CH676993A5 - - Google Patents
Download PDFInfo
- Publication number
- CH676993A5 CH676993A5 CH3267/87A CH326787A CH676993A5 CH 676993 A5 CH676993 A5 CH 676993A5 CH 3267/87 A CH3267/87 A CH 3267/87A CH 326787 A CH326787 A CH 326787A CH 676993 A5 CH676993 A5 CH 676993A5
- Authority
- CH
- Switzerland
- Prior art keywords
- cleaning agent
- alkali
- ionic surfactant
- use according
- acid
- Prior art date
Links
- 239000002736 nonionic surfactant Substances 0.000 claims description 74
- 239000000203 mixture Substances 0.000 claims description 73
- 239000007788 liquid Substances 0.000 claims description 43
- 239000012459 cleaning agent Substances 0.000 claims description 40
- 239000003599 detergent Substances 0.000 claims description 40
- 239000002253 acid Substances 0.000 claims description 36
- -1 alkylene glycol monoalkyl ether Chemical class 0.000 claims description 23
- 239000003513 alkali Substances 0.000 claims description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 20
- 239000003795 chemical substances by application Substances 0.000 claims description 16
- 229920000388 Polyphosphate Polymers 0.000 claims description 15
- 239000001205 polyphosphate Substances 0.000 claims description 15
- 235000011176 polyphosphates Nutrition 0.000 claims description 15
- 150000003839 salts Chemical class 0.000 claims description 15
- 238000005406 washing Methods 0.000 claims description 15
- 102000004190 Enzymes Human genes 0.000 claims description 14
- 108090000790 Enzymes Proteins 0.000 claims description 14
- 150000003014 phosphoric acid esters Chemical class 0.000 claims description 14
- 239000012190 activator Substances 0.000 claims description 13
- 238000004851 dishwashing Methods 0.000 claims description 13
- 239000004094 surface-active agent Substances 0.000 claims description 13
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 12
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 12
- 159000000000 sodium salts Chemical class 0.000 claims description 12
- FRPJTGXMTIIFIT-UHFFFAOYSA-N tetraacetylethylenediamine Chemical compound CC(=O)C(N)(C(C)=O)C(N)(C(C)=O)C(C)=O FRPJTGXMTIIFIT-UHFFFAOYSA-N 0.000 claims description 12
- 239000000126 substance Substances 0.000 claims description 11
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 claims description 10
- 229910052910 alkali metal silicate Inorganic materials 0.000 claims description 9
- 229920003145 methacrylic acid copolymer Polymers 0.000 claims description 9
- 239000007844 bleaching agent Substances 0.000 claims description 8
- 238000004140 cleaning Methods 0.000 claims description 8
- 239000003352 sequestering agent Substances 0.000 claims description 8
- 239000002518 antifoaming agent Substances 0.000 claims description 7
- 229940090960 diethylenetriamine pentamethylene phosphonic acid Drugs 0.000 claims description 7
- 239000011521 glass Substances 0.000 claims description 7
- 239000002304 perfume Substances 0.000 claims description 6
- 239000004115 Sodium Silicate Substances 0.000 claims description 5
- 235000019795 sodium metasilicate Nutrition 0.000 claims description 4
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 claims description 4
- 229910052911 sodium silicate Inorganic materials 0.000 claims description 4
- 239000002608 ionic liquid Substances 0.000 claims description 2
- 230000003287 optical effect Effects 0.000 claims description 2
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 claims 1
- 238000009472 formulation Methods 0.000 description 27
- 235000019832 sodium triphosphate Nutrition 0.000 description 25
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 18
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 16
- 150000002148 esters Chemical class 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- 150000001875 compounds Chemical class 0.000 description 13
- 239000002245 particle Substances 0.000 description 13
- 229940088598 enzyme Drugs 0.000 description 12
- 125000004432 carbon atom Chemical group C* 0.000 description 11
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 10
- 150000002191 fatty alcohols Chemical class 0.000 description 10
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 9
- 238000004061 bleaching Methods 0.000 description 8
- 239000006260 foam Substances 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 7
- 239000004615 ingredient Substances 0.000 description 7
- HWGNBUXHKFFFIH-UHFFFAOYSA-I pentasodium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O HWGNBUXHKFFFIH-UHFFFAOYSA-I 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- 229940014800 succinic anhydride Drugs 0.000 description 7
- XSVSPKKXQGNHMD-UHFFFAOYSA-N 5-bromo-3-methyl-1,2-thiazole Chemical compound CC=1C=C(Br)SN=1 XSVSPKKXQGNHMD-UHFFFAOYSA-N 0.000 description 6
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical class CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 229920002125 Sokalan® Polymers 0.000 description 6
- 238000000227 grinding Methods 0.000 description 6
- 239000007800 oxidant agent Substances 0.000 description 6
- 239000002562 thickening agent Substances 0.000 description 6
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 5
- 108091005804 Peptidases Proteins 0.000 description 5
- 230000002378 acidificating effect Effects 0.000 description 5
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000011575 calcium Substances 0.000 description 5
- 229910052791 calcium Inorganic materials 0.000 description 5
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 5
- DUYCTCQXNHFCSJ-UHFFFAOYSA-N dtpmp Chemical compound OP(=O)(O)CN(CP(O)(O)=O)CCN(CP(O)(=O)O)CCN(CP(O)(O)=O)CP(O)(O)=O DUYCTCQXNHFCSJ-UHFFFAOYSA-N 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- ODBPOHVSVJZQRX-UHFFFAOYSA-M sodium;[2-[2-[bis(phosphonomethyl)amino]ethyl-(phosphonomethyl)amino]ethyl-(phosphonomethyl)amino]methyl-hydroxyphosphinate Chemical compound [Na+].OP(=O)(O)CN(CP(O)(O)=O)CCN(CP(O)(=O)O)CCN(CP(O)(O)=O)CP(O)([O-])=O ODBPOHVSVJZQRX-UHFFFAOYSA-M 0.000 description 5
- 230000009974 thixotropic effect Effects 0.000 description 5
- 239000010457 zeolite Substances 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- 235000005979 Citrus limon Nutrition 0.000 description 4
- 239000004365 Protease Substances 0.000 description 4
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 238000005187 foaming Methods 0.000 description 4
- 239000000499 gel Substances 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 159000000003 magnesium salts Chemical class 0.000 description 4
- 229910021647 smectite Inorganic materials 0.000 description 4
- 230000000087 stabilizing effect Effects 0.000 description 4
- 239000001384 succinic acid Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 3
- 244000131522 Citrus pyriformis Species 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 230000003625 amylolytic effect Effects 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 229960000892 attapulgite Drugs 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000007046 ethoxylation reaction Methods 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- 230000002209 hydrophobic effect Effects 0.000 description 3
- NAFSTSRULRIERK-UHFFFAOYSA-M monosodium urate Chemical compound [Na+].N1C([O-])=NC(=O)C2=C1NC(=O)N2 NAFSTSRULRIERK-UHFFFAOYSA-M 0.000 description 3
- 150000002903 organophosphorus compounds Chemical class 0.000 description 3
- 229910052625 palygorskite Inorganic materials 0.000 description 3
- 235000021317 phosphate Nutrition 0.000 description 3
- 229920000141 poly(maleic anhydride) Polymers 0.000 description 3
- 229920000058 polyacrylate Polymers 0.000 description 3
- 235000019419 proteases Nutrition 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 108010075550 termamyl Proteins 0.000 description 3
- QCAHUFWKIQLBNB-UHFFFAOYSA-N 3-(3-methoxypropoxy)propan-1-ol Chemical compound COCCCOCCCO QCAHUFWKIQLBNB-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- QPCDCPDFJACHGM-UHFFFAOYSA-N N,N-bis{2-[bis(carboxymethyl)amino]ethyl}glycine Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(=O)O)CCN(CC(O)=O)CC(O)=O QPCDCPDFJACHGM-UHFFFAOYSA-N 0.000 description 2
- 102000035195 Peptidases Human genes 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 229910021536 Zeolite Inorganic materials 0.000 description 2
- 229910000323 aluminium silicate Inorganic materials 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229910052681 coesite Inorganic materials 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 229910052906 cristobalite Inorganic materials 0.000 description 2
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- 239000003205 fragrance Substances 0.000 description 2
- 239000003349 gelling agent Substances 0.000 description 2
- 239000008233 hard water Substances 0.000 description 2
- PMYUVOOOQDGQNW-UHFFFAOYSA-N hexasodium;trioxido(trioxidosilyloxy)silane Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[O-][Si]([O-])([O-])O[Si]([O-])([O-])[O-] PMYUVOOOQDGQNW-UHFFFAOYSA-N 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 229910052901 montmorillonite Inorganic materials 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- 229960003330 pentetic acid Drugs 0.000 description 2
- 150000004965 peroxy acids Chemical class 0.000 description 2
- 125000005342 perphosphate group Chemical group 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 235000021395 porridge Nutrition 0.000 description 2
- 230000003405 preventing effect Effects 0.000 description 2
- 150000004760 silicates Chemical class 0.000 description 2
- 229910052682 stishovite Inorganic materials 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 2
- 229910052905 tridymite Inorganic materials 0.000 description 2
- YRIZYWQGELRKNT-UHFFFAOYSA-N 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione Chemical compound ClN1C(=O)N(Cl)C(=O)N(Cl)C1=O YRIZYWQGELRKNT-UHFFFAOYSA-N 0.000 description 1
- QWOZZTWBWQMEPD-UHFFFAOYSA-N 1-(2-ethoxypropoxy)propan-2-ol Chemical compound CCOC(C)COCC(C)O QWOZZTWBWQMEPD-UHFFFAOYSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- PXRKCOCTEMYUEG-UHFFFAOYSA-N 5-aminoisoindole-1,3-dione Chemical compound NC1=CC=C2C(=O)NC(=O)C2=C1 PXRKCOCTEMYUEG-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 108010065511 Amylases Proteins 0.000 description 1
- 102000013142 Amylases Human genes 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 108010004032 Bromelains Proteins 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical group [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- 102000005701 Calcium-Binding Proteins Human genes 0.000 description 1
- 108010045403 Calcium-Binding Proteins Proteins 0.000 description 1
- 244000248349 Citrus limon Species 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- 239000012425 OXONE® Substances 0.000 description 1
- 108090000526 Papain Proteins 0.000 description 1
- 108090000284 Pepsin A Proteins 0.000 description 1
- 102000057297 Pepsin A Human genes 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- 229920002257 Plurafac® Polymers 0.000 description 1
- 229930182556 Polyacetal Natural products 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- 108090000787 Subtilisin Proteins 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 102000004142 Trypsin Human genes 0.000 description 1
- 108090000631 Trypsin Proteins 0.000 description 1
- UAOKXEHOENRFMP-ZJIFWQFVSA-N [(2r,3r,4s,5r)-2,3,4,5-tetraacetyloxy-6-oxohexyl] acetate Chemical compound CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C=O UAOKXEHOENRFMP-ZJIFWQFVSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910001963 alkali metal nitrate Inorganic materials 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- FNAQSUUGMSOBHW-UHFFFAOYSA-H calcium citrate Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O.[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O FNAQSUUGMSOBHW-UHFFFAOYSA-H 0.000 description 1
- 239000001354 calcium citrate Substances 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 238000010668 complexation reaction Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 230000001934 delay Effects 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 229940028356 diethylene glycol monobutyl ether Drugs 0.000 description 1
- UQGFMSUEHSUPRD-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane Chemical compound [Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 UQGFMSUEHSUPRD-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 238000001879 gelation Methods 0.000 description 1
- KWLMIXQRALPRBC-UHFFFAOYSA-L hectorite Chemical compound [Li+].[OH-].[OH-].[Na+].[Mg+2].O1[Si]2([O-])O[Si]1([O-])O[Si]([O-])(O1)O[Si]1([O-])O2 KWLMIXQRALPRBC-UHFFFAOYSA-L 0.000 description 1
- 229910000271 hectorite Inorganic materials 0.000 description 1
- 150000004687 hexahydrates Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229910001425 magnesium ion Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- HWPKGOGLCKPRLZ-UHFFFAOYSA-M monosodium citrate Chemical compound [Na+].OC(=O)CC(O)(C([O-])=O)CC(O)=O HWPKGOGLCKPRLZ-UHFFFAOYSA-M 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical class OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- JCGNDDUYTRNOFT-UHFFFAOYSA-N oxolane-2,4-dione Chemical compound O=C1COC(=O)C1 JCGNDDUYTRNOFT-UHFFFAOYSA-N 0.000 description 1
- 229940055729 papain Drugs 0.000 description 1
- 235000019834 papain Nutrition 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- HJKYXKSLRZKNSI-UHFFFAOYSA-I pentapotassium;hydrogen sulfate;oxido sulfate;sulfuric acid Chemical compound [K+].[K+].[K+].[K+].[K+].OS([O-])(=O)=O.[O-]S([O-])(=O)=O.OS(=O)(=O)O[O-].OS(=O)(=O)O[O-] HJKYXKSLRZKNSI-UHFFFAOYSA-I 0.000 description 1
- 229940111202 pepsin Drugs 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 235000019353 potassium silicate Nutrition 0.000 description 1
- IFIDXBCRSWOUSB-UHFFFAOYSA-N potassium;1,3-dichloro-1,3,5-triazinane-2,4,6-trione Chemical compound [K+].ClN1C(=O)NC(=O)N(Cl)C1=O IFIDXBCRSWOUSB-UHFFFAOYSA-N 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 229910000275 saponite Inorganic materials 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 235000015424 sodium Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 1
- GCLGEJMYGQKIIW-UHFFFAOYSA-H sodium hexametaphosphate Chemical compound [Na]OP1(=O)OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])O1 GCLGEJMYGQKIIW-UHFFFAOYSA-H 0.000 description 1
- 235000019982 sodium hexametaphosphate Nutrition 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- 229940048086 sodium pyrophosphate Drugs 0.000 description 1
- 229910000031 sodium sesquicarbonate Inorganic materials 0.000 description 1
- 235000018341 sodium sesquicarbonate Nutrition 0.000 description 1
- 235000019351 sodium silicates Nutrition 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- MWNQXXOSWHCCOZ-UHFFFAOYSA-L sodium;oxido carbonate Chemical compound [Na+].[O-]OC([O-])=O MWNQXXOSWHCCOZ-UHFFFAOYSA-L 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 229950009390 symclosene Drugs 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 description 1
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 235000013337 tricalcium citrate Nutrition 0.000 description 1
- WCTAGTRAWPDFQO-UHFFFAOYSA-K trisodium;hydrogen carbonate;carbonate Chemical compound [Na+].[Na+].[Na+].OC([O-])=O.[O-]C([O-])=O WCTAGTRAWPDFQO-UHFFFAOYSA-K 0.000 description 1
- 239000012588 trypsin Substances 0.000 description 1
- 229960001322 trypsin Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/20—Organic compounds containing oxygen
- C11D3/2068—Ethers
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/66—Non-ionic compounds
- C11D1/83—Mixtures of non-ionic with anionic compounds
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/0004—Non aqueous liquid compositions comprising insoluble particles
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/0008—Detergent materials or soaps characterised by their shape or physical properties aqueous liquid non soap compositions
- C11D17/0013—Liquid compositions with insoluble particles in suspension
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Emergency Medicine (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/901,221 US4753748A (en) | 1986-08-28 | 1986-08-28 | Nonaqueous liquid automatic dishwashing detergent composition with improved rinse properties and method of use |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH676993A5 true CH676993A5 (en:Method) | 1991-03-28 |
Family
ID=25413775
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH3267/87A CH676993A5 (en:Method) | 1986-08-28 | 1987-08-26 |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4753748A (en:Method) |
| JP (1) | JPS6361098A (en:Method) |
| AU (1) | AU613872B2 (en:Method) |
| BE (1) | BE1003061A3 (en:Method) |
| BR (1) | BR8704400A (en:Method) |
| CA (1) | CA1299052C (en:Method) |
| CH (1) | CH676993A5 (en:Method) |
| DE (1) | DE3727911A1 (en:Method) |
| DK (1) | DK438687A (en:Method) |
| ES (1) | ES2007105A6 (en:Method) |
| FI (1) | FI873731L (en:Method) |
| FR (1) | FR2603301A1 (en:Method) |
| GB (1) | GB2194546B (en:Method) |
| GR (1) | GR871297B (en:Method) |
| IT (1) | IT1211742B (en:Method) |
| LU (1) | LU86978A1 (en:Method) |
| MX (1) | MX163622B (en:Method) |
| NL (1) | NL8702022A (en:Method) |
| NO (1) | NO171991C (en:Method) |
| NZ (1) | NZ221342A (en:Method) |
| PT (1) | PT85580B (en:Method) |
| SE (1) | SE8703300L (en:Method) |
| ZA (1) | ZA875822B (en:Method) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5064553A (en) * | 1989-05-18 | 1991-11-12 | Colgate-Palmolive Co. | Linear-viscoelastic aqueous liquid automatic dishwasher detergent composition |
| US4753748A (en) * | 1986-08-28 | 1988-06-28 | Colgate-Palmolive Company | Nonaqueous liquid automatic dishwashing detergent composition with improved rinse properties and method of use |
| GB8625974D0 (en) * | 1986-10-30 | 1986-12-03 | Unilever Plc | Non-aqueous liquid detergent |
| CA1314186C (en) * | 1988-04-29 | 1993-03-09 | Frederik Jan Schepers | Liquid cleaning products |
| US5164106A (en) * | 1989-04-28 | 1992-11-17 | Colgate-Palmolive Company | Nonaqueous liquid automatic dishwasher detergent composition containing a dual bleach system |
| AU635774B2 (en) * | 1989-10-10 | 1993-04-01 | Colgate-Palmolive Company, The | Nonaqueous liquid automatic dishwasher detergent composition containing a dual bleach system |
| US5120465A (en) * | 1990-02-22 | 1992-06-09 | Dry Branch Kaolin Company | Detergent or cleansing composition and additive for imparting thixotropic properties thereto |
| US5094771A (en) * | 1991-05-07 | 1992-03-10 | Colgate-Palmolive Co. | Nonaqueous liquid automatic dishwasher detergent composition |
| US5240633A (en) * | 1991-05-31 | 1993-08-31 | Colgate-Palmolive Company | Liquid automatic dishwashing composition containing enzymes |
| AU651686B2 (en) * | 1991-05-31 | 1994-07-28 | Colgate-Palmolive Company, The | Nonaqueous liquid automatic dishwashing composition containing enzymes |
| US5318715A (en) * | 1991-05-31 | 1994-06-07 | Colgate-Palmolive Company | Liquid automatic dishwashing composition containing two enzymes |
| AU655261B2 (en) * | 1991-05-31 | 1994-12-08 | Colgate-Palmolive Company, The | Nonaqueous liquid automatic dishwashing composition containing enzymes |
| AU655274B2 (en) * | 1991-05-31 | 1994-12-15 | Colgate-Palmolive Company, The | Nonaqueous liquid, phosphate-free, improved automatic dishwashing composition containing enzymes |
| ATE127515T1 (de) * | 1991-05-31 | 1995-09-15 | Colgate Palmolive Co | Enzyme enthaltenes nichtwässriges flüssiges maschinengeschirrspülmittel. |
| US5618465A (en) * | 1991-05-31 | 1997-04-08 | Colgate Palmolive Co. | Nonaqueous liquid automatic dishwashing composition containing enzymes |
| US5527483A (en) * | 1991-05-31 | 1996-06-18 | Colgate Palmolive Co. | Nonaqueous gelled automatic dishwashing composition containing enzymes |
| US5510048A (en) * | 1991-05-31 | 1996-04-23 | Colgate Palmolive Co. | Nonaqueous liquid, phosphate-free, improved autoamatic dishwashing composition containing enzymes |
| US5527484A (en) * | 1991-05-31 | 1996-06-18 | Colgate-Palmolive Co. | Phosphate containing powdered automatic dishwashing composition with enzymes |
| US5173207A (en) * | 1991-05-31 | 1992-12-22 | Colgate-Palmolive Company | Powered automatic dishwashing composition containing enzymes |
| US5169553A (en) * | 1991-05-31 | 1992-12-08 | Colgate Palmolive Company | Nonaqueous liquid, phosphate-free, improved automatic dishwashing composition containing enzymes |
| US5545344A (en) * | 1991-05-31 | 1996-08-13 | Colgate-Palmolive Co. | Nonaqueous liquid, improved automatic dishwashing composition containing enzymes |
| EP0517311A1 (en) | 1991-06-07 | 1992-12-09 | Colgate-Palmolive Company | Linear viscoelastic aqueous liquid automatic dishwasher detergent composition |
| US5256327A (en) * | 1991-08-01 | 1993-10-26 | Shaklee Corporation | Method of preparing a sequestering agent for a non-phosphate cleaning composition |
| GB9124489D0 (en) * | 1991-11-18 | 1992-01-08 | Unilever Plc | Liquid cleaning products |
| US5559089A (en) * | 1992-03-12 | 1996-09-24 | The Procter & Gamble Company | Low-dosage automatic dishwashing detergent with monopersulfate and enzymes |
| US5898025A (en) * | 1992-09-25 | 1999-04-27 | Henkel Kommanditgesellschaft Auf Aktien | Mildly alkaline dishwashing detergents |
| ES2133775T3 (es) * | 1994-06-23 | 1999-09-16 | Unilever Nv | Composiciones para el lavado de vajillas. |
| US5858117A (en) * | 1994-08-31 | 1999-01-12 | Ecolab Inc. | Proteolytic enzyme cleaner |
| EP0888441B1 (en) * | 1996-03-19 | 2004-10-06 | The Procter & Gamble Company | Process of manufacturing of built automatic dishwashing compositions comprising blooming perfume |
| US5876514A (en) * | 1997-01-23 | 1999-03-02 | Ecolab Inc. | Warewashing system containing nonionic surfactant that performs both a cleaning and sheeting function and a method of warewashing |
| DE19822939A1 (de) * | 1998-05-22 | 1999-11-25 | Henkel Kgaa | Nichtwäßrige viskose Geschirreinigungsmittel |
| AU2001263437B2 (en) | 2000-06-05 | 2005-08-11 | S.C. Johnson & Son, Inc. | Biocidal cleaner composition |
| US20020142931A1 (en) * | 2000-07-19 | 2002-10-03 | The Procter & Gamble Company | Gel form automatic dishwashing compositions, methods of preparation and use thereof |
| EP1479756B1 (en) * | 2000-11-27 | 2005-09-07 | The Procter & Gamble Company | Dishwashing method |
| EP1553160B1 (en) * | 2003-12-29 | 2007-10-17 | The Procter & Gamble Company | Rinse aid compositions |
| CN101679987A (zh) | 2007-03-09 | 2010-03-24 | 丹尼斯科美国公司 | 嗜碱芽孢杆菌物种α-淀粉酶变体、包括α-淀粉酶变体的组合物以及使用方法 |
| WO2009149395A2 (en) | 2008-06-06 | 2009-12-10 | Danisco Us Inc., Genencor Division | Variant alpha-amylases from bacillus subtilis and methods of use, thereof |
| JP5599113B2 (ja) | 2008-06-06 | 2014-10-01 | ダニスコ・ユーエス・インク | 糖化酵素組成物及びその糖化方法 |
| CN102112621A (zh) | 2008-06-06 | 2011-06-29 | 丹尼斯科美国公司 | 用来自枯草芽孢杆菌的α-淀粉酶从淀粉产生葡萄糖 |
| DK2337837T4 (en) | 2008-09-25 | 2017-02-06 | Danisco Us Inc | ALPHA-AMYLASE MIXTURES AND PROCEDURES FOR USING IT |
| CA2778471A1 (en) | 2009-10-23 | 2011-04-28 | Danisco Us Inc. | Methods for reducing blue saccharide |
| US9745543B2 (en) | 2012-09-10 | 2017-08-29 | Ecolab Usa Inc. | Stable liquid manual dishwashing compositions containing enzymes |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE381672B (sv) * | 1971-07-15 | 1975-12-15 | Mo Och Domsjoe Ab | Flytande tvettmedelskomposition |
| CA1112534A (en) * | 1976-11-03 | 1981-11-17 | John Pardo | Detergent article for use in automatic dishwasher |
| US4115308A (en) * | 1976-12-27 | 1978-09-19 | The Procter & Gamble Company | High-shear process for preparing silicate-containing paste-form detergent compositions |
| NO781898L (no) * | 1977-06-09 | 1978-12-12 | Ici Ltd | Flytende vaskemiddelblanding. |
| EP0028849B1 (en) * | 1979-11-09 | 1983-09-28 | Unilever N.V. | Non-aqueous, built liquid detergent composition and method for preparing same |
| US4264466A (en) * | 1980-02-14 | 1981-04-28 | The Procter & Gamble Company | Mulls containing chain structure clay suspension aids |
| GB8308508D0 (en) * | 1983-03-28 | 1983-05-05 | Ici Plc | Detergent compositions |
| GB2158454B (en) * | 1984-04-06 | 1988-05-18 | Colgate Palmolive Co | Liquid laundry detergent composition |
| GB2158838B (en) * | 1984-04-06 | 1987-10-28 | Colgate Palmolive Co | Liquid bleaching laundry detergent composition |
| ZA852197B (en) * | 1984-04-06 | 1986-11-26 | Colgate Palmolive Co | Liquid laundry detergent composition containing polyphosphate |
| US4753750A (en) * | 1984-12-31 | 1988-06-28 | Delaware | Liquid laundry detergent composition and method of use |
| US4622173A (en) * | 1984-12-31 | 1986-11-11 | Colgate-Palmolive Co. | Non-aqueous liquid laundry detergents containing three surfactants including a polycarboxylic acid ester of a non-ionic |
| US4744916A (en) * | 1985-07-18 | 1988-05-17 | Colgate-Palmolive Company | Non-gelling non-aqueous liquid detergent composition containing higher fatty dicarboxylic acid and method of use |
| US4767558A (en) * | 1985-08-05 | 1988-08-30 | Colgate-Palmolive Company | Low phosphate or phosphate free nonaqueous liquid nonionic laundry detergent composition and method of use |
| US4647393A (en) * | 1985-08-05 | 1987-03-03 | Colgate-Palmolive Company | Low phosphate or phosphate free nonaqueous liquid nonionic laundry detergent composition and method of use |
| US4648983A (en) * | 1985-08-20 | 1987-03-10 | Colgate-Palmolive Company | Built non aqueous liquid nonionic laundry detergent composition containing urea stabilizer and method of use |
| US4753748A (en) * | 1986-08-28 | 1988-06-28 | Colgate-Palmolive Company | Nonaqueous liquid automatic dishwashing detergent composition with improved rinse properties and method of use |
-
1986
- 1986-08-28 US US06/901,221 patent/US4753748A/en not_active Expired - Fee Related
-
1987
- 1987-08-04 NZ NZ221342A patent/NZ221342A/xx unknown
- 1987-08-06 AU AU76638/87A patent/AU613872B2/en not_active Ceased
- 1987-08-06 ZA ZA875822A patent/ZA875822B/xx unknown
- 1987-08-11 MX MX7715A patent/MX163622B/es unknown
- 1987-08-19 GR GR871297A patent/GR871297B/el unknown
- 1987-08-21 DK DK438687A patent/DK438687A/da not_active Application Discontinuation
- 1987-08-21 DE DE19873727911 patent/DE3727911A1/de not_active Withdrawn
- 1987-08-21 GB GB8719788A patent/GB2194546B/en not_active Expired - Lifetime
- 1987-08-25 FR FR8711914A patent/FR2603301A1/fr not_active Withdrawn
- 1987-08-25 PT PT85580A patent/PT85580B/pt not_active IP Right Cessation
- 1987-08-25 CA CA000545270A patent/CA1299052C/en not_active Expired - Lifetime
- 1987-08-26 CH CH3267/87A patent/CH676993A5/de not_active IP Right Cessation
- 1987-08-26 SE SE8703300A patent/SE8703300L/ not_active Application Discontinuation
- 1987-08-27 ES ES8702485A patent/ES2007105A6/es not_active Expired
- 1987-08-27 BR BR8704400A patent/BR8704400A/pt not_active Application Discontinuation
- 1987-08-27 IT IT8748331A patent/IT1211742B/it active
- 1987-08-27 FI FI873731A patent/FI873731L/fi not_active Application Discontinuation
- 1987-08-27 NO NO873627A patent/NO171991C/no unknown
- 1987-08-28 JP JP62214961A patent/JPS6361098A/ja active Pending
- 1987-08-28 BE BE8700955A patent/BE1003061A3/fr not_active IP Right Cessation
- 1987-08-28 NL NL8702022A patent/NL8702022A/nl not_active Application Discontinuation
- 1987-08-28 LU LU86978A patent/LU86978A1/fr unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BR8704400A (pt) | 1988-04-19 |
| GR871297B (en) | 1988-01-12 |
| IT8748331A0 (it) | 1987-08-27 |
| BE1003061A3 (fr) | 1991-11-12 |
| NO171991C (no) | 1993-05-26 |
| FI873731A7 (fi) | 1988-02-29 |
| IT1211742B (it) | 1989-11-03 |
| FI873731A0 (fi) | 1987-08-27 |
| MX163622B (es) | 1992-06-08 |
| US4753748A (en) | 1988-06-28 |
| SE8703300D0 (sv) | 1987-08-26 |
| ES2007105A6 (es) | 1989-06-01 |
| SE8703300L (sv) | 1988-03-01 |
| AU7663887A (en) | 1988-03-03 |
| ZA875822B (en) | 1989-03-29 |
| LU86978A1 (fr) | 1988-03-02 |
| FR2603301A1 (fr) | 1988-03-04 |
| AU613872B2 (en) | 1991-08-15 |
| NO171991B (no) | 1993-02-15 |
| CA1299052C (en) | 1992-04-21 |
| DK438687D0 (da) | 1987-08-21 |
| GB2194546A (en) | 1988-03-09 |
| GB8719788D0 (en) | 1987-09-30 |
| NO873627L (no) | 1988-02-29 |
| DE3727911A1 (de) | 1988-03-03 |
| JPS6361098A (ja) | 1988-03-17 |
| DK438687A (da) | 1988-03-01 |
| FI873731L (fi) | 1988-02-29 |
| NL8702022A (nl) | 1988-03-16 |
| NZ221342A (en) | 1989-08-29 |
| PT85580A (en) | 1987-09-01 |
| GB2194546B (en) | 1990-07-04 |
| PT85580B (pt) | 1990-05-31 |
| NO873627D0 (no) | 1987-08-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH676993A5 (en:Method) | ||
| AT396114B (de) | Waschmittel | |
| EP1076683B1 (de) | Festes maschinelles geschirrspülmittel mit phosphat und kristallinen schichtförmigen silikaten | |
| AT395166B (de) | Vollwaschmittel | |
| AT394375B (de) | Fluessige waschmittelzusammensetzung | |
| DE3728256A1 (de) | Nicht-waessrige fluessige bleichmittelverstaerkende zusammensetzung | |
| DE3704903A1 (de) | Waschmittelzusammensetzung zum reinigen und weichmachen von textilien | |
| CH674371A5 (en:Method) | ||
| CH671234A5 (en:Method) | ||
| DE3829087A1 (de) | Nichtwaessrige, fluessige textilwaschmittelzusammensetzung und verfahren zu ihrer verwendung | |
| DE3728047A1 (de) | Zusammensetzung zum behandeln und reinigen von textilien, diese enthaltendes vollwaschmittel und anwendung | |
| CH672499A5 (en:Method) | ||
| AT395168B (de) | Nichtwaesseriges fluessiges grobwaschmittel | |
| CH675251A5 (en:Method) | ||
| DE69225677T2 (de) | Flüssige Reinigungsmittel | |
| CH674358A5 (en:Method) | ||
| DE69101467T2 (de) | Nichtwässerige flüssige Detergenszusammensetzung für Geschirrspülautomaten. | |
| CH669604A5 (en:Method) | ||
| CH675428A5 (en:Method) | ||
| EP1113068A9 (de) | Granulares Alkalischichtsilicat-Compound | |
| DE3729565A1 (de) | Fluessige, einen starken schaum bildende waschmittelzusammensetzung auf basis von niotensid | |
| DE3625256A1 (de) | Phosphatfreies oder gering phosphathaltiges waschmittel | |
| CH674850A5 (en:Method) | ||
| WO1996022353A1 (de) | Reinigungsmittel enthaltend silberkorrosionsschutzmittel | |
| JPS61204300A (ja) | 高級脂肪酸塩安定剤を含むビルダー入り液体洗濯洗剤および使用法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |