CH540884A - Verfahren zur Herstellung von dimeren Iminen aus monomeren Iminen - Google Patents
Verfahren zur Herstellung von dimeren Iminen aus monomeren IminenInfo
- Publication number
- CH540884A CH540884A CH1602867A CH1602867A CH540884A CH 540884 A CH540884 A CH 540884A CH 1602867 A CH1602867 A CH 1602867A CH 1602867 A CH1602867 A CH 1602867A CH 540884 A CH540884 A CH 540884A
- Authority
- CH
- Switzerland
- Prior art keywords
- alkyl
- cycloalkyl
- reaction
- aralkyl
- imines
- Prior art date
Links
- 150000002466 imines Chemical class 0.000 title claims abstract description 26
- 150000003233 pyrroles Chemical class 0.000 title abstract description 7
- 230000001590 oxidative effect Effects 0.000 title 1
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 claims abstract description 32
- -1 nickel peroxide Chemical class 0.000 claims abstract description 27
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 25
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 25
- 238000006243 chemical reaction Methods 0.000 claims abstract description 21
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 15
- 125000003118 aryl group Chemical group 0.000 claims abstract description 15
- 229910052759 nickel Inorganic materials 0.000 claims abstract description 12
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims abstract description 12
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 7
- 125000002877 alkyl aryl group Chemical group 0.000 claims abstract description 6
- 125000001072 heteroaryl group Chemical group 0.000 claims abstract description 5
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 5
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- 150000002978 peroxides Chemical class 0.000 claims 1
- 229920002472 Starch Polymers 0.000 abstract description 3
- 235000019698 starch Nutrition 0.000 abstract description 3
- 239000008107 starch Substances 0.000 abstract description 3
- 150000008064 anhydrides Chemical class 0.000 abstract description 2
- 239000003431 cross linking reagent Substances 0.000 abstract description 2
- 150000004985 diamines Chemical class 0.000 abstract description 2
- 239000012442 inert solvent Substances 0.000 abstract description 2
- 239000003607 modifier Substances 0.000 abstract description 2
- 150000002009 diols Chemical class 0.000 abstract 1
- 229910052757 nitrogen Inorganic materials 0.000 description 20
- 239000000203 mixture Substances 0.000 description 15
- 230000009102 absorption Effects 0.000 description 13
- 238000010521 absorption reaction Methods 0.000 description 13
- 230000015572 biosynthetic process Effects 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 9
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 8
- 238000002329 infrared spectrum Methods 0.000 description 8
- 150000001793 charged compounds Chemical class 0.000 description 7
- 239000010779 crude oil Substances 0.000 description 7
- 238000004821 distillation Methods 0.000 description 7
- 238000001819 mass spectrum Methods 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- 238000003786 synthesis reaction Methods 0.000 description 7
- SOJXDJJIMYWISJ-UHFFFAOYSA-N 2-methyl-n-(2-methylpropyl)propan-1-imine Chemical compound CC(C)CN=CC(C)C SOJXDJJIMYWISJ-UHFFFAOYSA-N 0.000 description 6
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- GOPYZMJAIPBUGX-UHFFFAOYSA-N [O-2].[O-2].[Mn+4] Chemical class [O-2].[O-2].[Mn+4] GOPYZMJAIPBUGX-UHFFFAOYSA-N 0.000 description 5
- 150000004705 aldimines Chemical class 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- 230000003595 spectral effect Effects 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 238000004817 gas chromatography Methods 0.000 description 3
- AMWRITDGCCNYAT-UHFFFAOYSA-L manganese oxide Inorganic materials [Mn].O[Mn]=O.O[Mn]=O AMWRITDGCCNYAT-UHFFFAOYSA-L 0.000 description 3
- PPNAOCWZXJOHFK-UHFFFAOYSA-N manganese(2+);oxygen(2-) Chemical class [O-2].[Mn+2] PPNAOCWZXJOHFK-UHFFFAOYSA-N 0.000 description 3
- 229910044991 metal oxide Inorganic materials 0.000 description 3
- 150000004706 metal oxides Chemical class 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 125000000168 pyrrolyl group Chemical group 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- IILLGPHWDHXXRH-UHFFFAOYSA-N 3,4-diethyl-1-(2-methylpropyl)pyrrole Chemical compound C(C(C)C)N1C=C(C(=C1)CC)CC IILLGPHWDHXXRH-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- QCVHZXIQEDRLSM-UHFFFAOYSA-N N-(2-methylpropyl)pentan-2-imine Chemical compound CC(CCC)=NCC(C)C QCVHZXIQEDRLSM-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 239000004009 herbicide Substances 0.000 description 2
- 230000010354 integration Effects 0.000 description 2
- GQMZNYJOTOYEII-UHFFFAOYSA-N n-(2-methylpropyl)butan-1-imine Chemical compound CCCC=NCC(C)C GQMZNYJOTOYEII-UHFFFAOYSA-N 0.000 description 2
- IWWGWVVTGLPZCY-UHFFFAOYSA-N n-butyl-3-methylbutan-1-imine Chemical compound CCCCN=CCC(C)C IWWGWVVTGLPZCY-UHFFFAOYSA-N 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 238000003822 preparative gas chromatography Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- BAMFBVSZEBABCA-UHFFFAOYSA-N 2-ethyl-n-(2-methylpropyl)hex-2-en-1-imine Chemical compound CCCC=C(CC)C=NCC(C)C BAMFBVSZEBABCA-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- 125000006042 4-hexenyl group Chemical group 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000001336 alkenes Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 125000000592 heterocycloalkyl group Chemical group 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- FQIMPUOQPQNHRX-UHFFFAOYSA-N n,2-dimethylpropan-1-imine Chemical compound CN=CC(C)C FQIMPUOQPQNHRX-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000009183 running Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/323—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to the ring nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyrrole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US59500166A | 1966-11-17 | 1966-11-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH540884A true CH540884A (de) | 1973-08-31 |
Family
ID=24381292
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1602867A CH540884A (de) | 1966-11-17 | 1967-11-16 | Verfahren zur Herstellung von dimeren Iminen aus monomeren Iminen |
Country Status (5)
| Country | Link |
|---|---|
| BE (1) | BE706725A (esLanguage) |
| CH (1) | CH540884A (esLanguage) |
| DE (2) | DE1668626A1 (esLanguage) |
| GB (1) | GB1177160A (esLanguage) |
| NL (1) | NL6715507A (esLanguage) |
-
1967
- 1967-10-24 GB GB4838567A patent/GB1177160A/en not_active Expired
- 1967-11-14 DE DE19671668626 patent/DE1668626A1/de active Granted
- 1967-11-14 DE DE19671795618 patent/DE1795618A1/de active Pending
- 1967-11-15 NL NL6715507A patent/NL6715507A/xx unknown
- 1967-11-16 CH CH1602867A patent/CH540884A/de not_active IP Right Cessation
- 1967-11-17 BE BE706725D patent/BE706725A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL6715507A (esLanguage) | 1968-05-20 |
| DE1668626A1 (de) | 1971-07-29 |
| DE1668626B2 (esLanguage) | 1974-01-10 |
| DE1668626C3 (esLanguage) | 1974-08-01 |
| DE1795618A1 (de) | 1972-04-06 |
| BE706725A (esLanguage) | 1968-05-17 |
| GB1177160A (en) | 1970-01-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2816637C2 (esLanguage) | ||
| DE2455887C2 (de) | Verfahren zur Herstellung von chlorierten Phenylhydroxylaminen | |
| DE2551055A1 (de) | Verfahren zur herstellung von 1,3- oder 1,4-bis-(aminomethyl)-cyclohexan | |
| CH540884A (de) | Verfahren zur Herstellung von dimeren Iminen aus monomeren Iminen | |
| DE1950280A1 (de) | Verfahren zur Herstellung von alpha-N-Formylaminosaeureverbindungen | |
| DE2852975C2 (de) | 5-Cyano-1-alkylpyrrol-2-essigsäure-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2612749C3 (de) | Verfahren zur Herstellung von 2,6,6-Trimethyl-2-cyanmethyltetrahydropyran | |
| DE2404306C3 (de) | Optisch aktive Pinanderivate | |
| DE1493752A1 (de) | Verfahren zur Herstellung von reinem wasserfreiem 2-Amino-propionitril | |
| DE3020298C2 (de) | Verfahren zur Herstellung von 2,2,4,5,5-Pentamethyl-3-formyl-3-pyrrolin | |
| DE69606389T2 (de) | Tricyclocarboxylate, verfahren zur herstellung sowie darauf basierendes parfum | |
| DE2730269C2 (esLanguage) | ||
| DE1927528C3 (de) | Verfahren zur herstellung von alpha- aethinylaminen | |
| DE2005515A1 (de) | P 08.02.69 Niederlande 6902028 Verfahren zur Herstellung von gamma-Cyanobutyraläiminen | |
| CH540885A (de) | Verfahren zur Herstellung dimerer Imine | |
| DE2262792C3 (de) | Verfahren zur Herstellung von 3,6-Dihydro-o-dioxinderivaten | |
| DE1102157B (de) | Verfahren zur Herstellung von ungesaettigten Acylaminomethyl-aminen | |
| DE1618420C3 (esLanguage) | ||
| AT259562B (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| DD236091A5 (de) | Verfahren zur herstellung von n-thienylchloracetamiden | |
| DE1964964C (esLanguage) | ||
| CH615418A5 (en) | Process for the preparation of 5-fluoro-2-methyl-1-(p-methylsulphinylbenzylidene)indene-3-acetic acid | |
| AT288391B (de) | Verfahren zur Herstellung von neuen Zimtsäureamiden | |
| DE860058C (de) | Verfahren zur Herstellung von quaternaeren Ammoniumverbindungen | |
| DE1173082B (de) | Verfahren zur Herstellung von N-mono-substituierten ª‡-Hydroxycarbonsaeureamiden |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |