CS196399B2 - Process for preparing 2-substituted 1-/omega-amino-alkoxy/-benzenes - Google Patents
Process for preparing 2-substituted 1-/omega-amino-alkoxy/-benzenes Download PDFInfo
- Publication number
- CS196399B2 CS196399B2 CS778089A CS808977A CS196399B2 CS 196399 B2 CS196399 B2 CS 196399B2 CS 778089 A CS778089 A CS 778089A CS 808977 A CS808977 A CS 808977A CS 196399 B2 CS196399 B2 CS 196399B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- formula
- group
- substituted
- compounds
- iii
- Prior art date
Links
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
- 150000001555 benzenes Chemical class 0.000 claims abstract description 8
- -1 1-piperazinyl Chemical group 0.000 claims description 73
- 150000001875 compounds Chemical class 0.000 claims description 29
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 27
- 239000002253 acid Substances 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 13
- 150000003839 salts Chemical class 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 10
- 230000008569 process Effects 0.000 claims description 10
- 150000001412 amines Chemical class 0.000 claims description 9
- 125000005843 halogen group Chemical group 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 125000006527 (C1-C5) alkyl group Chemical group 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 239000007858 starting material Substances 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- ZZLCFHIKESPLTH-UHFFFAOYSA-N 4-Methylbiphenyl Chemical compound C1=CC(C)=CC=C1C1=CC=CC=C1 ZZLCFHIKESPLTH-UHFFFAOYSA-N 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 239000000935 antidepressant agent Substances 0.000 abstract description 10
- 229940005513 antidepressants Drugs 0.000 abstract description 8
- 239000008177 pharmaceutical agent Substances 0.000 abstract 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 15
- 239000000243 solution Substances 0.000 description 12
- 230000000694 effects Effects 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000004480 active ingredient Substances 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- 230000001430 anti-depressive effect Effects 0.000 description 6
- 150000003254 radicals Chemical group 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 241000699670 Mus sp. Species 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- KRMDCWKBEZIMAB-UHFFFAOYSA-N amitriptyline Chemical compound C1CC2=CC=CC=C2C(=CCCN(C)C)C2=CC=CC=C21 KRMDCWKBEZIMAB-UHFFFAOYSA-N 0.000 description 4
- 229960000836 amitriptyline Drugs 0.000 description 4
- 230000001078 anti-cholinergic effect Effects 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000000891 anti-reserpine Effects 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 239000003937 drug carrier Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 229910000039 hydrogen halide Inorganic materials 0.000 description 3
- 239000012433 hydrogen halide Substances 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 235000019198 oils Nutrition 0.000 description 3
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- DNXIKVLOVZVMQF-UHFFFAOYSA-N (3beta,16beta,17alpha,18beta,20alpha)-17-hydroxy-11-methoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]-yohimban-16-carboxylic acid, methyl ester Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(C(=O)OC)C(O)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 DNXIKVLOVZVMQF-UHFFFAOYSA-N 0.000 description 2
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- LCQMZZCPPSWADO-UHFFFAOYSA-N Reserpilin Natural products COC(=O)C1COCC2CN3CCc4c([nH]c5cc(OC)c(OC)cc45)C3CC12 LCQMZZCPPSWADO-UHFFFAOYSA-N 0.000 description 2
- QEVHRUUCFGRFIF-SFWBKIHZSA-N Reserpine Natural products O=C(OC)[C@@H]1[C@H](OC)[C@H](OC(=O)c2cc(OC)c(OC)c(OC)c2)C[C@H]2[C@@H]1C[C@H]1N(C2)CCc2c3c([nH]c12)cc(OC)cc3 QEVHRUUCFGRFIF-SFWBKIHZSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 230000001773 anti-convulsant effect Effects 0.000 description 2
- 239000001961 anticonvulsive agent Substances 0.000 description 2
- 229960003965 antiepileptics Drugs 0.000 description 2
- 210000003169 central nervous system Anatomy 0.000 description 2
- 239000000812 cholinergic antagonist Substances 0.000 description 2
- 230000003001 depressive effect Effects 0.000 description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 2
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- 231100000053 low toxicity Toxicity 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 239000012057 packaged powder Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- QEVHRUUCFGRFIF-MDEJGZGSSA-N reserpine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C(C5=CC=C(OC)C=C5N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 QEVHRUUCFGRFIF-MDEJGZGSSA-N 0.000 description 2
- 229960003147 reserpine Drugs 0.000 description 2
- MDMGHDFNKNZPAU-UHFFFAOYSA-N roserpine Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(OC(C)=O)C(OC)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 MDMGHDFNKNZPAU-UHFFFAOYSA-N 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- 125000004149 thio group Chemical group *S* 0.000 description 2
- 125000006559 (C1-C3) alkylamino group Chemical group 0.000 description 1
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 1
- MQCPOLNSJCWPGT-UHFFFAOYSA-N 2,2'-Bisphenol F Chemical compound OC1=CC=CC=C1CC1=CC=CC=C1O MQCPOLNSJCWPGT-UHFFFAOYSA-N 0.000 description 1
- FLAJYIKIPQZYAY-UHFFFAOYSA-N 2,4-dibromo-6-phenylphenol Chemical group OC1=C(Br)C=C(Br)C=C1C1=CC=CC=C1 FLAJYIKIPQZYAY-UHFFFAOYSA-N 0.000 description 1
- ZIXTUODBTCADKZ-UHFFFAOYSA-N 2,4-dimethyl-6-phenylphenol Chemical group CC1=CC(C)=C(O)C(C=2C=CC=CC=2)=C1 ZIXTUODBTCADKZ-UHFFFAOYSA-N 0.000 description 1
- VXHYVVAUHMGCEX-UHFFFAOYSA-N 2-(2-hydroxyphenoxy)phenol Chemical compound OC1=CC=CC=C1OC1=CC=CC=C1O VXHYVVAUHMGCEX-UHFFFAOYSA-N 0.000 description 1
- HQNCHQRPPCLSCC-UHFFFAOYSA-N 2-(2-phenylphenoxy)ethanamine Chemical group NCCOC1=CC=CC=C1C1=CC=CC=C1 HQNCHQRPPCLSCC-UHFFFAOYSA-N 0.000 description 1
- IFUWFRSMPFMYOR-UHFFFAOYSA-N 2-(4-chlorophenoxy)phenol Chemical compound OC1=CC=CC=C1OC1=CC=C(Cl)C=C1 IFUWFRSMPFMYOR-UHFFFAOYSA-N 0.000 description 1
- NCKMMSIFQUPKCK-UHFFFAOYSA-N 2-benzyl-4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1CC1=CC=CC=C1 NCKMMSIFQUPKCK-UHFFFAOYSA-N 0.000 description 1
- 125000003635 2-dimethylaminoethoxy group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])O* 0.000 description 1
- ADHVILAGEGKWDE-UHFFFAOYSA-N 2-ethyl-6-phenylphenol Chemical group CCC1=CC=CC(C=2C=CC=CC=2)=C1O ADHVILAGEGKWDE-UHFFFAOYSA-N 0.000 description 1
- MILSYCKGLDDVLM-UHFFFAOYSA-N 2-phenylpropan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)C1=CC=CC=C1 MILSYCKGLDDVLM-UHFFFAOYSA-N 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 208000020401 Depressive disease Diseases 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 229920000715 Mucilage Polymers 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical class CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 241000906446 Theraps Species 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical class OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 239000010775 animal oil Substances 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000008135 aqueous vehicle Substances 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003874 central nervous system depressant Substances 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 125000006840 diphenylmethane group Chemical class 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 230000002631 hypothermal effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- 239000006194 liquid suspension Substances 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 230000003387 muscular Effects 0.000 description 1
- COMYJNPWDUUIDJ-UHFFFAOYSA-N n,n-diethyl-2-(2-phenylphenoxy)ethanamine;hydrochloride Chemical group Cl.CCN(CC)CCOC1=CC=CC=C1C1=CC=CC=C1 COMYJNPWDUUIDJ-UHFFFAOYSA-N 0.000 description 1
- RTXWMOWAQZKQNT-UHFFFAOYSA-N n,n-dimethyl-3-(2-phenylphenoxy)propan-1-amine Chemical group CN(C)CCCOC1=CC=CC=C1C1=CC=CC=C1 RTXWMOWAQZKQNT-UHFFFAOYSA-N 0.000 description 1
- CGUSPWBLTPDBPU-UHFFFAOYSA-N n-[2-(2-phenylphenoxy)ethyl]pentan-1-amine Chemical group CCCCCNCCOC1=CC=CC=C1C1=CC=CC=C1 CGUSPWBLTPDBPU-UHFFFAOYSA-N 0.000 description 1
- QBSQMYLAIVQWAN-UHFFFAOYSA-N n-ethyl-2-(2-phenylphenoxy)ethanamine Chemical group CCNCCOC1=CC=CC=C1C1=CC=CC=C1 QBSQMYLAIVQWAN-UHFFFAOYSA-N 0.000 description 1
- 230000007971 neurological deficit Effects 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000002831 pharmacologic agent Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 230000006461 physiological response Effects 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000003549 soybean oil Substances 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M toluenesulfonate group Chemical group C=1(C(=CC=CC1)S(=O)(=O)[O-])C LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- 238000012345 traction test Methods 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/088—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP51146254A JPS5935388B2 (ja) | 1976-12-06 | 1976-12-06 | 2−(ωアミノアルコキシ)ジフエニル誘導体及びその製造法 |
| JP15163276A JPS5946499B2 (ja) | 1976-12-17 | 1976-12-17 | 1−(オメガ−アミノアルコキシ)−2−置換ベンゼン類 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS196399B2 true CS196399B2 (en) | 1980-03-31 |
Family
ID=26477133
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS778089A CS196399B2 (en) | 1976-12-06 | 1977-12-05 | Process for preparing 2-substituted 1-/omega-amino-alkoxy/-benzenes |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4562211A (enExample) |
| CA (1) | CA1086733A (enExample) |
| CH (1) | CH631963A5 (enExample) |
| CS (1) | CS196399B2 (enExample) |
| DE (1) | DE2754029C2 (enExample) |
| DK (1) | DK154071C (enExample) |
| FR (1) | FR2372792A1 (enExample) |
| GB (1) | GB1551878A (enExample) |
| HU (1) | HU175134B (enExample) |
| NL (1) | NL188283C (enExample) |
| SE (1) | SE443778B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3233828A1 (de) * | 1982-09-11 | 1984-03-15 | Basf Ag, 6700 Ludwigshafen | Aryloxyalkylamine, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses |
| FR2555573A1 (fr) * | 1983-11-29 | 1985-05-31 | Irceba | Derives de b-(2-(halogenobenzyl)-phenoxy)-ethylamine, procede de preparation et utilisation en therapeutique |
| FR2569186B1 (fr) * | 1984-08-20 | 1986-09-05 | Lafon Labor | Derives de 1-(n-(a-amino-a-methylacetyl)-aminophenyl)-2-amino-propanone, procede de preparation et utilisation en therapeutique |
| DK368687A (da) * | 1986-11-21 | 1988-05-22 | Cheminova As | Aminoalkylerede hydroxyforbindelser og deres anvendelse som fungicider |
| IT1240598B (it) * | 1990-03-13 | 1993-12-17 | Mini Ricerca Scient Tecnolog | Derivati amminici ad azione antifungina |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2534236A (en) * | 1949-05-14 | 1950-12-19 | Searle & Co | 8-haloxanthine salts of dialkylaminoalkyl 0-benzylphenyl ethers and the production thereof |
| DE1053523B (de) * | 1949-11-14 | 1959-03-26 | Bristol Lab Inc | Verfahren zur Herstellung neuer therapeutisch wirksamer Verbindungen |
| US2703324A (en) * | 1950-08-30 | 1955-03-01 | Bristol Lab Inc | Basic ethers of aralkyl phenols and salts thereof |
| NL83750C (enExample) * | 1951-02-05 | |||
| US2966518A (en) * | 1957-07-22 | 1960-12-27 | Bristol Myers Co | Process of producing nitrtogen-containing chemical compounds |
| US2935439A (en) * | 1957-11-25 | 1960-05-03 | Abbott Lab | Method of inhibiting growth of fungi |
| GB1133334A (en) * | 1965-04-02 | 1968-11-13 | Vantorex Ltd | Stilbene ethers and their preparation |
| CH563336A5 (enExample) * | 1972-01-28 | 1975-06-30 | Robins Co Inc A H | |
| US4024282A (en) * | 1975-11-25 | 1977-05-17 | Mitsubishi Chemical Industries Ltd. | Pharmaceutically active 2-(3-alkylaminopropoxy)diphenylmethanes |
| DE2627227A1 (de) * | 1975-06-19 | 1976-12-30 | Mitsubishi Chem Ind | Orthosubstituierte phenoxyalkylamino-derivate |
| US4060641A (en) * | 1975-11-25 | 1977-11-29 | Mitsubishi Chemical Industries Ltd. | Pharmaceutically active 2-(3-alkylaminopropoxy)diphenylmethanes |
-
1977
- 1977-11-21 CA CA291,324A patent/CA1086733A/en not_active Expired
- 1977-12-02 SE SE7713700A patent/SE443778B/xx unknown
- 1977-12-02 DK DK539977A patent/DK154071C/da not_active IP Right Cessation
- 1977-12-05 DE DE2754029A patent/DE2754029C2/de not_active Expired
- 1977-12-05 CS CS778089A patent/CS196399B2/cs unknown
- 1977-12-05 CH CH1485077A patent/CH631963A5/de not_active IP Right Cessation
- 1977-12-05 HU HU77MI624A patent/HU175134B/hu not_active IP Right Cessation
- 1977-12-05 NL NLAANVRAGE7713438,A patent/NL188283C/xx not_active IP Right Cessation
- 1977-12-05 GB GB50584/77A patent/GB1551878A/en not_active Expired
- 1977-12-06 FR FR7736695A patent/FR2372792A1/fr active Granted
-
1979
- 1979-11-16 US US06/094,762 patent/US4562211A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DK154071B (da) | 1988-10-10 |
| GB1551878A (en) | 1979-09-05 |
| FR2372792A1 (fr) | 1978-06-30 |
| FR2372792B1 (enExample) | 1980-06-13 |
| DK154071C (da) | 1989-03-06 |
| DE2754029C2 (de) | 1987-04-23 |
| SE443778B (sv) | 1986-03-10 |
| DK539977A (da) | 1978-06-07 |
| SE7713700L (sv) | 1978-06-07 |
| NL188283B (nl) | 1991-12-16 |
| US4562211A (en) | 1985-12-31 |
| NL188283C (nl) | 1992-05-18 |
| CA1086733A (en) | 1980-09-30 |
| DE2754029A1 (de) | 1978-06-08 |
| HU175134B (hu) | 1980-05-28 |
| NL7713438A (nl) | 1978-06-08 |
| CH631963A5 (de) | 1982-09-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0004066B1 (en) | 2-(4-aminobutoxy)stilbenes and pharmaceutical compositions containing these substances | |
| EP0411912B1 (en) | Coumarin derivatives, their preparation and their use in the treatment of cerebrovascular disorders | |
| CS196399B2 (en) | Process for preparing 2-substituted 1-/omega-amino-alkoxy/-benzenes | |
| US4024282A (en) | Pharmaceutically active 2-(3-alkylaminopropoxy)diphenylmethanes | |
| RU2060249C1 (ru) | Полициклические биоцидные соединения и фармацевтическая композиция на их основе | |
| CS236680B2 (en) | Manufacturing process of imidazoazepine,oxazepine,or thiazepine derivatives | |
| DK154070B (da) | Analogifremgangsmaade til fremstilling af 2-substituerede 1-(omega-aminoalkoxy)benzenderivater | |
| US4071559A (en) | Pharmaceutically active 2-omega-aminoalkoxydiphenyls | |
| EP0001759B1 (en) | (omega-aminoalkoxy) bibenzyls, processes for their preparation and pharmaceutical compositions containing these substances | |
| US4866073A (en) | Acridinylmethylamino derivatives and pharmaceutical compositions containing them | |
| US4060641A (en) | Pharmaceutically active 2-(3-alkylaminopropoxy)diphenylmethanes | |
| JPS606349B2 (ja) | 2―(ω‐アミノアルコキシ)ジフエニルメタン類 | |
| AU622506B2 (en) | Novel derivatives of 1,7-(imidazo-(1,2-a)pyridine)5'-6'h) ones | |
| US4100299A (en) | Pharmaceutically active 2-omega-aminoalkoxydiphenylmethylmethanes | |
| US4061776A (en) | Pharmaceutically active 2-omega-aminoalkoxydiphenyl ethers | |
| US4060612A (en) | Pharmaceutically active 2-omega-aminoalkoxydiphenyl sulfides | |
| US4843085A (en) | Pyridine derivatives, process for production thereof and pharmaceutical compositions useful as anti-arhytmics | |
| US5721272A (en) | Intermediates and their use to prepare N,N'-bridged bisindolylmaleimides | |
| US3121724A (en) | Aminoalkyl ethers of 6-halobenzyl-5-indanol and 7-halobenzyl-4-indanol | |
| EP0004018B1 (en) | 1-oxa-4-aza-2,6-disilacyclohexanes, their production and use as muscle relaxants and pharmaceutical compositions containing them | |
| US4091114A (en) | Pharmaceutically active 2-omega-aminoalkoxydiphenylmethanes | |
| US3701786A (en) | Dibenzofuranyl-aminoalcohols | |
| JPH0631231B2 (ja) | 抗精神病性4―[4―(3―ベンズイソチアゾリル)―1―ピペラジニルブチル架橋二環式イミド | |
| DK166497B1 (da) | Ammoniumsalte afledt af hexahydrodibenzooeb,eaaoe1,4aadioxin samt mellemprodukter | |
| US3911021A (en) | 1-Alkoxy-1-aryl-2,3-butadienes |