6-(3-chlorophenyl)sulfanylpyridin-3-yl]carbamoyl]benzamide Chemical compound ClC1=CC=CC(SC=2N=CC(NC(=O)NC(=O)C=3C(=CC=CC=3Cl)Cl)=CC=2)=C1 KNKILXSAKXLKBK-UHFFFAOYSA-N 0.000 description 1
- JPLZIWQCELDKPW-UHFFFAOYSA-N 2,6-dichloro-n-[[6-(4-chlorophenoxy)pyridin-3-yl]carbamoyl]benzamide Chemical compound C1=CC(Cl)=CC=C1OC(N=C1)=CC=C1NC(=O)NC(=O)C1=C(Cl)C=CC=C1Cl JPLZIWQCELDKPW-UHFFFAOYSA-N 0.000 description 1
- OMAQXXDDQDRIEY-UHFFFAOYSA-N 2,6-dichloro-n-[[6-(4-chlorophenyl)sulfanylpyridin-3-yl]carbamoyl]benzamide Chemical compound C1=CC(Cl)=CC=C1SC(N=C1)=CC=C1NC(=O)NC(=O)C1=C(Cl)C=CC=C1Cl OMAQXXDDQDRIEY-UHFFFAOYSA-N 0.000 description 1
- QNJAZVUFULQWHO-UHFFFAOYSA-N 2,6-dichloro-n-[[6-(4-chlorophenyl)sulfinylpyridin-3-yl]carbamoyl]benzamide Chemical compound C1=CC(Cl)=CC=C1S(=O)C(N=C1)=CC=C1NC(=O)NC(=O)C1=C(Cl)C=CC=C1Cl QNJAZVUFULQWHO-UHFFFAOYSA-N 0.000 description 1
- VVXFZPAFRWNGKM-UHFFFAOYSA-N 2,6-dichloro-n-[[6-(4-chlorophenyl)sulfonylpyridin-3-yl]carbamoyl]benzamide Chemical compound C1=CC(Cl)=CC=C1S(=O)(=O)C(N=C1)=CC=C1NC(=O)NC(=O)C1=C(Cl)C=CC=C1Cl VVXFZPAFRWNGKM-UHFFFAOYSA-N 0.000 description 1
- ORHSZTJJTFOVMT-UHFFFAOYSA-N 2,6-dichloro-n-[[6-[(3,4-dichlorophenyl)methoxy]pyridin-3-yl]carbamoyl]benzamide Chemical compound C1=C(Cl)C(Cl)=CC=C1COC(N=C1)=CC=C1NC(=O)NC(=O)C1=C(Cl)C=CC=C1Cl ORHSZTJJTFOVMT-UHFFFAOYSA-N 0.000 description 1
- XWOCWEFDWIHDRW-UHFFFAOYSA-N 2,6-dichloro-n-[[6-[(4-chlorophenyl)methoxy]pyridin-3-yl]carbamoyl]benzamide Chemical compound C1=CC(Cl)=CC=C1COC(N=C1)=CC=C1NC(=O)NC(=O)C1=C(Cl)C=CC=C1Cl XWOCWEFDWIHDRW-UHFFFAOYSA-N 0.000 description 1
- NNCVMYOVZMLFNC-UHFFFAOYSA-N 2,6-dichloro-n-[[6-[(4-chlorophenyl)methylsulfanyl]pyridin-3-yl]carbamoyl]benzamide Chemical compound C1=CC(Cl)=CC=C1CSC(N=C1)=CC=C1NC(=O)NC(=O)C1=C(Cl)C=CC=C1Cl NNCVMYOVZMLFNC-UHFFFAOYSA-N 0.000 description 1
- FUDBWPHXLAQCIT-UHFFFAOYSA-N 2,6-dichloro-n-[[6-[(4-chlorophenyl)methylsulfonyl]pyridin-3-yl]carbamoyl]benzamide Chemical compound C1=CC(Cl)=CC=C1CS(=O)(=O)C(N=C1)=CC=C1NC(=O)NC(=O)C1=C(Cl)C=CC=C1Cl FUDBWPHXLAQCIT-UHFFFAOYSA-N 0.000 description 1
- JHSPCUHPSIUQRB-UHFFFAOYSA-N 2,6-dichlorobenzamide Chemical compound NC(=O)C1=C(Cl)C=CC=C1Cl JHSPCUHPSIUQRB-UHFFFAOYSA-N 0.000 description 1
- DMBUBTMSKOXICK-UHFFFAOYSA-N 2,6-difluoro-n-[[6-[3-(trifluoromethyl)phenoxy]pyridin-3-yl]carbamoyl]benzamide Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=N1)=CC=C1OC1=CC=CC(C(F)(F)F)=C1 DMBUBTMSKOXICK-UHFFFAOYSA-N 0.000 description 1
- 125000006508 2,6-difluorobenzyl group Chemical group [H]C1=C([H])C(F)=C(C(F)=C1[H])C([H])([H])* 0.000 description 1
- XPOXWMNEIOJUBH-UHFFFAOYSA-N 2,6-dimethoxy-N-[(6-pentoxypyridin-3-yl)carbamoyl]benzamide Chemical compound C1=NC(OCCCCC)=CC=C1NC(=O)NC(=O)C1=C(OC)C=CC=C1OC XPOXWMNEIOJUBH-UHFFFAOYSA-N 0.000 description 1
- JMBQAZXRYOMPJA-UHFFFAOYSA-N 2,6-dimethoxy-n-[(5-phenylmethoxypyridin-2-yl)carbamoyl]benzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(N=C1)=CC=C1OCC1=CC=CC=C1 JMBQAZXRYOMPJA-UHFFFAOYSA-N 0.000 description 1
- XDMQHHAQCYCROJ-UHFFFAOYSA-N 2,6-dimethoxy-n-[(6-methoxypyridin-3-yl)carbamoyl]benzamide Chemical compound C1=NC(OC)=CC=C1NC(=O)NC(=O)C1=C(OC)C=CC=C1OC XDMQHHAQCYCROJ-UHFFFAOYSA-N 0.000 description 1
- IKAHSFKRKQXXHL-UHFFFAOYSA-N 2,6-dimethoxy-n-[[6-(2,3,5,6-tetrafluorophenyl)sulfanylpyridin-3-yl]carbamoyl]benzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=N1)=CC=C1SC1=C(F)C(F)=CC(F)=C1F IKAHSFKRKQXXHL-UHFFFAOYSA-N 0.000 description 1
- MGXLJXSCYMXRJN-UHFFFAOYSA-N 2,6-dimethoxy-n-[[6-(2,4,5-trichlorophenyl)sulfanylpyridin-3-yl]carbamoyl]benzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=N1)=CC=C1SC1=CC(Cl)=C(Cl)C=C1Cl MGXLJXSCYMXRJN-UHFFFAOYSA-N 0.000 description 1
- WIKFUBQRQGXUKB-UHFFFAOYSA-N 2,6-dimethoxy-n-[[6-[[3-(trifluoromethyl)phenyl]methylsulfanyl]pyridin-3-yl]carbamoyl]benzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=N1)=CC=C1SCC1=CC=CC(C(F)(F)F)=C1 WIKFUBQRQGXUKB-UHFFFAOYSA-N 0.000 description 1
- JKMOWMTUUWFSCE-UHFFFAOYSA-N 2-(3,5-dimethylphenoxy)-5-nitropyridine Chemical compound CC1=CC(C)=CC(OC=2N=CC(=CC=2)[N+]([O-])=O)=C1 JKMOWMTUUWFSCE-UHFFFAOYSA-N 0.000 description 1
- SQBJPDVVJGLJMQ-UHFFFAOYSA-N 2-(4-chlorophenyl)sulfonyl-5-nitropyridine Chemical compound N1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)C1=CC=C(Cl)C=C1 SQBJPDVVJGLJMQ-UHFFFAOYSA-N 0.000 description 1
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 1
- SDHADEUVUAIVRD-UHFFFAOYSA-N 2-chloro-n-[[5-methyl-6-[3-(trifluoromethyl)phenyl]sulfanylpyridin-3-yl]carbamoyl]benzamide Chemical compound C=1N=C(SC=2C=C(C=CC=2)C(F)(F)F)C(C)=CC=1NC(=O)NC(=O)C1=CC=CC=C1Cl SDHADEUVUAIVRD-UHFFFAOYSA-N 0.000 description 1
- KKHKVMFGIACBNN-UHFFFAOYSA-N 2-chloro-n-[[6-(3,5-dimethoxyphenoxy)pyridin-3-yl]carbamoyl]-6-methoxybenzamide Chemical compound COC1=CC(OC)=CC(OC=2N=CC(NC(=O)NC(=O)C=3C(=CC=CC=3Cl)OC)=CC=2)=C1 KKHKVMFGIACBNN-UHFFFAOYSA-N 0.000 description 1
- DZYMCDAXUXUUEK-UHFFFAOYSA-N 2-chloro-n-[[6-(3-chloro-5-methoxyphenoxy)pyridin-3-yl]carbamoyl]-6-methoxybenzamide Chemical compound COC1=CC(Cl)=CC(OC=2N=CC(NC(=O)NC(=O)C=3C(=CC=CC=3Cl)OC)=CC=2)=C1 DZYMCDAXUXUUEK-UHFFFAOYSA-N 0.000 description 1
- VCBCPVCKEKXPEP-UHFFFAOYSA-N 2-chloro-n-[[6-(4-chlorophenyl)sulfanylpyridin-3-yl]carbamoyl]-6-fluorobenzamide Chemical compound FC1=CC=CC(Cl)=C1C(=O)NC(=O)NC(C=N1)=CC=C1SC1=CC=C(Cl)C=C1 VCBCPVCKEKXPEP-UHFFFAOYSA-N 0.000 description 1
- NBUHICVUIVXTOD-UHFFFAOYSA-N 2-chloro-n-[[6-(4-chlorophenyl)sulfanylpyridin-3-yl]carbamoyl]-6-methoxybenzamide Chemical compound COC1=CC=CC(Cl)=C1C(=O)NC(=O)NC(C=N1)=CC=C1SC1=CC=C(Cl)C=C1 NBUHICVUIVXTOD-UHFFFAOYSA-N 0.000 description 1
- KKYMMIJKHVPXBV-UHFFFAOYSA-N 2-chloro-n-[[6-(4-chlorophenyl)sulfanylpyridin-3-yl]carbamoyl]-6-methylbenzamide Chemical compound CC1=CC=CC(Cl)=C1C(=O)NC(=O)NC(C=N1)=CC=C1SC1=CC=C(Cl)C=C1 KKYMMIJKHVPXBV-UHFFFAOYSA-N 0.000 description 1
- XOPQNCCLHUUISN-UHFFFAOYSA-N 2-chloro-n-[[6-(4-chlorophenyl)sulfonylpyridin-3-yl]carbamoyl]-6-methoxybenzamide Chemical compound COC1=CC=CC(Cl)=C1C(=O)NC(=O)NC1=CC=C(S(=O)(=O)C=2C=CC(Cl)=CC=2)N=C1 XOPQNCCLHUUISN-UHFFFAOYSA-N 0.000 description 1
- UNYNCNCMZSPBLZ-UHFFFAOYSA-N 2-chloro-n-[[6-[(2,4-dichlorophenyl)methoxy]pyridin-3-yl]carbamoyl]-6-fluorobenzamide Chemical compound FC1=CC=CC(Cl)=C1C(=O)NC(=O)NC(C=N1)=CC=C1OCC1=CC=C(Cl)C=C1Cl UNYNCNCMZSPBLZ-UHFFFAOYSA-N 0.000 description 1
- AUGWMRCSSWWORQ-UHFFFAOYSA-N 2-chloro-n-[[6-[(2,4-dichlorophenyl)methoxy]pyridin-3-yl]carbamoyl]-6-methylbenzamide Chemical compound CC1=CC=CC(Cl)=C1C(=O)NC(=O)NC(C=N1)=CC=C1OCC1=CC=C(Cl)C=C1Cl AUGWMRCSSWWORQ-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- GYMURAWICKNNOQ-UHFFFAOYSA-N 2-n-[3-(trifluoromethyl)phenyl]pyridine-2,5-diamine Chemical compound N1=CC(N)=CC=C1NC1=CC=CC(C(F)(F)F)=C1 GYMURAWICKNNOQ-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- NUKYPUAOHBNCPY-UHFFFAOYSA-N 4-aminopyridine Chemical compound NC1=CC=NC=C1 NUKYPUAOHBNCPY-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- QPGQOFJYDKIZBW-UHFFFAOYSA-N 5-(4-chlorophenyl)sulfanyl-2-nitropyridine Chemical compound C1=NC([N+](=O)[O-])=CC=C1SC1=CC=C(Cl)C=C1 QPGQOFJYDKIZBW-UHFFFAOYSA-N 0.000 description 1
- OJCXGRPKFISGAZ-UHFFFAOYSA-N 6-(2,2,2-trifluoroethoxy)pyridin-3-amine Chemical compound NC1=CC=C(OCC(F)(F)F)N=C1 OJCXGRPKFISGAZ-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- CJUBTQYBOIZFDK-UHFFFAOYSA-N 6-cyclohexylsulfonylpyridin-3-amine Chemical compound N1=CC(N)=CC=C1S(=O)(=O)C1CCCCC1 CJUBTQYBOIZFDK-UHFFFAOYSA-N 0.000 description 1
- 241000256118 Aedes aegypti Species 0.000 description 1
- 241000902876 Alticini Species 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 241000254177 Anthonomus Species 0.000 description 1
- 241000254175 Anthonomus grandis Species 0.000 description 1
- 241001640910 Anthrenus Species 0.000 description 1
- 241001674044 Blattodea Species 0.000 description 1
- 241000255789 Bombyx mori Species 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 102100040999 Catechol O-methyltransferase Human genes 0.000 description 1
- 108020002739 Catechol O-methyltransferase Proteins 0.000 description 1
- 241000902406 Chaetocnema Species 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 241001340508 Crambus Species 0.000 description 1
- ZAKOWWREFLAJOT-CEFNRUSXSA-N D-alpha-tocopherylacetate Chemical compound CC(=O)OC1=C(C)C(C)=C2O[C@@](CCC[C@H](C)CCC[C@H](C)CCCC(C)C)(C)CCC2=C1C ZAKOWWREFLAJOT-CEFNRUSXSA-N 0.000 description 1
- 241000157278 Dacus <genus> Species 0.000 description 1
- 241000255925 Diptera Species 0.000 description 1
- 241001082081 Elodia Species 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 241001408611 Epirrhoe alternata Species 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 241000257176 Hypoderma <fly> Species 0.000 description 1
- 206010061217 Infestation Diseases 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 241000283160 Inia Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241001268491 Laspeyresia Species 0.000 description 1
- 241000255777 Lepidoptera Species 0.000 description 1
- 241000258915 Leptinotarsa Species 0.000 description 1
- 241000255676 Malacosoma Species 0.000 description 1
- 241000771994 Melophagus ovinus Species 0.000 description 1
- HRYILSDLIGTCOP-UHFFFAOYSA-N N-benzoylurea Chemical compound NC(=O)NC(=O)C1=CC=CC=C1 HRYILSDLIGTCOP-UHFFFAOYSA-N 0.000 description 1
- 241000196502 Naupactus Species 0.000 description 1
- 241000486026 Nebris Species 0.000 description 1
- 241000238814 Orthoptera Species 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 241000257149 Phormia Species 0.000 description 1
- 241001465382 Physalis alkekengi Species 0.000 description 1
- 241000500439 Plutella Species 0.000 description 1
- 241000914631 Psallus Species 0.000 description 1
- 241000287531 Psittacidae Species 0.000 description 1
- 241000282806 Rhinoceros Species 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 241001528589 Synanthedon Species 0.000 description 1
- 241001481659 Syrphidae Species 0.000 description 1
- 241000255632 Tabanus atratus Species 0.000 description 1
- IOYNQIMAUDJVEI-BMVIKAAMSA-N Tepraloxydim Chemical group C1C(=O)C(C(=N/OC\C=C\Cl)/CC)=C(O)CC1C1CCOCC1 IOYNQIMAUDJVEI-BMVIKAAMSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 241000254086 Tribolium <beetle> Species 0.000 description 1
- RHQDFWAXVIIEBN-UHFFFAOYSA-N Trifluoroethanol Chemical compound OCC(F)(F)F RHQDFWAXVIIEBN-UHFFFAOYSA-N 0.000 description 1
- WRWYGOVGIGCDLE-UHFFFAOYSA-N [O]c1ccccc1F Chemical group [O]c1ccccc1F WRWYGOVGIGCDLE-UHFFFAOYSA-N 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 239000003570 air Substances 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 210000000436 anus Anatomy 0.000 description 1
- 238000010420 art technique Methods 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 210000000941 bile Anatomy 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 101150047356 dec-1 gene Proteins 0.000 description 1
- QQQYTWIFVNKMRW-UHFFFAOYSA-N diflubenzuron Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC1=CC=C(Cl)C=C1 QQQYTWIFVNKMRW-UHFFFAOYSA-N 0.000 description 1
- 125000006001 difluoroethyl group Chemical group 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 230000008029 eradication Effects 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 239000010871 livestock manure Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 230000010534 mechanism of action Effects 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- OIRPXNXMSIDYNM-UHFFFAOYSA-N n-[(5-benzylsulfanylpyridin-2-yl)carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(N=C1)=CC=C1SCC1=CC=CC=C1 OIRPXNXMSIDYNM-UHFFFAOYSA-N 0.000 description 1
- UCGIZPATBSWURU-UHFFFAOYSA-N n-[(6-benzylsulfanylpyridin-3-yl)carbamoyl]-2,6-dichlorobenzamide Chemical compound ClC1=CC=CC(Cl)=C1C(=O)NC(=O)NC(C=N1)=CC=C1SCC1=CC=CC=C1 UCGIZPATBSWURU-UHFFFAOYSA-N 0.000 description 1
- FQUAIVPOVHKJQS-UHFFFAOYSA-N n-[(6-benzylsulfanylpyridin-3-yl)carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=N1)=CC=C1SCC1=CC=CC=C1 FQUAIVPOVHKJQS-UHFFFAOYSA-N 0.000 description 1
- RYNFNTKODSUHID-UHFFFAOYSA-N n-[(6-cyclohexylsulfonylpyridin-3-yl)carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC1=CC=C(S(=O)(=O)C2CCCCC2)N=C1 RYNFNTKODSUHID-UHFFFAOYSA-N 0.000 description 1
- KJNPCECXEGMUKR-UHFFFAOYSA-N n-[(6-tert-butylsulfanylpyridin-3-yl)carbamoyl]-2,6-dichlorobenzamide Chemical compound C1=NC(SC(C)(C)C)=CC=C1NC(=O)NC(=O)C1=C(Cl)C=CC=C1Cl KJNPCECXEGMUKR-UHFFFAOYSA-N 0.000 description 1
- YOCIOGRVSXCPPD-UHFFFAOYSA-N n-[[5-(3,4-dichlorophenoxy)pyridin-2-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(N=C1)=CC=C1OC1=CC=C(Cl)C(Cl)=C1 YOCIOGRVSXCPPD-UHFFFAOYSA-N 0.000 description 1
- SWAZPEFMMYCXON-UHFFFAOYSA-N n-[[5-(4-chlorophenoxy)pyridin-2-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(N=C1)=CC=C1OC1=CC=C(Cl)C=C1 SWAZPEFMMYCXON-UHFFFAOYSA-N 0.000 description 1
- MZRHWNFEFUBNNC-UHFFFAOYSA-N n-[[5-chloro-6-(4-chlorophenyl)sulfanylpyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=C1Cl)=CN=C1SC1=CC=C(Cl)C=C1 MZRHWNFEFUBNNC-UHFFFAOYSA-N 0.000 description 1
- KNXRVGISIFWPME-UHFFFAOYSA-N n-[[6-(2,4-dichlorophenyl)sulfanylpyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=N1)=CC=C1SC1=CC=C(Cl)C=C1Cl KNXRVGISIFWPME-UHFFFAOYSA-N 0.000 description 1
- VPCIPPUHWZWSQG-UHFFFAOYSA-N n-[[6-(2-bromophenyl)sulfanylpyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=N1)=CC=C1SC1=CC=CC=C1Br VPCIPPUHWZWSQG-UHFFFAOYSA-N 0.000 description 1
- KVMWKUYNXDTSQK-UHFFFAOYSA-N n-[[6-(2-chlorophenoxy)pyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=N1)=CC=C1OC1=CC=CC=C1Cl KVMWKUYNXDTSQK-UHFFFAOYSA-N 0.000 description 1
- LUDYEXBQQFPDBR-UHFFFAOYSA-N n-[[6-(3,4-dichlorophenoxy)pyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=N1)=CC=C1OC1=CC=C(Cl)C(Cl)=C1 LUDYEXBQQFPDBR-UHFFFAOYSA-N 0.000 description 1
- RXBXQPQUUNJCCX-UHFFFAOYSA-N n-[[6-(3,4-dichlorophenoxy)pyridin-3-yl]carbamoyl]-2,6-dimethylbenzamide Chemical compound CC1=CC=CC(C)=C1C(=O)NC(=O)NC(C=N1)=CC=C1OC1=CC=C(Cl)C(Cl)=C1 RXBXQPQUUNJCCX-UHFFFAOYSA-N 0.000 description 1
- NJKGOZIHUFDPOZ-UHFFFAOYSA-N n-[[6-(3,4-dichlorophenyl)sulfanylpyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=N1)=CC=C1SC1=CC=C(Cl)C(Cl)=C1 NJKGOZIHUFDPOZ-UHFFFAOYSA-N 0.000 description 1
- YDLGDLOIKXNZKZ-UHFFFAOYSA-N n-[[6-(3,4-dichlorophenyl)sulfonylpyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC1=CC=C(S(=O)(=O)C=2C=C(Cl)C(Cl)=CC=2)N=C1 YDLGDLOIKXNZKZ-UHFFFAOYSA-N 0.000 description 1
- CZZHXSSMVUDBIY-UHFFFAOYSA-N n-[[6-(3,5-dichlorophenoxy)-5-methylpyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=C1C)=CN=C1OC1=CC(Cl)=CC(Cl)=C1 CZZHXSSMVUDBIY-UHFFFAOYSA-N 0.000 description 1
- MBVPBTPIMMUDRE-UHFFFAOYSA-N n-[[6-(3,5-dichlorophenoxy)pyridin-3-yl]carbamoyl]-2-fluoro-6-methoxybenzamide Chemical compound COC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=N1)=CC=C1OC1=CC(Cl)=CC(Cl)=C1 MBVPBTPIMMUDRE-UHFFFAOYSA-N 0.000 description 1
- RXZXRWAVJKWYDH-UHFFFAOYSA-N n-[[6-(3,5-dimethoxyphenoxy)pyridin-3-yl]carbamoyl]-2,6-difluorobenzamide Chemical compound COC1=CC(OC)=CC(OC=2N=CC(NC(=O)NC(=O)C=3C(=CC=CC=3F)F)=CC=2)=C1 RXZXRWAVJKWYDH-UHFFFAOYSA-N 0.000 description 1
- OPOBGGACLYCTAH-UHFFFAOYSA-N n-[[6-(3,5-dimethoxyphenoxy)pyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC(OC)=CC(OC=2N=CC(NC(=O)NC(=O)C=3C(=CC=CC=3OC)OC)=CC=2)=C1 OPOBGGACLYCTAH-UHFFFAOYSA-N 0.000 description 1
- CICIRLWUEDLACG-UHFFFAOYSA-N n-[[6-(3,5-dimethoxyphenoxy)pyridin-3-yl]carbamoyl]-2-fluoro-6-methoxybenzamide Chemical compound COC1=CC(OC)=CC(OC=2N=CC(NC(=O)NC(=O)C=3C(=CC=CC=3F)OC)=CC=2)=C1 CICIRLWUEDLACG-UHFFFAOYSA-N 0.000 description 1
- VZMUKCQNJVTTFV-UHFFFAOYSA-N n-[[6-(3,5-dimethylphenoxy)pyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=N1)=CC=C1OC1=CC(C)=CC(C)=C1 VZMUKCQNJVTTFV-UHFFFAOYSA-N 0.000 description 1
- VTWIXGOEWNWTDF-UHFFFAOYSA-N n-[[6-(3-bromophenoxy)pyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=N1)=CC=C1OC1=CC=CC(Br)=C1 VTWIXGOEWNWTDF-UHFFFAOYSA-N 0.000 description 1
- RPRMEPZLCNDRTC-UHFFFAOYSA-N n-[[6-(3-bromophenyl)sulfanylpyridin-3-yl]carbamoyl]-2,6-dichlorobenzamide Chemical compound ClC1=CC=CC(Cl)=C1C(=O)NC(=O)NC(C=N1)=CC=C1SC1=CC=CC(Br)=C1 RPRMEPZLCNDRTC-UHFFFAOYSA-N 0.000 description 1
- LVUAAYMMNQXRDV-UHFFFAOYSA-N n-[[6-(3-chloro-5-methoxyphenoxy)pyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC(Cl)=CC(OC=2N=CC(NC(=O)NC(=O)C=3C(=CC=CC=3OC)OC)=CC=2)=C1 LVUAAYMMNQXRDV-UHFFFAOYSA-N 0.000 description 1
- ROZMWNSGALIRLW-UHFFFAOYSA-N n-[[6-(3-chlorophenoxy)pyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=N1)=CC=C1OC1=CC=CC(Cl)=C1 ROZMWNSGALIRLW-UHFFFAOYSA-N 0.000 description 1
- FVPDLGZCOYEZPC-UHFFFAOYSA-N n-[[6-(4-bromo-3-methylphenyl)sulfanylpyridin-3-yl]carbamoyl]-2,6-dichlorobenzamide Chemical compound C1=C(Br)C(C)=CC(SC=2N=CC(NC(=O)NC(=O)C=3C(=CC=CC=3Cl)Cl)=CC=2)=C1 FVPDLGZCOYEZPC-UHFFFAOYSA-N 0.000 description 1
- VAGKNJXQDLVXKB-UHFFFAOYSA-N n-[[6-(4-bromo-3-methylphenyl)sulfanylpyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=N1)=CC=C1SC1=CC=C(Br)C(C)=C1 VAGKNJXQDLVXKB-UHFFFAOYSA-N 0.000 description 1
- JNJREMLTCNGMKD-UHFFFAOYSA-N n-[[6-(4-bromophenoxy)pyridin-3-yl]carbamoyl]-2,6-dichlorobenzamide Chemical compound ClC1=CC=CC(Cl)=C1C(=O)NC(=O)NC(C=N1)=CC=C1OC1=CC=C(Br)C=C1 JNJREMLTCNGMKD-UHFFFAOYSA-N 0.000 description 1
- BRCZZBJHGFFUFO-UHFFFAOYSA-N n-[[6-(4-bromophenyl)sulfanylpyridin-3-yl]carbamoyl]-2,6-dichlorobenzamide Chemical compound ClC1=CC=CC(Cl)=C1C(=O)NC(=O)NC(C=N1)=CC=C1SC1=CC=C(Br)C=C1 BRCZZBJHGFFUFO-UHFFFAOYSA-N 0.000 description 1
- UXYLHBWVGTYFEI-UHFFFAOYSA-N n-[[6-(4-bromophenyl)sulfanylpyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=N1)=CC=C1SC1=CC=C(Br)C=C1 UXYLHBWVGTYFEI-UHFFFAOYSA-N 0.000 description 1
- DFHGTIJXPRAEIS-UHFFFAOYSA-N n-[[6-(4-chloro-3,5-dimethylphenoxy)pyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=N1)=CC=C1OC1=CC(C)=C(Cl)C(C)=C1 DFHGTIJXPRAEIS-UHFFFAOYSA-N 0.000 description 1
- PWECFBYULJTACI-UHFFFAOYSA-N n-[[6-(4-chloro-3-methylphenoxy)pyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=N1)=CC=C1OC1=CC=C(Cl)C(C)=C1 PWECFBYULJTACI-UHFFFAOYSA-N 0.000 description 1
- FQQYCQGPUHDCTK-UHFFFAOYSA-N n-[[6-(4-chlorophenoxy)-5-methylpyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=C1C)=CN=C1OC1=CC=C(Cl)C=C1 FQQYCQGPUHDCTK-UHFFFAOYSA-N 0.000 description 1
- VUROCFPNDLRVMC-UHFFFAOYSA-N n-[[6-(4-chlorophenoxy)pyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=N1)=CC=C1OC1=CC=C(Cl)C=C1 VUROCFPNDLRVMC-UHFFFAOYSA-N 0.000 description 1
- FWUNNIVPVVYIJT-UHFFFAOYSA-N n-[[6-(4-chlorophenyl)sulfanylpyridin-3-yl]carbamoyl]-2,6-difluorobenzamide Chemical compound FC1=CC=CC(F)=C1C(=O)NC(=O)NC(C=N1)=CC=C1SC1=CC=C(Cl)C=C1 FWUNNIVPVVYIJT-UHFFFAOYSA-N 0.000 description 1
- VYWGSUOLZOIEKR-UHFFFAOYSA-N n-[[6-(4-chlorophenyl)sulfinylpyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC1=CC=C(S(=O)C=2C=CC(Cl)=CC=2)N=C1 VYWGSUOLZOIEKR-UHFFFAOYSA-N 0.000 description 1
- GFKWRKDQHLIWSU-UHFFFAOYSA-N n-[[6-[(2,4-dichlorophenyl)methylsulfanyl]pyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=N1)=CC=C1SCC1=CC=C(Cl)C=C1Cl GFKWRKDQHLIWSU-UHFFFAOYSA-N 0.000 description 1
- JHRJVGKBDVZVBK-UHFFFAOYSA-N n-[[6-[(3,4-dichlorophenyl)methoxy]pyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=N1)=CC=C1OCC1=CC=C(Cl)C(Cl)=C1 JHRJVGKBDVZVBK-UHFFFAOYSA-N 0.000 description 1
- VEBOTSQYZXIEAQ-UHFFFAOYSA-N n-[[6-[(3,4-dichlorophenyl)methylsulfanyl]pyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=N1)=CC=C1SCC1=CC=C(Cl)C(Cl)=C1 VEBOTSQYZXIEAQ-UHFFFAOYSA-N 0.000 description 1
- VZADBWWNTJLBQP-UHFFFAOYSA-N n-[[6-[(4-chlorophenyl)methoxy]pyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=N1)=CC=C1OCC1=CC=C(Cl)C=C1 VZADBWWNTJLBQP-UHFFFAOYSA-N 0.000 description 1
- GCZQPLAFKQSWQQ-UHFFFAOYSA-N n-[[6-[(4-chlorophenyl)methylsulfanyl]pyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC(C=N1)=CC=C1SCC1=CC=C(Cl)C=C1 GCZQPLAFKQSWQQ-UHFFFAOYSA-N 0.000 description 1
- WRNRMGUVLLGMAL-UHFFFAOYSA-N n-[[6-[(4-chlorophenyl)methylsulfonyl]pyridin-3-yl]carbamoyl]-2,6-dimethoxybenzamide Chemical compound COC1=CC=CC(OC)=C1C(=O)NC(=O)NC1=CC=C(S(=O)(=O)CC=2C=CC(Cl)=CC=2)N=C1 WRNRMGUVLLGMAL-UHFFFAOYSA-N 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000012256 powdered iron Substances 0.000 description 1
- MQDVUDAZJMZQMF-UHFFFAOYSA-N pyridin-2-ylurea Chemical compound NC(=O)NC1=CC=CC=N1 MQDVUDAZJMZQMF-UHFFFAOYSA-N 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- NLVFBUXFDBBNBW-PBSUHMDJSA-N tobramycin Chemical compound N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N NLVFBUXFDBBNBW-PBSUHMDJSA-N 0.000 description 1
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/70—Sulfur atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/28—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N<
- A01N47/36—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N< containing the group >N—CO—N< directly attached to at least one heterocyclic ring; Thio analogues thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C265/00—Derivatives of isocyanic acid
- C07C265/16—Derivatives of isocyanic acid having isocyanate groups acylated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/61—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/73—Unsubstituted amino or imino radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Pyridine Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US93872178A | 1978-08-31 | 1978-08-31 | |
| US05/938,722 US4173639A (en) | 1978-08-31 | 1978-08-31 | 1-Benzoyl-3-(alkoxy- or alkylthiopyridinyl)ureas |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS207698B2 true CS207698B2 (en) | 1981-08-31 |
Family
ID=27130114
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS795373A CS207698B2 (en) | 1978-08-31 | 1979-08-03 | Insecticide means and method of making the active substances |
Country Status (23)
| Country | Link |
|---|---|
| EP (1) | EP0008881A1 (pt) |
| AR (1) | AR225899A1 (pt) |
| AT (1) | AT365043B (pt) |
| AU (1) | AU523252B2 (pt) |
| BR (1) | BR7905038A (pt) |
| CH (1) | CH640834A5 (pt) |
| CS (1) | CS207698B2 (pt) |
| DD (1) | DD145221A5 (pt) |
| DK (1) | DK330079A (pt) |
| EG (1) | EG14602A (pt) |
| ES (1) | ES483162A1 (pt) |
| FI (1) | FI792416A7 (pt) |
| FR (1) | FR2434805A1 (pt) |
| GB (1) | GB2029411B (pt) |
| GR (1) | GR71911B (pt) |
| HU (1) | HU184625B (pt) |
| IL (1) | IL57862A (pt) |
| LU (1) | LU81577A1 (pt) |
| NZ (1) | NZ191048A (pt) |
| PL (1) | PL118629B1 (pt) |
| PT (1) | PT70038A (pt) |
| RO (1) | RO78871A (pt) |
| TR (1) | TR20629A (pt) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4281003A (en) * | 1978-08-31 | 1981-07-28 | Eli Lilly And Company | 1-(2-6-Dihalobenzoyl)-3-(5-substituted-2-pyridinyl)urea insecticides and insecticidal method |
| FI820573A7 (fi) * | 1981-03-03 | 1982-09-04 | Lilly Co Eli | 1-bentsoyyli-3-(aryylipyridyyli) ureayhdisteitä koskevia tai niihin liittyviä parannuksia. |
| DE3126263A1 (de) * | 1981-07-03 | 1983-01-20 | Basf Ag, 6700 Ludwigshafen | N-benzoyl-n'-pyridylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von schaedlingen |
| US5246961A (en) * | 1988-10-18 | 1993-09-21 | Fournier Industrie Et Sante | β-d-phenylthioxylosides, and their use as therapeutic agents |
| FR2638749B1 (fr) * | 1988-10-18 | 1993-10-15 | Fournier Innovation Synergie | Nouveaux (beta)-d-phenyl-thioxylosides, leur procede de preparation et leur utilisation en therapeutique |
| IE63544B1 (en) * | 1988-10-18 | 1995-05-17 | Fournier Ind & Sante | Novel Beta-d-phenylthioxylosides their method of preparation and their use in therapy |
| EP0407346A3 (en) * | 1989-07-07 | 1991-10-02 | Ciba-Geigy Ag | Aminopyridines |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE754832A (fr) * | 1969-08-14 | 1971-02-15 | Beecham Group Ltd | Iminazolines |
| NL160809C (nl) * | 1970-05-15 | 1979-12-17 | Duphar Int Res | Werkwijze ter bereiding van benzoylureumverbindingen, alsmede werkwijze ter bereiding van insekticide prepara- ten op basis van benzoylureumverbindingen. |
-
1979
- 1979-07-05 GR GR59780A patent/GR71911B/el unknown
- 1979-07-18 NZ NZ191048A patent/NZ191048A/xx unknown
- 1979-07-23 IL IL57862A patent/IL57862A/xx unknown
- 1979-07-25 AU AU49219/79A patent/AU523252B2/en not_active Ceased
- 1979-08-02 FR FR7919894A patent/FR2434805A1/fr active Granted
- 1979-08-03 CS CS795373A patent/CS207698B2/cs unknown
- 1979-08-03 FI FI792416A patent/FI792416A7/fi not_active Application Discontinuation
- 1979-08-06 ES ES483162A patent/ES483162A1/es not_active Expired
- 1979-08-06 LU LU81577A patent/LU81577A1/xx unknown
- 1979-08-06 CH CH721179A patent/CH640834A5/fr not_active IP Right Cessation
- 1979-08-06 RO RO7998381A patent/RO78871A/ro unknown
- 1979-08-06 PL PL1979217597A patent/PL118629B1/pl unknown
- 1979-08-06 AR AR277614A patent/AR225899A1/es active
- 1979-08-06 AT AT0536379A patent/AT365043B/de not_active IP Right Cessation
- 1979-08-06 EG EG480/79A patent/EG14602A/xx active
- 1979-08-06 EP EP79301585A patent/EP0008881A1/en not_active Ceased
- 1979-08-06 TR TR20629A patent/TR20629A/xx unknown
- 1979-08-06 BR BR7905038A patent/BR7905038A/pt unknown
- 1979-08-06 HU HU79EI874A patent/HU184625B/hu unknown
- 1979-08-06 DD DD79214826A patent/DD145221A5/de unknown
- 1979-08-06 DK DK330079A patent/DK330079A/da not_active Application Discontinuation
- 1979-08-06 GB GB7927286A patent/GB2029411B/en not_active Expired
- 1979-08-08 PT PT70038A patent/PT70038A/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| EP0008881A1 (en) | 1980-03-19 |
| IL57862A (en) | 1983-03-31 |
| NZ191048A (en) | 1981-07-13 |
| AU4921979A (en) | 1980-03-06 |
| AU523252B2 (en) | 1982-07-22 |
| FR2434805A1 (fr) | 1980-03-28 |
| FI792416A7 (fi) | 1981-01-01 |
| FR2434805B1 (pt) | 1983-04-01 |
| AT365043B (de) | 1981-12-10 |
| AR225899A1 (es) | 1982-05-14 |
| RO78871B (ro) | 1983-07-30 |
| ES483162A1 (es) | 1980-09-01 |
| PL118629B1 (en) | 1981-10-31 |
| DD145221A5 (de) | 1980-12-03 |
| CH640834A5 (fr) | 1984-01-31 |
| RO78871A (ro) | 1983-08-03 |
| EG14602A (en) | 1984-09-30 |
| DK330079A (da) | 1980-03-01 |
| ATA536379A (de) | 1981-05-15 |
| GB2029411A (en) | 1980-03-19 |
| LU81577A1 (fr) | 1979-12-07 |
| BR7905038A (pt) | 1980-05-06 |
| HU184625B (en) | 1984-09-28 |
| PT70038A (en) | 1979-09-01 |
| GB2029411B (en) | 1982-12-15 |
| PL217597A1 (pt) | 1980-05-19 |
| GR71911B (pt) | 1983-08-16 |
| IL57862A0 (en) | 1979-11-30 |
| TR20629A (tr) | 1982-03-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4331670A (en) | Pyridylanilines | |
| DE3789683T2 (de) | Fungizide. | |
| JP3157234B2 (ja) | 除草性カルボキシアミド誘導体 | |
| EP1204642B1 (en) | Fungicides | |
| US5840654A (en) | Herbicidal heterocyclic-substituted pyridines | |
| JPH05163249A (ja) | 殺菌性化合物、その製造方法及びそれを含有する殺菌剤組成物 | |
| JPH0672140B2 (ja) | 殺菌性化合物、その製造法及びそれを含有する殺菌剤組成物 | |
| DE69228492T2 (de) | 3,4,N-Trisubstituierte-4,5-dihydro-1H-Pyrazol-1-carboxamide und deren Anwendung als Insektizide | |
| JPS58206547A (ja) | 2,4−ジハロゲノベンゾイル−(チオ)尿素類、それらの製造方法、および害虫防除剤としてのそれらの使用 | |
| HU181862B (en) | Herbicide compositions and process for preparing alpha-(/pyridyl-oxy/-phenoxy/-propionic acid amino-ethyl esters | |
| SK609586A3 (en) | Semicarbazones and thiosemicarbazones | |
| JP2937402B2 (ja) | ジアミノエチレン誘導体、その製造法及びその殺虫組成物 | |
| JPH024566B2 (pt) | ||
| CS195710B2 (en) | Insecticide and method of producing active ingredients | |
| IE893445L (en) | Tetrahydropyrimidines, their production and use | |
| US5164396A (en) | Barbituric acid derivatives having insecticidal activity | |
| EP0103537A2 (de) | N-Arylsulfonyl-N'-triazolylharnstoffe | |
| US4441913A (en) | Substituted phenoxypropionates and herbicidal compositions | |
| WO1997024321A1 (en) | Aryl benzoyl urea derivative and pesticidal composition comprising the same | |
| EP0008881A1 (en) | 1-Benzoyl-3-pyridinyl ureas, their use as insecticides, their preparation and formulations containing them | |
| US4614536A (en) | Certain pyridyloxy-phenoxy-propionate derivatives, herbicidal compositions containing same and their herbicidal method of use | |
| EP0124052A1 (en) | Benzoyl-ureas exerting an insecticide activity | |
| AU619038B2 (en) | Oxime derivatives and herbicides containing the same as an active ingredient | |
| EP0336199A1 (de) | Azaneophyl- und Silazaneophylsulfide, Verfahren zu ihrer Herstellung, sie enthaltende Mittel und ihre Verwendung als Schädlingsbekämpfungsmittel | |
| JPH1087569A (ja) | ベンジルオキシ置換フェニル化合物 |