CH650188A5 - Outil de blocage a long bec. - Google Patents
Outil de blocage a long bec. Download PDFInfo
- Publication number
- CH650188A5 CH650188A5 CH6484/82A CH648482A CH650188A5 CH 650188 A5 CH650188 A5 CH 650188A5 CH 6484/82 A CH6484/82 A CH 6484/82A CH 648482 A CH648482 A CH 648482A CH 650188 A5 CH650188 A5 CH 650188A5
- Authority
- CH
- Switzerland
- Prior art keywords
- jaw
- tool according
- jaws
- elements
- faces
- Prior art date
Links
- 238000005452 bending Methods 0.000 claims description 6
- 210000003323 beak Anatomy 0.000 claims description 4
- 229910000639 Spring steel Inorganic materials 0.000 claims description 2
- 229910000831 Steel Inorganic materials 0.000 description 6
- 239000010959 steel Substances 0.000 description 6
- 238000010276 construction Methods 0.000 description 4
- 230000035939 shock Effects 0.000 description 4
- 241001526882 Strongylura timucu Species 0.000 description 2
- 229910001315 Tool steel Inorganic materials 0.000 description 2
- 229910000851 Alloy steel Inorganic materials 0.000 description 1
- 229910000975 Carbon steel Inorganic materials 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005555 metalworking Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 238000003466 welding Methods 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B25—HAND TOOLS; PORTABLE POWER-DRIVEN TOOLS; MANIPULATORS
- B25B—TOOLS OR BENCH DEVICES NOT OTHERWISE PROVIDED FOR, FOR FASTENING, CONNECTING, DISENGAGING OR HOLDING
- B25B7/00—Pliers; Other hand-held gripping tools with jaws on pivoted limbs; Details applicable generally to pivoted-limb hand tools
- B25B7/02—Jaws
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Gripping Jigs, Holding Jigs, And Positioning Jigs (AREA)
- Quick-Acting Or Multi-Walled Pipe Joints (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/241,085 US4541312A (en) | 1981-03-06 | 1981-03-06 | Long nose locking plier |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH650188A5 true CH650188A5 (fr) | 1985-07-15 |
Family
ID=22909189
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH6484/82A CH650188A5 (fr) | 1981-03-06 | 1982-03-02 | Outil de blocage a long bec. |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4541312A (enExample) |
| EP (1) | EP0073832B1 (enExample) |
| JP (1) | JPS57149165A (enExample) |
| AU (1) | AU563877B2 (enExample) |
| BR (1) | BR8206877A (enExample) |
| CA (1) | CA1164253A (enExample) |
| CH (1) | CH650188A5 (enExample) |
| DE (2) | DE8115342U1 (enExample) |
| DK (1) | DK159602C (enExample) |
| ES (2) | ES258997Y (enExample) |
| GB (1) | GB2094199B (enExample) |
| IN (1) | IN158061B (enExample) |
| NL (1) | NL191175C (enExample) |
| WO (1) | WO1982003042A1 (enExample) |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4546680A (en) * | 1982-03-02 | 1985-10-15 | Petersen Manufacturing Co., Inc. | Long nose locking pliers |
| US4730524A (en) * | 1981-03-06 | 1988-03-15 | Petersen Manufacturing Co., Inc. | Long nose locking plier |
| US4709601A (en) * | 1981-03-06 | 1987-12-01 | Petersen Manufacturing Co., Inc. | Long nose locking pliers |
| JPH058054Y2 (enExample) * | 1987-05-29 | 1993-03-01 | ||
| US4820901A (en) * | 1988-02-08 | 1989-04-11 | Peviani Thomas P | Quick releasable ground and rod clamp for welding |
| TW267126B (enExample) * | 1993-02-04 | 1996-01-01 | Petersen Mfg Co Ltd | |
| US5351585A (en) * | 1993-08-11 | 1994-10-04 | Petersen Manufacturing Co. Inc. | Large capacity locking pliers |
| US5398535A (en) * | 1993-09-14 | 1995-03-21 | Giffin; Roger E. | Spreader clamp for automobile body repair and the like |
| US5456144A (en) * | 1994-01-11 | 1995-10-10 | Petersen Manufacturing | Locking pliers with axial clamping action |
| DE19515140A1 (de) * | 1995-04-25 | 1996-10-31 | Schneider & Klein Metallwaren | Greifzange |
| RU2115537C1 (ru) * | 1996-01-10 | 1998-07-20 | Александр Вильямович Казакевич | Зажим с усиленным сжатием |
| US5690416A (en) * | 1996-01-11 | 1997-11-25 | Van Gennep; Jan | Holder adjustable to hold a flashlight selected from a group of differently sized flashlights |
| US6408724B1 (en) | 1996-03-18 | 2002-06-25 | Adjustable Clamp Company | Self-adjusting plier-type locking tool |
| US6279431B1 (en) | 1999-06-15 | 2001-08-28 | Brett P. Seber | Self-adjusting pliers |
| US6212978B1 (en) | 1999-06-15 | 2001-04-10 | Brett P. Seber | Self-adjusting pliers |
| US7444907B2 (en) * | 1999-06-15 | 2008-11-04 | I.D.L. Tech Tools, Llc | Self-adjusting pliers |
| US6629975B1 (en) * | 1999-12-20 | 2003-10-07 | Pioneer Laboratories, Icn. | Multiple lumen crimp |
| US6256923B1 (en) * | 2000-02-25 | 2001-07-10 | United Plastic Molders, Inc. | Fish handling pliers |
| USD455629S1 (en) | 2001-07-30 | 2002-04-16 | Great Neck Saw Manufacturers, Inc. | Multi hand tool |
| USD499320S1 (en) | 2003-08-08 | 2004-12-07 | Brett P. Seber | Self-adjusting pliers |
| USD538121S1 (en) | 2006-01-24 | 2007-03-13 | I.D.L. Tech Tools, Llc | Pliers |
| US20070209484A1 (en) * | 2006-03-13 | 2007-09-13 | Chervenak Thomas M | Locking pliers |
| USD623493S1 (en) * | 2007-08-13 | 2010-09-14 | Cooper Brands, Inc. | Pliers |
| USD582234S1 (en) * | 2008-03-18 | 2008-12-09 | Wen Yueh Chiang | Self-adjusting locking pliers and claw hammer combination |
| US9751148B2 (en) * | 2011-05-25 | 2017-09-05 | Keith SHARROW | Plumber's heat shield |
| USD691009S1 (en) | 2011-09-20 | 2013-10-08 | Frank R. Tiley | Adjustable needle-nose pliers |
| JP5726365B1 (ja) * | 2014-12-25 | 2015-05-27 | 株式会社エンジニア | 挟持工具 |
| US11938600B2 (en) * | 2018-11-02 | 2024-03-26 | Snap-On Incorporated | Axial pliers |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US591720A (en) * | 1897-10-12 | Charles j | ||
| DE130910C (enExample) * | ||||
| US957560A (en) * | 1909-02-23 | 1910-05-10 | Gardner L Holt | Pliers or pipe-tongs. |
| US1427668A (en) * | 1920-09-14 | 1922-08-29 | Francis H Williams | Pliers |
| US1489458A (en) * | 1923-01-05 | 1924-04-08 | Jules A Sire | Wrench |
| US2590031A (en) * | 1947-04-28 | 1952-03-18 | Petersen Mfg | Cutter attachment for toggleactuated plier-type wrenches |
| US2563264A (en) * | 1947-09-29 | 1951-08-07 | Ross S Norgard | Limb cutter |
| DE1655077U (de) * | 1952-09-27 | 1953-05-07 | Eugen Zerver | Zange mit haftsitz. |
| US2853910A (en) * | 1956-11-30 | 1958-09-30 | Petersen William | Latch means for plier type toggle wrench |
| US2848810A (en) * | 1957-07-15 | 1958-08-26 | Mathias Klein & Sons | Long nose cutting pliers |
| US3192804A (en) * | 1962-09-20 | 1965-07-06 | Petersen Mfg | Chain clamps |
| US3282137A (en) * | 1964-12-30 | 1966-11-01 | Bendix Corp | Actuating mechanism for plier type devices |
| US3600986A (en) * | 1968-08-27 | 1971-08-24 | Leverage Tools Inc | Self-adjusting locking wrench |
| DE2132857A1 (de) * | 1971-06-29 | 1973-04-19 | Paul Egon | Zange mit klemmbacken |
| US3710658A (en) * | 1971-08-06 | 1973-01-16 | N Wilson | Self-adjusting wrench |
| US3748733A (en) * | 1971-10-18 | 1973-07-31 | W Mcclellan | Insulation stripper for conductors |
| GB1355269A (en) * | 1973-01-13 | 1974-06-05 | Wilson N R | Self adjusting wrenches |
| US4023450A (en) * | 1976-02-19 | 1977-05-17 | Goran Ygfors | Pliers of plastic |
| US4208749A (en) * | 1978-10-10 | 1980-06-24 | Amerman Gary S | Fisherman's pliers |
-
1981
- 1981-03-06 US US06/241,085 patent/US4541312A/en not_active Expired - Lifetime
- 1981-05-13 CA CA000377488A patent/CA1164253A/en not_active Expired
- 1981-05-22 DE DE8115342U patent/DE8115342U1/de not_active Expired
- 1981-05-22 JP JP56076672A patent/JPS57149165A/ja active Granted
- 1981-05-22 DE DE3120478A patent/DE3120478C2/de not_active Expired
- 1981-06-01 GB GB8116734A patent/GB2094199B/en not_active Expired
- 1981-06-16 ES ES1981258997U patent/ES258997Y/es not_active Expired
- 1981-06-18 ES ES1981268057U patent/ES268057Y/es not_active Expired
-
1982
- 1982-03-02 WO PCT/US1982/000259 patent/WO1982003042A1/en not_active Ceased
- 1982-03-02 AU AU83942/82A patent/AU563877B2/en not_active Expired
- 1982-03-02 EP EP82901383A patent/EP0073832B1/en not_active Expired
- 1982-03-02 NL NL8220152A patent/NL191175C/xx not_active IP Right Cessation
- 1982-03-02 CH CH6484/82A patent/CH650188A5/fr not_active IP Right Cessation
- 1982-03-02 BR BR8206877A patent/BR8206877A/pt not_active IP Right Cessation
- 1982-03-08 IN IN192/DEL/82A patent/IN158061B/en unknown
- 1982-11-05 DK DK492782A patent/DK159602C/da not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| ES268057U (es) | 1983-06-01 |
| ES258997Y (es) | 1982-06-16 |
| GB2094199B (en) | 1985-10-30 |
| EP0073832A1 (en) | 1983-03-16 |
| NL191175C (nl) | 1995-03-01 |
| US4541312A (en) | 1985-09-17 |
| EP0073832B1 (en) | 1985-08-07 |
| DE3120478C2 (de) | 1985-12-19 |
| DE3120478A1 (de) | 1982-09-16 |
| DK492782A (da) | 1982-11-05 |
| AU8394282A (en) | 1982-09-28 |
| DK159602C (da) | 1991-04-22 |
| GB2094199A (en) | 1982-09-15 |
| IN158061B (enExample) | 1986-08-23 |
| NL8220152A (nl) | 1983-02-01 |
| AU563877B2 (en) | 1987-07-23 |
| CA1164253A (en) | 1984-03-27 |
| JPS57149165A (en) | 1982-09-14 |
| DE8115342U1 (de) | 1986-11-13 |
| BR8206877A (pt) | 1983-03-01 |
| WO1982003042A1 (en) | 1982-09-16 |
| NL191175B (nl) | 1994-10-03 |
| JPS6157156B2 (enExample) | 1986-12-05 |
| ES268057Y (es) | 1985-01-16 |
| EP0073832A4 (en) | 1983-08-01 |
| DK159602B (da) | 1990-11-05 |
| ES258997U (es) | 1982-01-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH650188A5 (fr) | Outil de blocage a long bec. | |
| CH649245A5 (fr) | Outil de blocage a long bec. | |
| EP2149428B1 (en) | Locking pliers | |
| CH644049A5 (fr) | Manche destine a etre utilise en liaison avec un outil en forme de ''l''. | |
| WO2019051491A1 (en) | LOCKING SECTIONS WITH MOBILE JAW SECTION INCREASING TORQUE | |
| FR2778592A1 (fr) | Pince a poignees ergonomiques | |
| AU675097B2 (en) | Bicycle tool | |
| FR2916151A1 (fr) | Pince-etau avec mecanisme de verrouillage et procede pour sa fabrication | |
| WO1997002926A1 (fr) | Pince-etau | |
| EP0595978B1 (en) | Self-locking hand tools | |
| FR2741830A1 (fr) | Pince d'usinage a fonctions multiples | |
| FR2713124A1 (fr) | Pince étau automatique. | |
| US7424838B2 (en) | Combination pliers and adjustable wrench | |
| US5931067A (en) | Self adjusting pliers | |
| EP1237681B1 (fr) | Pince-etau | |
| EP0865880A1 (fr) | Pince d'usinage à fonctions multiples | |
| FR3020003A1 (fr) | Pince a circlips | |
| TW202012110A (zh) | 具有可動扭力增加夾爪部段的鎖定鉗 | |
| EP1268135A1 (fr) | Outil de serrage, notamment pince-etau | |
| FR2822095A1 (fr) | Outil a branches articulees avec regulation de l'effort resistant. | |
| BE482514A (enExample) | ||
| FR2769534A1 (fr) | Cle a chaine autoblocante | |
| EP2383052B1 (fr) | Outil de débosselage | |
| CH652067A5 (en) | Self-clamping key | |
| FR2626441A1 (fr) | Machine a eplucher et couper les poireaux |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |