CS207355B2 - Method of making the 2,6-diacyloxymethylpiridines - Google Patents
Method of making the 2,6-diacyloxymethylpiridines Download PDFInfo
- Publication number
- CS207355B2 CS207355B2 CS207376A CS207376A CS207355B2 CS 207355 B2 CS207355 B2 CS 207355B2 CS 207376 A CS207376 A CS 207376A CS 207376 A CS207376 A CS 207376A CS 207355 B2 CS207355 B2 CS 207355B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- reaction
- yield
- preparation
- pyridine
- bis
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title description 5
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims abstract description 29
- 238000000034 method Methods 0.000 claims abstract description 29
- IWQNFYRJSVJWQA-UHFFFAOYSA-N 2,6-bis(chloromethyl)pyridine Chemical compound ClCC1=CC=CC(CCl)=N1 IWQNFYRJSVJWQA-UHFFFAOYSA-N 0.000 claims abstract description 6
- 239000003960 organic solvent Substances 0.000 claims abstract description 6
- 150000001412 amines Chemical class 0.000 claims abstract 3
- 238000002360 preparation method Methods 0.000 claims description 14
- 239000000203 mixture Substances 0.000 claims description 12
- 239000011541 reaction mixture Substances 0.000 claims description 10
- 238000009835 boiling Methods 0.000 claims description 8
- -1 1,6-diformylmethylpyridine Chemical compound 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical compound CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 4
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 4
- 150000003222 pyridines Chemical class 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 2
- 235000019253 formic acid Nutrition 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000005270 trialkylamine group Chemical group 0.000 claims description 2
- HZONRRHNQILCNO-UHFFFAOYSA-N 1-methyl-2h-pyridine Chemical compound CN1CC=CC=C1 HZONRRHNQILCNO-UHFFFAOYSA-N 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 abstract description 20
- 230000015572 biosynthetic process Effects 0.000 abstract description 7
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 abstract description 6
- 239000000376 reactant Substances 0.000 abstract description 6
- 239000006227 byproduct Substances 0.000 abstract description 3
- YEKQSSHBERGOJK-UHFFFAOYSA-N Pyricarbate Chemical compound CNC(=O)OCC1=CC=CC(COC(=O)NC)=N1 YEKQSSHBERGOJK-UHFFFAOYSA-N 0.000 abstract description 2
- 125000000217 alkyl group Chemical group 0.000 abstract description 2
- 238000010992 reflux Methods 0.000 abstract description 2
- ATTHEJRCDHEDLT-UHFFFAOYSA-N [6-(prop-2-enoyloxymethyl)pyridin-2-yl]methyl prop-2-enoate Chemical class C=CC(=O)OCC1=CC=CC(COC(=O)C=C)=N1 ATTHEJRCDHEDLT-UHFFFAOYSA-N 0.000 abstract 1
- 239000002327 cardiovascular agent Substances 0.000 abstract 1
- 229940125692 cardiovascular agent Drugs 0.000 abstract 1
- 125000004970 halomethyl group Chemical group 0.000 abstract 1
- 239000012442 inert solvent Substances 0.000 abstract 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 abstract 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 26
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- 239000000047 product Substances 0.000 description 15
- 239000000243 solution Substances 0.000 description 14
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 239000003921 oil Substances 0.000 description 9
- 229960000583 acetic acid Drugs 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- 239000002904 solvent Substances 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 239000012362 glacial acetic acid Substances 0.000 description 6
- XARIFKSEVODEFM-UHFFFAOYSA-N [6-(acetyloxymethyl)pyridin-2-yl]methyl acetate Chemical compound C(C)(=O)OCC1=NC(=CC=C1)COC(C)=O XARIFKSEVODEFM-UHFFFAOYSA-N 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- XWKFPIODWVPXLX-UHFFFAOYSA-N 2-methyl-5-methylpyridine Natural products CC1=CC=C(C)N=C1 XWKFPIODWVPXLX-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 150000001204 N-oxides Chemical class 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 150000003512 tertiary amines Chemical class 0.000 description 3
- QNXQLPUEZYZYFC-UHFFFAOYSA-N (4-nitrophenyl)methyl acetate Chemical compound CC(=O)OCC1=CC=C([N+]([O-])=O)C=C1 QNXQLPUEZYZYFC-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000001242 acetic acid derivatives Chemical class 0.000 description 2
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- QUTSYCOAZVHGGT-UHFFFAOYSA-N 2,6-bis(bromomethyl)pyridine Chemical compound BrCC1=CC=CC(CBr)=N1 QUTSYCOAZVHGGT-UHFFFAOYSA-N 0.000 description 1
- UUXRMSMDDNCOLP-UHFFFAOYSA-N 2,6-bis(fluoromethyl)pyridine Chemical compound FCC1=CC=CC(CF)=N1 UUXRMSMDDNCOLP-UHFFFAOYSA-N 0.000 description 1
- ABKLYPKKJFLPGU-UHFFFAOYSA-N 2,6-bis(methoxymethyl)pyridine Chemical compound COCC1=CC=CC(COC)=N1 ABKLYPKKJFLPGU-UHFFFAOYSA-N 0.000 description 1
- FILKGCRCWDMBKA-UHFFFAOYSA-N 2,6-dichloropyridine Chemical compound ClC1=CC=CC(Cl)=N1 FILKGCRCWDMBKA-UHFFFAOYSA-N 0.000 description 1
- LLMLJDXZVVISDD-UHFFFAOYSA-N 2-chloro-6-(2-chloroethyl)pyridine Chemical compound ClCCC1=CC=CC(Cl)=N1 LLMLJDXZVVISDD-UHFFFAOYSA-N 0.000 description 1
- LUDRZEMPGPIUDD-UHFFFAOYSA-N 2-methoxy-6-(2-methoxyethyl)pyridine Chemical compound COCCC1=CC=CC(OC)=N1 LUDRZEMPGPIUDD-UHFFFAOYSA-N 0.000 description 1
- FVMCCWYUWHDLGS-UHFFFAOYSA-N 2-methyl-6-propylpyridine Chemical compound CCCC1=CC=CC(C)=N1 FVMCCWYUWHDLGS-UHFFFAOYSA-N 0.000 description 1
- YWLKXMKIKWXYSQ-UHFFFAOYSA-N 2-n,6-n-dimethylpyridine-2,6-diamine Chemical compound CNC1=CC=CC(NC)=N1 YWLKXMKIKWXYSQ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- 230000017531 blood circulation Effects 0.000 description 1
- 150000004653 carbonic acids Chemical class 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 239000012159 carrier gas Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- OONHJKCKWRTEBL-UHFFFAOYSA-N chlorosulfonyloxymethylbenzene Chemical compound ClS(=O)(=O)OCC1=CC=CC=C1 OONHJKCKWRTEBL-UHFFFAOYSA-N 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- VWVFSSLCCFQXEO-UHFFFAOYSA-N ethoxyethane;pyridine Chemical compound CCOCC.C1=CC=NC=C1 VWVFSSLCCFQXEO-UHFFFAOYSA-N 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 229940070851 pyridinolcarbamate Drugs 0.000 description 1
- 239000013558 reference substance Substances 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- 238000000870 ultraviolet spectroscopy Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HURI000562 HU170496B (enExample) | 1975-04-02 | 1975-04-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS207355B2 true CS207355B2 (en) | 1981-07-31 |
Family
ID=11000971
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS207376A CS207355B2 (en) | 1975-04-02 | 1976-03-31 | Method of making the 2,6-diacyloxymethylpiridines |
Country Status (10)
| Country | Link |
|---|---|
| AT (1) | AT347462B (enExample) |
| CH (1) | CH601236A5 (enExample) |
| CS (1) | CS207355B2 (enExample) |
| DD (1) | DD124875A5 (enExample) |
| DE (1) | DE2614400C3 (enExample) |
| ES (1) | ES446523A1 (enExample) |
| HU (1) | HU170496B (enExample) |
| PL (1) | PL101309B1 (enExample) |
| SU (1) | SU648089A3 (enExample) |
| YU (1) | YU83776A (enExample) |
-
1975
- 1975-04-02 HU HURI000562 patent/HU170496B/hu unknown
-
1976
- 1976-03-25 CH CH376376A patent/CH601236A5/xx not_active IP Right Cessation
- 1976-03-29 AT AT225876A patent/AT347462B/de not_active IP Right Cessation
- 1976-03-31 CS CS207376A patent/CS207355B2/cs unknown
- 1976-03-31 ES ES446523A patent/ES446523A1/es not_active Expired
- 1976-04-01 PL PL18842276A patent/PL101309B1/pl unknown
- 1976-04-01 DD DD19216576A patent/DD124875A5/xx unknown
- 1976-04-01 YU YU83776A patent/YU83776A/xx unknown
- 1976-04-02 SU SU762341201A patent/SU648089A3/ru active
- 1976-04-02 DE DE19762614400 patent/DE2614400C3/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AT347462B (de) | 1978-12-27 |
| ES446523A1 (es) | 1977-06-16 |
| DE2614400B2 (de) | 1978-07-06 |
| DD124875A5 (enExample) | 1977-03-16 |
| HU170496B (enExample) | 1977-06-28 |
| DE2614400C3 (de) | 1979-03-15 |
| YU83776A (en) | 1982-02-28 |
| DE2614400A1 (de) | 1977-03-03 |
| SU648089A3 (ru) | 1979-02-15 |
| PL101309B1 (pl) | 1978-12-30 |
| ATA225876A (de) | 1978-05-15 |
| CH601236A5 (enExample) | 1978-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0302720B1 (en) | Production of 2-(2-pyridylmethylsulfinyl)-benzimidazole compounds | |
| KR100242622B1 (ko) | 항궤양제의 제조방법 | |
| RU2669701C2 (ru) | Производные пиперидина в качестве антагонистов рецептора орексина | |
| KR850000923B1 (ko) | 피록시캄의 제조 방법 | |
| US4769493A (en) | Process for producing tetrafluorophthalic acid | |
| JP2876712B2 (ja) | 光学活性ピラノベンゾオキサジアゾール誘導体 | |
| KR101313842B1 (ko) | 에스-암로디핀 베실레이트 및 그 수화물의 제조방법 | |
| US7790891B2 (en) | Process for the preparation of pyridine-methylsulfinyl compounds | |
| KR100430575B1 (ko) | 란소프라졸 및 그 중간체의 제조방법 | |
| CS207355B2 (en) | Method of making the 2,6-diacyloxymethylpiridines | |
| EP0092117B1 (en) | Process for producing chloronicotinic acid compounds | |
| US6891041B2 (en) | Method for producing 4-(heteroaryl-methyl)-halogen-1(2H)-phthalazinones | |
| RU2228929C2 (ru) | Способ получения 3s-3-амино-3-пиридилпропионовой кислоты и ее производных и промежуточное вещество | |
| FI73680C (fi) | Foerfarande foer framstaellning av terapeutiskt verksam 5,11-dihydro-11-/(4-metyl-1-piperazinyl)- acetyl/-6h-pyrido/2,3-b//1,4/benzodiazepin-6-on. | |
| JPH0557255B2 (enExample) | ||
| JPH0546356B2 (enExample) | ||
| JP2703540B2 (ja) | アニリノフマレートの新規な製造方法 | |
| KR100219251B1 (ko) | 광학 활성 1,6-나프티리딘 유도체 | |
| KR100868160B1 (ko) | S-(-)-암로디핀 또는 이의 염의 제조방법 및 이에사용되는 중간체 | |
| SU1715809A1 (ru) | Ди- @ фуразано[3,4:5,6][1,4]диоксино @ [2,3-в: 5,6-е]пиразин и способ его получени | |
| KR20240163708A (ko) | 4-[5-[비스(2-클로로에틸)아미노]-1-메틸-1H-벤조[d]이미다졸-2-일]부티르산알킬 에스테르 및 포르밀화 유도체의 제조 방법 | |
| KR0132189B1 (ko) | (-)-3(s)-메틸피리도벤즈옥사진 카르복실산 유도체의 제조방법 | |
| JP2640622B2 (ja) | プログルメタシンの製造方法 | |
| KR0131049B1 (ko) | 벤즈이미다졸 유도체의 제조방법 | |
| JPH0686444B2 (ja) | 2−(2−ピリジルメチルスルフィニル)ベンズイミダゾール化合物の製造法 |