CH642945A5 - Meta-sulfonamido-benzamid derivate und verfahren zu ihrer herstellung. - Google Patents
Meta-sulfonamido-benzamid derivate und verfahren zu ihrer herstellung. Download PDFInfo
- Publication number
- CH642945A5 CH642945A5 CH86678A CH86678A CH642945A5 CH 642945 A5 CH642945 A5 CH 642945A5 CH 86678 A CH86678 A CH 86678A CH 86678 A CH86678 A CH 86678A CH 642945 A5 CH642945 A5 CH 642945A5
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- methoxy
- ethyl
- pyrrolidinylmethyl
- compound
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 26
- 238000004519 manufacturing process Methods 0.000 title claims 2
- -1 amino, methyl Chemical group 0.000 claims description 45
- 150000001875 compounds Chemical class 0.000 claims description 41
- 125000000217 alkyl group Chemical group 0.000 claims description 22
- 239000000460 chlorine Chemical group 0.000 claims description 22
- 239000002253 acid Substances 0.000 claims description 21
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 21
- 229910052739 hydrogen Inorganic materials 0.000 claims description 20
- 239000001257 hydrogen Substances 0.000 claims description 20
- 150000003839 salts Chemical class 0.000 claims description 20
- 125000003282 alkyl amino group Chemical group 0.000 claims description 15
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 9
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 125000006277 halobenzyl group Chemical group 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical group 0.000 claims description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- ZUNMZCCDRLBDHW-UHFFFAOYSA-N 4-chloro-n-[(1-ethylpyrrolidin-2-yl)methyl]-5-(methanesulfonamido)-2-methoxybenzamide Chemical compound CCN1CCCC1CNC(=O)C1=CC(NS(C)(=O)=O)=C(Cl)C=C1OC ZUNMZCCDRLBDHW-UHFFFAOYSA-N 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 4
- GJPQDUZAQIKKLP-UHFFFAOYSA-N 5-(dimethylsulfamoylamino)-n-[(1-ethylpyrrolidin-2-yl)methyl]-2-methoxy-4-methylbenzamide Chemical compound CCN1CCCC1CNC(=O)C1=CC(NS(=O)(=O)N(C)C)=C(C)C=C1OC GJPQDUZAQIKKLP-UHFFFAOYSA-N 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- 125000005237 alkyleneamino group Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims 2
- 239000012458 free base Substances 0.000 claims 2
- MDNGDDZYBUSQSU-UHFFFAOYSA-N 4-chloro-n-[(1-ethylpyrrolidin-2-yl)methyl]-2-methoxy-5-(propylsulfonylamino)benzamide Chemical compound C1=C(Cl)C(NS(=O)(=O)CCC)=CC(C(=O)NCC2N(CCC2)CC)=C1OC MDNGDDZYBUSQSU-UHFFFAOYSA-N 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 249
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Natural products CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 78
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 66
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 48
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 44
- 239000002904 solvent Substances 0.000 description 41
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 39
- 239000000203 mixture Substances 0.000 description 37
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 36
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 35
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 35
- 239000013078 crystal Substances 0.000 description 34
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 31
- 229910052938 sodium sulfate Inorganic materials 0.000 description 31
- 235000011152 sodium sulphate Nutrition 0.000 description 31
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 30
- 239000012044 organic layer Substances 0.000 description 30
- 239000011541 reaction mixture Substances 0.000 description 29
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 21
- 239000000243 solution Substances 0.000 description 19
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 18
- 235000017557 sodium bicarbonate Nutrition 0.000 description 18
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 18
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 14
- 238000001816 cooling Methods 0.000 description 13
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- 238000001704 evaporation Methods 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 230000008020 evaporation Effects 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 8
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 7
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 7
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 7
- 239000011780 sodium chloride Substances 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- WBXMKLUMWBPNFY-UHFFFAOYSA-N 2-(methanesulfonamido)benzamide Chemical compound CS(=O)(=O)NC1=CC=CC=C1C(N)=O WBXMKLUMWBPNFY-UHFFFAOYSA-N 0.000 description 5
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- IOHPVZBSOKLVMN-UHFFFAOYSA-N 2-(2-phenylethyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1CCC1=CC=CC=C1 IOHPVZBSOKLVMN-UHFFFAOYSA-N 0.000 description 4
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 4
- UJAUIHNBMJHTSW-UHFFFAOYSA-N 2-(ethylsulfonylamino)benzamide Chemical compound CCS(=O)(=O)NC1=CC=CC=C1C(N)=O UJAUIHNBMJHTSW-UHFFFAOYSA-N 0.000 description 4
- YDRXTUWNXMAPGB-UHFFFAOYSA-N 2-(sulfamoylamino)benzamide Chemical compound NC(=O)C1=CC=CC=C1NS(N)(=O)=O YDRXTUWNXMAPGB-UHFFFAOYSA-N 0.000 description 4
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 4
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 150000007529 inorganic bases Chemical class 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 4
- 230000002269 spontaneous effect Effects 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- SHQLDMYDWWQOTE-UHFFFAOYSA-N 2-amino-n-methylsulfonylbenzamide Chemical compound CS(=O)(=O)NC(=O)C1=CC=CC=C1N SHQLDMYDWWQOTE-UHFFFAOYSA-N 0.000 description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 3
- RSBXOVZBSUWTCT-UHFFFAOYSA-N 4-chloro-2-methoxy-5-nitrobenzoic acid Chemical compound COC1=CC(Cl)=C([N+]([O-])=O)C=C1C(O)=O RSBXOVZBSUWTCT-UHFFFAOYSA-N 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical class [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 3
- SCWBHWCAKIVLQO-UHFFFAOYSA-N n-[(1-ethylpyrrolidin-2-yl)methyl]-5-(methanesulfonamido)-2-methoxybenzamide Chemical compound CCN1CCCC1CNC(=O)C1=CC(NS(C)(=O)=O)=CC=C1OC SCWBHWCAKIVLQO-UHFFFAOYSA-N 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 235000019198 oils Nutrition 0.000 description 3
- 150000007530 organic bases Chemical class 0.000 description 3
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 229910003446 platinum oxide Inorganic materials 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 238000006277 sulfonation reaction Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- UNRBEYYLYRXYCG-UHFFFAOYSA-N (1-ethylpyrrolidin-2-yl)methanamine Chemical compound CCN1CCCC1CN UNRBEYYLYRXYCG-UHFFFAOYSA-N 0.000 description 2
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 2
- ATCRIUVQKHMXSH-UHFFFAOYSA-N 2,4-dichlorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1Cl ATCRIUVQKHMXSH-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 2
- FKLZXOIYBRAZIN-UHFFFAOYSA-N 5-amino-n-[(1-ethylpyrrolidin-2-yl)methyl]-2-methoxybenzamide Chemical compound CCN1CCCC1CNC(=O)C1=CC(N)=CC=C1OC FKLZXOIYBRAZIN-UHFFFAOYSA-N 0.000 description 2
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 2
- 241000282472 Canis lupus familiaris Species 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 208000025865 Ulcer Diseases 0.000 description 2
- 206010047700 Vomiting Diseases 0.000 description 2
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 230000003474 anti-emetic effect Effects 0.000 description 2
- 230000002788 anti-peptide Effects 0.000 description 2
- VMWNQDUVQKEIOC-CYBMUJFWSA-N apomorphine Chemical compound C([C@H]1N(C)CC2)C3=CC=C(O)C(O)=C3C3=C1C2=CC=C3 VMWNQDUVQKEIOC-CYBMUJFWSA-N 0.000 description 2
- 229960004046 apomorphine Drugs 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000012876 carrier material Substances 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- 125000004185 ester group Chemical class 0.000 description 2
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 235000019988 mead Nutrition 0.000 description 2
- PSCXCIPPRCFAAO-UHFFFAOYSA-N methyl 5-amino-2-methoxybenzoate Chemical compound COC(=O)C1=CC(N)=CC=C1OC PSCXCIPPRCFAAO-UHFFFAOYSA-N 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- JFCHSQDLLFJHOA-UHFFFAOYSA-N n,n-dimethylsulfamoyl chloride Chemical compound CN(C)S(Cl)(=O)=O JFCHSQDLLFJHOA-UHFFFAOYSA-N 0.000 description 2
- YTRPYXNQCLTHGY-UHFFFAOYSA-N n-[(1-ethylpyrrolidin-2-yl)methyl]-5-(methanesulfonamido)-2-methoxy-4-methylbenzamide Chemical compound CCN1CCCC1CNC(=O)C1=CC(NS(C)(=O)=O)=C(C)C=C1OC YTRPYXNQCLTHGY-UHFFFAOYSA-N 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 150000002828 nitro derivatives Chemical class 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 230000000506 psychotropic effect Effects 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N thiocyanic acid Chemical compound SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 2
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 2
- 231100000397 ulcer Toxicity 0.000 description 2
- 230000008673 vomiting Effects 0.000 description 2
- KDDNKZCVYQDGKE-UHFFFAOYSA-N (2-chlorophenyl)methanamine Chemical compound NCC1=CC=CC=C1Cl KDDNKZCVYQDGKE-UHFFFAOYSA-N 0.000 description 1
- IIFVWLUQBAIPMJ-UHFFFAOYSA-N (4-fluorophenyl)methanamine Chemical compound NCC1=CC=C(F)C=C1 IIFVWLUQBAIPMJ-UHFFFAOYSA-N 0.000 description 1
- BGRJTUBHPOOWDU-NSHDSACASA-N (S)-(-)-sulpiride Chemical compound CCN1CCC[C@H]1CNC(=O)C1=CC(S(N)(=O)=O)=CC=C1OC BGRJTUBHPOOWDU-NSHDSACASA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- SZOLUXDHHKCYKT-ONEGZZNKSA-N (e)-but-1-en-1-amine Chemical compound CC\C=C\N SZOLUXDHHKCYKT-ONEGZZNKSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 125000001917 2,4-dinitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1*)[N+]([O-])=O)[N+]([O-])=O 0.000 description 1
- WFUWWQRUDHNTGF-UHFFFAOYSA-N 2-(benzenesulfonamido)benzamide Chemical compound NC(=O)C1=CC=CC=C1NS(=O)(=O)C1=CC=CC=C1 WFUWWQRUDHNTGF-UHFFFAOYSA-N 0.000 description 1
- NENGJAOIFFHXBY-UHFFFAOYSA-N 2-(piperidin-1-ylsulfonylamino)benzamide Chemical compound NC(=O)C1=CC=CC=C1NS(=O)(=O)N1CCCCC1 NENGJAOIFFHXBY-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- WBNXTTPBEKRAJP-UHFFFAOYSA-N 2-amino-5-(methanesulfonamido)benzamide Chemical compound CS(=O)(=O)NC1=CC=C(N)C(C(N)=O)=C1 WBNXTTPBEKRAJP-UHFFFAOYSA-N 0.000 description 1
- SVCHJBHLIWRROV-UHFFFAOYSA-N 2-amino-n-(benzenesulfonyl)benzamide Chemical compound NC1=CC=CC=C1C(=O)NS(=O)(=O)C1=CC=CC=C1 SVCHJBHLIWRROV-UHFFFAOYSA-N 0.000 description 1
- WOUHOYPYLXMUBX-UHFFFAOYSA-N 2-methoxy-4-methyl-5-nitro-n-(oxolan-2-ylmethyl)benzamide Chemical compound COC1=CC(C)=C([N+]([O-])=O)C=C1C(=O)NCC1OCCC1 WOUHOYPYLXMUBX-UHFFFAOYSA-N 0.000 description 1
- NCLYYORBPCUMMU-UHFFFAOYSA-N 2-methoxy-4-methyl-5-nitrobenzoyl chloride Chemical compound COC1=CC(C)=C([N+]([O-])=O)C=C1C(Cl)=O NCLYYORBPCUMMU-UHFFFAOYSA-N 0.000 description 1
- PTOGQYUXLXZIMI-UHFFFAOYSA-N 3-(dimethylsulfamoylamino)-4-methylbenzamide Chemical compound CC1=CC=C(C(=O)N)C=C1NS(=O)(=O)N(C)C PTOGQYUXLXZIMI-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- SAUFRJLSGWYBLA-UHFFFAOYSA-N 4-chloro-2-methoxy-5-nitro-n-(oxolan-2-ylmethyl)benzamide Chemical compound COC1=CC(Cl)=C([N+]([O-])=O)C=C1C(=O)NCC1OCCC1 SAUFRJLSGWYBLA-UHFFFAOYSA-N 0.000 description 1
- UFEYMXHWIHFRBX-UHFFFAOYSA-N 4-chloro-2-methoxybenzoic acid Chemical compound COC1=CC(Cl)=CC=C1C(O)=O UFEYMXHWIHFRBX-UHFFFAOYSA-N 0.000 description 1
- XOUZIGCMSMPFJW-UHFFFAOYSA-N 4-chloro-n-[(1-ethylpyrrolidin-2-yl)methyl]-2-methoxy-5-[methyl(methylsulfonyl)amino]benzamide Chemical compound CCN1CCCC1CNC(=O)C1=CC(N(C)S(C)(=O)=O)=C(Cl)C=C1OC XOUZIGCMSMPFJW-UHFFFAOYSA-N 0.000 description 1
- MOKPQTSWJNZPCV-UHFFFAOYSA-N 4-chloro-n-[[1-[(4-fluorophenyl)methyl]pyrrolidin-2-yl]methyl]-5-(methanesulfonamido)-2-methoxybenzamide Chemical compound COC1=CC(Cl)=C(NS(C)(=O)=O)C=C1C(=O)NCC1N(CC=2C=CC(F)=CC=2)CCC1 MOKPQTSWJNZPCV-UHFFFAOYSA-N 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- HJVZGDWNFVNJAU-UHFFFAOYSA-N 5-(cyanoamino)-n-[(1-ethylpyrrolidin-2-yl)methyl]-2-methoxybenzamide Chemical compound CCN1CCCC1CNC(=O)C1=CC(NC#N)=CC=C1OC HJVZGDWNFVNJAU-UHFFFAOYSA-N 0.000 description 1
- MMYCZXRJYLNHBU-UHFFFAOYSA-N 5-(methanesulfonamido)-2-methoxy-4-methyl-n-(oxolan-2-ylmethyl)benzamide Chemical compound COC1=CC(C)=C(NS(C)(=O)=O)C=C1C(=O)NCC1OCCC1 MMYCZXRJYLNHBU-UHFFFAOYSA-N 0.000 description 1
- HUOHHUJXRCEBQL-UHFFFAOYSA-N 5-(methanesulfonamido)-2-methoxy-4-methylbenzoic acid Chemical compound COC1=CC(C)=C(NS(C)(=O)=O)C=C1C(O)=O HUOHHUJXRCEBQL-UHFFFAOYSA-N 0.000 description 1
- AWUSVSCKCCFGII-UHFFFAOYSA-N 5-(methanesulfonamido)-2-methoxybenzoic acid Chemical compound COC1=CC=C(NS(C)(=O)=O)C=C1C(O)=O AWUSVSCKCCFGII-UHFFFAOYSA-N 0.000 description 1
- DEQMTLAWUCDDKF-UHFFFAOYSA-N 5-(tert-butylsulfamoylamino)-n-[(1-ethylpyrrolidin-2-yl)methyl]-2-methoxy-4-methylbenzamide Chemical compound CCN1CCCC1CNC(=O)C1=CC(NS(=O)(=O)NC(C)(C)C)=C(C)C=C1OC DEQMTLAWUCDDKF-UHFFFAOYSA-N 0.000 description 1
- MHVXZVUZIMIXGR-UHFFFAOYSA-N 5-amino-4-chloro-2-methoxy-n-(oxolan-2-ylmethyl)benzamide Chemical compound COC1=CC(Cl)=C(N)C=C1C(=O)NCC1OCCC1 MHVXZVUZIMIXGR-UHFFFAOYSA-N 0.000 description 1
- PTRQVDVQOWYCES-UHFFFAOYSA-N 5-amino-4-chloro-n-[(1-ethylpyrrolidin-2-yl)methyl]-2-methoxybenzamide Chemical compound CCN1CCCC1CNC(=O)C1=CC(N)=C(Cl)C=C1OC PTRQVDVQOWYCES-UHFFFAOYSA-N 0.000 description 1
- LGPVJVWYNCASTE-UHFFFAOYSA-N 5-amino-n-(1-cyclohexylpyrrolidin-3-yl)-2-methoxybenzamide Chemical compound COC1=CC=C(N)C=C1C(=O)NC1CN(C2CCCCC2)CC1 LGPVJVWYNCASTE-UHFFFAOYSA-N 0.000 description 1
- BYLFPVUPGNEJJP-UHFFFAOYSA-N 5-amino-n-[(1-ethylpyrrolidin-2-yl)methyl]-2-methoxy-4-methylbenzamide Chemical compound CCN1CCCC1CNC(=O)C1=CC(N)=C(C)C=C1OC BYLFPVUPGNEJJP-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000723347 Cinnamomum Species 0.000 description 1
- RGJOEKWQDUBAIZ-IBOSZNHHSA-N CoASH Chemical compound O[C@@H]1[C@H](OP(O)(O)=O)[C@@H](COP(O)(=O)OP(O)(=O)OCC(C)(C)[C@@H](O)C(=O)NCCC(=O)NCCS)O[C@H]1N1C2=NC=NC(N)=C2N=C1 RGJOEKWQDUBAIZ-IBOSZNHHSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 206010022998 Irritability Diseases 0.000 description 1
- 230000006181 N-acylation Effects 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- 239000002111 antiemetic agent Substances 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 150000003936 benzamides Chemical class 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000004803 chlorobenzyl group Chemical group 0.000 description 1
- 235000017803 cinnamon Nutrition 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- CCJXQRNXZKSOGJ-UHFFFAOYSA-N ethylsulfonyl ethanesulfonate Chemical compound CCS(=O)(=O)OS(=O)(=O)CC CCJXQRNXZKSOGJ-UHFFFAOYSA-N 0.000 description 1
- 125000004175 fluorobenzyl group Chemical group 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 208000013403 hyperactivity Diseases 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- IZDROVVXIHRYMH-UHFFFAOYSA-N methanesulfonic anhydride Chemical compound CS(=O)(=O)OS(C)(=O)=O IZDROVVXIHRYMH-UHFFFAOYSA-N 0.000 description 1
- YSOOKVHJDSPPBE-UHFFFAOYSA-N methyl 5-(methanesulfonamido)-2-methoxybenzoate Chemical compound COC(=O)C1=CC(NS(C)(=O)=O)=CC=C1OC YSOOKVHJDSPPBE-UHFFFAOYSA-N 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- JHPQEXUCADZGGU-UHFFFAOYSA-N methylsulfonyl 2-aminobenzoate Chemical compound CS(=O)(=O)OC(=O)C1=CC=CC=C1N JHPQEXUCADZGGU-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- UCNKMHNRFPZNLU-UHFFFAOYSA-N n-(1-cyclohexylpyrrolidin-3-yl)-5-(methanesulfonamido)-2-methoxybenzamide Chemical compound COC1=CC=C(NS(C)(=O)=O)C=C1C(=O)NC1CN(C2CCCCC2)CC1 UCNKMHNRFPZNLU-UHFFFAOYSA-N 0.000 description 1
- MMVCVPRWHIYIDW-UHFFFAOYSA-N n-(2,5-dichloropentyl)-5-(dimethylsulfamoylamino)-2-methoxy-4-methylbenzamide Chemical compound COC1=CC(C)=C(NS(=O)(=O)N(C)C)C=C1C(=O)NCC(Cl)CCCCl MMVCVPRWHIYIDW-UHFFFAOYSA-N 0.000 description 1
- KWWADOCEGZQAEU-UHFFFAOYSA-N n-(2,5-dichloropentyl)-5-(methanesulfonamido)-2-methoxy-4-methylbenzamide Chemical compound COC1=CC(C)=C(NS(C)(=O)=O)C=C1C(=O)NCC(Cl)CCCCl KWWADOCEGZQAEU-UHFFFAOYSA-N 0.000 description 1
- JEJNOOWNOVKPAM-UHFFFAOYSA-N n-[(1-ethylpyrrolidin-2-yl)methyl]-2-methoxy-5-(sulfamoylamino)benzamide Chemical compound CCN1CCCC1CNC(=O)C1=CC(NS(N)(=O)=O)=CC=C1OC JEJNOOWNOVKPAM-UHFFFAOYSA-N 0.000 description 1
- DVRHYBYPKBFJKY-UHFFFAOYSA-N n-[(1-ethylpyrrolidin-2-yl)methyl]-2-methoxy-5-nitrobenzamide Chemical compound CCN1CCCC1CNC(=O)C1=CC([N+]([O-])=O)=CC=C1OC DVRHYBYPKBFJKY-UHFFFAOYSA-N 0.000 description 1
- BIPQMEIMZLUWMX-UHFFFAOYSA-N n-[(1-ethylpyrrolidin-2-yl)methyl]-5-(ethylsulfonylamino)-2-methoxybenzamide Chemical compound CCN1CCCC1CNC(=O)C1=CC(NS(=O)(=O)CC)=CC=C1OC BIPQMEIMZLUWMX-UHFFFAOYSA-N 0.000 description 1
- WGBSTIRRHNSMRN-UHFFFAOYSA-N n-tert-butylsulfamoyl chloride Chemical compound CC(C)(C)NS(Cl)(=O)=O WGBSTIRRHNSMRN-UHFFFAOYSA-N 0.000 description 1
- 230000000802 nitrating effect Effects 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- KQOATKAFTRNONV-UHFFFAOYSA-N oxolan-2-amine Chemical compound NC1CCCO1 KQOATKAFTRNONV-UHFFFAOYSA-N 0.000 description 1
- YNOGYQAEJGADFJ-UHFFFAOYSA-N oxolan-2-ylmethanamine Chemical compound NCC1CCCO1 YNOGYQAEJGADFJ-UHFFFAOYSA-N 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 238000011421 subcutaneous treatment Methods 0.000 description 1
- BGRJTUBHPOOWDU-UHFFFAOYSA-N sulpiride Chemical compound CCN1CCCC1CNC(=O)C1=CC(S(N)(=O)=O)=CC=C1OC BGRJTUBHPOOWDU-UHFFFAOYSA-N 0.000 description 1
- 229960004940 sulpiride Drugs 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 229940100445 wheat starch Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/10—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/14—Nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
- C07D207/09—Radicals substituted by nitrogen atoms, not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/04—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D307/10—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/14—Radicals substituted by nitrogen atoms not forming part of a nitro radical
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP52008443A JPS5920667B2 (ja) | 1977-01-27 | 1977-01-27 | スルホンアミド系ベンズアミド誘導体 |
| JP52094884A JPS5822110B2 (ja) | 1977-08-08 | 1977-08-08 | ベンズアミド誘導体の合成法 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH642945A5 true CH642945A5 (de) | 1984-05-15 |
Family
ID=26342958
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH86678A CH642945A5 (de) | 1977-01-27 | 1978-01-26 | Meta-sulfonamido-benzamid derivate und verfahren zu ihrer herstellung. |
Country Status (18)
| Country | Link |
|---|---|
| US (6) | US4351770A (enExample) |
| AR (1) | AR225881A1 (enExample) |
| AU (1) | AU512057B2 (enExample) |
| CA (1) | CA1085411A (enExample) |
| CH (1) | CH642945A5 (enExample) |
| DE (1) | DE2803651A1 (enExample) |
| DK (1) | DK154137C (enExample) |
| ES (1) | ES466366A1 (enExample) |
| FR (1) | FR2378758A1 (enExample) |
| GB (1) | GB1557019A (enExample) |
| GR (1) | GR70058B (enExample) |
| HU (1) | HU176613B (enExample) |
| IE (1) | IE46497B1 (enExample) |
| IL (1) | IL53881A (enExample) |
| NL (1) | NL7801005A (enExample) |
| NZ (1) | NZ186175A (enExample) |
| PH (1) | PH12853A (enExample) |
| SE (1) | SE426485B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2440946A2 (fr) * | 1978-01-20 | 1980-06-06 | Ile De France | Nouveaux benzamides heterocycliques substitues, leurs procedes de preparation et leur application comme modificateurs du comportement |
| FR2485526A1 (fr) * | 1980-06-24 | 1981-12-31 | Shionogi & Co | Procede de preparation de derives de n-(diethylaminoethyl)-2 - alcoxybenzamide, nouveaux produits ainsi obtenus et leurs utilisations comme produits pharmaceutiques antiemetiques ou pour guerir les troubles gastriques |
| SE8101536L (sv) * | 1981-03-11 | 1982-09-12 | Astra Laekemedel Ab | Bensamid-derivat |
| PT77219B (fr) * | 1982-08-24 | 1986-02-04 | May & Baker Ltd | Procede de preparation des derives de la benzamide |
| SE8205135D0 (sv) * | 1982-09-09 | 1982-09-09 | Astra Laekemedel Ab | Benzamido-derivatives |
| FR2550447B1 (fr) * | 1983-08-10 | 1986-01-17 | Ile De France | Application du n-(ally-2-pyrrolidinylmethyl) 2-methoxy 4-amino 5-methylsulfamoyl benzamide comme antiagregant plaquettaire |
| FR2557110B1 (fr) * | 1983-12-23 | 1989-11-24 | Sandoz Sa | Nouveaux derives d'amines cycliques, leur preparation et leur utilisation comme medicaments |
| AU567140B2 (en) * | 1984-01-06 | 1987-11-12 | Shionogi & Co., Ltd. | Sulphonamido-benzamide derivatives |
| US4544654A (en) * | 1984-03-20 | 1985-10-01 | Schering A.G. | Substituted sulfonamidobenzamides, antiarrhythmic agents and compositions thereof |
| CA2057324A1 (en) * | 1990-12-18 | 1992-06-19 | Lora Louise Fitch | Benzamide and sulfonamide hypoglycemic agents |
| TR200101398T2 (tr) * | 1998-11-20 | 2001-09-21 | F.Hoffmann-La Roche Ag | Pirolidin türevleri-CCR-3 reseptörü antagonistleri. |
| EP2265574A1 (en) * | 2008-02-29 | 2010-12-29 | Array Biopharma, Inc. | N- (6-aminopyridin-3-yl) -3- (sulfonamido) benzamide derivatives as b-raf inhibitors for the treatment of cancer |
| US20110003809A1 (en) * | 2008-02-29 | 2011-01-06 | Array Biopharma Inc. | Imidazo [4,5-b] pyridine derivatives used as raf inhibitors |
| AU2009222144A1 (en) * | 2008-02-29 | 2009-09-11 | Array Biopharma Inc. | Pyrazole [3, 4-b] pyridine Raf inhibitors |
| CL2009000447A1 (es) * | 2008-02-29 | 2010-01-04 | Array Biopharma Inc Y Genentech Inc | Compuestos derivados de (1h-pirrolo{2,3-b}piridin-5-il)-sulfonamido-benzamida sustituida; procedimiento de preparacion; composicion farmaceutica; y su uso en el tratamiento del cancer, a travez de la inhibicion de raf. |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2334186A (en) * | 1938-12-20 | 1943-11-16 | Du Pont | Organic sulphonamides and their preparation |
| FR148F (enExample) * | 1962-01-24 | |||
| US3342826A (en) * | 1964-01-13 | 1967-09-19 | Ile De France | Heterocyclic aminoalkyl benzamides |
| US3210370A (en) * | 1964-06-22 | 1965-10-05 | Upjohn Co | Process for preparing 2, 2'-methylene-bisareneimiazoles |
| FR5916M (enExample) * | 1966-01-21 | 1968-05-06 | ||
| FR2313935A1 (fr) * | 1975-06-10 | 1977-01-07 | Ile De France | Nouveaux benzamides substitues, leurs derives et leur procede de preparation |
| CH547797A (de) * | 1971-08-20 | 1974-04-11 | Fratmann Ag | Verfahren zur herstellung von n - ((1-aethyl-pyrrolidinyl2)-methyl) -2-methoxy-5-sulfamoyl-benzamid. |
| US4021229A (en) * | 1972-09-05 | 1977-05-03 | Stauffer Chemical Company | Sulfonamide herbicide antidote compositions and method of use |
| IL46696A (en) * | 1974-03-05 | 1978-07-31 | Soc Et Scient Et Ind | Substituted n-(2-pyrrolidinylalkyl)benzamides, their preparation and pharmaceutical compositions containing them |
| CH605793A5 (fr) * | 1974-03-05 | 1978-10-13 | Soc Et Scient Et Ind | Procédé de préparation de nouveaux N-(1benzylpyrrollidinil 2-alkyl) benzamides substitués |
| FR2294698A1 (fr) * | 1974-12-18 | 1976-07-16 | Synthelabo | Nouveaux derives des methoxy-2 benzamides substitues, leurs sels, leur preparation et les medicaments qui en renferment |
-
1978
- 1978-01-09 NZ NZ186175A patent/NZ186175A/xx unknown
- 1978-01-19 CA CA295,322A patent/CA1085411A/en not_active Expired
- 1978-01-19 GB GB2296/78A patent/GB1557019A/en not_active Expired
- 1978-01-21 GR GR55228A patent/GR70058B/el unknown
- 1978-01-23 IE IE145/78A patent/IE46497B1/en unknown
- 1978-01-24 IL IL53881A patent/IL53881A/xx unknown
- 1978-01-24 AU AU32687/78A patent/AU512057B2/en not_active Expired
- 1978-01-25 DK DK037278A patent/DK154137C/da not_active IP Right Cessation
- 1978-01-26 HU HU78SI1614A patent/HU176613B/hu not_active IP Right Cessation
- 1978-01-26 PH PH20712A patent/PH12853A/en unknown
- 1978-01-26 SE SE7800982A patent/SE426485B/sv not_active IP Right Cessation
- 1978-01-26 AR AR270868A patent/AR225881A1/es active
- 1978-01-26 CH CH86678A patent/CH642945A5/de not_active IP Right Cessation
- 1978-01-26 FR FR7802210A patent/FR2378758A1/fr active Granted
- 1978-01-26 ES ES466366A patent/ES466366A1/es not_active Expired
- 1978-01-27 DE DE19782803651 patent/DE2803651A1/de active Granted
- 1978-01-27 NL NL7801005A patent/NL7801005A/xx not_active Application Discontinuation
- 1978-12-06 US US05/967,011 patent/US4351770A/en not_active Expired - Lifetime
-
1980
- 1980-02-26 US US06/124,727 patent/US4328155A/en not_active Expired - Lifetime
- 1980-02-26 US US06/124,726 patent/US4350635A/en not_active Expired - Lifetime
- 1980-02-26 US US06/124,728 patent/US4328344A/en not_active Expired - Lifetime
- 1980-06-25 US US06/162,793 patent/US4330472A/en not_active Expired - Lifetime
-
1982
- 1982-07-15 US US06/398,702 patent/US4431663A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| DK154137C (da) | 1989-04-10 |
| FR2378758A1 (fr) | 1978-08-25 |
| IE46497B1 (en) | 1983-06-29 |
| US4431663A (en) | 1984-02-14 |
| DE2803651C2 (enExample) | 1988-10-20 |
| NZ186175A (en) | 1980-03-05 |
| US4351770A (en) | 1982-09-28 |
| PH12853A (en) | 1979-09-12 |
| US4328155A (en) | 1982-05-04 |
| ES466366A1 (es) | 1978-10-01 |
| IL53881A0 (en) | 1978-04-30 |
| HU176613B (en) | 1981-03-28 |
| SE426485B (sv) | 1983-01-24 |
| GR70058B (enExample) | 1982-07-26 |
| US4350635A (en) | 1982-09-21 |
| US4328344A (en) | 1982-05-04 |
| DE2803651A1 (de) | 1978-08-03 |
| US4330472A (en) | 1982-05-18 |
| DK154137B (da) | 1988-10-17 |
| SE7800982L (sv) | 1978-07-28 |
| AU512057B2 (en) | 1980-09-18 |
| AR225881A1 (es) | 1982-05-14 |
| IL53881A (en) | 1981-05-20 |
| AU3268778A (en) | 1979-08-02 |
| NL7801005A (nl) | 1978-07-31 |
| DK37278A (da) | 1978-07-28 |
| FR2378758B1 (enExample) | 1981-02-06 |
| GB1557019A (en) | 1979-12-05 |
| IE780145L (en) | 1978-07-27 |
| CA1085411A (en) | 1980-09-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2500157C2 (de) | N-Acyl-4-(2-aminoäthyl)-benzoesäuren, deren Salze und Ester, Verfahren zu deren Herstellung und deren Verwendung | |
| EP0136658B1 (de) | 1-Benzyl-aminoalkyl-pyrrolidinone und ihre Säureadditionssalze, Verfahren zu ihrer Herstellung und Arzneimittel | |
| EP0287907B1 (de) | Pyrazolo[3,4-d]pyrimidine, Verfahren zu ihrer Herstellung und Verwendung als Arzneimittel | |
| CH642945A5 (de) | Meta-sulfonamido-benzamid derivate und verfahren zu ihrer herstellung. | |
| DE2255172A1 (de) | Imidazotriazinone, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparate | |
| DE1493955A1 (de) | Verfahren zur Herstellung substituierter Sulfonanilide | |
| DE19963234A1 (de) | Substituierte Piperazinderivate, ihre Herstellung und ihre Verwendung als Arzneimittel | |
| AT391694B (de) | Verfahren zur herstellung von neuen ethylendiaminmonoamid-derivaten | |
| DE2901170C2 (enExample) | ||
| DE2613420C2 (de) | Benzamidderivate, Verfahren zu ihrer Herstellung und Arzneimittel mit diesen Verbindungen als Wirkstoff | |
| DE1795022A1 (de) | Heterocyclische Verbindungen und Verfahren zu ihrer Herstellung | |
| DE19945594A1 (de) | Substituierte Piperazinderivate, ihre Herstellung und ihre Verwendung als Arzneimittel | |
| DE1518452C3 (de) | 4 substituierte 2 Benzhydryl 2 butanol Derivate und Verfahren zu ihrer Herstellung | |
| DE2617955A1 (de) | Neue l-substituierte -aroyl-4-hydroxypiperidine, verfahren zu ihrer herstellung und sie enthaltende arzneimittel | |
| CH610330A5 (en) | Process for the preparation of novel ergopeptins | |
| DE3247454A1 (de) | Substituierte 3-phenyl-5-methyl-isoxazol-4-carboxy-anilide, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| EP0606658B1 (de) | Substituierte N-Aminoalkylmethansulfanilide als Antispasmodika | |
| DE2409313A1 (de) | Neue pyrrolyl-verbindungen und verfahren zu ihrer herstellung | |
| DE2521519A1 (de) | Substituierte 9,10-dihydroanthracen- 9,10-imine und heterocyclische (aza) analoge davon und verfahren zur herstellung dieser verbindungen | |
| DE2737195A1 (de) | Benzolsulfonamidderivate und verfahren zu ihrer herstellung | |
| DE2215999A1 (de) | Nitroimidazolyl-triazolo-pyridazine und verfahren zu ihrer herstellung | |
| DE3121137A1 (de) | Neue pyridazino(4,5-b)indole, verfahren zu ihrer herstellung, ihre verwendung sowie pharmazeutische praeparate auf basis dieser verbindungen, zwischenprodukte und deren herstellung" | |
| DE2402989C3 (de) | Neue Benzylamine, sie enthaltende Arzneimittel und Verfahren zu ihrer Herstellung | |
| DE1493828A1 (de) | Verfahren zur Herstellung von substituierten Benzamiden | |
| AT211297B (de) | Verfahren zur Herstellung des neuen 5-Chlortoluol-2,4-disulfonsäureamids und dessen Alkalimetallsalze |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |