CH639409A5 - Reaktivfarbstoffe. - Google Patents
Reaktivfarbstoffe. Download PDFInfo
- Publication number
- CH639409A5 CH639409A5 CH582879A CH582879A CH639409A5 CH 639409 A5 CH639409 A5 CH 639409A5 CH 582879 A CH582879 A CH 582879A CH 582879 A CH582879 A CH 582879A CH 639409 A5 CH639409 A5 CH 639409A5
- Authority
- CH
- Switzerland
- Prior art keywords
- parts
- dyes
- methyl
- reactive dyes
- formula
- Prior art date
Links
- 239000000985 reactive dye Substances 0.000 title claims 2
- 239000000975 dye Substances 0.000 claims description 10
- 238000004043 dyeing Methods 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 4
- REJHVSOVQBJEBF-OWOJBTEDSA-N 5-azaniumyl-2-[(e)-2-(4-azaniumyl-2-sulfonatophenyl)ethenyl]benzenesulfonate Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1\C=C\C1=CC=C(N)C=C1S(O)(=O)=O REJHVSOVQBJEBF-OWOJBTEDSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- REJHVSOVQBJEBF-UHFFFAOYSA-N DSD-acid Natural products OS(=O)(=O)C1=CC(N)=CC=C1C=CC1=CC=C(N)C=C1S(O)(=O)=O REJHVSOVQBJEBF-UHFFFAOYSA-N 0.000 claims description 3
- 239000000460 chlorine Chemical group 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Chemical group 0.000 claims description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 125000001153 fluoro group Chemical group F* 0.000 claims description 2
- 239000010985 leather Substances 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 229910006069 SO3H Inorganic materials 0.000 claims 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- WXWCDTXEKCVRRO-UHFFFAOYSA-N para-Cresidine Chemical compound COC1=CC=C(C)C=C1N WXWCDTXEKCVRRO-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- GYFZMCLUPHXUDV-UHFFFAOYSA-N 2-ethoxy-5-methylaniline Chemical compound CCOC1=CC=C(C)C=C1N GYFZMCLUPHXUDV-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- VMKJWLXVLHBJNK-UHFFFAOYSA-N cyanuric fluoride Chemical compound FC1=NC(F)=NC(F)=N1 VMKJWLXVLHBJNK-UHFFFAOYSA-N 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- PEMGGJDINLGTON-UHFFFAOYSA-N n-(3-aminophenyl)acetamide Chemical compound CC(=O)NC1=CC=CC(N)=C1 PEMGGJDINLGTON-UHFFFAOYSA-N 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/02—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring
- C09B62/04—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring to a triazine ring
- C09B62/08—Azo dyes
- C09B62/09—Disazo or polyazo dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Paper (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2827980A DE2827980C3 (de) | 1978-06-26 | 1978-06-26 | Reaktivfarbstoffe, Verfahren zu ihrer Herstellung und deren Verwendung zum Färben von hydroxylgruppenhaltigen TextUfasern, Leder und Papier |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH639409A5 true CH639409A5 (de) | 1983-11-15 |
Family
ID=6042785
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH582879A CH639409A5 (de) | 1978-06-26 | 1979-06-21 | Reaktivfarbstoffe. |
Country Status (6)
| Country | Link |
|---|---|
| JP (1) | JPS555976A (it) |
| CH (1) | CH639409A5 (it) |
| DE (1) | DE2827980C3 (it) |
| FR (1) | FR2429814B1 (it) |
| GB (1) | GB2029436B (it) |
| IT (1) | IT1120943B (it) |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5138588A (en) * | 1974-09-27 | 1976-03-31 | Nippon Kayaku Kk | Seruroozukeisenino senshokuho |
| GB1461125A (en) * | 1974-10-02 | 1977-01-13 | Ici Ltd | Fluorotriazinyl reactive dyestuff |
-
1978
- 1978-06-26 DE DE2827980A patent/DE2827980C3/de not_active Expired
-
1979
- 1979-06-07 IT IT23366/79A patent/IT1120943B/it active
- 1979-06-13 FR FR7915115A patent/FR2429814B1/fr not_active Expired
- 1979-06-14 JP JP7409179A patent/JPS555976A/ja active Pending
- 1979-06-21 CH CH582879A patent/CH639409A5/de not_active IP Right Cessation
- 1979-06-25 GB GB7922092A patent/GB2029436B/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB2029436A (en) | 1980-03-19 |
| DE2827980C3 (de) | 1981-01-22 |
| JPS555976A (en) | 1980-01-17 |
| FR2429814B1 (fr) | 1986-02-28 |
| IT1120943B (it) | 1986-03-26 |
| DE2827980A1 (de) | 1980-01-03 |
| FR2429814A1 (fr) | 1980-01-25 |
| DE2827980B2 (de) | 1980-05-08 |
| GB2029436B (en) | 1982-11-03 |
| IT7923366A0 (it) | 1979-06-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1235466B (de) | Verfahren zur Herstellung von organischen Farbstoffen | |
| CH645125A5 (de) | Verfahren zur herstellung wasserloeslicher phthalocyaninfarbstoffe. | |
| CH630945A5 (de) | Waessrige farbstoffzubereitungen fuer cellulose oder cellulosehaltiges fasermaterial. | |
| CH639409A5 (de) | Reaktivfarbstoffe. | |
| EP0075773B1 (de) | Farbstoffe, ihre Herstellung und Verwendung | |
| DE2849471A1 (de) | Azofarbstoffe mit heterocyclischen diazokomponenten | |
| DE2817033C2 (de) | Reaktivfarbstoffe | |
| DE2846201C2 (de) | Reaktivfarbstoffe | |
| DE959748C (de) | Verfahren zur Herstellung neuer Monoazofarbstoffe | |
| DE2151723A1 (de) | Verfahren zur Herstellung schwer loeslicher,heterocyclischer Verbindungen | |
| EP0029106B1 (de) | Reaktivfarbstoffe, die eine Halogenalkanoylamido- oder Halogenacryloylamido-Gruppe enthalten, deren Herstellung und Verwendung, sowie die Halogenalkanoylamido- bzw. Halogenacryloylamido-Zwischenverbindung | |
| EP0126406A2 (de) | Farbstoffmischungen | |
| DE3908073A1 (de) | Verdoppelte reaktivfarbstoffe | |
| EP0522339B1 (de) | Formazan-Farbstoffe mit einem Diffluorpyrimidinreaktivrest | |
| DE1808587C3 (de) | Wasserloesliche Monoazoreaktivfarbstoffe,Verfahren zu ihrer Herstellung und ihre Verwendung zum Faerben oder Bedrucken | |
| DE2816937C2 (de) | Verwendung von Reaktivfarbstoffen zum Färben von cellulosehaltigem Textilmaterial oder Leder | |
| EP0034724A2 (de) | Polyazofarbstoffe | |
| EP0319845A2 (de) | Wasserlösliche Disazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| DE2305223A1 (de) | Reaktivfarbstoffe | |
| EP0115626A2 (de) | Reaktivfarbstoffe | |
| DE2800147A1 (de) | Reaktivfarbstoffe | |
| AT207977B (de) | Verfahren zur Herstellung neuer Phthalocyaninfarbstoffe | |
| DE1930230C (de) | Wasserlösliche, scharlachrote Monoazofarbstoffe der l-Phenylazo-2-hydroxynaphthoesäure-arylamid-Reihe | |
| EP0078460A1 (de) | Metallkomplexfarbstoffe | |
| DE2324817A1 (de) | Disazofarbstoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |