CH629759A5 - Process for the preparation of novel substituted N-phenyl-N'-benzoylureas and their use in insecticides - Google Patents
Process for the preparation of novel substituted N-phenyl-N'-benzoylureas and their use in insecticides Download PDFInfo
- Publication number
- CH629759A5 CH629759A5 CH55077A CH55077A CH629759A5 CH 629759 A5 CH629759 A5 CH 629759A5 CH 55077 A CH55077 A CH 55077A CH 55077 A CH55077 A CH 55077A CH 629759 A5 CH629759 A5 CH 629759A5
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- spp
- phenyl
- carbon atoms
- nitro
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 12
- 238000000034 method Methods 0.000 title claims description 11
- 239000002917 insecticide Substances 0.000 title abstract 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 19
- 239000004480 active ingredient Substances 0.000 claims abstract description 14
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical class O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 claims abstract description 7
- 150000001448 anilines Chemical class 0.000 claims abstract description 4
- 229940054066 benzamide antipsychotics Drugs 0.000 claims abstract description 4
- 150000003936 benzamides Chemical class 0.000 claims abstract description 4
- 239000000460 chlorine Substances 0.000 claims description 29
- 239000002904 solvent Substances 0.000 claims description 18
- 239000000203 mixture Substances 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 125000001188 haloalkyl group Chemical group 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 230000000749 insecticidal effect Effects 0.000 claims description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- LURYMYITPCOQAU-UHFFFAOYSA-N benzoyl isocyanate Chemical class O=C=NC(=O)C1=CC=CC=C1 LURYMYITPCOQAU-UHFFFAOYSA-N 0.000 claims description 3
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- JVJQPDTXIALXOG-UHFFFAOYSA-N nitryl fluoride Chemical compound [O-][N+](F)=O JVJQPDTXIALXOG-UHFFFAOYSA-N 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- XJKKCLQTZOSEDY-UHFFFAOYSA-N cyano benzoate Chemical class N#COC(=O)C1=CC=CC=C1 XJKKCLQTZOSEDY-UHFFFAOYSA-N 0.000 abstract 1
- 125000001424 substituent group Chemical group 0.000 abstract 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 22
- -1 3,4-di-chlorophenyl Chemical group 0.000 description 15
- 239000013543 active substance Substances 0.000 description 14
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 11
- 239000003814 drug Substances 0.000 description 10
- 229940079593 drug Drugs 0.000 description 10
- 238000012360 testing method Methods 0.000 description 10
- 239000003995 emulsifying agent Substances 0.000 description 9
- 238000009472 formulation Methods 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 239000008187 granular material Substances 0.000 description 6
- 229920000151 polyglycol Polymers 0.000 description 6
- 239000010695 polyglycol Substances 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical group CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 5
- 241000238631 Hexapoda Species 0.000 description 5
- 239000012141 concentrate Substances 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 4
- 240000007124 Brassica oleracea Species 0.000 description 4
- 241000254173 Coleoptera Species 0.000 description 4
- 241000256248 Spodoptera Species 0.000 description 4
- 125000002877 alkyl aryl group Chemical group 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000004606 Fillers/Extenders Substances 0.000 description 3
- 241000607479 Yersinia pestis Species 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 230000003071 parasitic effect Effects 0.000 description 3
- 239000011435 rock Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 235000011303 Brassica alboglabra Nutrition 0.000 description 2
- 235000011302 Brassica oleracea Nutrition 0.000 description 2
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 2
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 2
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 244000299507 Gossypium hirsutum Species 0.000 description 2
- 241000258937 Hemiptera Species 0.000 description 2
- 241000257303 Hymenoptera Species 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical class [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- 241000257166 Lucilia cuprina Species 0.000 description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 241001608568 Phaedon Species 0.000 description 2
- 241001608567 Phaedon cochleariae Species 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- 241000500439 Plutella Species 0.000 description 2
- 241000500437 Plutella xylostella Species 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 241000256247 Spodoptera exigua Species 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 235000013312 flour Nutrition 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- DDUNBNSBYRYUJO-UHFFFAOYSA-N 2,3,6-trichlorobenzoyl isocyanate Chemical compound ClC1=CC=C(Cl)C(C(=O)N=C=O)=C1Cl DDUNBNSBYRYUJO-UHFFFAOYSA-N 0.000 description 1
- 125000004098 2,6-dichlorobenzoyl group Chemical group O=C([*])C1=C(Cl)C([H])=C([H])C([H])=C1Cl 0.000 description 1
- JHKYTLZWWVOYCP-UHFFFAOYSA-N 2,6-dichlorobenzoyl isocyanate Chemical compound ClC1=CC=CC(Cl)=C1C(=O)N=C=O JHKYTLZWWVOYCP-UHFFFAOYSA-N 0.000 description 1
- AVRQBXVUUXHRMY-UHFFFAOYSA-N 2,6-difluorobenzamide Chemical compound NC(=O)C1=C(F)C=CC=C1F AVRQBXVUUXHRMY-UHFFFAOYSA-N 0.000 description 1
- CPHXLFKIUVVIOQ-UHFFFAOYSA-N 2-(trifluoromethoxy)benzaldehyde Chemical group FC(F)(F)OC1=CC=CC=C1C=O CPHXLFKIUVVIOQ-UHFFFAOYSA-N 0.000 description 1
- QWXAYHAPQNMAKI-UHFFFAOYSA-N 2-chloro-4-isocyanato-1-(trifluoromethoxy)benzene Chemical compound FC(F)(F)OC1=CC=C(N=C=O)C=C1Cl QWXAYHAPQNMAKI-UHFFFAOYSA-N 0.000 description 1
- ZTUIVBFRTPPWEZ-UHFFFAOYSA-N 2-chlorobenzoyl isocyanate Chemical compound ClC1=CC=CC=C1C(=O)N=C=O ZTUIVBFRTPPWEZ-UHFFFAOYSA-N 0.000 description 1
- WRIRBHNPZYHSKA-UHFFFAOYSA-N 3-chloro-4-(2-chloro-1,1,2-trifluoroethoxy)aniline Chemical compound NC1=CC=C(OC(F)(F)C(F)Cl)C(Cl)=C1 WRIRBHNPZYHSKA-UHFFFAOYSA-N 0.000 description 1
- ZPKUUNGPBSRPRM-UHFFFAOYSA-N 3-chloro-4-(trifluoromethoxy)aniline Chemical compound NC1=CC=C(OC(F)(F)F)C(Cl)=C1 ZPKUUNGPBSRPRM-UHFFFAOYSA-N 0.000 description 1
- XUJFOSLZQITUOI-UHFFFAOYSA-N 4-(trifluoromethoxy)aniline Chemical compound NC1=CC=C(OC(F)(F)F)C=C1 XUJFOSLZQITUOI-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 241001143309 Acanthoscelides obtectus Species 0.000 description 1
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical group CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 1
- 241000238818 Acheta domesticus Species 0.000 description 1
- 241000256111 Aedes <genus> Species 0.000 description 1
- 241000902874 Agelastica alni Species 0.000 description 1
- 241001136265 Agriotes Species 0.000 description 1
- RGCKGOZRHPZPFP-UHFFFAOYSA-N Alizarin Natural products C1=CC=C2C(=O)C3=C(O)C(O)=CC=C3C(=O)C2=C1 RGCKGOZRHPZPFP-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241001398046 Amphimallon solstitiale Species 0.000 description 1
- 241000411431 Anobium Species 0.000 description 1
- 241000256186 Anopheles <genus> Species 0.000 description 1
- 241001427556 Anoplura Species 0.000 description 1
- 241000254177 Anthonomus Species 0.000 description 1
- 241001640910 Anthrenus Species 0.000 description 1
- 241001425390 Aphis fabae Species 0.000 description 1
- 241001600408 Aphis gossypii Species 0.000 description 1
- 241001095118 Aphis pomi Species 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 241000221377 Auricularia Species 0.000 description 1
- 241001490249 Bactrocera oleae Species 0.000 description 1
- 241000254127 Bemisia tabaci Species 0.000 description 1
- 241001142392 Bibio Species 0.000 description 1
- 241001573714 Blaniulus Species 0.000 description 1
- 241000238662 Blatta orientalis Species 0.000 description 1
- 241000238657 Blattella germanica Species 0.000 description 1
- 241001674044 Blattodea Species 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 241000913391 Brachionus forficula Species 0.000 description 1
- 241000982105 Brevicoryne brassicae Species 0.000 description 1
- 241001517925 Bucculatrix Species 0.000 description 1
- 241001491790 Bupalus piniaria Species 0.000 description 1
- 229910021532 Calcite Inorganic materials 0.000 description 1
- 241000257163 Calliphora vicina Species 0.000 description 1
- 241001350371 Capua Species 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 241000255579 Ceratitis capitata Species 0.000 description 1
- 241000426499 Chilo Species 0.000 description 1
- 241000258920 Chilopoda Species 0.000 description 1
- 241000255942 Choristoneura fumiferana Species 0.000 description 1
- 241001327638 Cimex lectularius Species 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 241001427559 Collembola Species 0.000 description 1
- 241000683561 Conoderus Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 241001212534 Cosmopolites sordidus Species 0.000 description 1
- 241000500845 Costelytra zealandica Species 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 241001094916 Cryptomyzus ribis Species 0.000 description 1
- 241000256054 Culex <genus> Species 0.000 description 1
- 241000692095 Cuterebra Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241001635274 Cydia pomonella Species 0.000 description 1
- 241001124144 Dermaptera Species 0.000 description 1
- 241001641895 Dermestes Species 0.000 description 1
- 241000489975 Diabrotica Species 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- 241000258963 Diplopoda Species 0.000 description 1
- 241000511318 Diprion Species 0.000 description 1
- 241000255925 Diptera Species 0.000 description 1
- 241000255601 Drosophila melanogaster Species 0.000 description 1
- 241001425477 Dysdercus Species 0.000 description 1
- 241000241133 Earias Species 0.000 description 1
- 241000995023 Empoasca Species 0.000 description 1
- 241000122098 Ephestia kuehniella Species 0.000 description 1
- 241000917107 Eriosoma lanigerum Species 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 241000060469 Eupoecilia ambiguella Species 0.000 description 1
- 241000515838 Eurygaster Species 0.000 description 1
- 241000239245 Euscelis Species 0.000 description 1
- 241000371383 Fannia Species 0.000 description 1
- 241000233488 Feltia Species 0.000 description 1
- 241000255896 Galleria mellonella Species 0.000 description 1
- 241001660203 Gasterophilus Species 0.000 description 1
- 241000248126 Geophilus Species 0.000 description 1
- 241001043186 Gibbium Species 0.000 description 1
- 235000009432 Gossypium hirsutum Nutrition 0.000 description 1
- 241001243091 Gryllotalpa Species 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 241000790933 Haematopinus Species 0.000 description 1
- 241000256257 Heliothis Species 0.000 description 1
- 241001659688 Hercinothrips femoralis Species 0.000 description 1
- 241001466007 Heteroptera Species 0.000 description 1
- 241000957299 Homona magnanima Species 0.000 description 1
- 241001417351 Hoplocampa Species 0.000 description 1
- 241001251909 Hyalopterus pruni Species 0.000 description 1
- 241000832180 Hylotrupes bajulus Species 0.000 description 1
- 241001508566 Hypera postica Species 0.000 description 1
- 241000257176 Hypoderma <fly> Species 0.000 description 1
- 241001495069 Ischnocera Species 0.000 description 1
- 241001149911 Isopoda Species 0.000 description 1
- 241000256602 Isoptera Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241001470016 Laodelphax Species 0.000 description 1
- 241000256686 Lasius <genus> Species 0.000 description 1
- 241000255777 Lepidoptera Species 0.000 description 1
- 241000500881 Lepisma Species 0.000 description 1
- 241001113970 Linognathus Species 0.000 description 1
- 241000254025 Locusta migratoria migratorioides Species 0.000 description 1
- 241000257162 Lucilia <blowfly> Species 0.000 description 1
- 241000255685 Malacosoma neustria Species 0.000 description 1
- 241000555303 Mamestra brassicae Species 0.000 description 1
- 241001415015 Melanoplus differentialis Species 0.000 description 1
- 241000254099 Melolontha melolontha Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 241000952627 Monomorium pharaonis Species 0.000 description 1
- 241000257229 Musca <genus> Species 0.000 description 1
- 241000721623 Myzus Species 0.000 description 1
- HRYILSDLIGTCOP-UHFFFAOYSA-N N-benzoylurea Chemical compound NC(=O)NC(=O)C1=CC=CC=C1 HRYILSDLIGTCOP-UHFFFAOYSA-N 0.000 description 1
- 241000358422 Nephotettix cincticeps Species 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- 241001385056 Niptus hololeucus Species 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- 241000384103 Oniscus asellus Species 0.000 description 1
- 241000963706 Onychiurus Species 0.000 description 1
- 241000238814 Orthoptera Species 0.000 description 1
- 241000131101 Oryzaephilus surinamensis Species 0.000 description 1
- 241000975417 Oscinella frit Species 0.000 description 1
- 241000486438 Panolis flammea Species 0.000 description 1
- 241001450657 Parthenolecanium corni Species 0.000 description 1
- 241000721451 Pectinophora gossypiella Species 0.000 description 1
- 241000517306 Pediculus humanus corporis Species 0.000 description 1
- 241000721454 Pemphigus Species 0.000 description 1
- 241000238675 Periplaneta americana Species 0.000 description 1
- 241001401863 Phorodon Species 0.000 description 1
- 241001517955 Phyllonorycter blancardella Species 0.000 description 1
- 241000255972 Pieris <butterfly> Species 0.000 description 1
- 241000690748 Piesma Species 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 241000908127 Porcellio scaber Species 0.000 description 1
- 235000005805 Prunus cerasus Nutrition 0.000 description 1
- 241000722234 Pseudococcus Species 0.000 description 1
- 241000526145 Psylla Species 0.000 description 1
- 241001160824 Psylliodes Species 0.000 description 1
- 241001105129 Ptinus Species 0.000 description 1
- 241001509970 Reticulitermes <genus> Species 0.000 description 1
- 241000722249 Rhodnius prolixus Species 0.000 description 1
- 241000125167 Rhopalosiphum padi Species 0.000 description 1
- 241001510236 Rhyparobia maderae Species 0.000 description 1
- 241000318997 Rhyzopertha dominica Species 0.000 description 1
- 241000316887 Saissetia oleae Species 0.000 description 1
- 241000253973 Schistocerca gregaria Species 0.000 description 1
- 241001157779 Scutigera Species 0.000 description 1
- 241000883293 Scutigerella Species 0.000 description 1
- 239000004113 Sepiolite Substances 0.000 description 1
- 241000258242 Siphonaptera Species 0.000 description 1
- 241000180219 Sitobion avenae Species 0.000 description 1
- 241000254181 Sitophilus Species 0.000 description 1
- 241001494139 Stomoxys Species 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 241000883295 Symphyla Species 0.000 description 1
- 241000255626 Tabanus <genus> Species 0.000 description 1
- 241000254109 Tenebrio molitor Species 0.000 description 1
- 241000339374 Thrips tabaci Species 0.000 description 1
- 241001414989 Thysanoptera Species 0.000 description 1
- 241000511627 Tipula paludosa Species 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- 241001238452 Tortrix Species 0.000 description 1
- 241000018137 Trialeurodes vaporariorum Species 0.000 description 1
- 241001414833 Triatoma Species 0.000 description 1
- 241000254086 Tribolium <beetle> Species 0.000 description 1
- 241001259047 Trichodectes Species 0.000 description 1
- 241000255993 Trichoplusia ni Species 0.000 description 1
- 241000267823 Trogoderma Species 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical group ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 235000013447 Xanthosoma atrovirens Nutrition 0.000 description 1
- 240000001781 Xanthosoma sagittifolium Species 0.000 description 1
- 241000353223 Xenopsylla cheopis Species 0.000 description 1
- 241001466337 Yponomeuta Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 241001414985 Zygentoma Species 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- HFVAFDPGUJEFBQ-UHFFFAOYSA-M alizarin red S Chemical compound [Na+].O=C1C2=CC=CC=C2C(=O)C2=C1C=C(S([O-])(=O)=O)C(O)=C2O HFVAFDPGUJEFBQ-UHFFFAOYSA-M 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 244000000054 animal parasite Species 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000008199 coating composition Substances 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 230000009189 diving Effects 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000002500 effect on skin Effects 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 238000005538 encapsulation Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 230000012173 estrus Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000003502 gasoline Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 230000001418 larval effect Effects 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical class [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000004579 marble Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- SYBYTAAJFKOIEJ-UHFFFAOYSA-N methyl iso-propyl ketone Natural products CC(C)C(C)=O SYBYTAAJFKOIEJ-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 229920005615 natural polymer Polymers 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000001007 phthalocyanine dye Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 239000003531 protein hydrolysate Substances 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- XMVJITFPVVRMHC-UHFFFAOYSA-N roxarsone Chemical group OC1=CC=C([As](O)(O)=O)C=C1[N+]([O-])=O XMVJITFPVVRMHC-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910052624 sepiolite Inorganic materials 0.000 description 1
- 235000019355 sepiolite Nutrition 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 230000000391 smoking effect Effects 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000004544 spot-on Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/39—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton at least one of the nitrogen atoms being part of any of the groups, X being a hetero atom, Y being any atom
- C07C323/43—Y being a hetero atom
- C07C323/44—X or Y being nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/46—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylureas
- C07C275/48—Y being a hydrogen or a carbon atom
- C07C275/54—Y being a carbon atom of a six-membered aromatic ring, e.g. benzoylureas
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2601780A DE2601780B2 (de) | 1976-01-20 | 1976-01-20 | N-Phenyl-N'-benzoylharnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH629759A5 true CH629759A5 (en) | 1982-05-14 |
Family
ID=5967721
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH55077A CH629759A5 (en) | 1976-01-20 | 1977-01-17 | Process for the preparation of novel substituted N-phenyl-N'-benzoylureas and their use in insecticides |
Country Status (38)
Families Citing this family (56)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5342958A (en) * | 1970-05-15 | 1994-08-30 | Solvay Duphar International Research B.V. | Organic compounds derived from urea or thiourea |
| US5245071A (en) * | 1970-05-15 | 1993-09-14 | Duphar International Research B.V. | Organic compounds derived from urea or thiourea |
| NL160809C (nl) * | 1970-05-15 | 1979-12-17 | Duphar Int Res | Werkwijze ter bereiding van benzoylureumverbindingen, alsmede werkwijze ter bereiding van insekticide prepara- ten op basis van benzoylureumverbindingen. |
| US4170657A (en) * | 1977-05-13 | 1979-10-09 | The Dow Chemical Company | Substituted(((phenyl)amino)carbonyl)-benzamides |
| USRE32418E (en) * | 1977-05-13 | 1987-05-12 | The Dow Chemical Company | Substituted(((phenyl)amino)carbonyl)-benzamides |
| DE2860137D1 (en) * | 1977-07-28 | 1980-12-11 | Ciba Geigy Ag | N-phenyl-n'-benzoyl ureas, process for their preparation, substances containing them, and their use as pesticides |
| DE2801316A1 (de) * | 1978-01-13 | 1979-07-19 | Bayer Ag | Substituierte n-phenyl-n'-(2-chlor- 6-fluor-benzoyl)-harnstoffe, verfahren zu ihrer herstellung und ihre verwendung als insektizide |
| EP0004030B1 (de) * | 1978-03-13 | 1981-12-30 | Ciba-Geigy Ag | Substituierte N-Phenyl-N'-fluorbenzoylharnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung in der Schädlingsbekämpfung |
| ZA793186B (en) * | 1978-07-06 | 1981-02-25 | Duphar Int Res | New urea and thiourea compounds, method of preparing the new compounds, as well as insecticidal compositions on the basis of these compounds |
| DE2839462A1 (de) * | 1978-09-11 | 1980-03-27 | Basf Ag | Aroylharnstoffe |
| GR73690B (enExample) * | 1979-01-15 | 1984-04-02 | Celamerck Gmbh & Co Kg | |
| US4505931A (en) * | 1979-02-01 | 1985-03-19 | Ciba-Geigy Corporation | Pesticidal N-(4-alkenylthio)-phenyl-N'-benzoylureas |
| US4339460A (en) | 1979-02-01 | 1982-07-13 | Ciba-Geigy Corporation | Pesticidal N-[4-(3'-bromoallyloxy)-phenyl]-N'-benzoyl ureas |
| US4310548A (en) | 1979-02-01 | 1982-01-12 | Ciba-Geigy Corporation | Pesticidal N-tetrafluorophenyl-N'-benzoyl ureas |
| US4243680A (en) * | 1979-02-07 | 1981-01-06 | Thompson-Hayward Chemical Company | Method of reducing infestation of citrus rust mites on citrus trees |
| DE2928410A1 (de) * | 1979-07-11 | 1981-01-29 | Schering Ag | Acylharnstoffe, insektizide mittel enthaltend diese verbindungen sowie verfahren zu ihrer herstellung |
| DE3064254D1 (en) * | 1979-07-11 | 1983-08-25 | Ciba Geigy Ag | N-phenyl-n'-benzoyl ureas, process for their preparation, compositions containing them and their use as pesticides |
| ZA804164B (en) * | 1979-07-11 | 1981-08-26 | Ciba Geigy | Phenylureas |
| US4399152A (en) * | 1980-04-03 | 1983-08-16 | Duphar International B.V. | Substituted benzoyl ureas as insecticides |
| DE3023328A1 (de) * | 1980-06-21 | 1982-01-14 | Bayer Ag, 5090 Leverkusen | Substituierte benzol-(thio)harnstoffe, verfahren zu ihrer herstellung und ihre verwendung als schaedlingsbekaempfungsmittel |
| US4431671A (en) * | 1980-12-12 | 1984-02-14 | Ciba-Geigy Corporation | Phenylureas |
| AU553953B2 (en) * | 1981-07-30 | 1986-07-31 | Dow Chemical Company, The | Urea and thiourea insecticides; intermediates in their preparation |
| US5416102A (en) * | 1981-11-10 | 1995-05-16 | Ciba-Geigy Corporation | Method of preventing the reinfestation of dogs and cats by fleas |
| CA1190246A (en) * | 1982-04-23 | 1985-07-09 | Martin Anderson | Benzoylphenylurea derivatives, their preparation and use as pesticides |
| US4438110A (en) | 1982-04-28 | 1984-03-20 | Union Carbide Corporation | Chewing insect toxicant compositions |
| DE3217620A1 (de) * | 1982-05-11 | 1983-11-17 | Bayer Ag, 5090 Leverkusen | 2,5-dihalogenbenzoyl-(thio)harnstoffe, verfahren zu ihrer herstellung und ihre verwendung als schaedlingsbekaempfungsmittel |
| DE3217619A1 (de) * | 1982-05-11 | 1983-11-17 | Bayer Ag, 5090 Leverkusen | 2,4-dihalogenbenzoyl-(thio)harnstoffe, verfahren zu ihrer herstellung und ihre verwendung als schaedlingsbekaempfungsmittel |
| DE3223505A1 (de) * | 1982-06-24 | 1983-12-29 | Bayer Ag, 5090 Leverkusen | Substituierte benzoyl-(thio)harnstoffe, verfahren zu ihrer herstellung und ihre verwendung als schaedlingsbekaempfungsmittel |
| US5001266A (en) * | 1982-07-26 | 1991-03-19 | The Dow Chemical Company | Substituted aniline compounds |
| US4868215A (en) * | 1982-07-26 | 1989-09-19 | The Dow Chemical Company | Substituted N-aroyl N'-phenyl urea compounds |
| US4529819A (en) * | 1982-08-02 | 1985-07-16 | The Dow Chemical Company | Method for making benzoylphenylureas |
| ZA835661B (en) * | 1982-09-16 | 1984-04-25 | Shell Res Ltd | Pesticidal benzoylurea compounds |
| US4560770A (en) * | 1983-02-09 | 1985-12-24 | Ciba-Geigy Corporation | Pesticidal compositions based on N-pyrrolylphenyl-N'-benzoylurea compounds |
| JPS6092260A (ja) * | 1983-10-27 | 1985-05-23 | Nippon Tokushu Noyaku Seizo Kk | 新規アニリン誘導体 |
| DE3431219A1 (de) | 1984-08-24 | 1986-03-06 | Bayer Ag, 5090 Leverkusen | Benzoylharnstoffe |
| JPS6197255A (ja) * | 1984-10-18 | 1986-05-15 | チバ‐ガイギー アクチエンゲゼルシヤフト | 置換n―ベンゾイル―n’―2.5―ジクロロ―4―ヘキサフルオロプロピルオキシフェニル尿素、その製造方法及び該化合物を含有する組成物 |
| US5135953A (en) * | 1984-12-28 | 1992-08-04 | Ciba-Geigy | Use of acyl urea compounds for controlling endoparasites and ectoparasites of warm-blooded animals |
| US5288756A (en) * | 1985-10-14 | 1994-02-22 | Ciba-Geigy Corporation | Benzoylphenylureas |
| MX5413A (es) * | 1986-02-28 | 1993-10-01 | Ciba Geigy Ag | Procedimiento para la preparacion de n-benzoil-n'-fenilureas. |
| US5157155A (en) * | 1987-02-04 | 1992-10-20 | Sumitomo Chemical Company, Limited | Benzoylurea derivative and its production and use |
| AU595417B2 (en) * | 1987-02-04 | 1990-03-29 | Sumitomo Chemical Company, Limited | A benzoylurea derivative and its production and use |
| US4925875A (en) * | 1987-07-21 | 1990-05-15 | Ciba-Geigy Corporation | N-benzoyl-N'-2,5-dihalo-4-perfluoroalkoxyphenylureas, pesticidal compositions containing them and their use in the control of pests |
| JP2661709B2 (ja) * | 1988-07-08 | 1997-10-08 | ダウ・ケミカル日本株式会社 | 高活性な農薬水和剤の製法 |
| DE19953775A1 (de) | 1999-11-09 | 2001-05-10 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| DE10018370A1 (de) * | 2000-04-14 | 2001-10-18 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| DE10043610A1 (de) * | 2000-09-05 | 2002-03-14 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| DE10248257A1 (de) * | 2002-10-16 | 2004-04-29 | Bayer Cropscience Ag | Wirkstoffkombinationen im insektiziden und akariziden Eigenschaften |
| DE102004001271A1 (de) | 2004-01-08 | 2005-08-04 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden Eigenschaften |
| DE102006031978A1 (de) * | 2006-07-11 | 2008-01-17 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| EP2039248A1 (de) * | 2007-09-21 | 2009-03-25 | Bayer CropScience AG | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| DE102007045957A1 (de) | 2007-09-26 | 2009-04-09 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden und akarziden Eigenschaften |
| EP2127522A1 (de) | 2008-05-29 | 2009-12-02 | Bayer CropScience AG | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| EP2410849A1 (de) | 2009-03-25 | 2012-02-01 | Bayer CropScience AG | Wirkstoffkombinationen mit insektiziden und akariziden eigenschaften |
| EP2382865A1 (de) | 2010-04-28 | 2011-11-02 | Bayer CropScience AG | Synergistische Wirkstoffkombinationen |
| CN102090409A (zh) * | 2011-03-25 | 2011-06-15 | 通化农药化工股份有限公司 | 1-(4-三氟甲氧基苯基)-3-(2,6-二氟苯甲酰基)脲与抗生素类杀虫剂农药复配制剂 |
| CN102177905B (zh) * | 2011-03-25 | 2013-07-17 | 通化农药化工股份有限公司 | 1-(4-三氟甲氧基苯基)-3-(2,6-二氟苯甲酰基)脲制剂 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL160809C (nl) * | 1970-05-15 | 1979-12-17 | Duphar Int Res | Werkwijze ter bereiding van benzoylureumverbindingen, alsmede werkwijze ter bereiding van insekticide prepara- ten op basis van benzoylureumverbindingen. |
| DE2232730A1 (de) * | 1972-07-04 | 1974-01-24 | Bayer Ag | Substituierte cyclohexan-2,6-dion-1carbonsaeureanilide und -thioanilide, verfahren zu ihrer herstellung und ihre verwendung als insektizide, akarizide und fungizide |
| DE2405733C2 (de) * | 1974-02-07 | 1984-12-13 | Bayer Ag, 5090 Leverkusen | Amidocarbonylthiobarbitursäurederivate und deren Salze, Verfahren zu ihrer Herstellung sowie ihre Verwendung zur Bekämpfung von Insekten, Milben und Pilzen |
| DE2405732A1 (de) * | 1974-02-07 | 1975-08-21 | Bayer Ag | Ekto- und endoparasitenmittel |
| DE2438747C2 (de) * | 1974-08-13 | 1982-10-14 | Bayer Ag, 5090 Leverkusen | Benzoylureido-diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| GB1460419A (en) * | 1975-02-06 | 1977-01-06 | Bayer Ag | Benzoylureido-diphenyl ethers and their use as insecticides |
| DE2504983C2 (de) * | 1975-02-06 | 1982-10-21 | Bayer Ag, 5090 Leverkusen | Benzoylureido-nitro-diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| DE2531279C2 (de) * | 1975-07-12 | 1983-07-14 | Bayer Ag, 5090 Leverkusen | N-(3-Trifluormethyl-4-halogen-phenyl)- N'-benzoyl-harnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
-
1976
- 1976-01-20 DE DE2601780A patent/DE2601780B2/de active Granted
- 1976-12-30 OA OA56033A patent/OA05531A/xx unknown
-
1977
- 1977-01-06 NO NO770042A patent/NO149173C/no unknown
- 1977-01-07 YU YU37/77A patent/YU39788B/xx unknown
- 1977-01-13 RO RO7789040A patent/RO72521A/ro unknown
- 1977-01-14 PT PT66078A patent/PT66078B/pt unknown
- 1977-01-17 BG BG035178A patent/BG25060A3/xx unknown
- 1977-01-17 TR TR19015A patent/TR19015A/xx unknown
- 1977-01-17 NZ NZ183094A patent/NZ183094A/xx unknown
- 1977-01-17 CH CH55077A patent/CH629759A5/de not_active IP Right Cessation
- 1977-01-17 BR BR7700289A patent/BR7700289A/pt unknown
- 1977-01-17 GB GB1687/77A patent/GB1501607A/en not_active Expired
- 1977-01-18 IL IL51279A patent/IL51279A/xx unknown
- 1977-01-18 FI FI770137A patent/FI63019C/fi not_active IP Right Cessation
- 1977-01-18 PL PL1977195379A patent/PL101199B1/pl unknown
- 1977-01-18 DD DD7700196993A patent/DD129394A5/xx unknown
- 1977-01-18 PH PH19359A patent/PH13080A/en unknown
- 1977-01-18 IT IT19412/77A patent/IT1085852B/it active
- 1977-01-19 BE BE174196A patent/BE850524A/xx not_active IP Right Cessation
- 1977-01-19 CS CS77367A patent/CS194790B2/cs unknown
- 1977-01-19 DK DK019877A patent/DK150594C/da not_active IP Right Cessation
- 1977-01-19 CA CA270,015A patent/CA1124747A/en not_active Expired
- 1977-01-19 HU HU77BA3498A patent/HU176471B/hu unknown
- 1977-01-19 AU AU21449/77A patent/AU504246B2/en not_active Expired
- 1977-01-19 GR GR52607A patent/GR62096B/el unknown
- 1977-01-19 ES ES455149A patent/ES455149A1/es not_active Expired
- 1977-01-19 ZA ZA77303A patent/ZA77303B/xx unknown
- 1977-01-19 EG EG37/77A patent/EG12374A/xx active
- 1977-01-19 SE SE7700531A patent/SE424858B/xx not_active IP Right Cessation
- 1977-01-19 SU SU772439799A patent/SU655278A3/ru active
- 1977-01-20 AT AT33777A patent/AT351864B/de not_active IP Right Cessation
- 1977-01-20 NL NL7700578A patent/NL7700578A/xx not_active Application Discontinuation
- 1977-01-20 JP JP52004478A patent/JPS6031820B2/ja not_active Expired
- 1977-01-20 AR AR266261A patent/AR219487A1/es active
- 1977-01-20 FR FR7701568A patent/FR2338928A1/fr active Granted
-
1978
- 1978-02-27 US US05/882,295 patent/US4139636A/en not_active Expired - Lifetime
- 1978-08-10 KE KE2871A patent/KE2871A/xx unknown
- 1978-12-30 MY MY373/78A patent/MY7800373A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2601780C3 (enExample) | ||
| EP0003099B1 (de) | Substituierte N-Phenyl-N'-(2-chlor-6-fluor-benzoyl)-harnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide | |
| EP0093976B1 (de) | 2,4-Dihalogenbenzoyl-(thio)harnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Schädlingsbekämpfungsmittel | |
| EP0008435B1 (de) | Substituierte N-Phenyl-N'-benzoyl-thioharnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Schädlingsbekämpfungsmittel | |
| DE2504983C2 (de) | Benzoylureido-nitro-diphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide | |
| EP0093977A1 (de) | 2,5-Dihalogenbenzoyl-(thio)harnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Schädlingsbekämpfungsmittel | |
| EP0009762B1 (de) | Substituierte N-Benzoyl-N'-tert.-alkoxycarbonylphenyl-(thio)harnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide | |
| DE2637947C2 (de) | Tetrafluor-1,3-benzodioxanyl-benzoylharnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide | |
| EP0042533B1 (de) | Substituierte Benzoyl-(thio)harnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Schädlingsbekämpfungsmittel | |
| CH634304A5 (de) | Phenylcarbamoyl-pyrazoline, verfahren zu deren herstellung sowie die verbindungen enthaltende insektizide. | |
| CH634303A5 (de) | Phenylcarbamoyl-2-pyrazoline, verfahren zu deren herstellung sowie diese verbindungen enthaltende insektizide. | |
| DE2638233C2 (de) | Substituierte Benzoyl-ureidodiphenyläther, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide | |
| EP0123861B1 (de) | Harnstoffderivate | |
| EP0122449B1 (de) | Benzoylharnstoffe | |
| DE3223505A1 (de) | Substituierte benzoyl-(thio)harnstoffe, verfahren zu ihrer herstellung und ihre verwendung als schaedlingsbekaempfungsmittel | |
| EP0318782B1 (de) | Substituierte Benzoyl(thio)harnstoffe | |
| DE2752613A1 (de) | N,n-dialkyl-0-pyrimidinyl-carbaminsaeureester, verfahren zu ihrer herstellung und ihre verwendung als insektizide | |
| EP0318796B1 (de) | Substituierte Benzoyl(thio)harnstoffe | |
| EP0003766A1 (de) | N-(omega-Chloralkanoyl)-N'-trifluormethylphenyl-harnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Pflanzenschutzmittel | |
| EP0180818A2 (de) | Benzoylharnstoffe und Zwischenprodukte | |
| DE3932534A1 (de) | Substituierte benzoylharnstoff-derivate | |
| DE3738946A1 (de) | Furazanylharnstoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |