CS207592B2 - Method of bleaching the textiles - Google Patents
Method of bleaching the textiles Download PDFInfo
- Publication number
- CS207592B2 CS207592B2 CS781915A CS191578A CS207592B2 CS 207592 B2 CS207592 B2 CS 207592B2 CS 781915 A CS781915 A CS 781915A CS 191578 A CS191578 A CS 191578A CS 207592 B2 CS207592 B2 CS 207592B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- phthalocyanine
- water
- aluminum
- bleaching
- bath
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 32
- 238000004061 bleaching Methods 0.000 title claims abstract description 30
- 239000004753 textile Substances 0.000 title claims abstract description 13
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 claims abstract description 29
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 11
- 239000001301 oxygen Substances 0.000 claims abstract description 11
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 37
- HUVXQFBFIFIDDU-UHFFFAOYSA-N aluminum phthalocyanine Chemical compound [Al+3].C12=CC=CC=C2C(N=C2[N-]C(C3=CC=CC=C32)=N2)=NC1=NC([C]1C=CC=CC1=1)=NC=1N=C1[C]3C=CC=CC3=C2[N-]1 HUVXQFBFIFIDDU-UHFFFAOYSA-N 0.000 claims description 25
- 150000001875 compounds Chemical class 0.000 claims description 19
- 150000003839 salts Chemical class 0.000 claims description 15
- 239000003504 photosensitizing agent Substances 0.000 claims description 11
- 125000002843 carboxylic acid group Chemical group 0.000 claims 1
- 230000002165 photosensitisation Effects 0.000 claims 1
- 229910052782 aluminium Inorganic materials 0.000 abstract description 22
- 239000000203 mixture Substances 0.000 abstract description 20
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 abstract description 19
- 239000003599 detergent Substances 0.000 abstract description 16
- 239000004411 aluminium Substances 0.000 abstract 2
- 230000001678 irradiating effect Effects 0.000 abstract 2
- 239000004744 fabric Substances 0.000 description 31
- -1 piperiidiino Chemical group 0.000 description 18
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 17
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000002253 acid Substances 0.000 description 14
- 239000000243 solution Substances 0.000 description 13
- 238000005406 washing Methods 0.000 description 13
- 229920000742 Cotton Polymers 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 12
- 230000000694 effects Effects 0.000 description 12
- 229910052783 alkali metal Inorganic materials 0.000 description 11
- 125000000217 alkyl group Chemical group 0.000 description 11
- 239000001257 hydrogen Substances 0.000 description 11
- 229910052739 hydrogen Inorganic materials 0.000 description 11
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- 239000011780 sodium chloride Substances 0.000 description 9
- 238000006277 sulfonation reaction Methods 0.000 description 9
- 239000000725 suspension Substances 0.000 description 9
- 239000011701 zinc Substances 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 239000000460 chlorine Substances 0.000 description 8
- 150000002431 hydrogen Chemical class 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- 239000001049 brown dye Substances 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 244000269722 Thea sinensis Species 0.000 description 6
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 6
- 150000001340 alkali metals Chemical class 0.000 description 6
- 150000001450 anions Chemical class 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 6
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 6
- 229910052725 zinc Inorganic materials 0.000 description 6
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 239000007844 bleaching agent Substances 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 125000004966 cyanoalkyl group Chemical group 0.000 description 4
- 239000000975 dye Substances 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000006467 substitution reaction Methods 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 239000007853 buffer solution Substances 0.000 description 3
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical class CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 3
- 238000004043 dyeing Methods 0.000 description 3
- 150000002191 fatty alcohols Chemical class 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 125000001188 haloalkyl group Chemical group 0.000 description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 125000004964 sulfoalkyl group Chemical group 0.000 description 3
- 150000003460 sulfonic acids Chemical class 0.000 description 3
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- IUVCFHHAEHNCFT-INIZCTEOSA-N 2-[(1s)-1-[4-amino-3-(3-fluoro-4-propan-2-yloxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-6-fluoro-3-(3-fluorophenyl)chromen-4-one Chemical compound C1=C(F)C(OC(C)C)=CC=C1C(C1=C(N)N=CN=C11)=NN1[C@@H](C)C1=C(C=2C=C(F)C=CC=2)C(=O)C2=CC(F)=CC=C2O1 IUVCFHHAEHNCFT-INIZCTEOSA-N 0.000 description 2
- GELVZYOEQVJIRR-UHFFFAOYSA-N 2-chloropyrazine Chemical compound ClC1=CN=CC=N1 GELVZYOEQVJIRR-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 241000795633 Olea <sea slug> Species 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- APUPEJJSWDHEBO-UHFFFAOYSA-P ammonium molybdate Chemical compound [NH4+].[NH4+].[O-][Mo]([O-])(=O)=O APUPEJJSWDHEBO-UHFFFAOYSA-P 0.000 description 2
- 239000011609 ammonium molybdate Substances 0.000 description 2
- 235000018660 ammonium molybdate Nutrition 0.000 description 2
- 229940010552 ammonium molybdate Drugs 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 125000004181 carboxyalkyl group Chemical group 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 239000003792 electrolyte Substances 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 150000002505 iron Chemical class 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 239000001007 phthalocyanine dye Substances 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 235000019832 sodium triphosphate Nutrition 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- ARCGXLSVLAOJQL-UHFFFAOYSA-N trimellitic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C(C(O)=O)=C1 ARCGXLSVLAOJQL-UHFFFAOYSA-N 0.000 description 2
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 1
- YRIZYWQGELRKNT-UHFFFAOYSA-N 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione Chemical compound ClN1C(=O)N(Cl)C(=O)N(Cl)C1=O YRIZYWQGELRKNT-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- UNCQVRBWJWWJBF-UHFFFAOYSA-N 2-chloropyrimidine Chemical compound ClC1=NC=CC=N1 UNCQVRBWJWWJBF-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical class OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 239000004166 Lanolin Substances 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 206010034972 Photosensitivity reaction Diseases 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 235000009499 Vanilla fragrans Nutrition 0.000 description 1
- 244000263375 Vanilla tahitensis Species 0.000 description 1
- 235000012036 Vanilla tahitensis Nutrition 0.000 description 1
- QSSKWNQTLVMTAT-UHFFFAOYSA-N [Cl].C1=CN=NN=C1 Chemical compound [Cl].C1=CN=NN=C1 QSSKWNQTLVMTAT-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910052910 alkali metal silicate Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000004599 antimicrobial Substances 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 238000010936 aqueous wash Methods 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 238000005282 brightening Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004737 colorimetric analysis Methods 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- HKYGSMOFSFOEIP-UHFFFAOYSA-N dichloro(dichloromethoxy)methane Chemical compound ClC(Cl)OC(Cl)Cl HKYGSMOFSFOEIP-UHFFFAOYSA-N 0.000 description 1
- CEJLBZWIKQJOAT-UHFFFAOYSA-N dichloroisocyanuric acid Chemical compound ClN1C(=O)NC(=O)N(Cl)C1=O CEJLBZWIKQJOAT-UHFFFAOYSA-N 0.000 description 1
- IUNMPGNGSSIWFP-UHFFFAOYSA-N dimethylaminopropylamine Chemical compound CN(C)CCCN IUNMPGNGSSIWFP-UHFFFAOYSA-N 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical class O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- UQGFMSUEHSUPRD-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane Chemical compound [Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 UQGFMSUEHSUPRD-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000004872 foam stabilizing agent Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000000232 haloalkynyl group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229940039717 lanolin Drugs 0.000 description 1
- 235000019388 lanolin Nutrition 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000010446 mirabilite Substances 0.000 description 1
- 229910000402 monopotassium phosphate Inorganic materials 0.000 description 1
- 235000019796 monopotassium phosphate Nutrition 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- CTYRPMDGLDAWRQ-UHFFFAOYSA-N phenyl hydrogen sulfate Chemical compound OS(=O)(=O)OC1=CC=CC=C1 CTYRPMDGLDAWRQ-UHFFFAOYSA-N 0.000 description 1
- PJNZPQUBCPKICU-UHFFFAOYSA-N phosphoric acid;potassium Chemical compound [K].OP(O)(O)=O PJNZPQUBCPKICU-UHFFFAOYSA-N 0.000 description 1
- 238000013032 photocatalytic reaction Methods 0.000 description 1
- XQZYPMVTSDWCCE-UHFFFAOYSA-N phthalonitrile Chemical class N#CC1=CC=CC=C1C#N XQZYPMVTSDWCCE-UHFFFAOYSA-N 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001012 protector Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- DSYVTLPHGJLVKD-UHFFFAOYSA-M sodium 1,5-dimethylcyclohexa-2,4-diene-1-sulfonate Chemical compound [Na+].C1(CC(=CC=C1)C)(C)S(=O)(=O)[O-] DSYVTLPHGJLVKD-UHFFFAOYSA-M 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- RSIJVJUOQBWMIM-UHFFFAOYSA-L sodium sulfate decahydrate Chemical compound O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].[O-]S([O-])(=O)=O RSIJVJUOQBWMIM-UHFFFAOYSA-L 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- HFQQZARZPUDIFP-UHFFFAOYSA-M sodium;2-dodecylbenzenesulfonate Chemical compound [Na+].CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O HFQQZARZPUDIFP-UHFFFAOYSA-M 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- DIORMHZUUKOISG-UHFFFAOYSA-N sulfoformic acid Chemical class OC(=O)S(O)(=O)=O DIORMHZUUKOISG-UHFFFAOYSA-N 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 150000003459 sulfonic acid esters Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- UEUXEKPTXMALOB-UHFFFAOYSA-J tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O UEUXEKPTXMALOB-UHFFFAOYSA-J 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- KRURGYOKPVLRHQ-UHFFFAOYSA-N trithionic acid Chemical class OS(=O)(=O)SS(O)(=O)=O KRURGYOKPVLRHQ-UHFFFAOYSA-N 0.000 description 1
- 230000002087 whitening effect Effects 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
- 150000003752 zinc compounds Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/40—Dyes ; Pigments
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/0005—Other compounding ingredients characterised by their effect
- C11D3/0063—Photo- activating compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Coloring (AREA)
- Chemical Or Physical Treatment Of Fibers (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH381077A CH630127A5 (de) | 1977-03-25 | 1977-03-25 | Verfahren zum bleichen von textilien. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS207592B2 true CS207592B2 (en) | 1981-08-31 |
Family
ID=4263941
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS781915A CS207592B2 (en) | 1977-03-25 | 1978-03-24 | Method of bleaching the textiles |
Country Status (32)
| Country | Link |
|---|---|
| US (1) | US4166718A (tr) |
| JP (1) | JPS53119381A (tr) |
| AR (1) | AR217682A1 (tr) |
| AU (1) | AU515088B2 (tr) |
| BE (1) | BE865292A (tr) |
| BR (1) | BR7801807A (tr) |
| CA (1) | CA1110947A (tr) |
| CH (1) | CH630127A5 (tr) |
| CS (1) | CS207592B2 (tr) |
| DD (1) | DD135630A5 (tr) |
| DE (1) | DE2812278A1 (tr) |
| DO (1) | DOP1984004248A (tr) |
| EG (1) | EG13176A (tr) |
| ES (1) | ES468124A1 (tr) |
| FR (1) | FR2384882A1 (tr) |
| GB (1) | GB1589652A (tr) |
| GR (1) | GR71702B (tr) |
| HK (1) | HK49984A (tr) |
| IL (1) | IL54341A0 (tr) |
| IN (1) | IN148118B (tr) |
| KE (1) | KE3387A (tr) |
| MX (2) | MX174092B (tr) |
| NL (1) | NL7803093A (tr) |
| NZ (1) | NZ186780A (tr) |
| PH (1) | PH14523A (tr) |
| PT (1) | PT67804A (tr) |
| RO (1) | RO84975B (tr) |
| SG (1) | SG18984G (tr) |
| SU (1) | SU818494A3 (tr) |
| TR (1) | TR19904A (tr) |
| YU (1) | YU69578A (tr) |
| ZA (1) | ZA781709B (tr) |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4256598A (en) * | 1978-01-11 | 1981-03-17 | The Procter & Gamble Company | Composition for combined washing and bleaching of fabrics |
| EP0003149A3 (en) * | 1978-01-11 | 1979-08-22 | THE PROCTER & GAMBLE COMPANY | Composition containing a photoactivator for improved washing and bleaching of fabrics |
| GR66580B (tr) | 1978-01-11 | 1981-03-27 | Procter & Gamble | |
| CA1104451A (en) | 1978-02-28 | 1981-07-07 | Manuel Juan De Luque | Detergent bleach composition and process |
| IN153407B (tr) * | 1979-09-28 | 1984-07-14 | Ciba Geigy Ag | |
| MX155643A (es) * | 1980-02-29 | 1988-04-11 | Ciba Geigy Ag | Composicion blanqueadora de telas |
| US4394125A (en) * | 1980-09-09 | 1983-07-19 | Ciba-Geigy Corporation | Process for bleaching textiles and for combating micro-organisms with sulfonated phthalocyanine of aluminum or zinc and containing halogen or cyano substituents as photoactivator |
| JPS5792095A (en) * | 1980-12-01 | 1982-06-08 | Kao Corp | Bleaching agent composition |
| EP0054992B1 (en) * | 1980-12-22 | 1985-03-20 | Unilever N.V. | Composition containing a photo-activator for improved bleaching |
| GR78065B (tr) * | 1982-02-19 | 1984-09-26 | Unilever Nv | |
| CH654121A5 (de) * | 1983-03-25 | 1986-01-31 | Ciba Geigy Ag | Verfahren zur herstellung von festen photoaktivatorpraeparaten. |
| CH654424A5 (de) * | 1983-03-25 | 1986-02-14 | Ciba Geigy Ag | Verfahren zur verhinderung des gelierens von konzentrierten waessrigen photoaktivatorloesungen. |
| CH657864A5 (de) * | 1984-02-17 | 1986-09-30 | Ciba Geigy Ag | Wasserloesliche phthalocyaninverbindungen und deren verwendung als photoaktivatoren. |
| CH658771A5 (de) * | 1984-05-28 | 1986-12-15 | Ciba Geigy Ag | Azaphthalocyanine und deren verwendung als photoaktivatoren. |
| GB8900807D0 (en) * | 1989-01-14 | 1989-03-08 | British Petroleum Co Plc | Bleach compositions |
| DE4230656A1 (de) * | 1992-09-14 | 1994-03-17 | Ciba Geigy | Verfahren zur Verbesserung von Weissgrad, Helligkeit und Farbort von Füllstoffen und Pigmenten |
| US5847111A (en) * | 1994-06-15 | 1998-12-08 | Clariant Finance (Bvi) Limited | Aluminum phthalocyanine reactive dyes |
| DE19521056A1 (de) * | 1994-06-15 | 1995-12-21 | Sandoz Ag | Aluminium Phthalocyanin Reaktivfarbstoffe |
| MX9701631A (es) * | 1994-08-30 | 1997-06-28 | Procter & Gamble | Fotoblanqueamiento mejorado a partir de quelatadores. |
| US5679661A (en) * | 1995-07-25 | 1997-10-21 | The Procter & Gamble Company | Low hue photodisinfectants |
| US5916481A (en) * | 1995-07-25 | 1999-06-29 | The Procter & Gamble Company | Low hue photobleaches |
| DE19529853A1 (de) * | 1995-08-14 | 1997-02-20 | Bayer Ag | Aluminium-Phthalocyanin-Reaktivfarbstoffe |
| WO1998032828A2 (en) * | 1997-01-24 | 1998-07-30 | The Procter & Gamble Company | Photochemical singlet oxygen generators having cationic substantivity modifiers |
| CN1250471A (zh) | 1997-01-24 | 2000-04-12 | 普罗格特-甘布尔公司 | 单态氧产率增大的光化学单态氧发生剂 |
| BR9807507A (pt) | 1997-01-24 | 2000-03-21 | Procter & Gamble | Geradores de superóxido fotoquìmico |
| BR9808577A (pt) | 1997-01-24 | 2000-05-02 | Procter & Gamble | Geradores de oxigênio singleto tendo melhorado efeito de átomo pesado. |
| JP2001511198A (ja) * | 1997-01-24 | 2001-08-07 | ザ、プロクター、エンド、ギャンブル、カンパニー | 混合メタロシアニンを含んだ光漂白組成物 |
| ATE241688T1 (de) | 1997-01-24 | 2003-06-15 | Univ Case Western Reserve | Photobleichzusammensetzungen mit wirkung auf angeschmutzte gewebe |
| WO1998032832A1 (en) | 1997-01-24 | 1998-07-30 | The Procter & Gamble Company | Low hue photobleaches |
| US20040055965A1 (en) * | 1997-06-13 | 2004-03-25 | Hubig Stephan M. | Recreational water treatment employing singlet oxygen |
| US20030194433A1 (en) * | 2002-03-12 | 2003-10-16 | Ecolab | Antimicrobial compositions, methods and articles employing singlet oxygen- generating agent |
| NZ331196A (en) | 1997-08-15 | 2000-01-28 | Ciba Sc Holding Ag | Water soluble fabric softener compositions comprising phthalocyanine, a quaternary ammonium compound and a photobleaching agent |
| US20070020300A1 (en) * | 2002-03-12 | 2007-01-25 | Ecolab Inc. | Recreational water treatment employing singlet oxygen |
| CN1320090C (zh) * | 2002-09-04 | 2007-06-06 | 西巴特殊化学品控股有限公司 | 包含水溶性颗粒的制剂 |
| ES2703553T3 (es) | 2015-01-13 | 2019-03-11 | Henkel Ag & Co Kgaa | Composición detergente líquida |
| EP3805346B1 (en) * | 2019-10-08 | 2024-08-14 | The Procter & Gamble Company | A method of laundering fabric |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1408144A (en) * | 1972-06-02 | 1975-10-01 | Procter & Gamble Ltd | Bleaching process |
| GB1372035A (en) | 1971-05-12 | 1974-10-30 | Procter & Gamble Ltd | Bleaching process |
| US3969387A (en) * | 1972-12-29 | 1976-07-13 | Merkl George | Metalic-organo-peroxide and organo-metalic-peroxide and preparation thereof |
| US4033718A (en) * | 1973-11-27 | 1977-07-05 | The Procter & Gamble Company | Photoactivated bleaching process |
| CA1064797A (en) | 1975-04-03 | 1979-10-23 | Brandon H. Wiers | Photoactivated bleach-compositions and process |
-
1977
- 1977-03-25 CH CH381077A patent/CH630127A5/de not_active IP Right Cessation
-
1978
- 1978-03-20 FR FR7807991A patent/FR2384882A1/fr active Granted
- 1978-03-20 DD DD78204286A patent/DD135630A5/xx unknown
- 1978-03-20 US US05/888,593 patent/US4166718A/en not_active Expired - Lifetime
- 1978-03-21 DE DE19782812278 patent/DE2812278A1/de not_active Ceased
- 1978-03-21 PT PT67804A patent/PT67804A/pt unknown
- 1978-03-21 MX MX010302A patent/MX174092B/es unknown
- 1978-03-22 BR BR7801807A patent/BR7801807A/pt unknown
- 1978-03-22 ES ES468124A patent/ES468124A1/es not_active Expired
- 1978-03-22 PH PH20924A patent/PH14523A/en unknown
- 1978-03-22 NL NL7803093A patent/NL7803093A/xx not_active Application Discontinuation
- 1978-03-22 AR AR271504A patent/AR217682A1/es active
- 1978-03-22 IN IN314/CAL/78A patent/IN148118B/en unknown
- 1978-03-23 CA CA299,732A patent/CA1110947A/en not_active Expired
- 1978-03-23 GB GB11798/78A patent/GB1589652A/en not_active Expired
- 1978-03-23 GR GR55784A patent/GR71702B/el unknown
- 1978-03-23 NZ NZ186780A patent/NZ186780A/xx unknown
- 1978-03-23 TR TR19904A patent/TR19904A/tr unknown
- 1978-03-23 AU AU34453/78A patent/AU515088B2/en not_active Expired
- 1978-03-23 IL IL54341A patent/IL54341A0/xx not_active IP Right Cessation
- 1978-03-23 YU YU00695/78A patent/YU69578A/xx unknown
- 1978-03-23 ZA ZA00781709A patent/ZA781709B/xx unknown
- 1978-03-24 CS CS781915A patent/CS207592B2/cs unknown
- 1978-03-24 BE BE186248A patent/BE865292A/xx not_active IP Right Cessation
- 1978-03-24 SU SU782596899A patent/SU818494A3/ru active
- 1978-03-25 RO RO93626A patent/RO84975B/ro unknown
- 1978-03-25 JP JP3365178A patent/JPS53119381A/ja active Granted
- 1978-03-25 EG EG201/78A patent/EG13176A/xx active
- 1978-03-27 MX MX172851A patent/MX149606A/es unknown
-
1984
- 1984-02-29 SG SG189/84A patent/SG18984G/en unknown
- 1984-03-20 KE KE3387A patent/KE3387A/xx unknown
- 1984-06-12 DO DO1984004248A patent/DOP1984004248A/es unknown
- 1984-06-14 HK HK499/84A patent/HK49984A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS53119381A (en) | 1978-10-18 |
| JPS6214669B2 (tr) | 1987-04-03 |
| US4166718A (en) | 1979-09-04 |
| CH630127A5 (de) | 1982-05-28 |
| IN148118B (tr) | 1980-10-25 |
| NL7803093A (nl) | 1978-09-27 |
| SG18984G (en) | 1985-01-04 |
| RO84975A (ro) | 1984-08-17 |
| NZ186780A (en) | 1980-11-14 |
| HK49984A (en) | 1984-06-22 |
| PH14523A (en) | 1981-08-26 |
| FR2384882B1 (tr) | 1980-06-13 |
| SU818494A3 (ru) | 1981-03-30 |
| GR71702B (tr) | 1983-06-21 |
| BR7801807A (pt) | 1978-12-19 |
| MX174092B (es) | 1994-04-21 |
| GB1589652A (en) | 1981-05-20 |
| KE3387A (en) | 1984-05-25 |
| EG13176A (en) | 1980-12-31 |
| PT67804A (en) | 1978-04-01 |
| FR2384882A1 (fr) | 1978-10-20 |
| TR19904A (tr) | 1980-04-28 |
| CA1110947A (en) | 1981-10-20 |
| YU69578A (en) | 1983-01-21 |
| IL54341A0 (en) | 1978-06-15 |
| AU515088B2 (en) | 1981-03-12 |
| DE2812278A1 (de) | 1978-09-28 |
| AR217682A1 (es) | 1980-04-15 |
| DOP1984004248A (es) | 1989-10-05 |
| ES468124A1 (es) | 1979-01-16 |
| BE865292A (fr) | 1978-09-25 |
| MX149606A (es) | 1983-12-01 |
| RO84975B (ro) | 1984-09-30 |
| ZA781709B (en) | 1979-03-28 |
| DD135630A5 (de) | 1979-05-16 |
| AU3445378A (en) | 1979-09-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS207592B2 (en) | Method of bleaching the textiles | |
| US4648992A (en) | Water-soluble phthalocyanine compounds | |
| US4318883A (en) | Process for combating micro-organisms, and novel phthalocyanine compounds | |
| FI67884C (fi) | Porfinfotoaktivator innehaollande blekningskomposition | |
| GB2159516A (en) | Azaphthalocyanines and their use as photoactivators | |
| JPH01198667A (ja) | フタロシアニン化合物 | |
| CA1128258A (en) | Composition for combined washing and bleaching of fabrics | |
| CS214758B2 (en) | Means for ammelioration of appearance of used and especially dirty textiles | |
| DK158160B (da) | Fremgangsmaade til blegning af tekstiler, herunder blegende pletfjernelse fra tekstiler samt et blegemiddel, herunder blegende pletfjernelsesmiddel | |
| US4497741A (en) | Water-soluble zinc and aluminium phthalocyanines | |
| JPH06107662A (ja) | 一重項酸素を発生させるための置換フタロシアニンおよびそのスルホン化誘導体、ならびに繊維から汚れを除去する方法 | |
| EP0003371A1 (en) | Composition containing a cationic substance and a photoactivator for improved washing and bleaching of fabrics | |
| CA1125957A (en) | Composition for combined washing and bleaching of fabrics | |
| JPS5858396B2 (ja) | 布類を洗濯しかつ漂白するための組成物 | |
| US4566874A (en) | Water-soluble zinc and aluminium phthalocyanines and use thereof as photoactivators | |
| US5484915A (en) | Sulphonated manganese phthalocyanines and compositions thereof | |
| GB2279657A (en) | Phthalocyanines | |
| EP0395588B1 (de) | Dibenzofuranylbiphenyle | |
| US3410847A (en) | 4-(5, 6-di-substituted oxy benzotriazole-2-yl) stilbenesulfonic acid brighteners and ethods for making same | |
| MXPA98006552A (en) | Softening composition for te | |
| DK159396B (da) | Sulfonerede zink- og aluminiumphthalocyaninforbindelser samt deres fremstilling |