CH630778A5 - Schaedlingsbekaempfungsmittel enthaltend einen substituierten benzylaether oder -thioaether. - Google Patents
Schaedlingsbekaempfungsmittel enthaltend einen substituierten benzylaether oder -thioaether. Download PDFInfo
- Publication number
- CH630778A5 CH630778A5 CH268977A CH268977A CH630778A5 CH 630778 A5 CH630778 A5 CH 630778A5 CH 268977 A CH268977 A CH 268977A CH 268977 A CH268977 A CH 268977A CH 630778 A5 CH630778 A5 CH 630778A5
- Authority
- CH
- Switzerland
- Prior art keywords
- group
- atom
- alkyl
- weight
- formula
- Prior art date
Links
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical class C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 title claims 8
- 241000607479 Yersinia pestis Species 0.000 title claims 2
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 48
- 150000001875 compounds Chemical class 0.000 claims description 28
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 18
- 239000000203 mixture Substances 0.000 claims description 18
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 15
- -1 alkynyl magnesium halide Chemical class 0.000 claims description 13
- 239000003921 oil Substances 0.000 claims description 12
- 239000000243 solution Substances 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- 239000000575 pesticide Substances 0.000 claims description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 9
- 239000002904 solvent Substances 0.000 claims description 9
- 241000238876 Acari Species 0.000 claims description 8
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 8
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 claims description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 239000007787 solid Substances 0.000 claims description 6
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims description 5
- 238000010992 reflux Methods 0.000 claims description 5
- 241000238631 Hexapoda Species 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 4
- 239000011541 reaction mixture Substances 0.000 claims description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 241001465754 Metazoa Species 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 239000000080 wetting agent Substances 0.000 claims description 3
- 239000002917 insecticide Substances 0.000 claims description 2
- 239000011777 magnesium Substances 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- 239000003208 petroleum Substances 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims 18
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 17
- 125000000217 alkyl group Chemical group 0.000 claims 16
- 229910052801 chlorine Inorganic materials 0.000 claims 12
- 125000001309 chloro group Chemical group Cl* 0.000 claims 12
- 125000005843 halogen group Chemical group 0.000 claims 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 10
- 239000004480 active ingredient Substances 0.000 claims 9
- 239000003795 chemical substances by application Substances 0.000 claims 8
- 125000004093 cyano group Chemical group *C#N 0.000 claims 7
- 150000003568 thioethers Chemical class 0.000 claims 7
- 125000003342 alkenyl group Chemical group 0.000 claims 6
- 229910052799 carbon Inorganic materials 0.000 claims 5
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims 4
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 claims 4
- 239000000654 additive Substances 0.000 claims 4
- 125000003545 alkoxy group Chemical group 0.000 claims 4
- 239000002270 dispersing agent Substances 0.000 claims 4
- 239000003381 stabilizer Substances 0.000 claims 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 claims 3
- 125000000304 alkynyl group Chemical group 0.000 claims 3
- 239000000969 carrier Substances 0.000 claims 3
- 239000007859 condensation product Substances 0.000 claims 3
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims 3
- 239000000839 emulsion Substances 0.000 claims 3
- 239000008187 granular material Substances 0.000 claims 3
- 239000007788 liquid Substances 0.000 claims 3
- 230000035515 penetration Effects 0.000 claims 3
- 239000000843 powder Substances 0.000 claims 3
- 239000011734 sodium Substances 0.000 claims 3
- 229910052708 sodium Inorganic materials 0.000 claims 3
- 229910052717 sulfur Inorganic materials 0.000 claims 3
- 239000004094 surface-active agent Substances 0.000 claims 3
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 claims 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims 2
- 239000003513 alkali Substances 0.000 claims 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims 2
- 229910052782 aluminium Inorganic materials 0.000 claims 2
- 125000003118 aryl group Chemical group 0.000 claims 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L calcium carbonate Substances [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 claims 2
- 239000012141 concentrate Substances 0.000 claims 2
- 229920001577 copolymer Polymers 0.000 claims 2
- 238000005260 corrosion Methods 0.000 claims 2
- 230000007797 corrosion Effects 0.000 claims 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 claims 2
- 235000014113 dietary fatty acids Nutrition 0.000 claims 2
- 239000004495 emulsifiable concentrate Substances 0.000 claims 2
- 239000000194 fatty acid Substances 0.000 claims 2
- 229930195729 fatty acid Natural products 0.000 claims 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims 2
- 239000003960 organic solvent Substances 0.000 claims 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims 2
- 229920000642 polymer Polymers 0.000 claims 2
- 239000000047 product Substances 0.000 claims 2
- 159000000000 sodium salts Chemical class 0.000 claims 2
- 125000001424 substituent group Chemical group 0.000 claims 2
- 125000000547 substituted alkyl group Chemical group 0.000 claims 2
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims 2
- 125000004434 sulfur atom Chemical group 0.000 claims 2
- 239000004546 suspension concentrate Substances 0.000 claims 2
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 claims 1
- MICMHFIQSAMEJG-UHFFFAOYSA-N 1-bromopyrrolidine-2,5-dione Chemical compound BrN1C(=O)CCC1=O.BrN1C(=O)CCC1=O MICMHFIQSAMEJG-UHFFFAOYSA-N 0.000 claims 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 claims 1
- NTDQQZYCCIDJRK-UHFFFAOYSA-N 4-octylphenol Chemical compound CCCCCCCCC1=CC=C(O)C=C1 NTDQQZYCCIDJRK-UHFFFAOYSA-N 0.000 claims 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 claims 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 claims 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims 1
- 239000005977 Ethylene Substances 0.000 claims 1
- 241000257303 Hymenoptera Species 0.000 claims 1
- 239000005909 Kieselgur Substances 0.000 claims 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 claims 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 claims 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 claims 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 claims 1
- 229920002125 Sokalan® Polymers 0.000 claims 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 claims 1
- 229930006000 Sucrose Natural products 0.000 claims 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims 1
- 239000000853 adhesive Substances 0.000 claims 1
- 230000001070 adhesive effect Effects 0.000 claims 1
- 239000000443 aerosol Substances 0.000 claims 1
- 238000005054 agglomeration Methods 0.000 claims 1
- 230000002776 aggregation Effects 0.000 claims 1
- 150000001298 alcohols Chemical class 0.000 claims 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 claims 1
- 150000008046 alkali metal hydrides Chemical class 0.000 claims 1
- 150000001342 alkaline earth metals Chemical class 0.000 claims 1
- 125000005466 alkylenyl group Chemical group 0.000 claims 1
- 150000001408 amides Chemical class 0.000 claims 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims 1
- 239000010426 asphalt Substances 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 229960000892 attapulgite Drugs 0.000 claims 1
- 235000013871 bee wax Nutrition 0.000 claims 1
- 239000012166 beeswax Substances 0.000 claims 1
- 239000011230 binding agent Substances 0.000 claims 1
- 239000011575 calcium Substances 0.000 claims 1
- 229910052791 calcium Inorganic materials 0.000 claims 1
- 235000010216 calcium carbonate Nutrition 0.000 claims 1
- 159000000007 calcium salts Chemical class 0.000 claims 1
- YYRMJZQKEFZXMX-UHFFFAOYSA-N calcium;phosphoric acid Chemical class [Ca+2].OP(O)(O)=O.OP(O)(O)=O YYRMJZQKEFZXMX-UHFFFAOYSA-N 0.000 claims 1
- 239000004359 castor oil Substances 0.000 claims 1
- 235000019438 castor oil Nutrition 0.000 claims 1
- 239000007795 chemical reaction product Substances 0.000 claims 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 claims 1
- 239000003245 coal Substances 0.000 claims 1
- 239000000084 colloidal system Substances 0.000 claims 1
- 238000007865 diluting Methods 0.000 claims 1
- 239000006185 dispersion Substances 0.000 claims 1
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical class [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 claims 1
- 239000003995 emulsifying agent Substances 0.000 claims 1
- 230000001804 emulsifying effect Effects 0.000 claims 1
- 150000004665 fatty acids Chemical class 0.000 claims 1
- 150000002191 fatty alcohols Chemical class 0.000 claims 1
- 239000003337 fertilizer Substances 0.000 claims 1
- 230000009969 flowable effect Effects 0.000 claims 1
- 230000008014 freezing Effects 0.000 claims 1
- 238000007710 freezing Methods 0.000 claims 1
- 230000000855 fungicidal effect Effects 0.000 claims 1
- 239000000417 fungicide Substances 0.000 claims 1
- 238000010413 gardening Methods 0.000 claims 1
- 235000011187 glycerol Nutrition 0.000 claims 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 claims 1
- 150000002334 glycols Chemical class 0.000 claims 1
- 150000004820 halides Chemical class 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- 230000002363 herbicidal effect Effects 0.000 claims 1
- 239000004009 herbicide Substances 0.000 claims 1
- 238000005470 impregnation Methods 0.000 claims 1
- 239000003350 kerosene Substances 0.000 claims 1
- 150000002576 ketones Chemical class 0.000 claims 1
- 229920005610 lignin Polymers 0.000 claims 1
- 239000011344 liquid material Substances 0.000 claims 1
- 239000000391 magnesium silicate Substances 0.000 claims 1
- 235000012243 magnesium silicates Nutrition 0.000 claims 1
- LROBJRRFCPYLIT-UHFFFAOYSA-M magnesium;ethyne;bromide Chemical compound [Mg+2].[Br-].[C-]#C LROBJRRFCPYLIT-UHFFFAOYSA-M 0.000 claims 1
- 239000010445 mica Substances 0.000 claims 1
- 229910052618 mica group Inorganic materials 0.000 claims 1
- 239000012184 mineral wax Substances 0.000 claims 1
- 230000004048 modification Effects 0.000 claims 1
- 238000012986 modification Methods 0.000 claims 1
- 239000000025 natural resin Substances 0.000 claims 1
- 229910052625 palygorskite Inorganic materials 0.000 claims 1
- 239000012188 paraffin wax Substances 0.000 claims 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 claims 1
- 239000004800 polyvinyl chloride Substances 0.000 claims 1
- 229920000915 polyvinyl chloride Polymers 0.000 claims 1
- 230000001681 protective effect Effects 0.000 claims 1
- 150000003254 radicals Chemical class 0.000 claims 1
- 239000011347 resin Substances 0.000 claims 1
- 229920005989 resin Polymers 0.000 claims 1
- 150000003839 salts Chemical class 0.000 claims 1
- 150000004760 silicates Chemical class 0.000 claims 1
- 239000000377 silicon dioxide Substances 0.000 claims 1
- LIVNPJMFVYWSIS-UHFFFAOYSA-N silicon monoxide Chemical class [Si-]#[O+] LIVNPJMFVYWSIS-UHFFFAOYSA-N 0.000 claims 1
- 229910052814 silicon oxide Inorganic materials 0.000 claims 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 claims 1
- 239000002689 soil Substances 0.000 claims 1
- 239000011343 solid material Substances 0.000 claims 1
- 239000000600 sorbitol Substances 0.000 claims 1
- 238000003860 storage Methods 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- 239000005720 sucrose Substances 0.000 claims 1
- 150000003871 sulfonates Chemical class 0.000 claims 1
- 150000003459 sulfonic acid esters Chemical class 0.000 claims 1
- 150000003460 sulfonic acids Chemical class 0.000 claims 1
- 239000011593 sulfur Substances 0.000 claims 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 claims 1
- 239000002426 superphosphate Substances 0.000 claims 1
- 239000000375 suspending agent Substances 0.000 claims 1
- 238000010189 synthetic method Methods 0.000 claims 1
- 229920003002 synthetic resin Polymers 0.000 claims 1
- 239000000057 synthetic resin Substances 0.000 claims 1
- 229950011008 tetrachloroethylene Drugs 0.000 claims 1
- 150000003573 thiols Chemical class 0.000 claims 1
- 239000013008 thixotropic agent Substances 0.000 claims 1
- 239000010455 vermiculite Substances 0.000 claims 1
- 229910052902 vermiculite Inorganic materials 0.000 claims 1
- 235000019354 vermiculite Nutrition 0.000 claims 1
- 239000001993 wax Substances 0.000 claims 1
- 239000004563 wettable powder Substances 0.000 claims 1
- 239000008096 xylene Substances 0.000 claims 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 11
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 11
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 10
- 235000019198 oils Nutrition 0.000 description 10
- 238000004458 analytical method Methods 0.000 description 9
- 239000003480 eluent Substances 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 244000046052 Phaseolus vulgaris Species 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 5
- 235000019341 magnesium sulphate Nutrition 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 238000005507 spraying Methods 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- UJUNUASMYSTBSK-UHFFFAOYSA-N 1-(bromomethyl)-3-phenoxybenzene Chemical compound BrCC1=CC=CC(OC=2C=CC=CC=2)=C1 UJUNUASMYSTBSK-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- OVQKKEORFRFAPU-UHFFFAOYSA-N 1-chloro-4-[3-methyl-1-[(3-phenoxyphenyl)methoxy]butan-2-yl]benzene Chemical compound C=1C=C(Cl)C=CC=1C(C(C)C)COCC(C=1)=CC=CC=1OC1=CC=CC=C1 OVQKKEORFRFAPU-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 241000335053 Beta vulgaris Species 0.000 description 2
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical compound C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 description 2
- 241000255925 Diptera Species 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 241000171293 Megoura viciae Species 0.000 description 2
- 241001608567 Phaedon cochleariae Species 0.000 description 2
- 241000256250 Spodoptera littoralis Species 0.000 description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- KPSSIOMAKSHJJG-UHFFFAOYSA-N neopentyl alcohol Chemical compound CC(C)(C)CO KPSSIOMAKSHJJG-UHFFFAOYSA-N 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- BBYMAHJPOVVDMU-UHFFFAOYSA-N (3-phenoxyphenyl)methanethiol Chemical compound SCC1=CC=CC(OC=2C=CC=CC=2)=C1 BBYMAHJPOVVDMU-UHFFFAOYSA-N 0.000 description 1
- JCHUCGKEGUAHEH-UHFFFAOYSA-N 1,1,2,2-tetramethylcyclopropane Chemical compound CC1(C)CC1(C)C JCHUCGKEGUAHEH-UHFFFAOYSA-N 0.000 description 1
- PBIJFSCPEFQXBB-UHFFFAOYSA-N 1,1-dimethylcyclopropane Chemical compound CC1(C)CC1 PBIJFSCPEFQXBB-UHFFFAOYSA-N 0.000 description 1
- SMJMAODGDWZZNQ-UHFFFAOYSA-N 1-chloro-4-(1-chloro-3-methylbutan-2-yl)benzene Chemical compound CC(C)C(CCl)C1=CC=C(Cl)C=C1 SMJMAODGDWZZNQ-UHFFFAOYSA-N 0.000 description 1
- QYHBTLWDJPGSEQ-UHFFFAOYSA-N 1-phenoxy-3-[3,3,3-trichloro-2-[1,1,1-trichloro-3-(3-phenoxyphenyl)propan-2-yl]oxypropyl]benzene Chemical compound O(C1=CC=CC=C1)C=1C=C(CC(C(Cl)(Cl)Cl)OC(C(Cl)(Cl)Cl)CC2=CC(=CC=C2)OC2=CC=CC=C2)C=CC=1 QYHBTLWDJPGSEQ-UHFFFAOYSA-N 0.000 description 1
- KPWDGTGXUYRARH-UHFFFAOYSA-N 2,2,2-trichloroethanol Chemical compound OCC(Cl)(Cl)Cl KPWDGTGXUYRARH-UHFFFAOYSA-N 0.000 description 1
- MZYGDCHJNAZTMC-UHFFFAOYSA-N 2-(4-chlorophenyl)-3-methylbutan-1-ol Chemical compound CC(C)C(CO)C1=CC=C(Cl)C=C1 MZYGDCHJNAZTMC-UHFFFAOYSA-N 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- JTADOXZAKSNBCE-UHFFFAOYSA-N CC(C)C(C1=CC=C(C=C1)Cl)C(CC2=CC(=CC=C2)OC3=CC=CC=C3)SC(CC4=CC(=CC=C4)OC5=CC=CC=C5)C(C6=CC=C(C=C6)Cl)C(C)C Chemical compound CC(C)C(C1=CC=C(C=C1)Cl)C(CC2=CC(=CC=C2)OC3=CC=CC=C3)SC(CC4=CC(=CC=C4)OC5=CC=CC=C5)C(C6=CC=C(C=C6)Cl)C(C)C JTADOXZAKSNBCE-UHFFFAOYSA-N 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000257159 Musca domestica Species 0.000 description 1
- 241000257226 Muscidae Species 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 241000238680 Rhipicephalus microplus Species 0.000 description 1
- 241001454295 Tetranychidae Species 0.000 description 1
- 241001454293 Tetranychus urticae Species 0.000 description 1
- 210000001015 abdomen Anatomy 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 235000019441 ethanol Nutrition 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N methylene hexane Natural products CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229920002113 octoxynol Polymers 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000009738 saturating Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- OGNAOIGAPPSUMG-UHFFFAOYSA-N spiro[2.2]pentane Chemical compound C1CC11CC1 OGNAOIGAPPSUMG-UHFFFAOYSA-N 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000012085 test solution Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/257—Ethers having an ether-oxygen atom bound to carbon atoms both belonging to six-membered aromatic rings
- C07C43/263—Ethers having an ether-oxygen atom bound to carbon atoms both belonging to six-membered aromatic rings the aromatic rings being non-condensed
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8905/76A GB1570982A (en) | 1976-03-05 | 1976-03-05 | Substituted benzyl ethers and thioethers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH630778A5 true CH630778A5 (de) | 1982-07-15 |
Family
ID=9861589
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH268977A CH630778A5 (de) | 1976-03-05 | 1977-03-03 | Schaedlingsbekaempfungsmittel enthaltend einen substituierten benzylaether oder -thioaether. |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4073812A (enExample) |
| JP (2) | JPS52106831A (enExample) |
| BE (1) | BE852082A (enExample) |
| CA (1) | CA1087208A (enExample) |
| CH (1) | CH630778A5 (enExample) |
| DE (1) | DE2709355A1 (enExample) |
| FR (1) | FR2342953A1 (enExample) |
| GB (1) | GB1570982A (enExample) |
| IT (1) | IT1085871B (enExample) |
| NL (1) | NL183397C (enExample) |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4152461A (en) * | 1975-03-26 | 1979-05-01 | Ciba-Geigy Corporation | Pesticidal composition and methods utilizing polyphenoxy alkanes |
| US4397864A (en) * | 1980-05-02 | 1983-08-09 | Mitsuitoatsu Chemicals Inc. | 2-Arylpropyl ether or thioether derivatives and insecticidal and acaricidal agents containing said derivatives |
| JPS5764632A (en) * | 1980-10-09 | 1982-04-19 | Mitsui Toatsu Chem Inc | Novel 2-arylethyl ether derivative and thioether derivative, their production and insecticide and acaricide |
| JPS5849303A (ja) * | 1981-09-18 | 1983-03-23 | Mitsui Toatsu Chem Inc | 殺虫および殺ダニ組成物 |
| JPS5852202A (ja) * | 1981-09-24 | 1983-03-28 | Mitsui Toatsu Chem Inc | 殺虫および殺ダニ剤組成物 |
| US4562213A (en) * | 1982-05-12 | 1985-12-31 | Sumitomo Chemical Company, Limited | Certain phenoxy-benzyloxy ether derivatives and an insecticidal and/or acaricidal composition containing the same and methods of use |
| JPS58198430A (ja) * | 1982-05-12 | 1983-11-18 | Sumitomo Chem Co Ltd | ベンジルフェネチルエーテル類およびそれを有効成分とする殺虫、殺ダニ剤 |
| JPS58201737A (ja) * | 1982-05-18 | 1983-11-24 | Mitsui Toatsu Chem Inc | 新規芳香族アルカン誘導体、その製造法およびそれを有効成分とする殺虫、殺ダニ剤 |
| EP0104908B1 (en) * | 1982-09-24 | 1990-12-27 | Commonwealth Scientific And Industrial Research Organisation | Arthropodicidal compounds |
| SE461790B (sv) * | 1982-10-19 | 1990-03-26 | Mitsui Toatsu Chemicals | Foerfarande foer framstaellning av 3-fenoxibensyl-2-(4-alkoxifenyl)-2-metylpropyletrar |
| EP0125204A1 (de) * | 1983-04-12 | 1984-11-14 | Ciba-Geigy Ag | 3-Phenoxybenzyl-(2-phenyl-2,2-alkylen-äthyl)-äther und -thioäther, Verfahren zu ihrer Herstellung und ihre Verwendung in der Schädlingsbekämpfung |
| DK181683A (da) * | 1983-04-25 | 1984-10-26 | Cheminova As | Arylcycloalkylether-derivater, deres anvendelse og fremstilling |
| GB8409195D0 (en) * | 1984-04-09 | 1984-05-16 | Elliott M | Pesticides |
| JPH072664B2 (ja) * | 1985-06-21 | 1995-01-18 | 住友化学工業株式会社 | エーテル化合物およびそれを有効成分とする殺虫、殺ダニ剤 |
| US4664698A (en) * | 1984-09-21 | 1987-05-12 | Sumitomo Chemical Company, Limited | Ether compound, and an insecticidal and acaricidal composition containing it as an active ingredient |
| GB8520027D0 (en) * | 1985-08-09 | 1985-09-18 | Ici Plc | Insecticidal ethers |
| GB8523464D0 (en) * | 1985-09-23 | 1985-10-30 | Ici Plc | Insecticidal alkenes |
| GB2184439B (en) * | 1985-12-23 | 1989-11-22 | Ici Plc | Insecticidal alkenyl ethers |
| US4840971A (en) * | 1986-04-07 | 1989-06-20 | Sumitomo Chemical Company, Limited | Novel ether compound, a process for manufacturing the same, a composition containing the same and a use thereof |
| US4786654A (en) * | 1986-06-10 | 1988-11-22 | Ciba-Geigy Corporation | Substituted benzylcyclopropylmethyl ethers |
| GB8624831D0 (en) * | 1986-10-16 | 1986-11-19 | Ici Plc | Insecticidal ethers |
| ZA878623B (en) * | 1986-11-19 | 1988-05-19 | Ciba-Geigy Ag | Substituted phenoxybenzyl-(dihalodimethylcyclopropylmethyl)ethers |
| US4798912A (en) * | 1986-11-19 | 1989-01-17 | Ciba-Geigy Corporation | Substituted phenoxybenzyl-(Dihalodimethylcyclopropyl-methyl)ethers |
| IL84495A0 (en) * | 1986-11-20 | 1988-04-29 | Ciba Geigy Ag | Substituted phenylbenzyl-(dimethyl-cyclopropylmethyl)ethers |
| US4788348A (en) * | 1987-08-12 | 1988-11-29 | Imperial Chemical Industries Plc | Insecticidal alkenes |
| MY103631A (en) * | 1987-11-07 | 1993-08-28 | Sumitomo Chemical Co | Certain insecticidal 6-(phenoxy-2-pyridyl)-methyl-neo-phental ethers |
| DE3900541A1 (de) * | 1989-01-06 | 1990-07-19 | Schering Ag | Substituierte alkene, verfahren zu ihrer herstellung und ihre verwendung als schaedlingsbekaempfungsmittel |
| JP2767707B2 (ja) * | 1989-07-07 | 1998-06-18 | 三井化学株式会社 | 固形殺虫殺ダニ製剤 |
| US7449481B2 (en) | 2004-04-13 | 2008-11-11 | Cephalon, Inc. | Thio-substituted biaryl-methanesulfinyl derivatives |
| US7297817B2 (en) | 2004-04-13 | 2007-11-20 | Cephalon France | Thio-substituted arylmethanesulfinyl derivatives |
| EP1586560A1 (en) * | 2004-04-13 | 2005-10-19 | Cephalon, Inc. | Thio-substituted arylmethanesulfinyl derivatives |
| CN104677917B (zh) * | 2015-01-23 | 2017-10-27 | 苏州新美达探伤器材有限公司 | 一种环保溶剂型着色探伤渗透剂及其制备方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3267151A (en) * | 1961-03-22 | 1966-08-16 | Dow Chemical Co | Ethers of halomethylated diphenyl oxide |
| US3600437A (en) * | 1969-05-28 | 1971-08-17 | Lilly Co Eli | Substituted phenylalkanoic acids and derivatives thereof |
| BE794894A (fr) * | 1972-02-04 | 1973-08-02 | Ciba Geigy | Ethers aryliques et produits pesticides |
| DE2516515A1 (de) * | 1974-04-18 | 1975-10-30 | Ciba Geigy Ag | Phenoxy-phenylaether |
-
1976
- 1976-03-05 GB GB8905/76A patent/GB1570982A/en not_active Expired
-
1977
- 1977-02-14 CA CA271,713A patent/CA1087208A/en not_active Expired
- 1977-03-01 US US05/773,355 patent/US4073812A/en not_active Expired - Lifetime
- 1977-03-03 FR FR7706273A patent/FR2342953A1/fr active Granted
- 1977-03-03 JP JP2228877A patent/JPS52106831A/ja active Granted
- 1977-03-03 NL NLAANVRAGE7702269,A patent/NL183397C/xx not_active IP Right Cessation
- 1977-03-03 CH CH268977A patent/CH630778A5/de not_active IP Right Cessation
- 1977-03-03 DE DE19772709355 patent/DE2709355A1/de not_active Withdrawn
- 1977-03-03 IT IT20884/77A patent/IT1085871B/it active
- 1977-03-04 BE BE1007992A patent/BE852082A/xx not_active IP Right Cessation
-
1986
- 1986-10-17 JP JP61245674A patent/JPS62129201A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| JPS62129201A (ja) | 1987-06-11 |
| JPS6237023B2 (enExample) | 1987-08-10 |
| FR2342953A1 (fr) | 1977-09-30 |
| BE852082A (nl) | 1977-09-05 |
| GB1570982A (en) | 1980-07-09 |
| NL7702269A (nl) | 1977-09-07 |
| CA1087208A (en) | 1980-10-07 |
| JPS52106831A (en) | 1977-09-07 |
| DE2709355A1 (de) | 1977-09-15 |
| IT1085871B (it) | 1985-05-28 |
| NL183397C (nl) | 1988-10-17 |
| FR2342953B1 (enExample) | 1979-03-09 |
| NL183397B (nl) | 1988-05-16 |
| US4073812A (en) | 1978-02-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH630778A5 (de) | Schaedlingsbekaempfungsmittel enthaltend einen substituierten benzylaether oder -thioaether. | |
| DE2407024A1 (de) | Zur schaedlingsbekaempfung geeignete cyclopropanderivate und verfahren zu ihrer herstellung | |
| DE3708222C2 (enExample) | ||
| CH624831A5 (enExample) | ||
| DE2603877C2 (de) | Oxadiazolinonverbindungen, ihre Herstellung und sie enthaltendes Mittel | |
| EP0175649A2 (de) | Substituierte Carbodiimide | |
| EP0207004A2 (de) | Substituierte 4,5-Dihydro-1,3,4-thiadiazole | |
| DE2422977C2 (de) | Cyclopropan-carbonsäure-α-cyanbenzylester, Verfahren zu deren Herstellung und diese Verbindungen enthaltende pestizide Mittel | |
| DE2054512A1 (de) | Pyranverbindungen, Verfahren zu ih rer Herstellung und ihre Verwendung als Pflanzenschutzmittel | |
| CH637386A5 (de) | Benzoxazol- und benzothiazolderivate. | |
| DE2941332C2 (enExample) | ||
| EP0145662B1 (de) | Isothioharnstoffe | |
| DE2247109A1 (de) | Benzylcyclopropancarboxylat-derivate und verfahren zu ihrer herstellung | |
| CH616311A5 (enExample) | ||
| CH632241A5 (en) | Benzyl oxime ethers with pesticidal activity | |
| DE2937334A1 (de) | Neue, als ovicide mittel brauchbare cyanomethyltrithiocarbonatverbindungen | |
| DE1813194A1 (de) | Trichlorthiophen-2-carbonsaeureamide | |
| CH629082A5 (de) | Schaedlingsbekaempfungsmittel enthaltend neue dispirocyclopropancarbonsaeureester als wirkstoffkomponente. | |
| DE2941312C2 (enExample) | ||
| CH597753A5 (en) | Aralkyl 2,2-dihalo-cyclopropane 3-carboxylates insecticides | |
| AT269557B (de) | Fungicid und Arachnicid | |
| DD215001A5 (de) | Pestizide zusammensetzung | |
| DE1962408A1 (de) | Schaedlingsbekaempfungsmittel | |
| DE2059424C3 (de) | Verfahren zur Herstellung der β-Form von 1-Phenylvinylthiophosphonsäureester | |
| EP0164308A1 (de) | N-Formyl-dithiophosphonsäureamide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |