CS207592B2 - Method of bleaching the textiles - Google Patents
Method of bleaching the textiles Download PDFInfo
- Publication number
- CS207592B2 CS207592B2 CS781915A CS191578A CS207592B2 CS 207592 B2 CS207592 B2 CS 207592B2 CS 781915 A CS781915 A CS 781915A CS 191578 A CS191578 A CS 191578A CS 207592 B2 CS207592 B2 CS 207592B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- phthalocyanine
- water
- aluminum
- bleaching
- bath
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 32
- 238000004061 bleaching Methods 0.000 title claims abstract description 30
- 239000004753 textile Substances 0.000 title claims abstract description 13
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 claims abstract description 29
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 11
- 239000001301 oxygen Substances 0.000 claims abstract description 11
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 37
- HUVXQFBFIFIDDU-UHFFFAOYSA-N aluminum phthalocyanine Chemical compound [Al+3].C12=CC=CC=C2C(N=C2[N-]C(C3=CC=CC=C32)=N2)=NC1=NC([C]1C=CC=CC1=1)=NC=1N=C1[C]3C=CC=CC3=C2[N-]1 HUVXQFBFIFIDDU-UHFFFAOYSA-N 0.000 claims description 25
- 150000001875 compounds Chemical class 0.000 claims description 19
- 150000003839 salts Chemical class 0.000 claims description 15
- 239000003504 photosensitizing agent Substances 0.000 claims description 11
- 125000002843 carboxylic acid group Chemical group 0.000 claims 1
- 230000002165 photosensitisation Effects 0.000 claims 1
- 229910052782 aluminium Inorganic materials 0.000 abstract description 22
- 239000000203 mixture Substances 0.000 abstract description 20
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 abstract description 19
- 239000003599 detergent Substances 0.000 abstract description 16
- 239000004411 aluminium Substances 0.000 abstract 2
- 230000001678 irradiating effect Effects 0.000 abstract 2
- 239000004744 fabric Substances 0.000 description 31
- -1 piperiidiino Chemical group 0.000 description 18
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 17
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000002253 acid Substances 0.000 description 14
- 239000000243 solution Substances 0.000 description 13
- 238000005406 washing Methods 0.000 description 13
- 229920000742 Cotton Polymers 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 12
- 230000000694 effects Effects 0.000 description 12
- 229910052783 alkali metal Inorganic materials 0.000 description 11
- 125000000217 alkyl group Chemical group 0.000 description 11
- 239000001257 hydrogen Substances 0.000 description 11
- 229910052739 hydrogen Inorganic materials 0.000 description 11
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- 239000011780 sodium chloride Substances 0.000 description 9
- 238000006277 sulfonation reaction Methods 0.000 description 9
- 239000000725 suspension Substances 0.000 description 9
- 239000011701 zinc Substances 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 239000000460 chlorine Substances 0.000 description 8
- 150000002431 hydrogen Chemical class 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- 239000001049 brown dye Substances 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 244000269722 Thea sinensis Species 0.000 description 6
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 6
- 150000001340 alkali metals Chemical class 0.000 description 6
- 150000001450 anions Chemical class 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 6
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 6
- 229910052725 zinc Inorganic materials 0.000 description 6
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 239000007844 bleaching agent Substances 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 125000004966 cyanoalkyl group Chemical group 0.000 description 4
- 239000000975 dye Substances 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000006467 substitution reaction Methods 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 239000007853 buffer solution Substances 0.000 description 3
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical class CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 3
- 238000004043 dyeing Methods 0.000 description 3
- 150000002191 fatty alcohols Chemical class 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 125000001188 haloalkyl group Chemical group 0.000 description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 125000004964 sulfoalkyl group Chemical group 0.000 description 3
- 150000003460 sulfonic acids Chemical class 0.000 description 3
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- IUVCFHHAEHNCFT-INIZCTEOSA-N 2-[(1s)-1-[4-amino-3-(3-fluoro-4-propan-2-yloxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-6-fluoro-3-(3-fluorophenyl)chromen-4-one Chemical compound C1=C(F)C(OC(C)C)=CC=C1C(C1=C(N)N=CN=C11)=NN1[C@@H](C)C1=C(C=2C=C(F)C=CC=2)C(=O)C2=CC(F)=CC=C2O1 IUVCFHHAEHNCFT-INIZCTEOSA-N 0.000 description 2
- GELVZYOEQVJIRR-UHFFFAOYSA-N 2-chloropyrazine Chemical compound ClC1=CN=CC=N1 GELVZYOEQVJIRR-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 241000795633 Olea <sea slug> Species 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- APUPEJJSWDHEBO-UHFFFAOYSA-P ammonium molybdate Chemical compound [NH4+].[NH4+].[O-][Mo]([O-])(=O)=O APUPEJJSWDHEBO-UHFFFAOYSA-P 0.000 description 2
- 239000011609 ammonium molybdate Substances 0.000 description 2
- 235000018660 ammonium molybdate Nutrition 0.000 description 2
- 229940010552 ammonium molybdate Drugs 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 125000004181 carboxyalkyl group Chemical group 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 239000003792 electrolyte Substances 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 150000002505 iron Chemical class 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 239000001007 phthalocyanine dye Substances 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 235000019832 sodium triphosphate Nutrition 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- ARCGXLSVLAOJQL-UHFFFAOYSA-N trimellitic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C(C(O)=O)=C1 ARCGXLSVLAOJQL-UHFFFAOYSA-N 0.000 description 2
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 1
- YRIZYWQGELRKNT-UHFFFAOYSA-N 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione Chemical compound ClN1C(=O)N(Cl)C(=O)N(Cl)C1=O YRIZYWQGELRKNT-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- UNCQVRBWJWWJBF-UHFFFAOYSA-N 2-chloropyrimidine Chemical compound ClC1=NC=CC=N1 UNCQVRBWJWWJBF-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical class OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 239000004166 Lanolin Substances 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 206010034972 Photosensitivity reaction Diseases 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 235000009499 Vanilla fragrans Nutrition 0.000 description 1
- 244000263375 Vanilla tahitensis Species 0.000 description 1
- 235000012036 Vanilla tahitensis Nutrition 0.000 description 1
- QSSKWNQTLVMTAT-UHFFFAOYSA-N [Cl].C1=CN=NN=C1 Chemical compound [Cl].C1=CN=NN=C1 QSSKWNQTLVMTAT-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910052910 alkali metal silicate Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000004599 antimicrobial Substances 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 238000010936 aqueous wash Methods 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 238000005282 brightening Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004737 colorimetric analysis Methods 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- HKYGSMOFSFOEIP-UHFFFAOYSA-N dichloro(dichloromethoxy)methane Chemical compound ClC(Cl)OC(Cl)Cl HKYGSMOFSFOEIP-UHFFFAOYSA-N 0.000 description 1
- CEJLBZWIKQJOAT-UHFFFAOYSA-N dichloroisocyanuric acid Chemical compound ClN1C(=O)NC(=O)N(Cl)C1=O CEJLBZWIKQJOAT-UHFFFAOYSA-N 0.000 description 1
- IUNMPGNGSSIWFP-UHFFFAOYSA-N dimethylaminopropylamine Chemical compound CN(C)CCCN IUNMPGNGSSIWFP-UHFFFAOYSA-N 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical class O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- UQGFMSUEHSUPRD-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane Chemical compound [Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 UQGFMSUEHSUPRD-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000004872 foam stabilizing agent Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000000232 haloalkynyl group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229940039717 lanolin Drugs 0.000 description 1
- 235000019388 lanolin Nutrition 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000010446 mirabilite Substances 0.000 description 1
- 229910000402 monopotassium phosphate Inorganic materials 0.000 description 1
- 235000019796 monopotassium phosphate Nutrition 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- CTYRPMDGLDAWRQ-UHFFFAOYSA-N phenyl hydrogen sulfate Chemical compound OS(=O)(=O)OC1=CC=CC=C1 CTYRPMDGLDAWRQ-UHFFFAOYSA-N 0.000 description 1
- PJNZPQUBCPKICU-UHFFFAOYSA-N phosphoric acid;potassium Chemical compound [K].OP(O)(O)=O PJNZPQUBCPKICU-UHFFFAOYSA-N 0.000 description 1
- 238000013032 photocatalytic reaction Methods 0.000 description 1
- XQZYPMVTSDWCCE-UHFFFAOYSA-N phthalonitrile Chemical class N#CC1=CC=CC=C1C#N XQZYPMVTSDWCCE-UHFFFAOYSA-N 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001012 protector Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- DSYVTLPHGJLVKD-UHFFFAOYSA-M sodium 1,5-dimethylcyclohexa-2,4-diene-1-sulfonate Chemical compound [Na+].C1(CC(=CC=C1)C)(C)S(=O)(=O)[O-] DSYVTLPHGJLVKD-UHFFFAOYSA-M 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- RSIJVJUOQBWMIM-UHFFFAOYSA-L sodium sulfate decahydrate Chemical compound O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].[O-]S([O-])(=O)=O RSIJVJUOQBWMIM-UHFFFAOYSA-L 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- HFQQZARZPUDIFP-UHFFFAOYSA-M sodium;2-dodecylbenzenesulfonate Chemical compound [Na+].CCCCCCCCCCCCC1=CC=CC=C1S([O-])(=O)=O HFQQZARZPUDIFP-UHFFFAOYSA-M 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- DIORMHZUUKOISG-UHFFFAOYSA-N sulfoformic acid Chemical class OC(=O)S(O)(=O)=O DIORMHZUUKOISG-UHFFFAOYSA-N 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 150000003459 sulfonic acid esters Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- UEUXEKPTXMALOB-UHFFFAOYSA-J tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O UEUXEKPTXMALOB-UHFFFAOYSA-J 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- KRURGYOKPVLRHQ-UHFFFAOYSA-N trithionic acid Chemical class OS(=O)(=O)SS(O)(=O)=O KRURGYOKPVLRHQ-UHFFFAOYSA-N 0.000 description 1
- 230000002087 whitening effect Effects 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
- 150000003752 zinc compounds Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/40—Dyes ; Pigments
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/0005—Other compounding ingredients characterised by their effect
- C11D3/0063—Photo- activating compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Coloring (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
- Chemical Or Physical Treatment Of Fibers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH381077A CH630127A5 (de) | 1977-03-25 | 1977-03-25 | Verfahren zum bleichen von textilien. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS207592B2 true CS207592B2 (en) | 1981-08-31 |
Family
ID=4263941
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS781915A CS207592B2 (en) | 1977-03-25 | 1978-03-24 | Method of bleaching the textiles |
Country Status (32)
| Country | Link |
|---|---|
| US (1) | US4166718A (el) |
| JP (1) | JPS53119381A (el) |
| AR (1) | AR217682A1 (el) |
| AU (1) | AU515088B2 (el) |
| BE (1) | BE865292A (el) |
| BR (1) | BR7801807A (el) |
| CA (1) | CA1110947A (el) |
| CH (1) | CH630127A5 (el) |
| CS (1) | CS207592B2 (el) |
| DD (1) | DD135630A5 (el) |
| DE (1) | DE2812278A1 (el) |
| DO (1) | DOP1984004248A (el) |
| EG (1) | EG13176A (el) |
| ES (1) | ES468124A1 (el) |
| FR (1) | FR2384882A1 (el) |
| GB (1) | GB1589652A (el) |
| GR (1) | GR71702B (el) |
| HK (1) | HK49984A (el) |
| IL (1) | IL54341A0 (el) |
| IN (1) | IN148118B (el) |
| KE (1) | KE3387A (el) |
| MX (2) | MX174092B (el) |
| NL (1) | NL7803093A (el) |
| NZ (1) | NZ186780A (el) |
| PH (1) | PH14523A (el) |
| PT (1) | PT67804A (el) |
| RO (1) | RO84975B (el) |
| SG (1) | SG18984G (el) |
| SU (1) | SU818494A3 (el) |
| TR (1) | TR19904A (el) |
| YU (1) | YU69578A (el) |
| ZA (1) | ZA781709B (el) |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0003371A1 (en) | 1978-01-11 | 1979-08-08 | THE PROCTER & GAMBLE COMPANY | Composition containing a cationic substance and a photoactivator for improved washing and bleaching of fabrics |
| US4256598A (en) * | 1978-01-11 | 1981-03-17 | The Procter & Gamble Company | Composition for combined washing and bleaching of fabrics |
| GR65653B (en) * | 1978-01-11 | 1980-10-16 | Procter & Gamble | Composition for combined washing and whitening cloths |
| CA1104451A (en) | 1978-02-28 | 1981-07-07 | Manuel Juan De Luque | Detergent bleach composition and process |
| IN153407B (el) * | 1979-09-28 | 1984-07-14 | Ciba Geigy Ag | |
| MX155643A (es) * | 1980-02-29 | 1988-04-11 | Ciba Geigy Ag | Composicion blanqueadora de telas |
| US4394125A (en) * | 1980-09-09 | 1983-07-19 | Ciba-Geigy Corporation | Process for bleaching textiles and for combating micro-organisms with sulfonated phthalocyanine of aluminum or zinc and containing halogen or cyano substituents as photoactivator |
| JPS5792095A (en) * | 1980-12-01 | 1982-06-08 | Kao Corp | Bleaching agent composition |
| ATE12254T1 (de) * | 1980-12-22 | 1985-04-15 | Unilever Nv | Einen photoaktivator enthaltende zusammensetzung mit verbesserter bleichwirkung. |
| GR78065B (el) * | 1982-02-19 | 1984-09-26 | Unilever Nv | |
| CH654424A5 (de) * | 1983-03-25 | 1986-02-14 | Ciba Geigy Ag | Verfahren zur verhinderung des gelierens von konzentrierten waessrigen photoaktivatorloesungen. |
| CH654121A5 (de) * | 1983-03-25 | 1986-01-31 | Ciba Geigy Ag | Verfahren zur herstellung von festen photoaktivatorpraeparaten. |
| CH657864A5 (de) * | 1984-02-17 | 1986-09-30 | Ciba Geigy Ag | Wasserloesliche phthalocyaninverbindungen und deren verwendung als photoaktivatoren. |
| CH658771A5 (de) * | 1984-05-28 | 1986-12-15 | Ciba Geigy Ag | Azaphthalocyanine und deren verwendung als photoaktivatoren. |
| GB8900807D0 (en) * | 1989-01-14 | 1989-03-08 | British Petroleum Co Plc | Bleach compositions |
| DE4230656A1 (de) * | 1992-09-14 | 1994-03-17 | Ciba Geigy | Verfahren zur Verbesserung von Weissgrad, Helligkeit und Farbort von Füllstoffen und Pigmenten |
| CH688935A5 (de) * | 1994-06-15 | 1998-06-15 | Clariant Finance Bvi Ltd | Aluminium-Phthalocyanin-Reaktivfarbstoffe. |
| US5847111A (en) * | 1994-06-15 | 1998-12-08 | Clariant Finance (Bvi) Limited | Aluminum phthalocyanine reactive dyes |
| CN1100861C (zh) * | 1994-08-30 | 2003-02-05 | 普罗格特-甘布尔公司 | 增强光漂白作用的螯合剂 |
| US5916481A (en) * | 1995-07-25 | 1999-06-29 | The Procter & Gamble Company | Low hue photobleaches |
| US5679661A (en) * | 1995-07-25 | 1997-10-21 | The Procter & Gamble Company | Low hue photodisinfectants |
| DE19529853A1 (de) * | 1995-08-14 | 1997-02-20 | Bayer Ag | Aluminium-Phthalocyanin-Reaktivfarbstoffe |
| EP0970176B1 (en) | 1997-01-24 | 2003-04-16 | Case Western Reserve University | Photochemical superoxide generators |
| ZA98528B (en) | 1997-01-24 | 1998-07-29 | Procter & Gamble | Photochemical singlet oxygen generators having enhanced singlet oxygen yields |
| US6413924B2 (en) * | 1997-01-24 | 2002-07-02 | Case Western Reserve University | Photobleaching compositions comprising mixed metallocyanines |
| ZA98524B (en) | 1997-01-24 | 1998-07-29 | Procter & Gamble | Low hue photobleaches |
| JP2001512498A (ja) | 1997-01-24 | 2001-08-21 | ザ、プロクター、エンド、ギャンブル、カンパニー | 向上した重原子効果を有する一重項酸素発生剤 |
| JP2001509193A (ja) | 1997-01-24 | 2001-07-10 | ザ、プロクター、エンド、ギャンブル、カンパニー | 黒ずんだ布帛に有効な光漂白組成物 |
| BR9807086A (pt) * | 1997-01-24 | 2000-04-18 | Procter & Gamble | Geradores fotoquìmicos de oxigênio singleto contendo modificadores catiÈnicos de substantividade |
| US20030194433A1 (en) * | 2002-03-12 | 2003-10-16 | Ecolab | Antimicrobial compositions, methods and articles employing singlet oxygen- generating agent |
| US20040055965A1 (en) * | 1997-06-13 | 2004-03-25 | Hubig Stephan M. | Recreational water treatment employing singlet oxygen |
| NZ331196A (en) | 1997-08-15 | 2000-01-28 | Ciba Sc Holding Ag | Water soluble fabric softener compositions comprising phthalocyanine, a quaternary ammonium compound and a photobleaching agent |
| US20070020300A1 (en) * | 2002-03-12 | 2007-01-25 | Ecolab Inc. | Recreational water treatment employing singlet oxygen |
| DE60305509T2 (de) * | 2002-09-04 | 2006-12-21 | Ciba Speciality Chemicals Holding Inc. | Formulierungen enthaltend wasserlösliche granulate |
| ES2703553T3 (es) | 2015-01-13 | 2019-03-11 | Henkel Ag & Co Kgaa | Composición detergente líquida |
| EP3805346B1 (en) * | 2019-10-08 | 2024-08-14 | The Procter & Gamble Company | A method of laundering fabric |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1372035A (en) | 1971-05-12 | 1974-10-30 | Procter & Gamble Ltd | Bleaching process |
| GB1408144A (en) * | 1972-06-02 | 1975-10-01 | Procter & Gamble Ltd | Bleaching process |
| US3969387A (en) * | 1972-12-29 | 1976-07-13 | Merkl George | Metalic-organo-peroxide and organo-metalic-peroxide and preparation thereof |
| US4033718A (en) * | 1973-11-27 | 1977-07-05 | The Procter & Gamble Company | Photoactivated bleaching process |
| CA1064797A (en) | 1975-04-03 | 1979-10-23 | Brandon H. Wiers | Photoactivated bleach-compositions and process |
-
1977
- 1977-03-25 CH CH381077A patent/CH630127A5/de not_active IP Right Cessation
-
1978
- 1978-03-20 US US05/888,593 patent/US4166718A/en not_active Expired - Lifetime
- 1978-03-20 DD DD78204286A patent/DD135630A5/xx unknown
- 1978-03-20 FR FR7807991A patent/FR2384882A1/fr active Granted
- 1978-03-21 PT PT67804A patent/PT67804A/pt unknown
- 1978-03-21 MX MX010302A patent/MX174092B/es unknown
- 1978-03-21 DE DE19782812278 patent/DE2812278A1/de not_active Ceased
- 1978-03-22 PH PH20924A patent/PH14523A/en unknown
- 1978-03-22 NL NL7803093A patent/NL7803093A/xx not_active Application Discontinuation
- 1978-03-22 ES ES468124A patent/ES468124A1/es not_active Expired
- 1978-03-22 IN IN314/CAL/78A patent/IN148118B/en unknown
- 1978-03-22 AR AR271504A patent/AR217682A1/es active
- 1978-03-22 BR BR7801807A patent/BR7801807A/pt unknown
- 1978-03-23 GR GR55784A patent/GR71702B/el unknown
- 1978-03-23 CA CA299,732A patent/CA1110947A/en not_active Expired
- 1978-03-23 GB GB11798/78A patent/GB1589652A/en not_active Expired
- 1978-03-23 IL IL54341A patent/IL54341A0/xx not_active IP Right Cessation
- 1978-03-23 YU YU00695/78A patent/YU69578A/xx unknown
- 1978-03-23 ZA ZA00781709A patent/ZA781709B/xx unknown
- 1978-03-23 AU AU34453/78A patent/AU515088B2/en not_active Expired
- 1978-03-23 TR TR19904A patent/TR19904A/xx unknown
- 1978-03-23 NZ NZ186780A patent/NZ186780A/xx unknown
- 1978-03-24 BE BE186248A patent/BE865292A/xx not_active IP Right Cessation
- 1978-03-24 CS CS781915A patent/CS207592B2/cs unknown
- 1978-03-24 SU SU782596899A patent/SU818494A3/ru active
- 1978-03-25 EG EG201/78A patent/EG13176A/xx active
- 1978-03-25 RO RO93626A patent/RO84975B/ro unknown
- 1978-03-25 JP JP3365178A patent/JPS53119381A/ja active Granted
- 1978-03-27 MX MX172851A patent/MX149606A/es unknown
-
1984
- 1984-02-29 SG SG189/84A patent/SG18984G/en unknown
- 1984-03-20 KE KE3387A patent/KE3387A/xx unknown
- 1984-06-12 DO DO1984004248A patent/DOP1984004248A/es unknown
- 1984-06-14 HK HK499/84A patent/HK49984A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DD135630A5 (de) | 1979-05-16 |
| GB1589652A (en) | 1981-05-20 |
| JPS53119381A (en) | 1978-10-18 |
| SU818494A3 (ru) | 1981-03-30 |
| PH14523A (en) | 1981-08-26 |
| IN148118B (el) | 1980-10-25 |
| BR7801807A (pt) | 1978-12-19 |
| TR19904A (tr) | 1980-04-28 |
| JPS6214669B2 (el) | 1987-04-03 |
| CH630127A5 (de) | 1982-05-28 |
| RO84975A (ro) | 1984-08-17 |
| MX149606A (es) | 1983-12-01 |
| SG18984G (en) | 1985-01-04 |
| MX174092B (es) | 1994-04-21 |
| YU69578A (en) | 1983-01-21 |
| IL54341A0 (en) | 1978-06-15 |
| HK49984A (en) | 1984-06-22 |
| KE3387A (en) | 1984-05-25 |
| NL7803093A (nl) | 1978-09-27 |
| AR217682A1 (es) | 1980-04-15 |
| ZA781709B (en) | 1979-03-28 |
| CA1110947A (en) | 1981-10-20 |
| PT67804A (en) | 1978-04-01 |
| DE2812278A1 (de) | 1978-09-28 |
| EG13176A (en) | 1980-12-31 |
| RO84975B (ro) | 1984-09-30 |
| FR2384882A1 (fr) | 1978-10-20 |
| GR71702B (el) | 1983-06-21 |
| BE865292A (fr) | 1978-09-25 |
| AU515088B2 (en) | 1981-03-12 |
| FR2384882B1 (el) | 1980-06-13 |
| NZ186780A (en) | 1980-11-14 |
| US4166718A (en) | 1979-09-04 |
| DOP1984004248A (es) | 1989-10-05 |
| AU3445378A (en) | 1979-09-27 |
| ES468124A1 (es) | 1979-01-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS207592B2 (en) | Method of bleaching the textiles | |
| CA1166632A (en) | Fabric conditioning compositions | |
| US4318883A (en) | Process for combating micro-organisms, and novel phthalocyanine compounds | |
| FI67884C (fi) | Porfinfotoaktivator innehaollande blekningskomposition | |
| US5608053A (en) | Poly-substituted phthalocyanines | |
| GB2159516A (en) | Azaphthalocyanines and their use as photoactivators | |
| HK107790A (en) | Water soluble phthalocyanine compounds and their use as photoactivators | |
| CA1151807A (en) | Compositions for treating textiles | |
| CA1128258A (en) | Composition for combined washing and bleaching of fabrics | |
| DK158160B (da) | Fremgangsmaade til blegning af tekstiler, herunder blegende pletfjernelse fra tekstiler samt et blegemiddel, herunder blegende pletfjernelsesmiddel | |
| US4497741A (en) | Water-soluble zinc and aluminium phthalocyanines | |
| EP0003371A1 (en) | Composition containing a cationic substance and a photoactivator for improved washing and bleaching of fabrics | |
| CA1125957A (en) | Composition for combined washing and bleaching of fabrics | |
| JPS5858396B2 (ja) | 布類を洗濯しかつ漂白するための組成物 | |
| US4566874A (en) | Water-soluble zinc and aluminium phthalocyanines and use thereof as photoactivators | |
| US5484915A (en) | Sulphonated manganese phthalocyanines and compositions thereof | |
| GB2279657A (en) | Phthalocyanines | |
| EP0395588B1 (de) | Dibenzofuranylbiphenyle | |
| US3410847A (en) | 4-(5, 6-di-substituted oxy benzotriazole-2-yl) stilbenesulfonic acid brighteners and ethods for making same | |
| MXPA98006552A (en) | Softening composition for te | |
| DK159396B (da) | Sulfonerede zink- og aluminiumphthalocyaninforbindelser samt deres fremstilling |