CH621357A5 - - Google Patents
Download PDFInfo
- Publication number
 - CH621357A5 CH621357A5 CH644676A CH644676A CH621357A5 CH 621357 A5 CH621357 A5 CH 621357A5 CH 644676 A CH644676 A CH 644676A CH 644676 A CH644676 A CH 644676A CH 621357 A5 CH621357 A5 CH 621357A5
 - Authority
 - CH
 - Switzerland
 - Prior art keywords
 - pyridone
 - methyl
 - hydroxy
 - formula
 - ethyl
 - Prior art date
 
Links
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 21
 - 230000008878 coupling Effects 0.000 claims description 18
 - 238000010168 coupling process Methods 0.000 claims description 18
 - 238000005859 coupling reaction Methods 0.000 claims description 18
 - -1 cyan Substances 0.000 claims description 11
 - 238000000034 method Methods 0.000 claims description 11
 - UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 10
 - 125000000217 alkyl group Chemical group 0.000 claims description 8
 - 239000001257 hydrogen Substances 0.000 claims description 8
 - 229910052739 hydrogen Inorganic materials 0.000 claims description 8
 - 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
 - 239000000987 azo dye Substances 0.000 claims description 6
 - 150000001875 compounds Chemical class 0.000 claims description 5
 - UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical class OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 claims description 5
 - 125000004964 sulfoalkyl group Chemical group 0.000 claims description 4
 - 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 3
 - 238000004043 dyeing Methods 0.000 claims description 3
 - ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
 - 239000000460 chlorine Substances 0.000 claims description 2
 - 229910052801 chlorine Inorganic materials 0.000 claims description 2
 - 239000000243 solution Substances 0.000 description 15
 - 239000000975 dye Substances 0.000 description 10
 - 239000002253 acid Substances 0.000 description 9
 - HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
 - XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
 - 229920002678 cellulose Polymers 0.000 description 5
 - 239000001913 cellulose Substances 0.000 description 5
 - 239000000835 fiber Substances 0.000 description 4
 - LVWZTYCIRDMTEY-UHFFFAOYSA-N metamizole Chemical compound O=C1C(N(CS(O)(=O)=O)C)=C(C)N(C)N1C1=CC=CC=C1 LVWZTYCIRDMTEY-UHFFFAOYSA-N 0.000 description 4
 - 238000002156 mixing Methods 0.000 description 4
 - 150000003254 radicals Chemical class 0.000 description 4
 - KGZUHYIHYBDNLC-UHFFFAOYSA-N 2-(4-aminophenyl)-6-methyl-1,3-benzothiazole-7-sulfonic acid Chemical compound S1C2=C(S(O)(=O)=O)C(C)=CC=C2N=C1C1=CC=C(N)C=C1 KGZUHYIHYBDNLC-UHFFFAOYSA-N 0.000 description 3
 - KBUWQCXQODASRJ-UHFFFAOYSA-N 6-hydroxy-5-methyl-1h-pyridin-2-one Chemical compound CC1=CC=C(O)N=C1O KBUWQCXQODASRJ-UHFFFAOYSA-N 0.000 description 3
 - 229920000742 Cotton Polymers 0.000 description 3
 - OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
 - 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
 - 238000004519 manufacturing process Methods 0.000 description 3
 - 239000000463 material Substances 0.000 description 3
 - 230000007935 neutral effect Effects 0.000 description 3
 - 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
 - 239000000725 suspension Substances 0.000 description 3
 - 210000002268 wool Anatomy 0.000 description 3
 - OTEBTSPEXWSPLD-UHFFFAOYSA-N 2-hydroxy-4-methyl-6-oxo-1h-pyridine-3-carboxamide Chemical compound CC1=CC(=O)NC(O)=C1C(N)=O OTEBTSPEXWSPLD-UHFFFAOYSA-N 0.000 description 2
 - WQMPZIYHTPLJJD-UHFFFAOYSA-N 4-ethyl-2-hydroxy-6-oxo-1h-pyridine-3-carbonitrile Chemical compound CCC1=CC(O)=NC(O)=C1C#N WQMPZIYHTPLJJD-UHFFFAOYSA-N 0.000 description 2
 - SKDHHIUENRGTHK-UHFFFAOYSA-N 4-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=C(C(Cl)=O)C=C1 SKDHHIUENRGTHK-UHFFFAOYSA-N 0.000 description 2
 - CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
 - VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
 - FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
 - QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
 - 239000007864 aqueous solution Substances 0.000 description 2
 - 239000004744 fabric Substances 0.000 description 2
 - 238000000227 grinding Methods 0.000 description 2
 - 239000000203 mixture Substances 0.000 description 2
 - UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
 - SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
 - GGOZGYRTNQBSSA-UHFFFAOYSA-N pyridine-2,3-diol Chemical compound OC1=CC=CN=C1O GGOZGYRTNQBSSA-UHFFFAOYSA-N 0.000 description 2
 - 239000011541 reaction mixture Substances 0.000 description 2
 - 238000002791 soaking Methods 0.000 description 2
 - LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
 - PQSTUAGLUWYWEW-UHFFFAOYSA-N (2-hydroxy-4-methyl-6-oxo-1h-pyridin-3-yl)methanesulfonic acid Chemical compound CC1=CC(O)=NC(O)=C1CS(O)(=O)=O PQSTUAGLUWYWEW-UHFFFAOYSA-N 0.000 description 1
 - OUINFWXCXWWTSF-UHFFFAOYSA-N (2-hydroxy-6-oxo-1h-pyridin-4-yl)methanesulfonic acid Chemical compound OC1=CC(CS(O)(=O)=O)=CC(O)=N1 OUINFWXCXWWTSF-UHFFFAOYSA-N 0.000 description 1
 - LITZXSLYAKVNBM-UHFFFAOYSA-N (5-carbamoyl-2-hydroxy-4-methyl-6-oxo-1h-pyridin-3-yl)methanesulfonic acid Chemical compound CC1=C(CS(O)(=O)=O)C(O)=NC(O)=C1C(N)=O LITZXSLYAKVNBM-UHFFFAOYSA-N 0.000 description 1
 - KKFDJZZADQONDE-UHFFFAOYSA-N (hydridonitrato)hydroxidocarbon(.) Chemical compound O[C]=N KKFDJZZADQONDE-UHFFFAOYSA-N 0.000 description 1
 - DVXMQZHDVBYYEQ-UHFFFAOYSA-N 2,4,6-triaminopyridine-3-carbonitrile Chemical compound NC1=CC(N)=C(C#N)C(N)=N1 DVXMQZHDVBYYEQ-UHFFFAOYSA-N 0.000 description 1
 - YRGYYQCOWUULNF-UHFFFAOYSA-N 2-hydroxy-4-methyl-6-oxo-1h-pyridine-3-carbonitrile Chemical compound CC1=CC(=O)NC(O)=C1C#N YRGYYQCOWUULNF-UHFFFAOYSA-N 0.000 description 1
 - IRGXCZQWHGTCIF-UHFFFAOYSA-N 3-[(4,6-diamino-3-cyanopyridin-2-yl)amino]benzenesulfonic acid Chemical compound NC1=CC(N)=C(C#N)C(NC=2C=C(C=CC=2)S(O)(=O)=O)=N1 IRGXCZQWHGTCIF-UHFFFAOYSA-N 0.000 description 1
 - 239000005995 Aluminium silicate Substances 0.000 description 1
 - IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
 - PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
 - LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
 - 230000002378 acidificating effect Effects 0.000 description 1
 - 230000010933 acylation Effects 0.000 description 1
 - 238000005917 acylation reaction Methods 0.000 description 1
 - 229940037003 alum Drugs 0.000 description 1
 - 235000012211 aluminium silicate Nutrition 0.000 description 1
 - 150000001412 amines Chemical class 0.000 description 1
 - 229920006320 anionic starch Polymers 0.000 description 1
 - 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
 - 125000004432 carbon atom Chemical group C* 0.000 description 1
 - 239000007795 chemical reaction product Substances 0.000 description 1
 - QPJDMGCKMHUXFD-UHFFFAOYSA-N cyanogen chloride Chemical group ClC#N QPJDMGCKMHUXFD-UHFFFAOYSA-N 0.000 description 1
 - 150000001989 diazonium salts Chemical class 0.000 description 1
 - 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
 - 239000000945 filler Substances 0.000 description 1
 - 239000003292 glue Substances 0.000 description 1
 - 229910052500 inorganic mineral Inorganic materials 0.000 description 1
 - 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
 - 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
 - NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
 - 239000010985 leather Substances 0.000 description 1
 - 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
 - 239000011707 mineral Substances 0.000 description 1
 - 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
 - QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
 - JOXIMZWYDAKGHI-UHFFFAOYSA-N p-toluenesulfonic acid Substances CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
 - 238000009980 pad dyeing Methods 0.000 description 1
 - 235000011056 potassium acetate Nutrition 0.000 description 1
 - 238000002360 preparation method Methods 0.000 description 1
 - 239000000047 product Substances 0.000 description 1
 - 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
 - 150000003222 pyridines Chemical class 0.000 description 1
 - 239000004627 regenerated cellulose Substances 0.000 description 1
 - 239000011347 resin Substances 0.000 description 1
 - 229920005989 resin Polymers 0.000 description 1
 - 150000003839 salts Chemical class 0.000 description 1
 - 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
 - 239000002002 slurry Substances 0.000 description 1
 - 239000011780 sodium chloride Substances 0.000 description 1
 - 235000010288 sodium nitrite Nutrition 0.000 description 1
 - 229910052938 sodium sulfate Inorganic materials 0.000 description 1
 - 235000011152 sodium sulphate Nutrition 0.000 description 1
 - 239000007858 starting material Substances 0.000 description 1
 - 238000003756 stirring Methods 0.000 description 1
 - 125000001424 substituent group Chemical group 0.000 description 1
 - 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
 - 239000002351 wastewater Substances 0.000 description 1
 
Classifications
- 
        
- C—CHEMISTRY; METALLURGY
 - C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
 - C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
 - C09B29/00—Monoazo dyes prepared by diazotising and coupling
 - C09B29/0003—Monoazo dyes prepared by diazotising and coupling from diazotized anilines
 
 - 
        
- C—CHEMISTRY; METALLURGY
 - C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
 - C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
 - C09B29/00—Monoazo dyes prepared by diazotising and coupling
 - C09B29/34—Monoazo dyes prepared by diazotising and coupling from other coupling components
 - C09B29/36—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds
 - C09B29/3604—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom
 - C09B29/3617—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom
 - C09B29/3621—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom from a pyridine ring
 
 
Landscapes
- Chemical & Material Sciences (AREA)
 - Organic Chemistry (AREA)
 - Paper (AREA)
 - Coloring (AREA)
 - Pyridine Compounds (AREA)
 
Priority Applications (15)
| Application Number | Priority Date | Filing Date | Title | 
|---|---|---|---|
| CH644676A CH621357A5 (pm) | 1976-05-21 | 1976-05-21 | |
| US05/794,286 US4102880A (en) | 1976-05-21 | 1977-05-05 | Benzoylated dehydrothio-p-toluidine sulfonic acid-azo-pyridone dyes | 
| DE2722572A DE2722572C2 (de) | 1976-05-21 | 1977-05-18 | Azofarbstoffe, deren Herstellung und Verwendung | 
| FR7715450A FR2352038A1 (fr) | 1976-05-21 | 1977-05-18 | Colorants azoiques, leur procede de preparation et leur application | 
| SE7705885A SE427114B (sv) | 1976-05-21 | 1977-05-18 | Azofergemnen, innehallande en benstiazolres och en pyridonrest, deras framstellning och anvending for pappersfergning | 
| IT4946977A IT1078146B (it) | 1976-05-21 | 1977-05-19 | Azocoloranti e procedimento per la loro produzione ed applicazione | 
| FI771603A FI66638C (fi) | 1976-05-21 | 1977-05-19 | Azofaergaemnen deras framstaellning och anvaendning | 
| CA278,749A CA1069121A (en) | 1976-05-21 | 1977-05-19 | Azo dyes, process for their manufacture and use thereof | 
| ES458984A ES458984A1 (es) | 1976-05-21 | 1977-05-20 | Procedimiento para la preparacion de colorantes azoicos. | 
| AU25329/77A AU512996B2 (en) | 1976-05-21 | 1977-05-20 | Azo dyes, process for their manufacture and use thereof | 
| BR7703282A BR7703282A (pt) | 1976-05-21 | 1977-05-20 | Azocorantes,sua preparacao e uso | 
| GB21339/77A GB1523709A (en) | 1976-05-21 | 1977-05-20 | Azo dyes based on pyridine or pyridone coupling component | 
| ZA00773019A ZA773019B (en) | 1976-05-21 | 1977-05-20 | Azo dyes,process for their manufacture and use thereof | 
| BE177742A BE854842A (fr) | 1976-05-21 | 1977-05-20 | Colorants azoiques, leur procede de preparation et leur application | 
| JP52058233A JPS6047307B2 (ja) | 1976-05-21 | 1977-05-21 | アゾ染料、それらの製法および用途 | 
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title | 
|---|---|---|---|
| CH644676A CH621357A5 (pm) | 1976-05-21 | 1976-05-21 | 
Publications (1)
| Publication Number | Publication Date | 
|---|---|
| CH621357A5 true CH621357A5 (pm) | 1981-01-30 | 
Family
ID=4309764
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date | 
|---|---|---|---|
| CH644676A CH621357A5 (pm) | 1976-05-21 | 1976-05-21 | 
Country Status (13)
| Country | Link | 
|---|---|
| US (1) | US4102880A (pm) | 
| JP (1) | JPS6047307B2 (pm) | 
| AU (1) | AU512996B2 (pm) | 
| BE (1) | BE854842A (pm) | 
| BR (1) | BR7703282A (pm) | 
| CA (1) | CA1069121A (pm) | 
| CH (1) | CH621357A5 (pm) | 
| DE (1) | DE2722572C2 (pm) | 
| ES (1) | ES458984A1 (pm) | 
| FI (1) | FI66638C (pm) | 
| FR (1) | FR2352038A1 (pm) | 
| GB (1) | GB1523709A (pm) | 
| ZA (1) | ZA773019B (pm) | 
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| CH667663A5 (de) * | 1985-04-26 | 1988-10-31 | Sandoz Ag | Anionische disazoverbindungen. | 
| US5580980A (en) * | 1991-05-03 | 1996-12-03 | Basf Aktiengesellschaft | N-aminopyridone dyes | 
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| DE883019C (de) * | 1951-07-07 | 1953-07-13 | Bayer Ag | Verfahren zur Herstellung von gelben substantiven Azofarbstoffen | 
| FR1112147A (fr) * | 1953-09-09 | 1956-03-08 | Ici Ltd | Matières colorantes azoïques et leur fabrication | 
| DE2033281A1 (en) * | 1970-07-04 | 1972-01-20 | Badische Anilin & Soda Fabrik AG, 6700 Ludwigshafen | Water-soluble azo dyes - from diazotised heterocyclic amines and pyridone-(6) coupling components | 
| CA918643A (en) * | 1970-10-19 | 1973-01-09 | Blackwell John | Green-yellow monazo paper dyes derived from barbituric acid | 
| GB1412757A (en) * | 1972-04-17 | 1975-11-05 | Ici Ltd | Azo dyestuffs | 
| US3933787A (en) * | 1973-01-12 | 1976-01-20 | Sandoz Ltd., (Sandoz Ag) | Substituted 4-(2-benzothiazolyl)phenylazo dyes having a quaternary ammonium, hydrazinium or optionally substituted amino substituent | 
| DE2403736A1 (de) * | 1973-02-01 | 1974-08-08 | Sandoz Ag | Sulfonsaeuregruppenfreie basische azoverbindungen, ihre herstellung und verwendung | 
- 
        1976
        
- 1976-05-21 CH CH644676A patent/CH621357A5/de not_active IP Right Cessation
 
 - 
        1977
        
- 1977-05-05 US US05/794,286 patent/US4102880A/en not_active Expired - Lifetime
 - 1977-05-18 DE DE2722572A patent/DE2722572C2/de not_active Expired
 - 1977-05-18 FR FR7715450A patent/FR2352038A1/fr active Granted
 - 1977-05-19 CA CA278,749A patent/CA1069121A/en not_active Expired
 - 1977-05-19 FI FI771603A patent/FI66638C/fi not_active IP Right Cessation
 - 1977-05-20 BR BR7703282A patent/BR7703282A/pt unknown
 - 1977-05-20 BE BE177742A patent/BE854842A/xx not_active IP Right Cessation
 - 1977-05-20 AU AU25329/77A patent/AU512996B2/en not_active Expired
 - 1977-05-20 GB GB21339/77A patent/GB1523709A/en not_active Expired
 - 1977-05-20 ZA ZA00773019A patent/ZA773019B/xx unknown
 - 1977-05-20 ES ES458984A patent/ES458984A1/es not_active Expired
 - 1977-05-21 JP JP52058233A patent/JPS6047307B2/ja not_active Expired
 
 
Also Published As
| Publication number | Publication date | 
|---|---|
| JPS52142728A (en) | 1977-11-28 | 
| FI66638C (fi) | 1984-11-12 | 
| ES458984A1 (es) | 1978-02-16 | 
| CA1069121A (en) | 1980-01-01 | 
| AU512996B2 (en) | 1980-11-06 | 
| ZA773019B (en) | 1978-04-26 | 
| BR7703282A (pt) | 1977-11-29 | 
| GB1523709A (en) | 1978-09-06 | 
| DE2722572C2 (de) | 1986-07-24 | 
| US4102880A (en) | 1978-07-25 | 
| FI66638B (fi) | 1984-07-31 | 
| AU2532977A (en) | 1978-11-23 | 
| BE854842A (fr) | 1977-11-21 | 
| FR2352038B1 (pm) | 1980-01-04 | 
| JPS6047307B2 (ja) | 1985-10-21 | 
| FI771603A7 (pm) | 1977-11-22 | 
| DE2722572A1 (de) | 1977-12-01 | 
| FR2352038A1 (fr) | 1977-12-16 | 
Similar Documents
| Publication | Publication Date | Title | 
|---|---|---|
| DE2915323C2 (pm) | ||
| DE3440777C2 (de) | Neue sulfonsäuregruppenhaltige, basische Azoverbindungen, deren Herstellung und Verwendung als Farbstoffe | |
| CH667464A5 (de) | Sulfonsaeuregruppenfreie basische azoverbindungen. | |
| CH663417A5 (de) | Basische verbindungen, deren herstellung und verwendung. | |
| EP0092520B1 (de) | Basische Verbindungen, deren Herstellung und Verwendung | |
| CH627201A5 (pm) | ||
| DE2329135A1 (de) | Disazofarbstoffe | |
| EP0116513A2 (de) | Wasserlösliche Triazinverbindungen | |
| DE1106897B (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| CH621357A5 (pm) | ||
| EP0038299B1 (de) | Kationische Verbindungen | |
| EP0306452A2 (de) | Kationische Stilben-disazofarbstoffe | |
| EP0043792B1 (de) | Färben von Papier | |
| EP0062824A2 (de) | Sulfonsäuregruppenhaltige kationische Azofarbstoffe, ihre Herstellung und ihre Verwendung | |
| EP0831130B1 (de) | Lichtechte Disazofarbstoffe | |
| DE1136039B (de) | Verfahren zur Herstellung von Disazofarbstoffen | |
| EP0831129B1 (de) | Disazofarbstoffe | |
| DE69707122T2 (de) | Basische monoazoverbindungen | |
| DE19911267A1 (de) | Azoxyfarbstoffe und deren Cu-Komplexe | |
| DE1644270C3 (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| EP0342159B1 (de) | Wasserlösliche Phthalocyaninverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE19638891A1 (de) | Verfahren zum Färben von cellulosehaltigen Materialien mit Disazofarbstoffen | |
| DE881092C (de) | Verfahren zur Herstellung von Disazofarbstoffen | |
| DE1066302B (de) | Verfahren zur Herstellung von Monoazofarbstoffe^ | |
| DE3416117C2 (pm) | 
Legal Events
| Date | Code | Title | Description | 
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |