CH631704A5 - Verfahren zur herstellung substituierter pyridine. - Google Patents
Verfahren zur herstellung substituierter pyridine. Download PDFInfo
- Publication number
- CH631704A5 CH631704A5 CH1075077A CH1075077A CH631704A5 CH 631704 A5 CH631704 A5 CH 631704A5 CH 1075077 A CH1075077 A CH 1075077A CH 1075077 A CH1075077 A CH 1075077A CH 631704 A5 CH631704 A5 CH 631704A5
- Authority
- CH
- Switzerland
- Prior art keywords
- catalyst
- acetophenone
- ammonia
- temperature
- formaldehyde
- Prior art date
Links
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical class C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 title description 20
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 title description 10
- 238000004519 manufacturing process Methods 0.000 title description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 50
- 229910021529 ammonia Inorganic materials 0.000 claims description 25
- 239000003054 catalyst Substances 0.000 claims description 24
- 238000006243 chemical reaction Methods 0.000 claims description 20
- 238000000034 method Methods 0.000 claims description 19
- 150000001299 aldehydes Chemical class 0.000 claims description 15
- 150000002576 ketones Chemical class 0.000 claims description 14
- 239000007789 gas Substances 0.000 claims description 11
- 229910052782 aluminium Inorganic materials 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 7
- 229910052731 fluorine Inorganic materials 0.000 claims description 7
- -1 aliphatic aldehydes Chemical class 0.000 claims description 6
- 239000011261 inert gas Substances 0.000 claims description 6
- 230000000737 periodic effect Effects 0.000 claims description 6
- 150000003222 pyridines Chemical class 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 claims description 2
- 125000000468 ketone group Chemical group 0.000 claims description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 60
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 57
- 239000000126 substance Substances 0.000 description 20
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- PJUOHDQXFNPPRF-UHFFFAOYSA-N 2,6-diphenylpyridine Chemical compound C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=N1 PJUOHDQXFNPPRF-UHFFFAOYSA-N 0.000 description 12
- WEGYGNROSJDEIW-UHFFFAOYSA-N 3-Acetylpyridine Chemical compound CC(=O)C1=CC=CN=C1 WEGYGNROSJDEIW-UHFFFAOYSA-N 0.000 description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- GNKZMNRKLCTJAY-UHFFFAOYSA-N 4'-Methylacetophenone Chemical compound CC(=O)C1=CC=C(C)C=C1 GNKZMNRKLCTJAY-UHFFFAOYSA-N 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- 239000006227 byproduct Substances 0.000 description 9
- WYJOVVXUZNRJQY-UHFFFAOYSA-N 2-Acetylthiophene Chemical compound CC(=O)C1=CC=CS1 WYJOVVXUZNRJQY-UHFFFAOYSA-N 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- CZJKYAPZMSCBHB-UHFFFAOYSA-N 3-methyl-2,6-diphenylpyridine Chemical compound CC1=CC=C(C=2C=CC=CC=2)N=C1C1=CC=CC=C1 CZJKYAPZMSCBHB-UHFFFAOYSA-N 0.000 description 6
- YIXJRHPUWRPCBB-UHFFFAOYSA-N magnesium nitrate Chemical compound [Mg+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O YIXJRHPUWRPCBB-UHFFFAOYSA-N 0.000 description 6
- BGJSXRVXTHVRSN-UHFFFAOYSA-N 1,3,5-trioxane Chemical compound C1OCOCO1 BGJSXRVXTHVRSN-UHFFFAOYSA-N 0.000 description 5
- WMQUKDQWMMOHSA-UHFFFAOYSA-N 1-pyridin-4-ylethanone Chemical compound CC(=O)C1=CC=NC=C1 WMQUKDQWMMOHSA-UHFFFAOYSA-N 0.000 description 4
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 4
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 4
- KRIOVPPHQSLHCZ-UHFFFAOYSA-N propiophenone Chemical compound CCC(=O)C1=CC=CC=C1 KRIOVPPHQSLHCZ-UHFFFAOYSA-N 0.000 description 4
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N butyric aldehyde Natural products CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 125000001072 heteroaryl group Chemical group 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- MOMFXATYAINJML-UHFFFAOYSA-N 2-Acetylthiazole Chemical compound CC(=O)C1=NC=CS1 MOMFXATYAINJML-UHFFFAOYSA-N 0.000 description 2
- XSAYZAUNJMRRIR-UHFFFAOYSA-N 2-acetylnaphthalene Chemical compound C1=CC=CC2=CC(C(=O)C)=CC=C21 XSAYZAUNJMRRIR-UHFFFAOYSA-N 0.000 description 2
- DBZAKQWXICEWNW-UHFFFAOYSA-N 2-acetylpyrazine Chemical compound CC(=O)C1=CN=CC=N1 DBZAKQWXICEWNW-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 2
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 150000003053 piperidines Chemical class 0.000 description 2
- RKFAGMSIZPDPQQ-UHFFFAOYSA-N 1-(2h-thiopyran-2-yl)ethanone Chemical compound CC(=O)C1SC=CC=C1 RKFAGMSIZPDPQQ-UHFFFAOYSA-N 0.000 description 1
- BUZYGTVTZYSBCU-UHFFFAOYSA-N 1-(4-chlorophenyl)ethanone Chemical compound CC(=O)C1=CC=C(Cl)C=C1 BUZYGTVTZYSBCU-UHFFFAOYSA-N 0.000 description 1
- GCCKHXWBNPBUOD-UHFFFAOYSA-N 1-(furan-3-yl)ethanone Chemical compound CC(=O)C=1C=COC=1 GCCKHXWBNPBUOD-UHFFFAOYSA-N 0.000 description 1
- NZFLWVDXYUGFAV-UHFFFAOYSA-N 1-methyl-2-acetylpyrrole Chemical compound CC(=O)C1=CC=CN1C NZFLWVDXYUGFAV-UHFFFAOYSA-N 0.000 description 1
- QQOKEPYBMDDSNC-UHFFFAOYSA-N 1-pyridin-2-ylethanone;hydrobromide Chemical compound Br.CC(=O)C1=CC=CC=N1 QQOKEPYBMDDSNC-UHFFFAOYSA-N 0.000 description 1
- SPZUXKZZYDALEY-UHFFFAOYSA-N 1-pyrimidin-2-ylethanone Chemical compound CC(=O)C1=NC=CC=N1 SPZUXKZZYDALEY-UHFFFAOYSA-N 0.000 description 1
- UCCQXCFFHYCLEC-UHFFFAOYSA-N 1-quinolin-2-ylethanone Chemical class C1=CC=CC2=NC(C(=O)C)=CC=C21 UCCQXCFFHYCLEC-UHFFFAOYSA-N 0.000 description 1
- BLRYHCTZTSRBNB-UHFFFAOYSA-N 2,6-bis(4-methylphenyl)pyridine Chemical compound C1=CC(C)=CC=C1C1=CC=CC(C=2C=CC(C)=CC=2)=N1 BLRYHCTZTSRBNB-UHFFFAOYSA-N 0.000 description 1
- FILKGCRCWDMBKA-UHFFFAOYSA-N 2,6-dichloropyridine Chemical compound ClC1=CC=CC(Cl)=N1 FILKGCRCWDMBKA-UHFFFAOYSA-N 0.000 description 1
- JFSBBQJVLHOEKH-UHFFFAOYSA-M 2,6-diphenylpyrylium;perchlorate Chemical compound [O-]Cl(=O)(=O)=O.C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=[O+]1 JFSBBQJVLHOEKH-UHFFFAOYSA-M 0.000 description 1
- KAZLMTSNKVMZLA-UHFFFAOYSA-N 2,6-dipyridin-3-ylpyridine Chemical compound C1=CN=CC(C=2N=C(C=CC=2)C=2C=NC=CC=2)=C1 KAZLMTSNKVMZLA-UHFFFAOYSA-N 0.000 description 1
- QCDUAXSWPGEYBB-UHFFFAOYSA-N 2-Acetyloxazole Chemical compound CC(=O)C1=NC=CO1 QCDUAXSWPGEYBB-UHFFFAOYSA-N 0.000 description 1
- IQMGXSROJBYCLS-UHFFFAOYSA-N 2-bromo-1-pyridin-3-ylethanone Chemical compound BrCC(=O)C1=CC=CN=C1 IQMGXSROJBYCLS-UHFFFAOYSA-N 0.000 description 1
- JIESKSSHKWDESA-UHFFFAOYSA-N 3,5-dimethyl-2,6-diphenylpyridine Chemical compound CC1=CC(C)=C(C=2C=CC=CC=2)N=C1C1=CC=CC=C1 JIESKSSHKWDESA-UHFFFAOYSA-N 0.000 description 1
- RNIDWJDZNNVFDY-UHFFFAOYSA-N 3-Acetylthiophene Chemical compound CC(=O)C=1C=CSC=1 RNIDWJDZNNVFDY-UHFFFAOYSA-N 0.000 description 1
- IDASOVSVRKONFS-UHFFFAOYSA-N 3-phenylprop-2-ynal Chemical compound O=CC#CC1=CC=CC=C1 IDASOVSVRKONFS-UHFFFAOYSA-N 0.000 description 1
- NLPHXWGWBKZSJC-UHFFFAOYSA-N 4-acetylbenzonitrile Chemical compound CC(=O)C1=CC=C(C#N)C=C1 NLPHXWGWBKZSJC-UHFFFAOYSA-N 0.000 description 1
- IRJCHLDRHLQLGZ-UHFFFAOYSA-N 4-methyl-2,6-diphenylpyridine Chemical compound C=1C(C)=CC(C=2C=CC=CC=2)=NC=1C1=CC=CC=C1 IRJCHLDRHLQLGZ-UHFFFAOYSA-N 0.000 description 1
- VRJHQPZVIGNGMX-UHFFFAOYSA-N 4-piperidinone Chemical class O=C1CCNCC1 VRJHQPZVIGNGMX-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 238000007792 addition Methods 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- LDDQLRUQCUTJBB-UHFFFAOYSA-O azanium;hydrofluoride Chemical compound [NH4+].F LDDQLRUQCUTJBB-UHFFFAOYSA-O 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- FFSAXUULYPJSKH-UHFFFAOYSA-N butyrophenone Chemical compound CCCC(=O)C1=CC=CC=C1 FFSAXUULYPJSKH-UHFFFAOYSA-N 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 230000000911 decarboxylating effect Effects 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- MPFLRYZEEAQMLQ-UHFFFAOYSA-N dinicotinic acid Chemical compound OC(=O)C1=CN=CC(C(O)=O)=C1 MPFLRYZEEAQMLQ-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- FQHXWZMJALFSJJ-UHFFFAOYSA-N ethyl 3-oxo-3-pyridin-2-ylpropanoate Chemical compound CCOC(=O)CC(=O)C1=CC=CC=N1 FQHXWZMJALFSJJ-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 150000004673 fluoride salts Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 150000002373 hemiacetals Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- SNHOZPMHMQQMNI-UHFFFAOYSA-N lithium;2h-thiophen-2-ide Chemical compound [Li+].C=1C=[C-]SC=1 SNHOZPMHMQQMNI-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910001512 metal fluoride Inorganic materials 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 1
- ILVXOBCQQYKLDS-UHFFFAOYSA-N pyridine N-oxide Chemical compound [O-][N+]1=CC=CC=C1 ILVXOBCQQYKLDS-UHFFFAOYSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- XROWMBWRMNHXMF-UHFFFAOYSA-J titanium tetrafluoride Chemical compound [F-].[F-].[F-].[F-].[Ti+4] XROWMBWRMNHXMF-UHFFFAOYSA-J 0.000 description 1
- HGBOYTHUEUWSSQ-UHFFFAOYSA-N valeric aldehyde Natural products CCCCC=O HGBOYTHUEUWSSQ-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/06—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom
- C07D213/08—Preparation by ring-closure
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/06—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom
- C07D213/22—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom containing two or more pyridine rings directly linked together, e.g. bipyridyl
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19772736791 DE2736791A1 (de) | 1977-08-16 | 1977-08-16 | Verfahren zur herstellung substituierter pyridine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH631704A5 true CH631704A5 (de) | 1982-08-31 |
Family
ID=6016455
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1075077A CH631704A5 (de) | 1977-08-16 | 1977-09-02 | Verfahren zur herstellung substituierter pyridine. |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4171444A (enExample) |
| JP (1) | JPS5910662B2 (enExample) |
| BE (1) | BE858390A (enExample) |
| BR (1) | BR7705882A (enExample) |
| CA (1) | CA1084932A (enExample) |
| CH (1) | CH631704A5 (enExample) |
| DE (1) | DE2736791A1 (enExample) |
| FR (1) | FR2400509A1 (enExample) |
| GB (1) | GB1550725A (enExample) |
| IL (1) | IL52886A (enExample) |
| IT (1) | IT1143597B (enExample) |
| NL (1) | NL184218C (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2639702C2 (de) * | 1976-09-03 | 1984-03-08 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von 2,3-Cycloalkenopyridinen |
| WO1994027604A1 (en) * | 1993-05-28 | 1994-12-08 | Taisho Pharmaceutical Co., Ltd. | Medicinal use of pyridine derivative |
| KR102038815B1 (ko) * | 2012-07-31 | 2019-10-31 | 엘지디스플레이 주식회사 | 인광 도펀트용 호스트 화합물 및 이를 이용한 유기발광다이오드소자 |
| US20250206884A1 (en) * | 2022-03-31 | 2025-06-26 | Taica Corporation | Ultraviolet radiation-curable polysiloxane composition, and damping material |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2877228A (en) * | 1952-10-20 | 1959-03-10 | Phillips Petroleum Co | Production of substituted pyridines |
| US2780626A (en) * | 1953-08-13 | 1957-02-05 | Research Corp | 2, 6-alkylpyridines |
| GB917765A (en) * | 1960-11-10 | 1963-02-06 | Distillers Co Yeast Ltd | Production of pyridine bases |
| US3932421A (en) * | 1967-07-13 | 1976-01-13 | Koei Chemical Company, Ltd. | Process for producing alkylpyridines |
| NL170536C (nl) * | 1969-12-30 | 1982-11-16 | Koei Chemical Co | Werkwijze voor het bereiden van 2,6-dimethylpyridine. |
| US3946020A (en) * | 1970-12-28 | 1976-03-23 | Koei Chemical Co., Ltd. | Process for producing pyridine bases |
| BE790121A (fr) * | 1971-10-15 | 1973-02-01 | Degussa | Catalyseurs pour la preparation de pyridine et de 3-methylpyridine |
| DE2224160C3 (de) * | 1972-05-18 | 1979-10-04 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur Herstellung von Katalysatoren für die Herstellung von Pyridin und 3-Methylpyridin |
| DE2239801C3 (de) * | 1972-08-12 | 1979-08-23 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur Herstellung von Katalysatoren |
| GB1495233A (en) * | 1976-01-30 | 1977-12-14 | Ici Ltd | Manufacture of pyridine and methylpyridines |
-
1977
- 1977-08-16 DE DE19772736791 patent/DE2736791A1/de active Granted
- 1977-09-01 CA CA285,990A patent/CA1084932A/en not_active Expired
- 1977-09-01 IT IT50864/77A patent/IT1143597B/it active
- 1977-09-02 NL NLAANVRAGE7709710,A patent/NL184218C/xx not_active IP Right Cessation
- 1977-09-02 IL IL52886A patent/IL52886A/xx unknown
- 1977-09-02 JP JP52105731A patent/JPS5910662B2/ja not_active Expired
- 1977-09-02 GB GB36773/77A patent/GB1550725A/en not_active Expired
- 1977-09-02 BE BE6046132A patent/BE858390A/xx not_active IP Right Cessation
- 1977-09-02 CH CH1075077A patent/CH631704A5/de not_active IP Right Cessation
- 1977-09-02 BR BR7705882A patent/BR7705882A/pt unknown
- 1977-09-05 FR FR7726897A patent/FR2400509A1/fr active Granted
- 1977-09-06 US US05/830,985 patent/US4171444A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US4171444A (en) | 1979-10-16 |
| GB1550725A (en) | 1979-08-22 |
| NL7709710A (nl) | 1979-02-20 |
| IL52886A0 (en) | 1977-11-30 |
| FR2400509A1 (fr) | 1979-03-16 |
| NL184218B (nl) | 1988-12-16 |
| BE858390A (fr) | 1978-03-02 |
| JPS5910662B2 (ja) | 1984-03-10 |
| IT1143597B (it) | 1986-10-22 |
| DE2736791A1 (de) | 1979-03-01 |
| BR7705882A (pt) | 1979-03-27 |
| CA1084932A (en) | 1980-09-02 |
| IL52886A (en) | 1980-05-30 |
| NL184218C (nl) | 1989-05-16 |
| DE2736791C2 (enExample) | 1988-07-28 |
| JPS5432478A (en) | 1979-03-09 |
| FR2400509B1 (enExample) | 1982-07-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3634975A1 (de) | Verfahren zur herstellung von substituierten und disubstituierten pyridin-2,3-dicarboxylatestern | |
| CH631705A5 (de) | Verfahren zur herstellung substituierter pyridine. | |
| DE3722891A1 (de) | Verfahren zur herstellung von vinylethern | |
| DE2519529A1 (de) | Verfahren zur herstellung von 3-methylpyridin | |
| EP0263464A2 (de) | Verfahren zur Herstellung von substituierten Pyridinen | |
| CH631704A5 (de) | Verfahren zur herstellung substituierter pyridine. | |
| DE2746177C2 (de) | Verfahren zur Herstellung von Pyridinbasen | |
| DE2703070A1 (de) | Verfahren zur herstellung von 3-methylpyridin | |
| DE2615309C2 (de) | Verfahren zur katalytischen Herstellung von 2-substituierten Pyridinen | |
| DE2819196C2 (enExample) | ||
| EP0057890B1 (de) | Verfahren zur Herstellung von Pyridinen oder Pyrrolen aus alpha,omega-Dinitrilen | |
| DE2736888C2 (de) | Verfahren zur Herstellung von 2,3:5,6-Bis-(cycloalkeno)-pyridinen | |
| DE2712694C2 (enExample) | ||
| DE2639702C2 (de) | Verfahren zur Herstellung von 2,3-Cycloalkenopyridinen | |
| DE2832132A1 (de) | Verfahren zur herstellung von methacrylsaeure | |
| DE60009060T2 (de) | Verfahren zur herstellung von 2-pyridylpyridin-derivaten | |
| EP0607804B1 (de) | Verfahren zur Herstellung von 2-Amino-5-aminomethyl-pyridin | |
| EP0099592B1 (de) | Verfahren zur katalytischen Dehydrierung von Piperidin | |
| DE2051316A1 (de) | Verfahren zur Herstellung von Pyndin | |
| DE858399C (de) | Verfahren zur Herstellung von Alkylpyridinen, insbesondere von 2-Methyl-5-aethylpyridin | |
| DE1618295C3 (de) | Verfahren zur Herstellung von Ketonitrilen | |
| DE1795239B2 (de) | Verfahren zur Herstellung von symmetrischen 3,5-Dialkylpyridinen | |
| DE1445974A1 (de) | Verfahren zur Herstellung von Pyridin | |
| DE2736269A1 (de) | Verfahren zur herstellung von pyridin | |
| DE1124951B (de) | Verfahren zur Herstellung neuer Piperidmverbmdungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |