CS197232B2 - Insecticide means notably against the plant louses and method of making the active substance - Google Patents
Insecticide means notably against the plant louses and method of making the active substance Download PDFInfo
- Publication number
- CS197232B2 CS197232B2 CS744058A CS405874A CS197232B2 CS 197232 B2 CS197232 B2 CS 197232B2 CS 744058 A CS744058 A CS 744058A CS 405874 A CS405874 A CS 405874A CS 197232 B2 CS197232 B2 CS 197232B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- formula
- methyl
- hydrogen
- compound
- ethyl
- Prior art date
Links
- 239000013543 active substance Substances 0.000 title description 5
- 239000002917 insecticide Substances 0.000 title description 4
- 238000004519 manufacturing process Methods 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 abstract description 82
- -1 4 - methylpiperazinyl Chemical group 0.000 abstract description 39
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract description 30
- 239000001257 hydrogen Substances 0.000 abstract description 19
- 229910052739 hydrogen Inorganic materials 0.000 abstract description 19
- 150000001412 amines Chemical class 0.000 abstract description 17
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 abstract description 15
- 239000012948 isocyanate Substances 0.000 abstract description 14
- 150000002513 isocyanates Chemical class 0.000 abstract description 14
- 150000002431 hydrogen Chemical class 0.000 abstract description 11
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 abstract description 11
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 abstract description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract description 8
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 abstract description 6
- 125000000217 alkyl group Chemical group 0.000 abstract description 6
- 125000004432 carbon atom Chemical group C* 0.000 abstract description 6
- 239000003795 chemical substances by application Substances 0.000 abstract description 6
- 125000000753 cycloalkyl group Chemical group 0.000 abstract description 5
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 abstract description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract description 3
- 150000004648 butanoic acid derivatives Chemical class 0.000 abstract description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 abstract description 2
- 125000003342 alkenyl group Chemical group 0.000 abstract description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 abstract description 2
- 125000003545 alkoxy group Chemical group 0.000 abstract description 2
- 229910052799 carbon Inorganic materials 0.000 abstract description 2
- 229910052731 fluorine Inorganic materials 0.000 abstract description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 abstract 1
- VGJSNSMPSKBFLF-UHFFFAOYSA-N [(1-amino-1-oxobutan-2-ylidene)amino] carbamate Chemical class C(N)(=O)ON=C(C(=O)N)CC VGJSNSMPSKBFLF-UHFFFAOYSA-N 0.000 abstract 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 abstract 1
- 239000011737 fluorine Substances 0.000 abstract 1
- 241001124076 Aphididae Species 0.000 description 71
- 229910052757 nitrogen Inorganic materials 0.000 description 45
- 239000000203 mixture Substances 0.000 description 30
- 238000012360 testing method Methods 0.000 description 27
- 241000196324 Embryophyta Species 0.000 description 24
- 230000000694 effects Effects 0.000 description 24
- 239000000243 solution Substances 0.000 description 23
- 238000006243 chemical reaction Methods 0.000 description 21
- 238000000034 method Methods 0.000 description 21
- 239000002689 soil Substances 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 19
- 238000005507 spraying Methods 0.000 description 16
- 239000000126 substance Substances 0.000 description 16
- 239000002904 solvent Substances 0.000 description 14
- 238000002844 melting Methods 0.000 description 13
- 230000008018 melting Effects 0.000 description 13
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- DNSISZSEWVHGLH-UHFFFAOYSA-N butanamide Chemical class CCCC(N)=O DNSISZSEWVHGLH-UHFFFAOYSA-N 0.000 description 11
- 239000007921 spray Substances 0.000 description 11
- 240000001090 Papaver somniferum Species 0.000 description 10
- 235000008753 Papaver somniferum Nutrition 0.000 description 10
- 206010061217 Infestation Diseases 0.000 description 9
- 240000005407 Nasturtium officinale Species 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000004094 surface-active agent Substances 0.000 description 9
- 235000017879 Nasturtium officinale Nutrition 0.000 description 8
- UUEVFMOUBSLVJW-UHFFFAOYSA-N oxo-[[1-[2-[2-[2-[4-(oxoazaniumylmethylidene)pyridin-1-yl]ethoxy]ethoxy]ethyl]pyridin-4-ylidene]methyl]azanium;dibromide Chemical compound [Br-].[Br-].C1=CC(=C[NH+]=O)C=CN1CCOCCOCCN1C=CC(=C[NH+]=O)C=C1 UUEVFMOUBSLVJW-UHFFFAOYSA-N 0.000 description 8
- 230000008569 process Effects 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 7
- 239000004480 active ingredient Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 238000011282 treatment Methods 0.000 description 7
- 241000273311 Aphis spiraecola Species 0.000 description 6
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical compound NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 6
- 241000255749 Coccinellidae Species 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- 102100025854 Acyl-coenzyme A thioesterase 1 Human genes 0.000 description 5
- 101710175445 Acyl-coenzyme A thioesterase 1 Proteins 0.000 description 5
- 150000001408 amides Chemical class 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 239000003085 diluting agent Substances 0.000 description 5
- 238000011156 evaluation Methods 0.000 description 5
- 239000008187 granular material Substances 0.000 description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 5
- 230000035484 reaction time Effects 0.000 description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- XFLOBLIVLYVEST-UHFFFAOYSA-N CC(=N)C(=NO)C(N)=O Chemical class CC(=N)C(=NO)C(N)=O XFLOBLIVLYVEST-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 241000607479 Yersinia pestis Species 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 235000008504 concentrate Nutrition 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 241000982105 Brevicoryne brassicae Species 0.000 description 3
- 229940126062 Compound A Drugs 0.000 description 3
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 3
- 241000238631 Hexapoda Species 0.000 description 3
- 241000721621 Myzus persicae Species 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- WDJHALXBUFZDSR-UHFFFAOYSA-M acetoacetate Chemical compound CC(=O)CC([O-])=O WDJHALXBUFZDSR-UHFFFAOYSA-M 0.000 description 3
- 230000009435 amidation Effects 0.000 description 3
- 238000007112 amidation reaction Methods 0.000 description 3
- 230000002252 carbamoylating effect Effects 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 239000002480 mineral oil Substances 0.000 description 3
- 235000010446 mineral oil Nutrition 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 239000008188 pellet Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 238000009331 sowing Methods 0.000 description 3
- 230000009885 systemic effect Effects 0.000 description 3
- 150000003512 tertiary amines Chemical class 0.000 description 3
- RHUYHJGZWVXEHW-UHFFFAOYSA-N 1,1-Dimethyhydrazine Chemical compound CN(C)N RHUYHJGZWVXEHW-UHFFFAOYSA-N 0.000 description 2
- KZPDOYCDYDTFPS-UHFFFAOYSA-N 2-hydroxyimino-3-iminopentanamide Chemical class CCC(=N)C(=NO)C(N)=O KZPDOYCDYDTFPS-UHFFFAOYSA-N 0.000 description 2
- YHZBJNXFYPODJB-UHFFFAOYSA-N 2-hydroxyimino-3-methoxyimino-N,N-dimethylbutanamide Chemical compound CON=C(C)C(=NO)C(=O)N(C)C YHZBJNXFYPODJB-UHFFFAOYSA-N 0.000 description 2
- UKYBHEPQCODSCP-UHFFFAOYSA-N 2-hydroxyimino-3-oxobutanamide Chemical compound CC(=O)C(=NO)C(N)=O UKYBHEPQCODSCP-UHFFFAOYSA-N 0.000 description 2
- PCDLJFHTPHZVMV-UHFFFAOYSA-N 2-hydroxyimino-n,n-dimethyl-3-oxobutanamide Chemical compound CN(C)C(=O)C(=NO)C(C)=O PCDLJFHTPHZVMV-UHFFFAOYSA-N 0.000 description 2
- FHSUFDYFOHSYHI-UHFFFAOYSA-N 3-oxopentanoic acid Chemical compound CCC(=O)CC(O)=O FHSUFDYFOHSYHI-UHFFFAOYSA-N 0.000 description 2
- 241001095118 Aphis pomi Species 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- 244000141359 Malus pumila Species 0.000 description 2
- 235000011430 Malus pumila Nutrition 0.000 description 2
- 235000015103 Malus silvestris Nutrition 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 2
- 239000005950 Oxamyl Substances 0.000 description 2
- 241000590524 Protaphis middletonii Species 0.000 description 2
- 241000722027 Schizaphis graminum Species 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 241000282485 Vulpes vulpes Species 0.000 description 2
- GCPWJFKTWGFEHH-UHFFFAOYSA-N acetoacetamide Chemical compound CC(=O)CC(N)=O GCPWJFKTWGFEHH-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 238000005054 agglomeration Methods 0.000 description 2
- 230000002776 aggregation Effects 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 230000021235 carbamoylation Effects 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 229960000878 docusate sodium Drugs 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- XNXVOSBNFZWHBV-UHFFFAOYSA-N hydron;o-methylhydroxylamine;chloride Chemical compound Cl.CON XNXVOSBNFZWHBV-UHFFFAOYSA-N 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 229920005610 lignin Polymers 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000002420 orchard Substances 0.000 description 2
- KZAUOCCYDRDERY-UHFFFAOYSA-N oxamyl Chemical compound CNC(=O)ON=C(SC)C(=O)N(C)C KZAUOCCYDRDERY-UHFFFAOYSA-N 0.000 description 2
- 230000035515 penetration Effects 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- APSBXTVYXVQYAB-UHFFFAOYSA-M sodium docusate Chemical compound [Na+].CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC APSBXTVYXVQYAB-UHFFFAOYSA-M 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 230000002194 synthesizing effect Effects 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- YKPQUSLRUFLVDA-UHFFFAOYSA-N $l^{2}-azanylmethane Chemical compound [NH]C YKPQUSLRUFLVDA-UHFFFAOYSA-N 0.000 description 1
- GXMBHQRROXQUJS-UHFFFAOYSA-N (2-hept-2-ynylsulfanylphenyl) acetate Chemical compound CCCCC#CCSC1=CC=CC=C1OC(C)=O GXMBHQRROXQUJS-UHFFFAOYSA-N 0.000 description 1
- NXZLTPQEYLXQCH-DAFODLJHSA-N (2e)-2-hydroxyiminoacetamide Chemical compound NC(=O)\C=N\O NXZLTPQEYLXQCH-DAFODLJHSA-N 0.000 description 1
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
- YYOAJGVOBRTMJJ-UHFFFAOYSA-N 2-hydroxyimino-3-methoxyimino-N-methylpentanamide Chemical compound CON=C(CC)C(=NO)C(=O)NC YYOAJGVOBRTMJJ-UHFFFAOYSA-N 0.000 description 1
- LBVIWYRIQOZIRO-UHFFFAOYSA-N 2-hydroxyimino-3-oxobutanoic acid Chemical compound CC(=O)C(=NO)C(O)=O LBVIWYRIQOZIRO-UHFFFAOYSA-N 0.000 description 1
- NXZLTPQEYLXQCH-UHFFFAOYSA-N 2-hydroxyiminoacetamide Chemical class NC(=O)C=NO NXZLTPQEYLXQCH-UHFFFAOYSA-N 0.000 description 1
- XTLXJHADOAPIEA-UHFFFAOYSA-N 4-hydroxyimino-3-oxo-2-propylpentanamide Chemical class CCCC(C(N)=O)C(=O)C(C)=NO XTLXJHADOAPIEA-UHFFFAOYSA-N 0.000 description 1
- 101150008289 Aox4 gene Proteins 0.000 description 1
- 241001151957 Aphis aurantii Species 0.000 description 1
- 241001425390 Aphis fabae Species 0.000 description 1
- 240000007124 Brassica oleracea Species 0.000 description 1
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 1
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 1
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 1
- 235000010149 Brassica rapa subsp chinensis Nutrition 0.000 description 1
- 235000000536 Brassica rapa subsp pekinensis Nutrition 0.000 description 1
- 241000499436 Brassica rapa subsp. pekinensis Species 0.000 description 1
- WNMWFGATINEGEJ-UHFFFAOYSA-N C(CCC)(=O)NNOC(N(C)C)=O Chemical compound C(CCC)(=O)NNOC(N(C)C)=O WNMWFGATINEGEJ-UHFFFAOYSA-N 0.000 description 1
- 101100005001 Caenorhabditis elegans cah-5 gene Proteins 0.000 description 1
- 241000207199 Citrus Species 0.000 description 1
- 241000254173 Coleoptera Species 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 241000221785 Erysiphales Species 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 244000211187 Lepidium sativum Species 0.000 description 1
- 235000007849 Lepidium sativum Nutrition 0.000 description 1
- 241000721714 Macrosiphum euphorbiae Species 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- 229920003091 Methocel™ Polymers 0.000 description 1
- VKEQBMCRQDSRET-UHFFFAOYSA-N Methylone Chemical compound CNC(C)C(=O)C1=CC=C2OCOC2=C1 VKEQBMCRQDSRET-UHFFFAOYSA-N 0.000 description 1
- 241000244206 Nematoda Species 0.000 description 1
- DJTZTYVLQOCWGA-UHFFFAOYSA-N ON=C(C(=O)O)C(C)=N Chemical compound ON=C(C(=O)O)C(C)=N DJTZTYVLQOCWGA-UHFFFAOYSA-N 0.000 description 1
- RSPISYXLHRIGJD-UHFFFAOYSA-N OOOO Chemical compound OOOO RSPISYXLHRIGJD-UHFFFAOYSA-N 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- 241001474791 Proboscis Species 0.000 description 1
- 101100054666 Streptomyces halstedii sch3 gene Proteins 0.000 description 1
- 241000228452 Venturia inaequalis Species 0.000 description 1
- NOABJNYOHPTKLL-UHFFFAOYSA-N [[1-(dimethylamino)-3-methoxyimino-1-oxobutan-2-ylidene]amino] N,N-dimethylcarbamate Chemical compound CON=C(C)C(C(=O)N(C)C)=NOC(=O)N(C)C NOABJNYOHPTKLL-UHFFFAOYSA-N 0.000 description 1
- WKZLYEJGOQQZGO-UHFFFAOYSA-N [[1-(dimethylamino)-3-methoxyimino-1-oxobutan-2-ylidene]amino] n,n-diethylcarbamate Chemical compound CCN(CC)C(=O)ON=C(C(=O)N(C)C)C(C)=NOC WKZLYEJGOQQZGO-UHFFFAOYSA-N 0.000 description 1
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 150000004729 acetoacetic acid derivatives Chemical class 0.000 description 1
- KLUDQUOLAFVLOL-UHFFFAOYSA-N acetyl propanoate Chemical class CCC(=O)OC(C)=O KLUDQUOLAFVLOL-UHFFFAOYSA-N 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical class 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- RIOXQFHNBCKOKP-UHFFFAOYSA-N benomyl Chemical compound C1=CC=C2N(C(=O)NCCCC)C(NC(=O)OC)=NC2=C1 RIOXQFHNBCKOKP-UHFFFAOYSA-N 0.000 description 1
- MITFXPHMIHQXPI-UHFFFAOYSA-N benzoxaprofen Natural products N=1C2=CC(C(C(O)=O)C)=CC=C2OC=1C1=CC=C(Cl)C=C1 MITFXPHMIHQXPI-UHFFFAOYSA-N 0.000 description 1
- 238000004166 bioassay Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 238000003889 chemical engineering Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- 229940127573 compound 38 Drugs 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 239000012975 dibutyltin dilaurate Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 230000008029 eradication Effects 0.000 description 1
- IACSYDRIOYGJNH-UHFFFAOYSA-N ethyl 2-hydroxyimino-3-oxobutanoate Chemical compound CCOC(=O)C(=NO)C(C)=O IACSYDRIOYGJNH-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000021384 green leafy vegetables Nutrition 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 238000011221 initial treatment Methods 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 235000014666 liquid concentrate Nutrition 0.000 description 1
- 230000001926 lymphatic effect Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 125000004674 methylcarbonyl group Chemical group CC(=O)* 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 230000000813 microbial effect Effects 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- MKQLBNJQQZRQJU-UHFFFAOYSA-N morpholin-4-amine Chemical compound NN1CCOCC1 MKQLBNJQQZRQJU-UHFFFAOYSA-N 0.000 description 1
- OFCCYDUUBNUJIB-UHFFFAOYSA-N n,n-diethylcarbamoyl chloride Chemical compound CCN(CC)C(Cl)=O OFCCYDUUBNUJIB-UHFFFAOYSA-N 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- NUXCOKIYARRTDC-UHFFFAOYSA-N o-ethylhydroxylamine;hydron;chloride Chemical compound Cl.CCON NUXCOKIYARRTDC-UHFFFAOYSA-N 0.000 description 1
- IOQPZZOEVPZRBK-UHFFFAOYSA-N octan-1-amine Chemical compound CCCCCCCCN IOQPZZOEVPZRBK-UHFFFAOYSA-N 0.000 description 1
- 239000012053 oil suspension Substances 0.000 description 1
- PIDFDZJZLOTZTM-KHVQSSSXSA-N ombitasvir Chemical compound COC(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@H]1C(=O)NC1=CC=C([C@H]2N([C@@H](CC2)C=2C=CC(NC(=O)[C@H]3N(CCC3)C(=O)[C@@H](NC(=O)OC)C(C)C)=CC=2)C=2C=CC(=CC=2)C(C)(C)C)C=C1 PIDFDZJZLOTZTM-KHVQSSSXSA-N 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 244000045947 parasite Species 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- BHRZNVHARXXAHW-UHFFFAOYSA-N sec-butylamine Chemical compound CCC(C)N BHRZNVHARXXAHW-UHFFFAOYSA-N 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000011265 semifinished product Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 230000007480 spreading Effects 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 239000004546 suspension concentrate Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000009897 systematic effect Effects 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 238000001238 wet grinding Methods 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/185—Radicals derived from carboxylic acids from aliphatic carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C251/00—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton
- C07C251/72—Hydrazones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/22—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with hetero atoms directly attached to ring nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US36960673A | 1973-06-13 | 1973-06-13 | |
| US05/463,987 US4059623A (en) | 1973-06-13 | 1974-04-25 | Butyramides and butyrates |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS197232B2 true CS197232B2 (en) | 1980-04-30 |
Family
ID=27004643
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS744058A CS197232B2 (en) | 1973-06-13 | 1974-06-07 | Insecticide means notably against the plant louses and method of making the active substance |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4059623A (ca) |
| JP (1) | JPS5757445B2 (ca) |
| AR (1) | AR216040A1 (ca) |
| BR (1) | BR7404848D0 (ca) |
| CA (1) | CA1031341A (ca) |
| CH (1) | CH600763A5 (ca) |
| CS (1) | CS197232B2 (ca) |
| DD (1) | DD118511A5 (ca) |
| DE (1) | DE2428070C2 (ca) |
| DK (1) | DK314374A (ca) |
| ES (1) | ES427185A1 (ca) |
| FR (1) | FR2233317B1 (ca) |
| GB (1) | GB1438426A (ca) |
| IE (1) | IE39284B1 (ca) |
| IL (1) | IL45017A (ca) |
| IT (1) | IT1049223B (ca) |
| NL (1) | NL7407926A (ca) |
| NO (1) | NO139220C (ca) |
| PH (1) | PH11491A (ca) |
| PL (1) | PL94958B1 (ca) |
| SE (1) | SE7406469L (ca) |
| YU (2) | YU166674A (ca) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4725682A (en) * | 1978-11-03 | 1988-02-16 | Rhone-Poulenc Nederland, B.V. | Biocidal sulfur-containing bis-imino carbamate compounds |
| US4657904A (en) * | 1978-11-03 | 1987-04-14 | Union Carbide Corporation | Sulfur-containing bis-imino carbamate compounds, pesticidal composition and use |
| US4435421A (en) | 1978-11-03 | 1984-03-06 | Union Carbide Corporation | Biocidal sulfur-containing bis-imino carbamate compounds |
| DK0387499T3 (da) * | 1989-02-16 | 1994-02-14 | Bayer Ag | Substituerede oximethere samt deres anvendelse som pesticider |
| AU4400497A (en) * | 1996-10-15 | 1998-05-11 | Shionogi & Co., Ltd. | Oxime derivatives, hydrazone derivatives, and use thereof |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2542812A (en) * | 1946-04-03 | 1951-02-20 | Walter H Hartung | Preparation of aminoacidamides |
| US3849481A (en) * | 1970-12-11 | 1974-11-19 | Allied Chem | Hydrogenation of lysine precursors |
-
1974
- 1974-04-25 US US05/463,987 patent/US4059623A/en not_active Expired - Lifetime
- 1974-05-15 SE SE7406469A patent/SE7406469L/xx unknown
- 1974-05-22 IE IE1098/74A patent/IE39284B1/xx unknown
- 1974-06-07 CS CS744058A patent/CS197232B2/cs unknown
- 1974-06-11 IT IT23856/74A patent/IT1049223B/it active
- 1974-06-11 ES ES427185A patent/ES427185A1/es not_active Expired
- 1974-06-11 CA CA202,336A patent/CA1031341A/en not_active Expired
- 1974-06-11 JP JP49065669A patent/JPS5757445B2/ja not_active Expired
- 1974-06-11 DE DE2428070A patent/DE2428070C2/de not_active Expired
- 1974-06-12 DD DD179108A patent/DD118511A5/xx unknown
- 1974-06-12 IL IL45017A patent/IL45017A/xx unknown
- 1974-06-12 FR FR7420317A patent/FR2233317B1/fr not_active Expired
- 1974-06-12 DK DK314374A patent/DK314374A/da unknown
- 1974-06-12 PL PL1974171858A patent/PL94958B1/pl unknown
- 1974-06-12 BR BR4848/74A patent/BR7404848D0/pt unknown
- 1974-06-12 GB GB2608774A patent/GB1438426A/en not_active Expired
- 1974-06-12 NO NO742129A patent/NO139220C/no unknown
- 1974-06-12 CH CH805974A patent/CH600763A5/xx not_active IP Right Cessation
- 1974-06-12 AR AR254171A patent/AR216040A1/es active
- 1974-06-13 YU YU01666/74A patent/YU166674A/xx unknown
- 1974-06-13 NL NL7407926A patent/NL7407926A/xx not_active Application Discontinuation
- 1974-06-13 PH PH15934A patent/PH11491A/en unknown
-
1981
- 1981-09-09 YU YU02156/81A patent/YU215681A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5035336A (ca) | 1975-04-04 |
| BR7404848D0 (pt) | 1975-09-23 |
| NO139220C (no) | 1979-01-24 |
| CA1031341A (en) | 1978-05-16 |
| AU6999674A (en) | 1975-12-11 |
| CH600763A5 (ca) | 1978-06-30 |
| NO742129L (ca) | 1975-01-06 |
| DE2428070C2 (de) | 1985-10-10 |
| DE2428070A1 (de) | 1975-01-09 |
| DD118511A5 (ca) | 1976-03-12 |
| GB1438426A (en) | 1976-06-09 |
| IL45017A0 (en) | 1974-09-10 |
| NO139220B (no) | 1978-10-16 |
| FR2233317B1 (ca) | 1978-01-13 |
| SE7406469L (ca) | 1974-12-16 |
| IE39284L (en) | 1974-12-13 |
| NL7407926A (ca) | 1974-12-17 |
| ES427185A1 (es) | 1976-09-16 |
| JPS5757445B2 (ca) | 1982-12-04 |
| YU215681A (en) | 1982-08-31 |
| PH11491A (en) | 1978-02-01 |
| US4059623A (en) | 1977-11-22 |
| IE39284B1 (en) | 1978-09-13 |
| FR2233317A1 (ca) | 1975-01-10 |
| DK314374A (ca) | 1975-02-03 |
| AR216040A1 (es) | 1979-11-30 |
| PL94958B1 (ca) | 1977-09-30 |
| IL45017A (en) | 1978-01-31 |
| IT1049223B (it) | 1981-01-20 |
| YU166674A (en) | 1982-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2552811B2 (ja) | 殺虫作用のあるフェニルヒドラジン誘導体 | |
| DE3779836T4 (de) | Iodopropargylcarbamat-Derivate, Herstellungsverfahren und fungizide Mittel, die diese Verbindungen enthalten. | |
| CS197232B2 (en) | Insecticide means notably against the plant louses and method of making the active substance | |
| DE3782931T2 (de) | Mittel zur erzeugung einer maennlichen sterilitaet in pflanzen. | |
| US7511029B2 (en) | Pesticidal diazene oxide carboxylates | |
| GB1596224A (en) | Substituted benzene-1,3-diurethanes and their use as herbicides and fungicides | |
| EP0263958B1 (en) | 4-substituted-2,6-diphenylpyridine derivatives, use thereof, production of the same, chemical intermediates therein and herbicides | |
| CN115417791B (zh) | 一种肟醚类1,3-环己二酮化合物及其合成方法和应用 | |
| EP0010692B1 (de) | Neue m-Anilidurethane, sie enthaltende Herbizide und Verfahren zu deren Herstellung, sowie Verfahren zur Bekämpfung von unerwünschtem Pflanzenwuchs | |
| EP0770067B1 (de) | Substituierte zimtoxim- und zimthydroxamid-derivate | |
| EP0090263B1 (en) | Carbamate derivatives, process for producing the same and herbicides comprising the compounds as an effective component | |
| DE2758172A1 (de) | Thiophosphorylguanidine zur bekaempfung von schaedlingen | |
| US3495968A (en) | Herbicidal composition and method of use | |
| CS208667B2 (en) | Herbicide means and method of making the active substances | |
| US3885954A (en) | Meta-3-alkoxyureidophenyl N-haloalkyl carbamates as herbicides | |
| JP2570343B2 (ja) | カーバメイト誘導体 | |
| US4343803A (en) | 2-Trichloromethyl-4-pyrimidinyl carbamates and their use as fungicides | |
| JPS5844643B2 (ja) | シンキナジヨソウザイ | |
| KR820000176B1 (ko) | 우레아 유도체의 제조 방법 | |
| JPS5837281B2 (ja) | シンキナジヨソウザイ | |
| US4151296A (en) | Butyramides and butyrates | |
| US5543404A (en) | Pesticidal phenylhydrazinephosphates | |
| JPS59216874A (ja) | カ−バメ−ト誘導体 | |
| JPS5844642B2 (ja) | シクロヘキサン誘導体除草剤 | |
| EP0034205A1 (de) | Fungizide Sulfonyl- bzw. Sulfinylacetanilide, Verfahren zu ihrer Herstellung und diese enthaltende Schädlingsbekämpfungsmittel |