CH675418A5 - - Google Patents
Download PDFInfo
- Publication number
- CH675418A5 CH675418A5 CH195/87A CH19587A CH675418A5 CH 675418 A5 CH675418 A5 CH 675418A5 CH 195/87 A CH195/87 A CH 195/87A CH 19587 A CH19587 A CH 19587A CH 675418 A5 CH675418 A5 CH 675418A5
- Authority
- CH
- Switzerland
- Prior art keywords
- found
- calculated
- elemental analysis
- carbonyl
- piperazine
- Prior art date
Links
- 229910052757 nitrogen Inorganic materials 0.000 claims description 223
- 238000000034 method Methods 0.000 claims description 45
- 150000001412 amines Chemical class 0.000 claims description 15
- 239000002664 nootropic agent Substances 0.000 claims description 15
- 230000008569 process Effects 0.000 claims description 12
- WGOIHPRRFBCVBZ-VKHMYHEASA-N (2s)-5-oxopyrrolidine-2-carboxamide Chemical class NC(=O)[C@@H]1CCC(=O)N1 WGOIHPRRFBCVBZ-VKHMYHEASA-N 0.000 claims description 11
- 125000003277 amino group Chemical group 0.000 claims description 11
- 125000004122 cyclic group Chemical group 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 8
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- ODHCTXKNWHHXJC-GSVOUGTGSA-N 5-oxo-D-proline Chemical class OC(=O)[C@H]1CCC(=O)N1 ODHCTXKNWHHXJC-GSVOUGTGSA-N 0.000 claims description 5
- 125000005842 heteroatom Chemical group 0.000 claims description 5
- WGOIHPRRFBCVBZ-GSVOUGTGSA-N (2r)-5-oxopyrrolidine-2-carboxamide Chemical class NC(=O)[C@H]1CCC(=O)N1 WGOIHPRRFBCVBZ-GSVOUGTGSA-N 0.000 claims description 4
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 239000004480 active ingredient Substances 0.000 claims description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 216
- 238000000921 elemental analysis Methods 0.000 description 107
- 150000001875 compounds Chemical class 0.000 description 76
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 58
- -1 piperazino Chemical group 0.000 description 42
- 230000000694 effects Effects 0.000 description 32
- 238000006243 chemical reaction Methods 0.000 description 27
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 24
- 239000002904 solvent Substances 0.000 description 22
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- 241001465754 Metazoa Species 0.000 description 19
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 19
- 239000003795 chemical substances by application Substances 0.000 description 19
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 18
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 239000000203 mixture Substances 0.000 description 15
- 208000000044 Amnesia Diseases 0.000 description 14
- 208000026139 Memory disease Diseases 0.000 description 14
- 238000007912 intraperitoneal administration Methods 0.000 description 14
- 230000006984 memory degeneration Effects 0.000 description 14
- 208000023060 memory loss Diseases 0.000 description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 11
- 125000004432 carbon atom Chemical group C* 0.000 description 11
- 239000000825 pharmaceutical preparation Substances 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- 229960000793 aniracetam Drugs 0.000 description 10
- ZXNRTKGTQJPIJK-UHFFFAOYSA-N aniracetam Chemical compound C1=CC(OC)=CC=C1C(=O)N1C(=O)CCC1 ZXNRTKGTQJPIJK-UHFFFAOYSA-N 0.000 description 10
- 230000001777 nootropic effect Effects 0.000 description 10
- 229930000680 A04AD01 - Scopolamine Natural products 0.000 description 9
- STECJAGHUSJQJN-GAUPFVANSA-N Hyoscine Natural products C1([C@H](CO)C(=O)OC2C[C@@H]3N([C@H](C2)[C@@H]2[C@H]3O2)C)=CC=CC=C1 STECJAGHUSJQJN-GAUPFVANSA-N 0.000 description 9
- STECJAGHUSJQJN-UHFFFAOYSA-N N-Methyl-scopolamin Natural products C1C(C2C3O2)N(C)C3CC1OC(=O)C(CO)C1=CC=CC=C1 STECJAGHUSJQJN-UHFFFAOYSA-N 0.000 description 9
- 241000700159 Rattus Species 0.000 description 9
- 125000000217 alkyl group Chemical group 0.000 description 9
- STECJAGHUSJQJN-FWXGHANASA-N scopolamine Chemical compound C1([C@@H](CO)C(=O)O[C@H]2C[C@@H]3N([C@H](C2)[C@@H]2[C@H]3O2)C)=CC=CC=C1 STECJAGHUSJQJN-FWXGHANASA-N 0.000 description 9
- 229960002646 scopolamine Drugs 0.000 description 9
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 8
- 239000003814 drug Substances 0.000 description 8
- 230000006872 improvement Effects 0.000 description 8
- 231100000419 toxicity Toxicity 0.000 description 8
- 230000001988 toxicity Effects 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 206010012289 Dementia Diseases 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 230000004044 response Effects 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 125000001424 substituent group Chemical group 0.000 description 7
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 6
- 235000019441 ethanol Nutrition 0.000 description 6
- GOWRRBABHQUJMX-UHFFFAOYSA-N fasoracetam Chemical compound C1CCCCN1C(=O)C1CCC(=O)N1 GOWRRBABHQUJMX-UHFFFAOYSA-N 0.000 description 6
- 125000000623 heterocyclic group Chemical group 0.000 description 6
- 229910052740 iodine Inorganic materials 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 238000010898 silica gel chromatography Methods 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 208000024891 symptom Diseases 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- 125000003710 aryl alkyl group Chemical group 0.000 description 5
- 125000003118 aryl group Chemical group 0.000 description 5
- 150000004820 halides Chemical class 0.000 description 5
- 150000008282 halocarbons Chemical class 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- MDMAUEITTFGEIK-UHFFFAOYSA-N 5-(piperazine-1-carbonyl)pyrrolidin-2-one Chemical compound C1CNCCN1C(=O)C1CCC(=O)N1 MDMAUEITTFGEIK-UHFFFAOYSA-N 0.000 description 4
- 206010010904 Convulsion Diseases 0.000 description 4
- 241000124008 Mammalia Species 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 4
- 230000036461 convulsion Effects 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 230000000144 pharmacologic effect Effects 0.000 description 4
- 239000002798 polar solvent Substances 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 230000007059 acute toxicity Effects 0.000 description 3
- 231100000403 acute toxicity Toxicity 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 3
- 150000001350 alkyl halides Chemical class 0.000 description 3
- 238000007112 amidation reaction Methods 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 238000010171 animal model Methods 0.000 description 3
- 125000005098 aryl alkoxy carbonyl group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 230000002490 cerebral effect Effects 0.000 description 3
- 230000001143 conditioned effect Effects 0.000 description 3
- 230000003111 delayed effect Effects 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 208000035475 disorder Diseases 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 239000000945 filler Substances 0.000 description 3
- 235000011087 fumaric acid Nutrition 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 231100000252 nontoxic Toxicity 0.000 description 3
- 230000003000 nontoxic effect Effects 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 238000011084 recovery Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 231100000161 signs of toxicity Toxicity 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 230000000638 stimulation Effects 0.000 description 3
- 239000000829 suppository Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 238000010998 test method Methods 0.000 description 3
- 125000005505 thiomorpholino group Chemical group 0.000 description 3
- ULSDMUVEXKOYBU-ZDUSSCGKSA-N zolmitriptan Chemical compound C1=C2C(CCN(C)C)=CNC2=CC=C1C[C@H]1COC(=O)N1 ULSDMUVEXKOYBU-ZDUSSCGKSA-N 0.000 description 3
- JEOVABNPJMHXGZ-QMMMGPOBSA-N (2S)-5-oxo-1-piperidin-1-ylpyrrolidine-2-carboxamide Chemical class NC(=O)[C@@H]1CCC(=O)N1N1CCCCC1 JEOVABNPJMHXGZ-QMMMGPOBSA-N 0.000 description 2
- YQXLOVXVWICTBX-ZETCQYMHSA-N (2S)-5-oxo-1-pyrrolidin-1-ylpyrrolidine-2-carboxamide Chemical class NC(=O)[C@@H]1CCC(=O)N1N1CCCC1 YQXLOVXVWICTBX-ZETCQYMHSA-N 0.000 description 2
- LCXSXBYYVYTYDY-BTJKTKAUSA-N (z)-but-2-enedioic acid;piperazine Chemical compound C1CNCCN1.OC(=O)\C=C/C(O)=O LCXSXBYYVYTYDY-BTJKTKAUSA-N 0.000 description 2
- FQUYSHZXSKYCSY-UHFFFAOYSA-N 1,4-diazepane Chemical compound C1CNCCNC1 FQUYSHZXSKYCSY-UHFFFAOYSA-N 0.000 description 2
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 2
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- IIGFRCNOTWWJGY-UHFFFAOYSA-N 5-[4-(2-chlorophenyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound ClC1=CC=CC=C1N1CCN(C(=O)C2NC(=O)CC2)CC1 IIGFRCNOTWWJGY-UHFFFAOYSA-N 0.000 description 2
- ODHCTXKNWHHXJC-VKHMYHEASA-N 5-oxo-L-proline Chemical compound OC(=O)[C@@H]1CCC(=O)N1 ODHCTXKNWHHXJC-VKHMYHEASA-N 0.000 description 2
- 208000024827 Alzheimer disease Diseases 0.000 description 2
- 206010065559 Cerebral arteriosclerosis Diseases 0.000 description 2
- 206010008190 Cerebrovascular accident Diseases 0.000 description 2
- GOWRRBABHQUJMX-MRVPVSSYSA-N Fasoracetam Chemical compound C1CCCCN1C(=O)[C@H]1CCC(=O)N1 GOWRRBABHQUJMX-MRVPVSSYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- 208000006011 Stroke Diseases 0.000 description 2
- 102000011923 Thyrotropin Human genes 0.000 description 2
- 108010061174 Thyrotropin Proteins 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- ODHCTXKNWHHXJC-UHFFFAOYSA-N acide pyroglutamique Natural products OC(=O)C1CCC(=O)N1 ODHCTXKNWHHXJC-UHFFFAOYSA-N 0.000 description 2
- 239000012190 activator Substances 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 125000004103 aminoalkyl group Chemical group 0.000 description 2
- 239000003699 antiulcer agent Substances 0.000 description 2
- 125000005099 aryl alkyl carbonyl group Chemical group 0.000 description 2
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 2
- 125000005129 aryl carbonyl group Chemical group 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 210000004556 brain Anatomy 0.000 description 2
- 125000001589 carboacyl group Chemical group 0.000 description 2
- 230000003727 cerebral blood flow Effects 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 206010014599 encephalitis Diseases 0.000 description 2
- 239000003623 enhancer Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- 201000005851 intracranial arteriosclerosis Diseases 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 231100000053 low toxicity Toxicity 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 239000012528 membrane Substances 0.000 description 2
- 230000036630 mental development Effects 0.000 description 2
- 230000004060 metabolic process Effects 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000011259 mixed solution Substances 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000008177 pharmaceutical agent Substances 0.000 description 2
- 239000002504 physiological saline solution Substances 0.000 description 2
- ZULJGOSFKWFVRX-UHFFFAOYSA-N pramiracetam Chemical compound CC(C)N(C(C)C)CCNC(=O)CN1CCCC1=O ZULJGOSFKWFVRX-UHFFFAOYSA-N 0.000 description 2
- 229960003389 pramiracetam Drugs 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 239000003488 releasing hormone Substances 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 229960000874 thyrotropin Drugs 0.000 description 2
- 230000001748 thyrotropin Effects 0.000 description 2
- 239000003204 tranquilizing agent Substances 0.000 description 2
- 230000002936 tranquilizing effect Effects 0.000 description 2
- 125000005270 trialkylamine group Chemical group 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- LUZOFMGZMUZSSK-LRDDRELGSA-N (-)-indolactam V Chemical compound C1[C@@H](CO)NC(=O)[C@H](C(C)C)N(C)C2=CC=CC3=C2C1=CN3 LUZOFMGZMUZSSK-LRDDRELGSA-N 0.000 description 1
- LLZWOOMWJQIHAW-ZETCQYMHSA-N (2S)-1-morpholin-4-yl-5-oxopyrrolidine-2-carboxamide Chemical compound O1CCN(CC1)N1[C@@H](CCC1=O)C(=O)N LLZWOOMWJQIHAW-ZETCQYMHSA-N 0.000 description 1
- IGUYYHAFNYFSEJ-GFCCVEGCSA-N (5R)-5-[4-(2-morpholin-4-yl-2-oxoethyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1COCCN1C(=O)CN(CC1)CCN1C(=O)[C@H]1CCC(=O)N1 IGUYYHAFNYFSEJ-GFCCVEGCSA-N 0.000 description 1
- JIICDYRNQKVXFR-OAHLLOKOSA-N (5R)-5-[4-[(4-methylphenyl)methyl]piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1=CC(C)=CC=C1CN1CCN(C(=O)[C@@H]2NC(=O)CC2)CC1 JIICDYRNQKVXFR-OAHLLOKOSA-N 0.000 description 1
- WPDJMBAXQKFEOI-SSDOTTSWSA-N (5r)-5-(morpholine-4-carbonyl)pyrrolidin-2-one Chemical compound C1COCCN1C(=O)[C@H]1CCC(=O)N1 WPDJMBAXQKFEOI-SSDOTTSWSA-N 0.000 description 1
- IWMYEQSITOXBMZ-SSDOTTSWSA-N (5r)-5-(pyrrolidine-1-carbonyl)pyrrolidin-2-one Chemical compound C1CCCN1C(=O)[C@H]1CCC(=O)N1 IWMYEQSITOXBMZ-SSDOTTSWSA-N 0.000 description 1
- NDLBAWLHCCJUKI-UHFFFAOYSA-N 2-[4-(5-oxopyrrolidine-2-carbonyl)piperazin-1-yl]-n-propan-2-ylacetamide Chemical compound C1CN(CC(=O)NC(C)C)CCN1C(=O)C1NC(=O)CC1 NDLBAWLHCCJUKI-UHFFFAOYSA-N 0.000 description 1
- YMQRPXBBBOXHNZ-UHFFFAOYSA-N 2-chloro-1-morpholin-4-ylethanone Chemical compound ClCC(=O)N1CCOCC1 YMQRPXBBBOXHNZ-UHFFFAOYSA-N 0.000 description 1
- 125000003541 2-chlorobenzoyl group Chemical group ClC1=C(C(=O)*)C=CC=C1 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- NPUKDXXFDDZOKR-UHFFFAOYSA-N 3-(1-phenylethyl)-4-imidazolecarboxylic acid ethyl ester Chemical compound CCOC(=O)C1=CN=CN1C(C)C1=CC=CC=C1 NPUKDXXFDDZOKR-UHFFFAOYSA-N 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- VLVACYFVIIGDTH-UHFFFAOYSA-N 4-(5-oxopyrrolidine-2-carbonyl)piperazin-2-one Chemical compound C1CNC(=O)CN1C(=O)C1CCC(=O)N1 VLVACYFVIIGDTH-UHFFFAOYSA-N 0.000 description 1
- ABGXADJDTPFFSZ-UHFFFAOYSA-N 4-benzylpiperidine Chemical compound C=1C=CC=CC=1CC1CCNCC1 ABGXADJDTPFFSZ-UHFFFAOYSA-N 0.000 description 1
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- AKZVUJJGPBLNEU-UHFFFAOYSA-N 5-(4-acetylpiperazine-1-carbonyl)pyrrolidin-2-one Chemical compound C1CN(C(=O)C)CCN1C(=O)C1NC(=O)CC1 AKZVUJJGPBLNEU-UHFFFAOYSA-N 0.000 description 1
- UGWACYOHACFGOY-UHFFFAOYSA-N 5-(4-benzylpiperazine-1-carbonyl)pyrrolidin-2-one Chemical compound C1CN(CC=2C=CC=CC=2)CCN1C(=O)C1CCC(=O)N1 UGWACYOHACFGOY-UHFFFAOYSA-N 0.000 description 1
- WNISGGBLKVYPLT-UHFFFAOYSA-N 5-(4-benzylpiperidine-1-carbonyl)pyrrolidin-2-one Chemical compound C1CC(CC=2C=CC=CC=2)CCN1C(=O)C1CCC(=O)N1 WNISGGBLKVYPLT-UHFFFAOYSA-N 0.000 description 1
- DBOVLSFOWGQEEH-UHFFFAOYSA-N 5-(4-hydroxypiperidine-1-carbonyl)pyrrolidin-2-one Chemical compound C1CC(O)CCN1C(=O)C1NC(=O)CC1 DBOVLSFOWGQEEH-UHFFFAOYSA-N 0.000 description 1
- XDMLLAQOGUVBQZ-UHFFFAOYSA-N 5-(4-methylpiperazine-1-carbonyl)pyrrolidin-2-one Chemical compound C1CN(C)CCN1C(=O)C1NC(=O)CC1 XDMLLAQOGUVBQZ-UHFFFAOYSA-N 0.000 description 1
- MLAAAANVVPHUOL-UHFFFAOYSA-N 5-(4-phenylpiperidine-1-carbonyl)pyrrolidin-2-one Chemical compound C1CC(C=2C=CC=CC=2)CCN1C(=O)C1CCC(=O)N1 MLAAAANVVPHUOL-UHFFFAOYSA-N 0.000 description 1
- HNACDIWTXLVJHM-UHFFFAOYSA-N 5-(4-piperidin-1-ylpiperidine-1-carbonyl)pyrrolidin-2-one Chemical compound C1CC(N2CCCCC2)CCN1C(=O)C1CCC(=O)N1 HNACDIWTXLVJHM-UHFFFAOYSA-N 0.000 description 1
- XWJUMPJFJJLJNS-UHFFFAOYSA-N 5-(4-propanoylpiperazine-1-carbonyl)pyrrolidin-2-one Chemical compound C1CN(C(=O)CC)CCN1C(=O)C1NC(=O)CC1 XWJUMPJFJJLJNS-UHFFFAOYSA-N 0.000 description 1
- IWMYEQSITOXBMZ-UHFFFAOYSA-N 5-(pyrrolidine-1-carbonyl)pyrrolidin-2-one Chemical compound C1CCCN1C(=O)C1CCC(=O)N1 IWMYEQSITOXBMZ-UHFFFAOYSA-N 0.000 description 1
- FXPPFYHTECWNIW-ULKQDVFKSA-N 5-[(2s,6r)-2,6-dimethylpiperidine-1-carbonyl]pyrrolidin-2-one Chemical compound C[C@H]1CCC[C@@H](C)N1C(=O)C1NC(=O)CC1 FXPPFYHTECWNIW-ULKQDVFKSA-N 0.000 description 1
- VASBUIDICQIINV-UHFFFAOYSA-N 5-[4-(2,4-dimethylbenzoyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound CC1=CC(C)=CC=C1C(=O)N1CCN(C(=O)C2NC(=O)CC2)CC1 VASBUIDICQIINV-UHFFFAOYSA-N 0.000 description 1
- GGZYBQHPZMZTCA-UHFFFAOYSA-N 5-[4-(2-methoxyphenyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound COC1=CC=CC=C1N1CCN(C(=O)C2NC(=O)CC2)CC1 GGZYBQHPZMZTCA-UHFFFAOYSA-N 0.000 description 1
- BKHGHAJVGVBDBE-UHFFFAOYSA-N 5-[4-(2-methylphenyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound CC1=CC=CC=C1N1CCN(C(=O)C2NC(=O)CC2)CC1 BKHGHAJVGVBDBE-UHFFFAOYSA-N 0.000 description 1
- IGUYYHAFNYFSEJ-UHFFFAOYSA-N 5-[4-(2-morpholin-4-yl-2-oxoethyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1COCCN1C(=O)CN(CC1)CCN1C(=O)C1CCC(=O)N1 IGUYYHAFNYFSEJ-UHFFFAOYSA-N 0.000 description 1
- NPTIKHBPOQKTIF-UHFFFAOYSA-N 5-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1CCCN1C(=O)CN(CC1)CCN1C(=O)C1CCC(=O)N1 NPTIKHBPOQKTIF-UHFFFAOYSA-N 0.000 description 1
- XPNPHKDELPLOFQ-UHFFFAOYSA-N 5-[4-(2-phenylacetyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1CN(C(=O)C2NC(=O)CC2)CCN1C(=O)CC1=CC=CC=C1 XPNPHKDELPLOFQ-UHFFFAOYSA-N 0.000 description 1
- YSPPUFHSWPTYKV-UHFFFAOYSA-N 5-[4-(2-piperidin-1-ylethyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1CN(CCN2CCCCC2)CCN1C(=O)C1CCC(=O)N1 YSPPUFHSWPTYKV-UHFFFAOYSA-N 0.000 description 1
- YVHFCHRSYUAVBN-UHFFFAOYSA-N 5-[4-(3-methylbenzoyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound CC1=CC=CC(C(=O)N2CCN(CC2)C(=O)C2NC(=O)CC2)=C1 YVHFCHRSYUAVBN-UHFFFAOYSA-N 0.000 description 1
- LGLJLBJEXVAYMI-UHFFFAOYSA-N 5-[4-(4-acetylphenyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1=CC(C(=O)C)=CC=C1N1CCN(C(=O)C2NC(=O)CC2)CC1 LGLJLBJEXVAYMI-UHFFFAOYSA-N 0.000 description 1
- XMGXQPVSRWPVRN-UHFFFAOYSA-N 5-[4-(4-aminobutanoyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1CN(C(=O)CCCN)CCN1C(=O)C1NC(=O)CC1 XMGXQPVSRWPVRN-UHFFFAOYSA-N 0.000 description 1
- QLHHLQKZVNEWEI-UHFFFAOYSA-N 5-[4-(4-methoxybenzoyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1=CC(OC)=CC=C1C(=O)N1CCN(C(=O)C2NC(=O)CC2)CC1 QLHHLQKZVNEWEI-UHFFFAOYSA-N 0.000 description 1
- IHFMEPWMGSZTAK-UHFFFAOYSA-N 5-[4-(4-methoxyphenyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1=CC(OC)=CC=C1N1CCN(C(=O)C2NC(=O)CC2)CC1 IHFMEPWMGSZTAK-UHFFFAOYSA-N 0.000 description 1
- MEGGLDUKDVEZML-UHFFFAOYSA-N 5-[4-(4-methylbenzoyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1=CC(C)=CC=C1C(=O)N1CCN(C(=O)C2NC(=O)CC2)CC1 MEGGLDUKDVEZML-UHFFFAOYSA-N 0.000 description 1
- RKOLHIMNEWIGFW-UHFFFAOYSA-N 5-[4-(4-nitrobenzoyl)piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(=O)N1CCN(C(=O)C2NC(=O)CC2)CC1 RKOLHIMNEWIGFW-UHFFFAOYSA-N 0.000 description 1
- PYYLWLJDWMLWRJ-UHFFFAOYSA-N 5-[4-[(2-chlorophenyl)methyl]piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound ClC1=CC=CC=C1CN1CCN(C(=O)C2NC(=O)CC2)CC1 PYYLWLJDWMLWRJ-UHFFFAOYSA-N 0.000 description 1
- YCABXZYYSYWQLS-UHFFFAOYSA-N 5-[4-[(4-fluorophenyl)methyl]piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1=CC(F)=CC=C1CN1CCN(C(=O)C2NC(=O)CC2)CC1 YCABXZYYSYWQLS-UHFFFAOYSA-N 0.000 description 1
- JIICDYRNQKVXFR-UHFFFAOYSA-N 5-[4-[(4-methylphenyl)methyl]piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1=CC(C)=CC=C1CN1CCN(C(=O)C2NC(=O)CC2)CC1 JIICDYRNQKVXFR-UHFFFAOYSA-N 0.000 description 1
- VDXQJKGFWCCXRL-UHFFFAOYSA-N 5-[4-[2-(2-chlorophenoxy)ethyl]piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound ClC1=CC=CC=C1OCCN1CCN(C(=O)C2NC(=O)CC2)CC1 VDXQJKGFWCCXRL-UHFFFAOYSA-N 0.000 description 1
- ALESADZKPFSKSH-UHFFFAOYSA-N 5-[4-[2-(4-phenylmethoxyphenoxy)ethyl]piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1CN(CCOC=2C=CC(OCC=3C=CC=CC=3)=CC=2)CCN1C(=O)C1CCC(=O)N1 ALESADZKPFSKSH-UHFFFAOYSA-N 0.000 description 1
- HNEHHUXARMOTEE-UHFFFAOYSA-N 5-[4-[3-(4-methylphenoxy)propyl]piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound C1=CC(C)=CC=C1OCCCN1CCN(C(=O)C2NC(=O)CC2)CC1 HNEHHUXARMOTEE-UHFFFAOYSA-N 0.000 description 1
- YIDZWHJYKIPJRB-UHFFFAOYSA-N 5-[4-[3-(trifluoromethyl)phenyl]piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound FC(F)(F)C1=CC=CC(N2CCN(CC2)C(=O)C2NC(=O)CC2)=C1 YIDZWHJYKIPJRB-UHFFFAOYSA-N 0.000 description 1
- UWQPTPXCKMIZQJ-UHFFFAOYSA-N 5-[4-[[2-(trifluoromethyl)phenyl]methyl]piperazine-1-carbonyl]pyrrolidin-2-one Chemical compound FC(F)(F)C1=CC=CC=C1CN1CCN(C(=O)C2NC(=O)CC2)CC1 UWQPTPXCKMIZQJ-UHFFFAOYSA-N 0.000 description 1
- FUFZNHHSSMCXCZ-UHFFFAOYSA-N 5-piperidin-4-yl-3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazole Chemical compound FC(F)(F)C1=CC=CC(C=2N=C(ON=2)C2CCNCC2)=C1 FUFZNHHSSMCXCZ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- VGIODZUECSTLFY-HEKVCFEKSA-N C(\C=C/C(=O)O)(=O)O.S1CCN(CC1)C(=O)CN1CCN(CC1)C(=O)[C@H]1CCC(N1)=O Chemical compound C(\C=C/C(=O)O)(=O)O.S1CCN(CC1)C(=O)CN1CCN(CC1)C(=O)[C@H]1CCC(N1)=O VGIODZUECSTLFY-HEKVCFEKSA-N 0.000 description 1
- BKHGHAJVGVBDBE-ZDUSSCGKSA-N CC1=CC=CC=C1N1CCN(C(=O)[C@H]2NC(=O)CC2)CC1 Chemical compound CC1=CC=CC=C1N1CCN(C(=O)[C@H]2NC(=O)CC2)CC1 BKHGHAJVGVBDBE-ZDUSSCGKSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 206010019196 Head injury Diseases 0.000 description 1
- 101000974340 Homo sapiens Nuclear receptor corepressor 1 Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- HQGPKMSGXAUKHT-UHFFFAOYSA-N L-pyroglutamic acid methyl ester Natural products COC(=O)C1CCC(=O)N1 HQGPKMSGXAUKHT-UHFFFAOYSA-N 0.000 description 1
- 102100022935 Nuclear receptor corepressor 1 Human genes 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000005456 alcohol based solvent Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000005236 alkanoylamino group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 125000005160 aryl oxy alkyl group Chemical group 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- QPZJXYPDBUSTMG-UHFFFAOYSA-N benzyl 4-(5-oxopyrrolidine-2-carbonyl)piperazine-1-carboxylate Chemical compound C1CN(C(=O)C2NC(=O)CC2)CCN1C(=O)OCC1=CC=CC=C1 QPZJXYPDBUSTMG-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- RKPBUCZXDBLXMV-UHFFFAOYSA-N benzyl n-[4-oxo-4-[4-(5-oxopyrrolidine-2-carbonyl)piperazin-1-yl]butyl]carbamate Chemical compound C=1C=CC=CC=1COC(=O)NCCCC(=O)N(CC1)CCN1C(=O)C1CCC(=O)N1 RKPBUCZXDBLXMV-UHFFFAOYSA-N 0.000 description 1
- CTOUWUYDDUSBQE-UHFFFAOYSA-N benzyl piperazine-1-carboxylate Chemical compound C1CNCCN1C(=O)OCC1=CC=CC=C1 CTOUWUYDDUSBQE-UHFFFAOYSA-N 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- UXXXZMDJQLPQPH-UHFFFAOYSA-N bis(2-methylpropyl) carbonate Chemical compound CC(C)COC(=O)OCC(C)C UXXXZMDJQLPQPH-UHFFFAOYSA-N 0.000 description 1
- 208000029028 brain injury Diseases 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005242 carbamoyl alkyl group Chemical group 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 206010008129 cerebral palsy Diseases 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229940001468 citrate Drugs 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- UNNWZHOQBNHIPV-UHFFFAOYSA-N ethyl 4-(5-oxopyrrolidine-2-carbonyl)piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C(=O)C1NC(=O)CC1 UNNWZHOQBNHIPV-UHFFFAOYSA-N 0.000 description 1
- UNNWZHOQBNHIPV-SECBINFHSA-N ethyl 4-[(2R)-5-oxopyrrolidine-2-carbonyl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C(=O)[C@@H]1NC(=O)CC1 UNNWZHOQBNHIPV-SECBINFHSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 229940050411 fumarate Drugs 0.000 description 1
- 125000000268 heptanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- JBFYUZGYRGXSFL-UHFFFAOYSA-N imidazolide Chemical compound C1=C[N-]C=N1 JBFYUZGYRGXSFL-UHFFFAOYSA-N 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- HQGPKMSGXAUKHT-BYPYZUCNSA-N methyl (2s)-5-oxopyrrolidine-2-carboxylate Chemical compound COC(=O)[C@@H]1CCC(=O)N1 HQGPKMSGXAUKHT-BYPYZUCNSA-N 0.000 description 1
- CXHHBNMLPJOKQD-UHFFFAOYSA-M methyl carbonate Chemical compound COC([O-])=O CXHHBNMLPJOKQD-UHFFFAOYSA-M 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- CQDGTJPVBWZJAZ-UHFFFAOYSA-N monoethyl carbonate Chemical compound CCOC(O)=O CQDGTJPVBWZJAZ-UHFFFAOYSA-N 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- MAFJXAYWVBYUEH-UHFFFAOYSA-N n,n'-bis(4-methoxyphenyl)ethane-1,2-diamine Chemical compound C1=CC(OC)=CC=C1NCCNC1=CC=C(OC)C=C1 MAFJXAYWVBYUEH-UHFFFAOYSA-N 0.000 description 1
- CEUVYVBWZIVIEM-UHFFFAOYSA-N n,n-dimethyl-4-(5-oxopyrrolidine-2-carbonyl)piperazine-1-carboxamide Chemical compound C1CN(C(=O)N(C)C)CCN1C(=O)C1NC(=O)CC1 CEUVYVBWZIVIEM-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004998 naphthylethyl group Chemical group C1(=CC=CC2=CC=CC=C12)CC* 0.000 description 1
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 229960002195 perazine Drugs 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 230000000391 smoking effect Effects 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 229940086735 succinate Drugs 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 150000003459 sulfonic acid esters Chemical class 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/273—2-Pyrrolidones with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to other ring carbon atoms
- C07D207/277—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D207/28—2-Pyrrolidone-5- carboxylic acids; Functional derivatives thereof, e.g. esters, nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D407/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00
- C07D407/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings
- C07D407/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Peptides Or Proteins (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP1136086 | 1986-01-21 | ||
| JP1135986 | 1986-01-21 | ||
| JP17516886 | 1986-07-24 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH675418A5 true CH675418A5 (https=) | 1990-09-28 |
Family
ID=27279384
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH195/87A CH675418A5 (https=) | 1986-01-21 | 1987-01-20 |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US5102882A (https=) |
| BE (1) | BE1003248A5 (https=) |
| CA (1) | CA1323874C (https=) |
| CH (1) | CH675418A5 (https=) |
| DE (2) | DE3701494A1 (https=) |
| ES (1) | ES2002083A6 (https=) |
| FR (2) | FR2597100A1 (https=) |
| GB (1) | GB2185483B (https=) |
| IT (1) | IT1205715B (https=) |
| NL (1) | NL192304C (https=) |
| SE (1) | SE503436C2 (https=) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5021439A (en) * | 1988-10-31 | 1991-06-04 | Takeda Chemical Industries, Ltd. | Cerebral function ameliorating agents related to Tan-950 A |
| IT1244507B (it) * | 1991-04-11 | 1994-07-15 | Sigma Tau Ind Farmaceuti | Derivati dell'acido piroglutammico quali attivatori dei processi di apprendimento e della memoria e composizioni farmaceutiche comprendenti tali composti |
| FR2680508B1 (fr) * | 1991-08-20 | 1995-03-03 | Adir | Nouveaux composes amidiques des 1-(alcoxybenzyl)piperazines, leurs procedes de preparation et les compositions pharmaceutiques qui les contiennent. |
| WO1995003801A1 (en) * | 1993-07-28 | 1995-02-09 | Nippon Shinyaku Co., Ltd. | Antidepressant |
| CA2157348A1 (en) * | 1994-09-01 | 1996-03-02 | Aventis Pharmaceuticals Inc. | 3-¬4-(1-substituted-4-piperazinyl)butyl|-4-thiazolidinone and related compounds |
| GB9420784D0 (en) * | 1994-10-14 | 1994-11-30 | Glaxo Group Ltd | Medicaments |
| US6194413B1 (en) * | 1995-11-13 | 2001-02-27 | Smithkline Beecham Corporation | Hemoregulatory compounds |
| HUP0301391A3 (en) * | 2000-02-11 | 2010-03-29 | Vertex Pharma | Piperazine and piperidine derivatives pharmaceutical compositions containing them and their use |
| US20040180880A1 (en) * | 2002-10-03 | 2004-09-16 | Lauffer David J. | Piperazine and piperidine derivatives |
| PH12012502091A1 (en) | 2007-01-12 | 2019-06-14 | Novartis Ag | Process for preparing 5-biphenyl-4-amino-2-methyl pentanoic acid |
| DE102008003828B3 (de) | 2008-01-10 | 2009-09-03 | Clariant International Limited | Verwendung von Salzen als Korrosionsinhibitoren mit erhöhter biologischer Abbaubarkeit und verminderter Toxizität und diese Salze |
| DE102008003826B4 (de) * | 2008-01-10 | 2010-07-22 | Clariant International Limited | Verwendung von Salzen als Korrosionsinhibitoren mit erhöhter biologischer Abbaubarkeit und verminderter Toxizität und diese Salze |
| BR112013004164A2 (pt) | 2010-08-23 | 2016-05-10 | Novartis Ag | processo para a preparação de intermediários para a produção de inibidores da nep |
| AU2016278053A1 (en) | 2015-06-15 | 2018-01-04 | The Children's Hospital Of Philadelphia | Methods of diagnosing and treating autism |
| KR102877903B1 (ko) * | 2018-01-18 | 2025-10-31 | 더 칠드런스 호스피탈 오브 필라델피아 | 파소라세탐의 고체 형태 |
| US11535604B2 (en) | 2018-01-18 | 2022-12-27 | The Children's Hospital Of Philadelphia | Fasoracetam crystalline forms |
| GB202300833D0 (en) | 2023-01-19 | 2023-03-08 | Nrg Therapeutics Ltd | Novel compounds |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3051722A (en) * | 1960-10-21 | 1962-08-28 | Lakeside Lab Inc | 5-pyrrolidone-2-carboxamides |
| JPS5015793B2 (https=) * | 1972-06-07 | 1975-06-07 | ||
| JPS518266A (en) * | 1974-07-10 | 1976-01-23 | Sakai Chemical Industry Co | Piroridonjudotaino seizohoho |
| GB1492640A (en) * | 1975-07-08 | 1977-11-23 | Ucb Sa | L-pyroglutamyl-l-prolinamide |
| BE864269A (fr) * | 1977-03-03 | 1978-06-16 | Parke Davis & Co | Nouveaux n-(aminoalkyl substitue)-2-oxo-1-pyrrolidine-acetamides et procedes pour les produire |
| DE2924011C2 (de) * | 1979-06-13 | 1982-04-08 | A. Nattermann & Cie GmbH, 5000 Köln | Pyrrolidin-(2)-on-(1)-ylessigsäure-2,6,-dimethylanilid, Verfahren zur Herstellung und Arzneimittel, welche diese Verbindung enthalten |
| HU180925B (en) * | 1979-06-28 | 1983-05-30 | Richter Gedeon Vegyeszet | Process for producing tripeptide-amides trh-analogues,effectives on the central nerve systhem |
| JPS56147766A (en) * | 1980-04-17 | 1981-11-16 | Sakai Chem Ind Co Ltd | Preparation of lactam |
| DE3031118A1 (de) * | 1980-08-18 | 1982-04-01 | Meditest Institut für medizinisch-pharmazeutische Untersuchungen GmbH & Co KG, 7958 Laupheim | N,n'-bis(5-oxo-1-methyl-pyrrolidin-2-yl-essigsaeure)-hydrazid, verfahren zu dessen herstellung und seine verwendung als arzneimittel |
| HU184481B (en) * | 1981-10-02 | 1984-08-28 | Richter Gedeon Vegyeszet | Process for producing tripeptides for diminishing appetite |
| GB2130590B (en) * | 1982-11-10 | 1986-01-08 | Erba Farmitalia | Peptides |
| US4483991A (en) * | 1983-01-17 | 1984-11-20 | American Home Products Corporation | Hypotensive agents |
| US4525476A (en) * | 1983-05-26 | 1985-06-25 | Warner-Lambert Company | N-[1-oxo-3-(5-oxo-2-pyrrolidinyl)propyl]-alpha-aminoacids and derivatives as cognition activators |
| IT1172391B (it) * | 1983-12-23 | 1987-06-18 | Polifarma Spa | Composti tirpeptidici contenenti acido piroglutaminico e triptofano,procedimentio di produzione ed applicazioni terapeutiche |
| DE3420193A1 (de) * | 1984-05-30 | 1985-12-05 | Boehringer Ingelheim KG, 6507 Ingelheim | Neue substituierte pyrrolidinone, verfahren zu ihrer herstellung und arzneimittel |
-
1987
- 1987-01-16 FR FR8700485A patent/FR2597100A1/fr active Granted
- 1987-01-20 ES ES8700128A patent/ES2002083A6/es not_active Expired
- 1987-01-20 NL NL8700119A patent/NL192304C/nl not_active IP Right Cessation
- 1987-01-20 SE SE8700203A patent/SE503436C2/xx not_active IP Right Cessation
- 1987-01-20 DE DE19873701494 patent/DE3701494A1/de active Granted
- 1987-01-20 IT IT47545/87A patent/IT1205715B/it active
- 1987-01-20 CH CH195/87A patent/CH675418A5/de not_active IP Right Cessation
- 1987-01-20 CA CA000527706A patent/CA1323874C/en not_active Expired - Fee Related
- 1987-01-20 DE DE3744947A patent/DE3744947C2/de not_active Expired - Fee Related
- 1987-01-21 BE BE8700036A patent/BE1003248A5/fr not_active IP Right Cessation
- 1987-01-21 GB GB8701245A patent/GB2185483B/en not_active Expired - Fee Related
- 1987-09-28 FR FR8713376A patent/FR2613366A1/fr active Granted
-
1991
- 1991-02-26 US US07/661,523 patent/US5102882A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| ES2002083A6 (es) | 1988-07-01 |
| FR2613366B1 (https=) | 1994-08-19 |
| SE8700203D0 (sv) | 1987-01-20 |
| GB8701245D0 (en) | 1987-02-25 |
| IT1205715B (it) | 1989-03-31 |
| DE3701494A1 (de) | 1987-07-23 |
| SE503436C2 (sv) | 1996-06-17 |
| FR2597100B1 (https=) | 1994-08-19 |
| IT8747545A0 (it) | 1987-01-20 |
| GB2185483A (en) | 1987-07-22 |
| SE8700203L (sv) | 1987-07-22 |
| BE1003248A5 (fr) | 1992-02-11 |
| FR2613366A1 (fr) | 1988-10-07 |
| DE3744947C2 (https=) | 1992-07-16 |
| CA1323874C (en) | 1993-11-02 |
| FR2597100A1 (fr) | 1987-10-16 |
| GB2185483B (en) | 1990-10-24 |
| US5102882A (en) | 1992-04-07 |
| NL192304C (nl) | 1997-05-07 |
| NL192304B (nl) | 1997-01-06 |
| NL8700119A (nl) | 1987-08-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0136658B1 (de) | 1-Benzyl-aminoalkyl-pyrrolidinone und ihre Säureadditionssalze, Verfahren zu ihrer Herstellung und Arzneimittel | |
| CH675418A5 (https=) | ||
| DE2458177A1 (de) | Substituierte 1,3-dihydrospiro eckige klammer auf isobenzofurane eckige klammer zu | |
| DE2708236A1 (de) | 3-aryl-2-oxazolidinone, verfahren zu ihrer herstellung und arzneimittel | |
| DE2819210A1 (de) | 4-aminomethyl-1-(3,3,3-triarylpropyl)-4-arylpiperidin und dessen derivate | |
| DE2807623C2 (de) | 2-Phenoxyphenyl-pyrrolidinderivate, deren Salze, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Zubereitungen | |
| DE2918523A1 (de) | Lactam-n-essigsaeuren und deren amide, verfahren zu ihrer herstellung und diese enthaltende arzneimittel | |
| DE3420193A1 (de) | Neue substituierte pyrrolidinone, verfahren zu ihrer herstellung und arzneimittel | |
| DE2712023A1 (de) | Sulfonamidoaminobenzoesaeurederivate, solche enthaltende arzneimittel sowie verfahren zur herstellung derselben | |
| DE2006978A1 (de) | Neue Aminosäuren, ihre Derivate und ihr Herstellungsverfahren | |
| DE3445339A1 (de) | 3,3-disubstituierte 1-(phenylamino)-guanidinderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DD298397A5 (de) | Verfahren zur herstellung von 1-(heterocyclylsulfonyl-3-/4-(2-pyrimidinyl)-1-piperazinyl/propanen | |
| DE2126559C3 (de) | 2,2-Diaryl-4-piperidinbutyramide, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE2362754C2 (de) | Cyclopropylalkylaminoreste enthaltende Oxazolinverbindungen, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| AT396362B (de) | 5,5-dimethyl-3-phenylvinyl-1-aminoalkoxy-iminocyclohex-2-enderivate | |
| DE3025238C2 (https=) | ||
| DE3305495A1 (de) | Piperazin- und homopiperazinderivate, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische zubereitungen | |
| DE2757532A1 (de) | N,n'-disubstituiertes cyclisches diamin und verfahren zu dessen herstellung | |
| DE2425767A1 (de) | 3-alkyl-9-aminoalkyl-1,2,3,4-tetrahydrocarbazole und ihre verwendung in arzneimitteln | |
| DE3028064C2 (https=) | ||
| DE1670622A1 (de) | Verfahren zur Herstellung von Aminoalkyl-pyrrol-2-yl-ketonen | |
| DE2730593A1 (de) | Neue aminoalkoxybenzofurane, verfahren zur herstellung derselben und diese enthaltende pharmazeutische mittel | |
| AT319936B (de) | Verfahren zur Herstellung von neuen Phenylimidazolidinonderivaten und ihren Salzen | |
| DE2912026C2 (https=) | ||
| KR950007591B1 (ko) | 피로글루타미드 유도체 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |