CH639949A5 - Process for the preparation of chlorothioformates - Google Patents
Process for the preparation of chlorothioformates Download PDFInfo
- Publication number
- CH639949A5 CH639949A5 CH258778A CH258778A CH639949A5 CH 639949 A5 CH639949 A5 CH 639949A5 CH 258778 A CH258778 A CH 258778A CH 258778 A CH258778 A CH 258778A CH 639949 A5 CH639949 A5 CH 639949A5
- Authority
- CH
- Switzerland
- Prior art keywords
- reactor
- alkyl
- chlorothioformate
- chlorine
- phosgene
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 48
- KTRFZWJCHOQHMN-UHFFFAOYSA-N chloromethanethioic s-acid Chemical class SC(Cl)=O KTRFZWJCHOQHMN-UHFFFAOYSA-N 0.000 title claims description 16
- 238000002360 preparation method Methods 0.000 title claims description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 25
- 238000006243 chemical reaction Methods 0.000 claims description 21
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 18
- 239000003054 catalyst Substances 0.000 claims description 15
- 239000007791 liquid phase Substances 0.000 claims description 12
- -1 alkyl chlorothioformate Chemical compound 0.000 claims description 11
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 11
- 239000000047 product Substances 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 claims description 9
- 239000007795 chemical reaction product Substances 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 7
- 239000000463 material Substances 0.000 claims description 7
- 239000007858 starting material Substances 0.000 claims description 7
- 125000004981 cycloalkylmethyl group Chemical group 0.000 claims description 6
- 125000001797 benzyl group Chemical class [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- GRSBAMVBFWRBBH-UHFFFAOYSA-N o-ethyl chloromethanethioate Chemical compound CCOC(Cl)=S GRSBAMVBFWRBBH-UHFFFAOYSA-N 0.000 claims description 5
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 239000007788 liquid Substances 0.000 claims description 4
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- ZAQKARPVESJRLT-UHFFFAOYSA-M C(=S)[O-].[Cl+] Chemical compound C(=S)[O-].[Cl+] ZAQKARPVESJRLT-UHFFFAOYSA-M 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- 229910052801 chlorine Inorganic materials 0.000 claims 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims 1
- 239000006227 byproduct Substances 0.000 description 8
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- CETBSQOFQKLHHZ-UHFFFAOYSA-N Diethyl disulfide Chemical group CCSSCC CETBSQOFQKLHHZ-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- KIZSKBJFSGBVQC-UHFFFAOYSA-N o-propyl chloromethanethioate Chemical compound CCCOC(Cl)=S KIZSKBJFSGBVQC-UHFFFAOYSA-N 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 2
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- SUVIGLJNEAMWEG-UHFFFAOYSA-N propane-1-thiol Chemical compound CCCS SUVIGLJNEAMWEG-UHFFFAOYSA-N 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- LDVVMCZRFWMZSG-OLQVQODUSA-N (3ar,7as)-2-(trichloromethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione Chemical compound C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)Cl)C(=O)[C@H]21 LDVVMCZRFWMZSG-OLQVQODUSA-N 0.000 description 1
- ULIKDJVNUXNQHS-UHFFFAOYSA-N 2-Propene-1-thiol Chemical compound SCC=C ULIKDJVNUXNQHS-UHFFFAOYSA-N 0.000 description 1
- 239000005745 Captan Substances 0.000 description 1
- UENWRTRMUIOCKN-UHFFFAOYSA-N benzyl thiol Chemical compound SCC1=CC=CC=C1 UENWRTRMUIOCKN-UHFFFAOYSA-N 0.000 description 1
- 229940117949 captan Drugs 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- CMKBCTPCXZNQKX-UHFFFAOYSA-N cyclohexanethiol Chemical compound SC1CCCCC1 CMKBCTPCXZNQKX-UHFFFAOYSA-N 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000005244 neohexyl group Chemical group [H]C([H])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- BQIABQCJXBELMT-UHFFFAOYSA-N o-(4-chlorophenyl) chloromethanethioate Chemical compound ClC(=S)OC1=CC=C(Cl)C=C1 BQIABQCJXBELMT-UHFFFAOYSA-N 0.000 description 1
- SFSPOXSIVFSJHM-UHFFFAOYSA-N o-benzyl chloromethanethioate Chemical compound ClC(=S)OCC1=CC=CC=C1 SFSPOXSIVFSJHM-UHFFFAOYSA-N 0.000 description 1
- UFFYFCIOYMVMDY-UHFFFAOYSA-N o-cyclohexyl chloromethanethioate Chemical compound ClC(=S)OC1CCCCC1 UFFYFCIOYMVMDY-UHFFFAOYSA-N 0.000 description 1
- JGZZEAPGGFAOAY-UHFFFAOYSA-N o-ethyl ethylsulfanylmethanethioate Chemical group CCOC(=S)SCC JGZZEAPGGFAOAY-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- HBEFYGYBMKPNSZ-UHFFFAOYSA-N s-phenyl chloromethanethioate Chemical compound ClC(=O)SC1=CC=CC=C1 HBEFYGYBMKPNSZ-UHFFFAOYSA-N 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003558 thiocarbamic acid derivatives Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C329/00—Thiocarbonic acids; Halides, esters or anhydrides thereof
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/582—Recycling of unreacted starting or intermediate materials
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/775,821 US4119659A (en) | 1975-11-28 | 1977-03-09 | Production of ethyl chlorothioformate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH639949A5 true CH639949A5 (en) | 1983-12-15 |
Family
ID=25105608
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH258778A CH639949A5 (en) | 1977-03-09 | 1978-03-09 | Process for the preparation of chlorothioformates |
Country Status (20)
| Country | Link |
|---|---|
| JP (1) | JPS53112816A (enExample) |
| AT (1) | AT368992B (enExample) |
| AU (1) | AU3388178A (enExample) |
| BE (1) | BE864686R (enExample) |
| BG (1) | BG38486A3 (enExample) |
| BR (1) | BR7801423A (enExample) |
| CH (1) | CH639949A5 (enExample) |
| DD (1) | DD134869A5 (enExample) |
| DE (1) | DE2809776C2 (enExample) |
| ES (1) | ES467699A1 (enExample) |
| FR (1) | FR2383172A1 (enExample) |
| GB (1) | GB1560608A (enExample) |
| HU (1) | HU182575B (enExample) |
| IL (1) | IL54140A (enExample) |
| IT (1) | IT1155865B (enExample) |
| NL (1) | NL188640C (enExample) |
| PL (1) | PL205160A1 (enExample) |
| RO (1) | RO77787A (enExample) |
| YU (1) | YU41428B (enExample) |
| ZA (1) | ZA781370B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2007204428A (ja) * | 2006-02-02 | 2007-08-16 | Sumitomo Chemical Co Ltd | クロロチオールホルメートの製造法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3165544A (en) * | 1960-09-06 | 1965-01-12 | Stauffer Chemical Co | Chlorothiolformates and preparation thereof |
| US3093537A (en) * | 1960-09-06 | 1963-06-11 | Tilles Harry | Chlorothiolformate pesticide |
| US4012405A (en) * | 1975-11-28 | 1977-03-15 | Stauffer Chemical Company | Production of ethyl chlorothioformate |
-
1978
- 1978-02-27 IL IL54140A patent/IL54140A/xx unknown
- 1978-03-02 AT AT0151578A patent/AT368992B/de not_active IP Right Cessation
- 1978-03-06 NL NLAANVRAGE7802453,A patent/NL188640C/xx not_active IP Right Cessation
- 1978-03-06 AU AU33881/78A patent/AU3388178A/en active Pending
- 1978-03-07 IT IT48316/78A patent/IT1155865B/it active
- 1978-03-07 DE DE2809776A patent/DE2809776C2/de not_active Expired
- 1978-03-07 DD DD78204017A patent/DD134869A5/xx unknown
- 1978-03-07 RO RO7893427A patent/RO77787A/ro unknown
- 1978-03-08 GB GB9170/78A patent/GB1560608A/en not_active Expired
- 1978-03-08 ZA ZA00781370A patent/ZA781370B/xx unknown
- 1978-03-08 FR FR7806649A patent/FR2383172A1/fr active Granted
- 1978-03-08 BR BR7801423A patent/BR7801423A/pt unknown
- 1978-03-08 PL PL20516078A patent/PL205160A1/xx unknown
- 1978-03-08 HU HU78SA3097A patent/HU182575B/hu unknown
- 1978-03-09 JP JP2609078A patent/JPS53112816A/ja active Granted
- 1978-03-09 CH CH258778A patent/CH639949A5/de not_active IP Right Cessation
- 1978-03-09 ES ES467699A patent/ES467699A1/es not_active Expired
- 1978-03-09 YU YU561/78A patent/YU41428B/xx unknown
- 1978-03-09 BE BE2056744A patent/BE864686R/xx not_active IP Right Cessation
- 1978-03-09 BG BG038954A patent/BG38486A3/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2383172B1 (enExample) | 1984-02-10 |
| DE2809776A1 (de) | 1978-09-14 |
| BR7801423A (pt) | 1978-10-31 |
| AT368992B (de) | 1982-11-25 |
| JPS53112816A (en) | 1978-10-02 |
| FR2383172A1 (fr) | 1978-10-06 |
| HU182575B (en) | 1984-02-28 |
| IT7848316A0 (it) | 1978-03-07 |
| NL7802453A (nl) | 1978-09-12 |
| BG38486A3 (en) | 1985-12-16 |
| ES467699A1 (es) | 1978-10-16 |
| DD134869A5 (de) | 1979-03-28 |
| BE864686R (nl) | 1978-09-11 |
| NL188640B (nl) | 1992-03-16 |
| AU3388178A (en) | 1979-09-13 |
| PL205160A1 (pl) | 1979-03-26 |
| DE2809776C2 (de) | 1986-06-26 |
| GB1560608A (en) | 1980-02-06 |
| YU41428B (en) | 1987-06-30 |
| ZA781370B (en) | 1979-02-28 |
| RO77787A (ro) | 1981-11-24 |
| IT1155865B (it) | 1987-01-28 |
| IL54140A (en) | 1982-03-31 |
| JPS6228783B2 (enExample) | 1987-06-23 |
| NL188640C (nl) | 1992-08-17 |
| ATA151578A (de) | 1982-04-15 |
| IL54140A0 (en) | 1978-04-30 |
| YU56178A (en) | 1982-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69620461T2 (de) | Verfahren zur herstellung von 1,1,1,3,3,-pentafluoropropanen | |
| DE69626119T2 (de) | Verfahren zur herstellung von 3- (methylthio) propanol | |
| DE1811768C2 (de) | Verfahren zur kontinuierlichen Herstellung von Alkylsulfonylchloriden | |
| DE69515036T2 (de) | Verfahren zur herstellung von difluormethan | |
| DE69801392T2 (de) | Herstellung von Methylchlorid | |
| AT414239B (de) | Hochdruckverfahren zur herstellung von reinem melamin | |
| DE2652959C2 (de) | Verfahren zur Herstellung von Äthylchlorthioformiat | |
| DE2418592C2 (de) | Verfahren zur Herstellung von Thiocarbaminsäureestern | |
| DE19510909B4 (de) | Verbessertes Verfahren zur Synthese von Dimethylcarbonat | |
| DE2604277C2 (de) | Verfahren zur Herstellung von 2,5- Dichlor-p-xylol | |
| DE69209192T2 (de) | Verfahren zur selektiven Darstellung von organischen Trisulfiden | |
| DE2924133A1 (de) | Verfahren zur kontinuierlichen cyanaethylierung | |
| DE2845918A1 (de) | Verfahren zur herstellung von alkansulfonsaeurechloriden | |
| CH639949A5 (en) | Process for the preparation of chlorothioformates | |
| DE2530094B1 (de) | Verfahren zur kontinuierlichen Herstellung von Mono- oder Di-(trichlor methyl) benzolen | |
| DE2832876A1 (de) | Verfahren zur halogenierung von aldehyden | |
| DE1936988B2 (de) | Verfahren zur herstellung von vanadinoxitrichlorid | |
| DE69400130T2 (de) | Verfahren zur Herstellung von Alkylen-Carbonaten | |
| DE1960063C3 (de) | Verfahren zur Herstellung von Allylchlorid | |
| DE3111619C2 (de) | Verfahren zur Herstellung von Guanidinnitrat aus einem Gemisch aus Harnstoff und überschüssigem Ammonnitrat | |
| DE1768532C3 (de) | Verfahren zur Herstellung von Vinylfluorid und/oder 1,1-Difluoräthan | |
| DE1618667C (de) | Verfahren zur Herstellung von aliphatischen Sulfonylchloriden und Alkylchloriden | |
| DE2134159B2 (enExample) | ||
| DE2601824C2 (de) | Verfahren zur Herstellung von beta-Chlorpropionsäurechlorid | |
| DE1768055C (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PUE | Assignment |
Owner name: ZENECA INC. |
|
| PL | Patent ceased |