CH633528A5 - Verfahren zur herstellung von cyclopropanderivaten. - Google Patents
Verfahren zur herstellung von cyclopropanderivaten. Download PDFInfo
- Publication number
- CH633528A5 CH633528A5 CH839677A CH839677A CH633528A5 CH 633528 A5 CH633528 A5 CH 633528A5 CH 839677 A CH839677 A CH 839677A CH 839677 A CH839677 A CH 839677A CH 633528 A5 CH633528 A5 CH 633528A5
- Authority
- CH
- Switzerland
- Prior art keywords
- reaction
- diluent
- solvent
- chloride
- salt
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title description 2
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical class C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 title 1
- 238000000034 method Methods 0.000 claims description 36
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 22
- 239000003085 diluting agent Substances 0.000 claims description 20
- 238000006243 chemical reaction Methods 0.000 claims description 18
- -1 alkaline earth metal salt Chemical class 0.000 claims description 17
- 239000002904 solvent Substances 0.000 claims description 17
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 16
- 150000001879 copper Chemical class 0.000 claims description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 15
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Inorganic materials [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 claims description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- 150000001875 compounds Chemical class 0.000 claims description 13
- 150000003839 salts Chemical class 0.000 claims description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 10
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 claims description 9
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical group CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 claims description 8
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 7
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 7
- 229910052791 calcium Inorganic materials 0.000 claims description 7
- 239000011575 calcium Substances 0.000 claims description 7
- VXJIMUZIBHBWBV-UHFFFAOYSA-M lithium;chloride;hydrate Chemical compound [Li+].O.[Cl-] VXJIMUZIBHBWBV-UHFFFAOYSA-M 0.000 claims description 7
- 150000004682 monohydrates Chemical class 0.000 claims description 7
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 6
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 claims description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims description 6
- 239000001110 calcium chloride Substances 0.000 claims description 6
- 229910001628 calcium chloride Inorganic materials 0.000 claims description 6
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical group [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 claims description 6
- 229910052744 lithium Inorganic materials 0.000 claims description 6
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 claims description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims description 5
- NIUZJTWSUGSWJI-UHFFFAOYSA-M triethyl(methyl)azanium;chloride Chemical compound [Cl-].CC[N+](C)(CC)CC NIUZJTWSUGSWJI-UHFFFAOYSA-M 0.000 claims description 5
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 239000002585 base Substances 0.000 claims description 4
- 229910021538 borax Inorganic materials 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 239000000376 reactant Substances 0.000 claims description 4
- 235000010339 sodium tetraborate Nutrition 0.000 claims description 4
- 239000003513 alkali Substances 0.000 claims description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 3
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 229940076286 cupric acetate Drugs 0.000 claims description 3
- 159000000003 magnesium salts Chemical class 0.000 claims description 3
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 claims description 3
- 235000011056 potassium acetate Nutrition 0.000 claims description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical group [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims description 2
- 239000004327 boric acid Substances 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Chemical group 0.000 claims description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 2
- 239000001569 carbon dioxide Substances 0.000 claims description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 2
- 150000001993 dienes Chemical class 0.000 claims description 2
- 150000002148 esters Chemical group 0.000 claims description 2
- 239000003444 phase transfer catalyst Substances 0.000 claims description 2
- BSVBQGMMJUBVOD-UHFFFAOYSA-N trisodium borate Chemical compound [Na+].[Na+].[Na+].[O-]B([O-])[O-] BSVBQGMMJUBVOD-UHFFFAOYSA-N 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical group C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 claims 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 235000010216 calcium carbonate Nutrition 0.000 claims 1
- 235000007686 potassium Nutrition 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 10
- 239000000203 mixture Substances 0.000 description 8
- ZIUSEGSNTOUIPT-UHFFFAOYSA-N ethyl 2-cyanoacetate Chemical compound CCOC(=O)CC#N ZIUSEGSNTOUIPT-UHFFFAOYSA-N 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- 229960003280 cupric chloride Drugs 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical class [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 229910052802 copper Inorganic materials 0.000 description 4
- 239000010949 copper Substances 0.000 description 4
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical compound OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 4
- ROPZVINUZPSLQG-UHFFFAOYSA-N ethyl 1-cyano-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound CCOC(=O)C1(C#N)C(C=C(Cl)Cl)C1(C)C ROPZVINUZPSLQG-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- LLMLSUSAKZVFOA-UHFFFAOYSA-N 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(O)=O LLMLSUSAKZVFOA-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 239000005749 Copper compound Substances 0.000 description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 150000001880 copper compounds Chemical class 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 150000001942 cyclopropanes Chemical class 0.000 description 2
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 2
- YVPJCJLMRRTDMQ-UHFFFAOYSA-N ethyl diazoacetate Chemical compound CCOC(=O)C=[N+]=[N-] YVPJCJLMRRTDMQ-UHFFFAOYSA-N 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 239000003880 polar aprotic solvent Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000004328 sodium tetraborate Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- NHGXDBSUJJNIRV-UHFFFAOYSA-M tetrabutylammonium chloride Chemical compound [Cl-].CCCC[N+](CCCC)(CCCC)CCCC NHGXDBSUJJNIRV-UHFFFAOYSA-M 0.000 description 2
- BYBMXEMDDQTUPP-UHFFFAOYSA-N (3-phenoxyphenyl)methyl 2-cyanoacetate Chemical compound N#CCC(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 BYBMXEMDDQTUPP-UHFFFAOYSA-N 0.000 description 1
- YYOLVILSZOVWLS-UHFFFAOYSA-N 1,1-dichloro-4-methylpenta-1,3-diene Chemical compound CC(C)=CC=C(Cl)Cl YYOLVILSZOVWLS-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- BXEFQPCKQSTMKA-UHFFFAOYSA-N OC(=O)C=[N+]=[N-] Chemical class OC(=O)C=[N+]=[N-] BXEFQPCKQSTMKA-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- RCUIWQWWDLZNMS-UHFFFAOYSA-N benzyl 2-cyanoacetate Chemical compound N#CCC(=O)OCC1=CC=CC=C1 RCUIWQWWDLZNMS-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- KXHPPCXNWTUNSB-UHFFFAOYSA-M benzyl(trimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)(C)CC1=CC=CC=C1 KXHPPCXNWTUNSB-UHFFFAOYSA-M 0.000 description 1
- 239000003183 carcinogenic agent Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 229910000366 copper(II) sulfate Inorganic materials 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- UMSGVWVBUHUHEH-UHFFFAOYSA-M ethyl(trimethyl)azanium;bromide Chemical compound [Br-].CC[N+](C)(C)C UMSGVWVBUHUHEH-UHFFFAOYSA-M 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 238000001030 gas--liquid chromatography Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- RLLPVAHGXHCWKJ-UHFFFAOYSA-N permethrin Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 RLLPVAHGXHCWKJ-UHFFFAOYSA-N 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- 125000003698 tetramethyl group Chemical group [H]C([H])([H])* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/45—Carboxylic acid nitriles having cyano groups bound to carbon atoms of rings other than six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB28240/76A GB1578139A (en) | 1976-07-07 | 1976-07-07 | Preparation of alicyclic compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH633528A5 true CH633528A5 (de) | 1982-12-15 |
Family
ID=10272554
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH839677A CH633528A5 (de) | 1976-07-07 | 1977-07-07 | Verfahren zur herstellung von cyclopropanderivaten. |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4118412A (enExample) |
| JP (1) | JPS537650A (enExample) |
| AU (1) | AU515441B2 (enExample) |
| CA (1) | CA1122608A (enExample) |
| CH (1) | CH633528A5 (enExample) |
| DE (1) | DE2730755C2 (enExample) |
| FR (1) | FR2357535A1 (enExample) |
| GB (1) | GB1578139A (enExample) |
| IL (1) | IL52476A (enExample) |
| IT (1) | IT1080782B (enExample) |
| NL (1) | NL7707559A (enExample) |
| NZ (1) | NZ184508A (enExample) |
| ZA (1) | ZA773905B (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2606635A1 (de) * | 1976-02-19 | 1977-08-25 | Bayer Ag | Verfahren zur herstellung von 2,2-dimethyl-3-(2',2'-dichlorvinyl) -cyclopropan-1-carbonsaeure |
| DE2751782A1 (de) * | 1977-11-19 | 1979-05-23 | Bayer Ag | Mittel zur regulierung des pflanzenwachstums |
| DE2751783A1 (de) * | 1977-11-19 | 1979-05-23 | Bayer Ag | Alpha-isocyanocarbonsaeure-salze, verfahren zu ihrer herstellung und ihre verwendung als pflanzenwachstumsregulatoren |
| EP0007154B1 (en) * | 1978-04-28 | 1981-12-30 | Imperial Chemical Industries Plc | Process for the preparation of cyclopropane derivatives, intermediates in the synthesis of pyrethroid insecticides |
| DE2923778A1 (de) * | 1979-06-12 | 1980-12-18 | Bayer Ag | Verfahren zur herstellung von 3,3-dimethyl-cyclopropan-1,1,2-tricarbonsaeurederivaten sowie alpha -halogen- nitrile als neue zwischenprodukte hierfuer und verfahren zu deren herstellung |
| FR2485004A1 (fr) * | 1980-06-20 | 1981-12-24 | Roussel Uclaf | Derives cyclopropane-1-carboxyliques et leurs sels, leur preparation et leur application a la synthese d'intermediaires de composes pyrethrinoides de configuration cis |
| JPS59103072U (ja) * | 1982-12-22 | 1984-07-11 | カルソニックカンセイ株式会社 | 扁平管エバポレータ |
| US4567265A (en) * | 1984-01-16 | 1986-01-28 | Loyola University Of Chicago | Cyclopropanoid cyanoesters and method of making same |
| CN118652168A (zh) * | 2024-04-17 | 2024-09-17 | 大连凯飞化学股份有限公司 | 一种2,2,3,3-四甲基环丙烷羧酸的制备方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4000180A (en) * | 1974-08-14 | 1976-12-28 | Imperial Chemical Industries Limited | Process for preparing 2-dihalovinyl-3,3-dimethyl cyclo propane derivatives |
| US4022816A (en) * | 1975-05-02 | 1977-05-10 | Ethyl Corporation | Purification of chlorobutyronitrile |
| US3974199A (en) * | 1975-06-16 | 1976-08-10 | The Dow Chemical Company | Process for production of cyclopropylcyanide |
-
1976
- 1976-07-07 GB GB28240/76A patent/GB1578139A/en not_active Expired
-
1977
- 1977-06-28 NZ NZ184508A patent/NZ184508A/xx unknown
- 1977-06-28 ZA ZA00773905A patent/ZA773905B/xx unknown
- 1977-07-06 AU AU26792/77A patent/AU515441B2/en not_active Expired
- 1977-07-06 IT IT25456/77A patent/IT1080782B/it active
- 1977-07-06 IL IL52476A patent/IL52476A/xx not_active IP Right Cessation
- 1977-07-06 FR FR7720807A patent/FR2357535A1/fr active Granted
- 1977-07-07 JP JP8050677A patent/JPS537650A/ja active Granted
- 1977-07-07 DE DE2730755A patent/DE2730755C2/de not_active Expired
- 1977-07-07 NL NL7707559A patent/NL7707559A/xx not_active Application Discontinuation
- 1977-07-07 CA CA282,230A patent/CA1122608A/en not_active Expired
- 1977-07-07 CH CH839677A patent/CH633528A5/de not_active IP Right Cessation
- 1977-07-07 US US05/813,669 patent/US4118412A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US4118412A (en) | 1978-10-03 |
| DE2730755A1 (de) | 1978-01-12 |
| IT1080782B (it) | 1985-05-16 |
| FR2357535A1 (fr) | 1978-02-03 |
| AU515441B2 (en) | 1981-04-02 |
| CA1122608A (en) | 1982-04-27 |
| FR2357535B1 (enExample) | 1981-08-07 |
| NL7707559A (nl) | 1978-01-10 |
| IL52476A0 (en) | 1977-10-31 |
| IL52476A (en) | 1980-12-31 |
| AU2679277A (en) | 1979-01-11 |
| JPS537650A (en) | 1978-01-24 |
| DE2730755C2 (de) | 1986-05-07 |
| NZ184508A (en) | 1979-07-11 |
| JPS6117820B2 (enExample) | 1986-05-09 |
| GB1578139A (en) | 1980-11-05 |
| ZA773905B (en) | 1979-03-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE602004007226T2 (de) | Monomethylderivate von Malonsäure und Verfahren zu ihrer Herstellung | |
| DE2723383C2 (enExample) | ||
| DE2536145A1 (de) | Verfahren zur herstellung von cyclopropanderivaten | |
| DE2853178C2 (enExample) | ||
| CH633528A5 (de) | Verfahren zur herstellung von cyclopropanderivaten. | |
| CH615411A5 (enExample) | ||
| DE2751610A1 (de) | Verfahren zur herstellung von cyclopropanderivaten | |
| DE2437882B2 (de) | Verfahren zur herstellung von estern des 3-phenoxybenzylalkohols | |
| DE1286030B (de) | Verfahren zur Herstellung von niedermolekularen trans-Chrysanthemum-monocarbonsaeurealkylestern | |
| DE2642140C2 (de) | Verfahren zur Herstellung von Benzoylcyanid | |
| DE69216856T2 (de) | Verfahren zur herstellung von adipinsäure | |
| EP0089417B1 (de) | Verfahren zur Herstellung von Phthalid | |
| DE2356702C2 (de) | Verfahren zur Herstellung von trans- Chrysanthemummonocarbonsäure durch Hydrolyse eines cis/trans Gemisches aus Chrysanthemummonocarbonsäure-C↓1↓-C↓8↓-alkylestern | |
| DE69910867T2 (de) | Verbessertes Verfahren zur Herstellung von Chloroalkylen und Alkynylaminen | |
| DE1203760B (de) | Verfahren zur Herstellung von Sorbinsaeure-alkylestern | |
| DE2716772A1 (de) | Verfahren zur herstellung von estern von m-phenoxybenzylalkohol und seiner alpha-cyano- und alpha-aethinylderivate mit carbonsaeuren | |
| DE2716773A1 (de) | Verfahren zur herstellung von estern von m-phenoxybenzylalkohol und seiner alpha-cyano- und alpha- aethinylderivate mit carbonsaeuren | |
| DE3877585T2 (de) | Verfahren zur durchfuehrung von carbonylierungsreaktionen von aromatischen carbocyclischen estern und alkyliodiden. | |
| DE2727613A1 (de) | Cyanosubstituierte cyclopropanderivate und verfahren zu ihrer herstellung | |
| DE2831555C2 (enExample) | ||
| DE3206006C2 (enExample) | ||
| DE3037086A1 (de) | 3-(m-chloranilino-)acrylsaeureaethylester und ein verfahren zu dessen herstellung | |
| CH628015A5 (de) | Verfahren zur decarbalkoxylierung von carbonsaeureestern. | |
| DE2926852A1 (de) | Verfahren zur herstellung von cyclopropannitrilen | |
| DE1001259C2 (de) | Verfahren zur Herstellung von Derivaten des Nortricyclens |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |