CH535013A - Mikrobizides Präparat und Verwendung desselben - Google Patents
Mikrobizides Präparat und Verwendung desselbenInfo
- Publication number
- CH535013A CH535013A CH416570A CH416570A CH535013A CH 535013 A CH535013 A CH 535013A CH 416570 A CH416570 A CH 416570A CH 416570 A CH416570 A CH 416570A CH 535013 A CH535013 A CH 535013A
- Authority
- CH
- Switzerland
- Prior art keywords
- sep
- parts
- similar
- dust
- carbon atoms
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 20
- 230000003641 microbiacidal effect Effects 0.000 title claims description 7
- -1 polyoxyethylene phenyl phenol Polymers 0.000 claims description 103
- 239000000428 dust Substances 0.000 claims description 85
- 239000004480 active ingredient Substances 0.000 claims description 60
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 51
- 239000000460 chlorine Substances 0.000 claims description 40
- 125000004432 carbon atom Chemical group C* 0.000 claims description 35
- 150000003949 imides Chemical class 0.000 claims description 32
- 125000000217 alkyl group Chemical group 0.000 claims description 31
- 239000004927 clay Substances 0.000 claims description 31
- 239000008187 granular material Substances 0.000 claims description 27
- 239000000203 mixture Substances 0.000 claims description 26
- 239000004563 wettable powder Substances 0.000 claims description 26
- 239000004495 emulsifiable concentrate Substances 0.000 claims description 21
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 21
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 20
- 229910052736 halogen Inorganic materials 0.000 claims description 20
- 150000002367 halogens Chemical class 0.000 claims description 20
- 229910052739 hydrogen Inorganic materials 0.000 claims description 19
- 239000001257 hydrogen Substances 0.000 claims description 19
- 239000005909 Kieselgur Substances 0.000 claims description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 10
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 10
- 239000003995 emulsifying agent Substances 0.000 claims description 9
- 239000000454 talc Substances 0.000 claims description 9
- 229910052623 talc Inorganic materials 0.000 claims description 9
- 239000000080 wetting agent Substances 0.000 claims description 9
- WCJYTPVNMWIZCG-UHFFFAOYSA-N xylylcarb Chemical compound CNC(=O)OC1=CC=C(C)C(C)=C1 WCJYTPVNMWIZCG-UHFFFAOYSA-N 0.000 claims description 9
- 239000004372 Polyvinyl alcohol Substances 0.000 claims description 8
- 125000004414 alkyl thio group Chemical group 0.000 claims description 8
- 239000011230 binding agent Substances 0.000 claims description 8
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- PVTHJAPFENJVNC-MHRBZPPQSA-N kasugamycin Chemical compound N[C@H]1C[C@H](NC(=N)C(O)=O)[C@@H](C)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1O PVTHJAPFENJVNC-MHRBZPPQSA-N 0.000 claims description 8
- 229920002451 polyvinyl alcohol Polymers 0.000 claims description 8
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims description 8
- 125000005035 acylthio group Chemical group 0.000 claims description 7
- 125000005108 alkenylthio group Chemical group 0.000 claims description 7
- 125000004659 aryl alkyl thio group Chemical group 0.000 claims description 7
- 239000012141 concentrate Substances 0.000 claims description 7
- LRMHFDNWKCSEQU-UHFFFAOYSA-N ethoxyethane;phenol Chemical compound CCOCC.OC1=CC=CC=C1 LRMHFDNWKCSEQU-UHFFFAOYSA-N 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 6
- 239000000839 emulsion Substances 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 6
- 239000000843 powder Substances 0.000 claims description 6
- 125000004980 cyclopropylene group Chemical group 0.000 claims description 5
- 150000002431 hydrogen Chemical group 0.000 claims description 5
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 claims description 5
- LGUQLCNEEQVETG-UHFFFAOYSA-N 1-(3,5-dichlorophenyl)-3-ethylsulfinylpyrrolidine-2,5-dione Chemical compound O=C1C(S(=O)CC)CC(=O)N1C1=CC(Cl)=CC(Cl)=C1 LGUQLCNEEQVETG-UHFFFAOYSA-N 0.000 claims description 4
- YFHBEZPAMWZGEZ-UHFFFAOYSA-N 1-(3,5-dichlorophenyl)-3-octylsulfinylpyrrolidine-2,5-dione Chemical compound O=C1C(S(=O)CCCCCCCC)CC(=O)N1C1=CC(Cl)=CC(Cl)=C1 YFHBEZPAMWZGEZ-UHFFFAOYSA-N 0.000 claims description 4
- TVCTYTPQFROLJB-UHFFFAOYSA-N 3-benzylsulfinyl-1-(3,5-dichlorophenyl)pyrrolidine-2,5-dione Chemical compound ClC1=CC(Cl)=CC(N2C(C(CC2=O)S(=O)CC=2C=CC=CC=2)=O)=C1 TVCTYTPQFROLJB-UHFFFAOYSA-N 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 244000005700 microbiome Species 0.000 claims description 4
- 239000000443 aerosol Substances 0.000 claims description 3
- 125000005136 alkenylsulfinyl group Chemical group 0.000 claims description 3
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 3
- 239000007921 spray Substances 0.000 claims description 3
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 claims description 2
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 238000010410 dusting Methods 0.000 claims description 2
- 239000002674 ointment Substances 0.000 claims description 2
- 239000008188 pellet Substances 0.000 claims description 2
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 claims description 2
- 239000003826 tablet Substances 0.000 claims description 2
- RYYWUUFWQRZTIU-UHFFFAOYSA-K thiophosphate Chemical compound [O-]P([O-])([O-])=S RYYWUUFWQRZTIU-UHFFFAOYSA-K 0.000 claims description 2
- 230000001419 dependent effect Effects 0.000 claims 1
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 55
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 48
- 238000000034 method Methods 0.000 description 46
- 150000001875 compounds Chemical class 0.000 description 42
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 19
- 238000010561 standard procedure Methods 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 17
- 239000000047 product Substances 0.000 description 15
- 239000000243 solution Substances 0.000 description 14
- 239000002904 solvent Substances 0.000 description 13
- 238000012360 testing method Methods 0.000 description 13
- 208000015181 infectious disease Diseases 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 11
- 238000002474 experimental method Methods 0.000 description 11
- 150000001448 anilines Chemical class 0.000 description 10
- 230000002349 favourable effect Effects 0.000 description 10
- 230000000855 fungicidal effect Effects 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 10
- 241000228245 Aspergillus niger Species 0.000 description 9
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 238000000921 elemental analysis Methods 0.000 description 9
- 230000002401 inhibitory effect Effects 0.000 description 9
- 230000000694 effects Effects 0.000 description 8
- JDVPQXZIJDEHAN-UHFFFAOYSA-N succinamic acid Chemical compound NC(=O)CCC(O)=O JDVPQXZIJDEHAN-UHFFFAOYSA-N 0.000 description 8
- 241000233866 Fungi Species 0.000 description 7
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 7
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 7
- 230000000845 anti-microbial effect Effects 0.000 description 7
- 230000009422 growth inhibiting effect Effects 0.000 description 7
- 230000003032 phytopathogenic effect Effects 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- RINCXYDBBGOEEQ-UHFFFAOYSA-N succinic anhydride Chemical class O=C1CCC(=O)O1 RINCXYDBBGOEEQ-UHFFFAOYSA-N 0.000 description 7
- 125000001874 trioxidanyl group Chemical group [*]OOO[H] 0.000 description 7
- HIDBROSJWZYGSZ-UHFFFAOYSA-N 1-phenylpyrrole-2,5-dione Chemical compound O=C1C=CC(=O)N1C1=CC=CC=C1 HIDBROSJWZYGSZ-UHFFFAOYSA-N 0.000 description 6
- ZTUKZULGOCFJET-UHFFFAOYSA-N 1-phenylpyrrolidine-2,5-dione Chemical compound O=C1CCC(=O)N1C1=CC=CC=C1 ZTUKZULGOCFJET-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- 241000813090 Rhizoctonia solani Species 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 150000008065 acid anhydrides Chemical class 0.000 description 6
- 239000002689 soil Substances 0.000 description 6
- 241000123650 Botrytis cinerea Species 0.000 description 5
- 241001330975 Magnaporthe oryzae Species 0.000 description 5
- 241000209094 Oryza Species 0.000 description 5
- 241000221696 Sclerotinia sclerotiorum Species 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- FSQQTNAZHBEJLS-UPHRSURJSA-N maleamic acid Chemical class NC(=O)\C=C/C(O)=O FSQQTNAZHBEJLS-UPHRSURJSA-N 0.000 description 5
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 5
- 150000003573 thiols Chemical class 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 241000352690 Alternaria kikuchiana Species 0.000 description 4
- 241001450781 Bipolaris oryzae Species 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- PEEHTFAAVSWFBL-UHFFFAOYSA-N Maleimide Chemical compound O=C1NC(=O)C=C1 PEEHTFAAVSWFBL-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 238000002814 agar dilution Methods 0.000 description 4
- ZNOLGFHPUIJIMJ-UHFFFAOYSA-N fenitrothion Chemical compound COP(=S)(OC)OC1=CC=C([N+]([O-])=O)C(C)=C1 ZNOLGFHPUIJIMJ-UHFFFAOYSA-N 0.000 description 4
- 239000000417 fungicide Substances 0.000 description 4
- 238000001228 spectrum Methods 0.000 description 4
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- KDXROTVXLGAFGW-UHFFFAOYSA-N 1-(phenylcarbamoyl)cyclopropane-1-carboxylic acid Chemical class C=1C=CC=CC=1NC(=O)C1(C(=O)O)CC1 KDXROTVXLGAFGW-UHFFFAOYSA-N 0.000 description 3
- DSUPUOGOCIFZBG-UHFFFAOYSA-N 2-(phenylcarbamoyl)benzoic acid Chemical class OC(=O)C1=CC=CC=C1C(=O)NC1=CC=CC=C1 DSUPUOGOCIFZBG-UHFFFAOYSA-N 0.000 description 3
- GKPWKSVEFFEORF-UHFFFAOYSA-N 3-(3,5-dichlorophenyl)-3-azabicyclo[3.1.0]hexane-2,4-dione Chemical compound ClC1=CC(Cl)=CC(N2C(C3CC3C2=O)=O)=C1 GKPWKSVEFFEORF-UHFFFAOYSA-N 0.000 description 3
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 3
- 241000412366 Alternaria mali Species 0.000 description 3
- 241000196324 Embryophyta Species 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 229940125904 compound 1 Drugs 0.000 description 3
- 229940125782 compound 2 Drugs 0.000 description 3
- 239000012024 dehydrating agents Substances 0.000 description 3
- 238000006297 dehydration reaction Methods 0.000 description 3
- 239000000645 desinfectant Substances 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000011976 maleic acid Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- LGRFSURHDFAFJT-UHFFFAOYSA-N phthalic anhydride Chemical class C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 150000003568 thioethers Chemical class 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- ZRKMQKLGEQPLNS-UHFFFAOYSA-N 1-Pentanethiol Chemical compound CCCCCS ZRKMQKLGEQPLNS-UHFFFAOYSA-N 0.000 description 2
- MJTQBKQAZIJCDG-UHFFFAOYSA-N 3-butylsulfinyl-1-(3,5-dichlorophenyl)pyrrolidine-2,5-dione Chemical compound O=C1C(S(=O)CCCC)CC(=O)N1C1=CC(Cl)=CC(Cl)=C1 MJTQBKQAZIJCDG-UHFFFAOYSA-N 0.000 description 2
- WVBTVBBBHZYKKM-UHFFFAOYSA-N 3-chloro-1-(3,5-dichlorophenyl)pyrrolidine-2,5-dione Chemical compound O=C1C(Cl)CC(=O)N1C1=CC(Cl)=CC(Cl)=C1 WVBTVBBBHZYKKM-UHFFFAOYSA-N 0.000 description 2
- GKOFFGQUWTYEDQ-UHFFFAOYSA-N 5-oxaspiro[2.3]hexane-4,6-dione Chemical class O=C1OC(=O)C11CC1 GKOFFGQUWTYEDQ-UHFFFAOYSA-N 0.000 description 2
- 241001530056 Athelia rolfsii Species 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- 241000688200 Cingulata Species 0.000 description 2
- 241001133184 Colletotrichum agaves Species 0.000 description 2
- 235000007164 Oryza sativa Nutrition 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 241000918585 Pythium aphanidermatum Species 0.000 description 2
- 241000579741 Sphaerotheca <fungi> Species 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 241001617088 Thanatephorus sasakii Species 0.000 description 2
- 241000589652 Xanthomonas oryzae Species 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 238000007259 addition reaction Methods 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 125000004188 dichlorophenyl group Chemical group 0.000 description 2
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 2
- 125000005456 glyceride group Chemical group 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000002363 herbicidal effect Effects 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 2
- 244000000010 microbial pathogen Species 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 244000045947 parasite Species 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- IGURWOUVEYRFJD-UHFFFAOYSA-N (2,5-dimethoxy-3-methyl-4-nitrophenoxy)-dihydroxy-sulfanylidene-lambda5-phosphane Chemical compound CC1=C(C(=CC(=C1OC)OP(=S)(O)O)OC)[N+](=O)[O-] IGURWOUVEYRFJD-UHFFFAOYSA-N 0.000 description 1
- CXNPLSGKWMLZPZ-GIFSMMMISA-N (2r,3r,6s)-3-[[(3s)-3-amino-5-[carbamimidoyl(methyl)amino]pentanoyl]amino]-6-(4-amino-2-oxopyrimidin-1-yl)-3,6-dihydro-2h-pyran-2-carboxylic acid Chemical compound O1[C@@H](C(O)=O)[C@H](NC(=O)C[C@@H](N)CCN(C)C(N)=N)C=C[C@H]1N1C(=O)N=C(N)C=C1 CXNPLSGKWMLZPZ-GIFSMMMISA-N 0.000 description 1
- CPDPYDWANKSYJT-UPHRSURJSA-N (z)-4-(3,5-diiodoanilino)-4-oxobut-2-enoic acid Chemical compound OC(=O)\C=C/C(=O)NC1=CC(I)=CC(I)=C1 CPDPYDWANKSYJT-UPHRSURJSA-N 0.000 description 1
- WBEJYOJJBDISQU-UHFFFAOYSA-N 1,2-Dibromo-3-chloropropane Chemical compound ClCC(Br)CBr WBEJYOJJBDISQU-UHFFFAOYSA-N 0.000 description 1
- 229940100682 1,2-dibromo-3-chloropropane Drugs 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- NTSCLTBGDRNNOH-UHFFFAOYSA-N 1-(3,5-dichlorophenyl)-3-(4-methylphenyl)sulfanylpyrrolidine-2,5-dione Chemical compound C1=CC(C)=CC=C1SC1C(=O)N(C=2C=C(Cl)C=C(Cl)C=2)C(=O)C1 NTSCLTBGDRNNOH-UHFFFAOYSA-N 0.000 description 1
- LGGJFGYSMVHCLP-UHFFFAOYSA-N 1-(3,5-dichlorophenyl)-5-phenylsulfanyl-2h-pyridine-3,6-dione Chemical compound ClC1=CC(Cl)=CC(N2C(C(SC=3C=CC=CC=3)=CC(=O)C2)=O)=C1 LGGJFGYSMVHCLP-UHFFFAOYSA-N 0.000 description 1
- OSSFTHGZMNLASE-UHFFFAOYSA-N 1-(3,5-dichlorophenyl)pyrrole-2,5-dione Chemical compound ClC1=CC(Cl)=CC(N2C(C=CC2=O)=O)=C1 OSSFTHGZMNLASE-UHFFFAOYSA-N 0.000 description 1
- IVDUQQYSLGDPER-UHFFFAOYSA-N 1-(3,5-difluorophenyl)pyrrole-2,5-dione Chemical compound FC1=CC(F)=CC(N2C(C=CC2=O)=O)=C1 IVDUQQYSLGDPER-UHFFFAOYSA-N 0.000 description 1
- SDHXFKBMHSJXHA-UHFFFAOYSA-N 1-carbamoylcyclopropane-1-carboxylic acid Chemical compound NC(=O)C1(C(O)=O)CC1 SDHXFKBMHSJXHA-UHFFFAOYSA-N 0.000 description 1
- XVIRIXVOLLJIPF-UHFFFAOYSA-N 1-nitro-2-(2-nitrophenoxy)benzene Chemical compound [O-][N+](=O)C1=CC=CC=C1OC1=CC=CC=C1[N+]([O-])=O XVIRIXVOLLJIPF-UHFFFAOYSA-N 0.000 description 1
- SVPKNMBRVBMTLB-UHFFFAOYSA-N 2,3-dichloronaphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(Cl)=C(Cl)C(=O)C2=C1 SVPKNMBRVBMTLB-UHFFFAOYSA-N 0.000 description 1
- 150000003923 2,5-pyrrolediones Chemical class 0.000 description 1
- OVSKIKFHRZPJSS-DOMIDYPGSA-N 2-(2,4-dichlorophenoxy)acetic acid Chemical compound OC(=O)[14CH2]OC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-DOMIDYPGSA-N 0.000 description 1
- LXUNZSDDXMPKLP-UHFFFAOYSA-N 2-Methylbenzenethiol Chemical compound CC1=CC=CC=C1S LXUNZSDDXMPKLP-UHFFFAOYSA-N 0.000 description 1
- ULIKDJVNUXNQHS-UHFFFAOYSA-N 2-Propene-1-thiol Chemical compound SCC=C ULIKDJVNUXNQHS-UHFFFAOYSA-N 0.000 description 1
- PWOBDMNCYMQTCE-UHFFFAOYSA-N 2-chlorobenzenethiol Chemical compound SC1=CC=CC=C1Cl PWOBDMNCYMQTCE-UHFFFAOYSA-N 0.000 description 1
- MFUPLJQNEXUUDW-UHFFFAOYSA-N 2-phenylisoindole-1,3-dione Chemical class O=C1C2=CC=CC=C2C(=O)N1C1=CC=CC=C1 MFUPLJQNEXUUDW-UHFFFAOYSA-N 0.000 description 1
- QISDNBWZLNLGSS-UHFFFAOYSA-N 3-(3,5-dibromophenyl)-1,5-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione Chemical compound O=C1C2(C)CC2(C)C(=O)N1C1=CC(Br)=CC(Br)=C1 QISDNBWZLNLGSS-UHFFFAOYSA-N 0.000 description 1
- SRJGJJHBMCHHED-UHFFFAOYSA-N 3-(3,5-dichlorophenyl)-1,6-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione Chemical compound O=C1C2(C)C(C)C2C(=O)N1C1=CC(Cl)=CC(Cl)=C1 SRJGJJHBMCHHED-UHFFFAOYSA-N 0.000 description 1
- PXWLQTSOCNTUOW-UHFFFAOYSA-N 3-(3,5-diiodophenyl)-1,5-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione Chemical compound O=C1C2(C)CC2(C)C(=O)N1C1=CC(I)=CC(I)=C1 PXWLQTSOCNTUOW-UHFFFAOYSA-N 0.000 description 1
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical compound NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 1
- ZEQIMXQAKYXNKY-UHFFFAOYSA-N 3-(4-chlorophenyl)sulfanyl-1-(3,5-dichlorophenyl)pyrrolidine-2,5-dione Chemical compound C1=CC(Cl)=CC=C1SC1C(=O)N(C=2C=C(Cl)C=C(Cl)C=2)C(=O)C1 ZEQIMXQAKYXNKY-UHFFFAOYSA-N 0.000 description 1
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 1
- PJGUFYMTNMCFGH-UHFFFAOYSA-N 3-bromo-1-(3,5-dibromophenyl)pyrrolidine-2,5-dione Chemical compound O=C1C(Br)CC(=O)N1C1=CC(Br)=CC(Br)=C1 PJGUFYMTNMCFGH-UHFFFAOYSA-N 0.000 description 1
- AQTOTTXJYWSGNX-UHFFFAOYSA-N 3-butylsulfanyl-1-(3,5-dichlorophenyl)pyrrolidine-2,5-dione Chemical compound O=C1C(SCCCC)CC(=O)N1C1=CC(Cl)=CC(Cl)=C1 AQTOTTXJYWSGNX-UHFFFAOYSA-N 0.000 description 1
- VAQRKDJTHMDRST-UHFFFAOYSA-N 3-chloro-1-(3,5-dibromophenyl)pyrrolidine-2,5-dione Chemical compound O=C1C(Cl)CC(=O)N1C1=CC(Br)=CC(Br)=C1 VAQRKDJTHMDRST-UHFFFAOYSA-N 0.000 description 1
- WRXOZRLZDJAYDR-UHFFFAOYSA-N 3-methylbenzenethiol Chemical compound CC1=CC=CC(S)=C1 WRXOZRLZDJAYDR-UHFFFAOYSA-N 0.000 description 1
- MOLSZXACYHAGBZ-UHFFFAOYSA-N 3-phenyl-3-azabicyclo[3.1.0]hexane-2,4-dione Chemical compound O=C1C2CC2C(=O)N1C1=CC=CC=C1 MOLSZXACYHAGBZ-UHFFFAOYSA-N 0.000 description 1
- AFJWMGOTLUUGHF-UHFFFAOYSA-N 4,5,6,7-tetrahydroisoindole-1,3-dione Chemical compound C1CCCC2=C1C(=O)NC2=O AFJWMGOTLUUGHF-UHFFFAOYSA-N 0.000 description 1
- WLHCBQAPPJAULW-UHFFFAOYSA-N 4-methylbenzenethiol Chemical compound CC1=CC=C(S)C=C1 WLHCBQAPPJAULW-UHFFFAOYSA-N 0.000 description 1
- UHPMCKVQTMMPCG-UHFFFAOYSA-N 5,8-dihydroxy-2-methoxy-6-methyl-7-(2-oxopropyl)naphthalene-1,4-dione Chemical compound CC1=C(CC(C)=O)C(O)=C2C(=O)C(OC)=CC(=O)C2=C1O UHPMCKVQTMMPCG-UHFFFAOYSA-N 0.000 description 1
- SUTXCNLCXABXRN-UHFFFAOYSA-N 5-(3,5-dibromoanilino)-5-oxopentanoic acid Chemical compound OC(=O)CCCC(=O)NC1=CC(Br)=CC(Br)=C1 SUTXCNLCXABXRN-UHFFFAOYSA-N 0.000 description 1
- IMFWILUSTVYLEX-UHFFFAOYSA-N 5-(3,5-dichloroanilino)-5-oxopentanoic acid Chemical compound OC(=O)CCCC(=O)NC1=CC(Cl)=CC(Cl)=C1 IMFWILUSTVYLEX-UHFFFAOYSA-N 0.000 description 1
- NQCOBSUYDLFEAP-UHFFFAOYSA-N 5-(3,5-diiodoanilino)-5-oxopentanoic acid Chemical compound OC(=O)CCCC(=O)NC1=CC(I)=CC(I)=C1 NQCOBSUYDLFEAP-UHFFFAOYSA-N 0.000 description 1
- YTKGLURLTLIZJG-UHFFFAOYSA-N 6-methyl-1,4-dihydroquinoxaline-2,3-dithione Chemical class N1C(=S)C(=S)NC2=CC(C)=CC=C21 YTKGLURLTLIZJG-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 235000000832 Ayote Nutrition 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 235000007516 Chrysanthemum Nutrition 0.000 description 1
- 244000189548 Chrysanthemum x morifolium Species 0.000 description 1
- 240000008067 Cucumis sativus Species 0.000 description 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 1
- 240000004244 Cucurbita moschata Species 0.000 description 1
- 235000009854 Cucurbita moschata Nutrition 0.000 description 1
- 235000009804 Cucurbita pepo subsp pepo Nutrition 0.000 description 1
- 241000371644 Curvularia ravenelii Species 0.000 description 1
- 239000004805 Cyclohexane-1,2-dicarboxylic acid Substances 0.000 description 1
- YVGGHNCTFXOJCH-UHFFFAOYSA-N DDT Chemical compound C1=CC(Cl)=CC=C1C(C(Cl)(Cl)Cl)C1=CC=C(Cl)C=C1 YVGGHNCTFXOJCH-UHFFFAOYSA-N 0.000 description 1
- 241000588698 Erwinia Species 0.000 description 1
- 241000221785 Erysiphales Species 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- IWDQPCIQCXRBQP-UHFFFAOYSA-M Fenaminosulf Chemical compound [Na+].CN(C)C1=CC=C(N=NS([O-])(=O)=O)C=C1 IWDQPCIQCXRBQP-UHFFFAOYSA-M 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000223218 Fusarium Species 0.000 description 1
- 241000223221 Fusarium oxysporum Species 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-Chlorosuccinimide Substances ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 1
- 241001626624 Nakataea sigmoidea Species 0.000 description 1
- 229910006124 SOCl2 Inorganic materials 0.000 description 1
- WHKUVVPPKQRRBV-UHFFFAOYSA-N Trasan Chemical compound CC1=CC(Cl)=CC=C1OCC(O)=O WHKUVVPPKQRRBV-UHFFFAOYSA-N 0.000 description 1
- 241000223229 Trichophyton rubrum Species 0.000 description 1
- 241000985670 Xanthomonas arboricola pv. pruni Species 0.000 description 1
- 241000589655 Xanthomonas citri Species 0.000 description 1
- FRDDEJAABOMVCH-UHFFFAOYSA-N [dimethylcarbamothioylsulfanyl(methyl)arsanyl] n,n-dimethylcarbamodithioate Chemical compound CN(C)C(=S)S[As](C)SC(=S)N(C)C FRDDEJAABOMVCH-UHFFFAOYSA-N 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- IMHBYKMAHXWHRP-UHFFFAOYSA-N anilazine Chemical compound ClC1=CC=CC=C1NC1=NC(Cl)=NC(Cl)=N1 IMHBYKMAHXWHRP-UHFFFAOYSA-N 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 239000004599 antimicrobial Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 1
- CXNPLSGKWMLZPZ-UHFFFAOYSA-N blasticidin-S Natural products O1C(C(O)=O)C(NC(=O)CC(N)CCN(C)C(N)=N)C=CC1N1C(=O)N=C(N)C=C1 CXNPLSGKWMLZPZ-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- LDVVMCZRFWMZSG-UHFFFAOYSA-N captan Chemical compound C1C=CCC2C(=O)N(SC(Cl)(Cl)Cl)C(=O)C21 LDVVMCZRFWMZSG-UHFFFAOYSA-N 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- JBTGHKUTYAMZEZ-UHFFFAOYSA-N cellocidin Chemical compound NC(=O)C#CC(N)=O JBTGHKUTYAMZEZ-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- WIIZWVCIJKGZOK-RKDXNWHRSA-N chloramphenicol Chemical compound ClC(Cl)C(=O)N[C@H](CO)[C@H](O)C1=CC=C([N+]([O-])=O)C=C1 WIIZWVCIJKGZOK-RKDXNWHRSA-N 0.000 description 1
- 229960005091 chloramphenicol Drugs 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 230000003750 conditioning effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- QPJDMGCKMHUXFD-UHFFFAOYSA-N cyanogen chloride Chemical compound ClC#N QPJDMGCKMHUXFD-UHFFFAOYSA-N 0.000 description 1
- QSAWQNUELGIYBC-UHFFFAOYSA-N cyclohexane-1,2-dicarboxylic acid Chemical compound OC(=O)C1CCCCC1C(O)=O QSAWQNUELGIYBC-UHFFFAOYSA-N 0.000 description 1
- FDKLLWKMYAMLIF-UHFFFAOYSA-N cyclopropane-1,1-dicarboxylic acid Chemical compound OC(=O)C1(C(O)=O)CC1 FDKLLWKMYAMLIF-UHFFFAOYSA-N 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 230000000249 desinfective effect Effects 0.000 description 1
- FHIVAFMUCKRCQO-UHFFFAOYSA-N diazinon Chemical compound CCOP(=S)(OCC)OC1=CC(C)=NC(C(C)C)=N1 FHIVAFMUCKRCQO-UHFFFAOYSA-N 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- OEBRKCOSUFCWJD-UHFFFAOYSA-N dichlorvos Chemical compound COP(=O)(OC)OC=C(Cl)Cl OEBRKCOSUFCWJD-UHFFFAOYSA-N 0.000 description 1
- UOAMTSKGCBMZTC-UHFFFAOYSA-N dicofol Chemical compound C=1C=C(Cl)C=CC=1C(C(Cl)(Cl)Cl)(O)C1=CC=C(Cl)C=C1 UOAMTSKGCBMZTC-UHFFFAOYSA-N 0.000 description 1
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 1
- IQJBVBVYSZCXMF-UHFFFAOYSA-N dihydroxy-(2-nitrophenoxy)-sulfanylidene-$l^{5}-phosphane Chemical compound OP(O)(=S)OC1=CC=CC=C1[N+]([O-])=O IQJBVBVYSZCXMF-UHFFFAOYSA-N 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- AWYFNIZYMPNGAI-UHFFFAOYSA-L ethylenebis(dithiocarbamate) Chemical compound [S-]C(=S)NCCNC([S-])=S AWYFNIZYMPNGAI-UHFFFAOYSA-L 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 239000003317 industrial substance Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 229910000462 iron(III) oxide hydroxide Inorganic materials 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- QYPPRTNMGCREIM-UHFFFAOYSA-M methylarsonate(1-) Chemical compound C[As](O)([O-])=O QYPPRTNMGCREIM-UHFFFAOYSA-M 0.000 description 1
- 229940124561 microbicide Drugs 0.000 description 1
- 230000002906 microbiologic effect Effects 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- ILWHQBCNYCHNIL-UHFFFAOYSA-N n'-phenylbutanediamide Chemical class NC(=O)CCC(=O)NC1=CC=CC=C1 ILWHQBCNYCHNIL-UHFFFAOYSA-N 0.000 description 1
- JACMPVXHEARCBO-UHFFFAOYSA-N n-pentylpentan-1-amine Chemical compound CCCCCNCCCCC JACMPVXHEARCBO-UHFFFAOYSA-N 0.000 description 1
- JXTHEWSKYLZVJC-UHFFFAOYSA-N naptalam Chemical compound OC(=O)C1=CC=CC=C1C(=O)NC1=CC=CC2=CC=CC=C12 JXTHEWSKYLZVJC-UHFFFAOYSA-N 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- HVZWVEKIQMJYIK-UHFFFAOYSA-N nitryl chloride Chemical compound [O-][N+](Cl)=O HVZWVEKIQMJYIK-UHFFFAOYSA-N 0.000 description 1
- 150000004967 organic peroxy acids Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- RLBIQVVOMOPOHC-UHFFFAOYSA-N parathion-methyl Chemical compound COP(=S)(OC)OC1=CC=C([N+]([O-])=O)C=C1 RLBIQVVOMOPOHC-UHFFFAOYSA-N 0.000 description 1
- PQUHFRSGVHFXNT-UHFFFAOYSA-N pcl5 pocl3 Chemical compound ClP(Cl)(Cl)=O.ClP(Cl)(Cl)(Cl)Cl PQUHFRSGVHFXNT-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- QXJKBPAVAHBARF-UHFFFAOYSA-N procymidone Chemical compound O=C1C2(C)CC2(C)C(=O)N1C1=CC(Cl)=CC(Cl)=C1 QXJKBPAVAHBARF-UHFFFAOYSA-N 0.000 description 1
- 235000015136 pumpkin Nutrition 0.000 description 1
- KOUKXHPPRFNWPP-UHFFFAOYSA-N pyrazine-2,5-dicarboxylic acid;hydrate Chemical compound O.OC(=O)C1=CN=C(C(O)=O)C=N1 KOUKXHPPRFNWPP-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- ODCWYMIRDDJXKW-UHFFFAOYSA-N simazine Chemical compound CCNC1=NC(Cl)=NC(NCC)=N1 ODCWYMIRDDJXKW-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- KUAZQDVKQLNFPE-UHFFFAOYSA-N thiram Chemical compound CN(C)C(=S)SSC(=S)N(C)C KUAZQDVKQLNFPE-UHFFFAOYSA-N 0.000 description 1
- 229960002447 thiram Drugs 0.000 description 1
- JSPLKZUTYZBBKA-UHFFFAOYSA-N trioxidane Chemical compound OOO JSPLKZUTYZBBKA-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- AMHNZOICSMBGDH-UHFFFAOYSA-L zineb Chemical compound [Zn+2].[S-]C(=S)NCCNC([S-])=S AMHNZOICSMBGDH-UHFFFAOYSA-L 0.000 description 1
- DUBNHZYBDBBJHD-UHFFFAOYSA-L ziram Chemical compound [Zn+2].CN(C)C([S-])=S.CN(C)C([S-])=S DUBNHZYBDBBJHD-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/36—Oxygen or sulfur atoms
- C07D207/40—2,5-Pyrrolidine-diones
- C07D207/404—2,5-Pyrrolidine-diones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. succinimide
- C07D207/408—Radicals containing only hydrogen and carbon atoms attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/36—Oxygen or sulfur atoms
- C07D207/40—2,5-Pyrrolidine-diones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/44—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/44—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members
- C07D207/444—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5
- C07D207/448—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5 with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. maleimide
- C07D207/452—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5 with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. maleimide with hydrocarbon radicals, substituted by hetero atoms, directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/52—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring condensed with a ring other than six-membered
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/86—Oxygen atoms
- C07D211/88—Oxygen atoms attached in positions 2 and 6, e.g. glutarimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/14—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D295/145—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with the ring nitrogen atoms and the carbon atoms with three bonds to hetero atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/15—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with the ring nitrogen atoms and the carbon atoms with three bonds to hetero atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Indole Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2152969 | 1969-03-19 | ||
| JP2579569 | 1969-04-02 | ||
| JP2858569 | 1969-04-11 | ||
| JP3045569 | 1969-04-19 | ||
| JP3591969 | 1969-05-09 | ||
| JP4150469 | 1969-05-27 | ||
| JP4187469 | 1969-05-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH535013A true CH535013A (de) | 1973-03-31 |
Family
ID=27563943
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH416570A CH535013A (de) | 1969-03-19 | 1970-03-19 | Mikrobizides Präparat und Verwendung desselben |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3745170A (OSRAM) |
| CA (1) | CA960219A (OSRAM) |
| CH (1) | CH535013A (OSRAM) |
| DE (1) | DE2012656C3 (OSRAM) |
| FR (1) | FR2035073A1 (OSRAM) |
| GB (1) | GB1298261A (OSRAM) |
| NL (5) | NL7003836A (OSRAM) |
| RO (1) | RO59919A (OSRAM) |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3984435A (en) * | 1970-12-23 | 1976-10-05 | Mitsubishi Chemical Industries Ltd. | Herbicidal N-substituted-Δ1 -tetrahydrophthalimide |
| FR2205274B1 (OSRAM) | 1972-11-02 | 1976-10-01 | Sumitomo Chemical Co | |
| JPS5032306B2 (OSRAM) * | 1972-11-02 | 1975-10-20 | ||
| US3987056A (en) * | 1973-05-07 | 1976-10-19 | Phillips Petroleum Company | Disproportionation of n-aryl-1,2,3,6-tetrahydrophthalimides |
| DE2529359A1 (de) * | 1974-07-01 | 1976-01-22 | Kureha Chemical Ind Co Ltd | Fungizid |
| US3987057A (en) * | 1975-01-30 | 1976-10-19 | E. I. Du Pont De Nemours And Company | Herbicidal 2-(substituted aryl)-3a,4,5,6,7,7a-hexahydro-1h-isoindole-1,3(2h)-diones |
| JPS5247918A (en) * | 1975-10-15 | 1977-04-16 | Sumitomo Chem Co Ltd | Non-medical fungicides and method of making the same |
| US4183857A (en) * | 1978-07-06 | 1980-01-15 | Shell Oil Company | 3-Benzyl-3-azabicyclo(3.1.0)hexane-2,4-dione |
| CA1121355A (en) * | 1978-10-27 | 1982-04-06 | Ronald F. Mason | Pyrrolidine derivatives and process for the preparation of such compounds |
| DE2852924A1 (de) * | 1978-12-07 | 1980-06-26 | Bayer Ag | Substituierte spiro-derivate von 3- (3,5-dihalogenphenyl)-oxazolidin-2,4-dionen (thion-onen), verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| US4292070A (en) * | 1979-04-13 | 1981-09-29 | Mitsubishi Chemical Industries, Ltd. | N-Substituted tetrahydrophthalimide and herbicidal composition |
| IL59877A0 (en) * | 1979-04-20 | 1980-06-30 | Ciba Geigy | Cyclobutanedicarboxylic acid imides,their production and their use as fungicides |
| EP0031297A3 (de) * | 1979-12-07 | 1981-07-15 | Ciba-Geigy Ag | Pyrrolidin-2,5-dion-Derivate, Verfahren zu ihrer Herstellung und Verwendung als mikrobiozide Mittel |
| DE3030926A1 (de) * | 1980-08-16 | 1982-04-01 | Consortium für elektrochemische Industrie GmbH, 8000 München | Substituierte bernsteinsaeureimide |
| US4595408A (en) * | 1981-02-06 | 1986-06-17 | Stauffer Chemical Co. | N-m-phenyl succinimide and glutarimide derivatives and their use as herbicides |
| US4487777A (en) * | 1981-09-29 | 1984-12-11 | Chevron Research Company | N-Phenyl-2-thiomethylsuccinimides, and N-phenyl-2-thiomethenyl succinimides, and fungicidal use thereof |
| JPS59118750A (ja) * | 1982-12-27 | 1984-07-09 | Eisai Co Ltd | カルボン酸アミド化合物およびその誘導体 |
| JPS59231057A (ja) * | 1983-06-14 | 1984-12-25 | Eisai Co Ltd | カルボン酸アミド化合物およびその誘導体 |
| US4804400A (en) * | 1986-09-12 | 1989-02-14 | Ciba-Geigy Corporation | N-phenyl-maleimides and herbicidal and plant growth regulating methods of use thereof |
| DE3635282A1 (de) * | 1986-10-16 | 1988-04-28 | Dow Chemical Co | 3 halogensuccinimide |
| US5223018A (en) * | 1989-04-04 | 1993-06-29 | Ciba-Geigy Corporation | 1-phenyl-piperdine-2,6-diones with herbicidal activity |
| ES2086857T3 (es) * | 1992-12-04 | 1996-07-01 | Mitsui Toatsu Chemicals | Derivados de 3-azabiciclo(3.1.0)hexano-2-ona y composiciones herbicidas que los contienen como ingredientes herbicidamente activos. |
| US6248884B1 (en) * | 1999-06-03 | 2001-06-19 | The Perkin-Elmer Corporation | Extended rhodamine compounds useful as fluorescent labels |
| PL200668B1 (pl) * | 1999-12-13 | 2009-01-30 | Bayer Ag | Kombinacje substancji aktywnych, zastosowanie tych kombinacji i sposób wytwarzania środków grzybobójczych |
| DE10019758A1 (de) | 2000-04-20 | 2001-10-25 | Bayer Ag | Fungizide Wirkstoffkombinationen |
| DE10103832A1 (de) * | 2000-05-11 | 2001-11-15 | Bayer Ag | Fungizide Wirkstoffkombinationen |
| DE10049804A1 (de) * | 2000-10-09 | 2002-04-18 | Bayer Ag | Wirkstoffkombinationen mit fungiziden und akariziden Eigenschaften |
| DE10141618A1 (de) * | 2001-08-24 | 2003-03-06 | Bayer Cropscience Ag | Fungizide Wirkstoffkombinationen |
| DE10347090A1 (de) | 2003-10-10 | 2005-05-04 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE10349501A1 (de) | 2003-10-23 | 2005-05-25 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE102004049761A1 (de) | 2004-10-12 | 2006-04-13 | Bayer Cropscience Ag | Fungizide Wirkstoffkombinationen |
| DE102005015677A1 (de) * | 2005-04-06 | 2006-10-12 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE102005026482A1 (de) | 2005-06-09 | 2006-12-14 | Bayer Cropscience Ag | Wirkstoffkombinationen |
| EA201270781A1 (ru) | 2005-06-09 | 2013-09-30 | Байер Кропсайенс Аг | Комбинации биологически активных веществ |
| DE102006023263A1 (de) | 2006-05-18 | 2007-11-22 | Bayer Cropscience Ag | Synergistische Wirkstoffkombinationen |
| DE102007045920B4 (de) | 2007-09-26 | 2018-07-05 | Bayer Intellectual Property Gmbh | Synergistische Wirkstoffkombinationen |
| KR101647703B1 (ko) | 2009-03-25 | 2016-08-11 | 바이엘 인텔렉쳐 프로퍼티 게엠베하 | 상승적 활성 성분 배합물 |
| BR112012001080A2 (pt) | 2009-07-16 | 2015-09-01 | Bayer Cropscience Ag | Combinações de substâncias ativas sinérgicas contendo feniltriazóis |
| EP2910126A1 (en) | 2015-05-05 | 2015-08-26 | Bayer CropScience AG | Active compound combinations having insecticidal properties |
| CN111825597A (zh) * | 2020-07-27 | 2020-10-27 | 江西禾益化工股份有限公司 | 一种合成腐霉利的方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2900243A (en) * | 1955-12-28 | 1959-08-18 | Monsanto Chemicals | Herbicides 1596(a) |
| US3166571A (en) * | 1962-06-06 | 1965-01-19 | American Cyanamid Co | 1-phenyl-1, 2-cyclopropane dicarboximides |
| GB1191015A (en) * | 1966-05-17 | 1970-05-06 | Sterling Drug Inc | Iodinated Imido-Benzoic Acids |
-
1970
- 1970-03-06 US US00017339A patent/US3745170A/en not_active Expired - Lifetime
- 1970-03-11 CA CA077,130A patent/CA960219A/en not_active Expired
- 1970-03-16 GB GB02614/70A patent/GB1298261A/en not_active Expired
- 1970-03-17 DE DE2012656A patent/DE2012656C3/de not_active Expired
- 1970-03-18 FR FR7009714A patent/FR2035073A1/fr active Pending
- 1970-03-18 NL NL7003836A patent/NL7003836A/xx unknown
- 1970-03-19 RO RO62817A patent/RO59919A/ro unknown
- 1970-03-19 CH CH416570A patent/CH535013A/de not_active IP Right Cessation
-
1974
- 1974-07-24 NL NL7409983.A patent/NL165455C/xx not_active IP Right Cessation
- 1974-07-24 NL NL7409986.A patent/NL165458C/xx not_active IP Right Cessation
- 1974-07-24 NL NL7409984.A patent/NL165456C/xx not_active IP Right Cessation
- 1974-07-24 NL NL7409985.A patent/NL165457C/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| US3745170A (en) | 1973-07-10 |
| DE2012656A1 (de) | 1971-09-30 |
| DE2012656C3 (de) | 1975-12-18 |
| GB1298261A (en) | 1972-11-29 |
| NL7409985A (OSRAM) | 1974-09-25 |
| DE2012656B2 (de) | 1975-05-07 |
| NL7003836A (OSRAM) | 1970-09-22 |
| NL165455B (nl) | 1980-11-17 |
| CA960219A (en) | 1974-12-31 |
| NL165457C (nl) | 1981-04-15 |
| NL165458C (nl) | 1981-04-15 |
| NL165456B (nl) | 1980-11-17 |
| NL165457B (nl) | 1980-11-17 |
| NL165455C (nl) | 1981-04-15 |
| NL165456C (nl) | 1981-04-15 |
| NL7409983A (OSRAM) | 1974-09-25 |
| RO59919A (OSRAM) | 1976-10-15 |
| NL165458B (nl) | 1980-11-17 |
| FR2035073A1 (OSRAM) | 1970-12-18 |
| NL7409984A (OSRAM) | 1974-09-25 |
| NL7409986A (OSRAM) | 1974-09-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH535013A (de) | Mikrobizides Präparat und Verwendung desselben | |
| DE3881443T2 (de) | Imidazol-Verbindung und diese enthaltende biozide Zusammensetzungen. | |
| DE69012512T2 (de) | Heterocyclische Oxy-phenoxy-Essigsäurederivate und ihre Verwendung als Herbizide. | |
| EP0004279A1 (de) | Verfahren zur Herstellung von 4-Pyridon-3-carbonsäuren, 1-Cyclopropyl-4-Pyridon-3-Carbonsäurederivate und diese enthaltende Arzneimittel | |
| CH630233A5 (de) | Fungizides mittel und verfahren zu dessen herstellung. | |
| EP0318425A1 (de) | 2,2-Difluorcyclopropylethanderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Schädlingsbekämpfungsmittel | |
| EP0013360B1 (de) | N-substituierte Carbonsäureanilide, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide | |
| DE2513789A1 (de) | Haloacylanilide als mikrobizide wirkstoffe | |
| EP0130366B1 (de) | Arylalkylimidazolium- und -triazoliumsalze, Verfahren zu ihrer Herstellung und ihre Verwendung als Mikrozide | |
| DE2543888C3 (de) | l-Phenyl-S-alkyl-S-benzylharnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide | |
| US4094985A (en) | Fungicidal isothiazoles | |
| DE2110217A1 (de) | Substituierte Phenylharnstoffverbindungen, ihre Herstellung und Verwendung | |
| EP0257294B1 (de) | E/Z-Isomerengemische und reine Z-Isomere von N alpha-(2-Cyan-2-alkoximinoacetyl) aminosäurederivaten und- peptiden | |
| DE3311636A1 (de) | Neue fuenfgliedrige stickstoffhaltige heterocyclen, verfahren zu ihrer herstellung sowie ihre verwendung als schaedlingsbekaempfungsmittel | |
| CH622510A5 (OSRAM) | ||
| DE3427847A1 (de) | Thiolan-2,4-dion-3-carboxamide | |
| DD202374A5 (de) | Herbizide mittel | |
| DE2002410A1 (de) | Neue Oxazolidin-Derivate,Verfahren zu ihrer Herstellung und ihre Verwendung | |
| US4136189A (en) | 2-(5-nitro-furfurylidene)-amino-benzimidoles and fungicidal compositions containing the same | |
| DE68910736T2 (de) | Fungizide heterozyklische Stickstoffverbindungen. | |
| DE69625702T2 (de) | N-((fluoroalkoxy)phenoxyalkyl)benzamidverbindungen, ihre zwischenprodukte, verfahren zur ihrer herstellung und landwirtschaftliche und gartenbauliche pestizide | |
| US3824281A (en) | 1-carboxamidothio-3-aryl ureas | |
| US4007278A (en) | 1-(1-Carbamoyloxy-2,2,2-trichloroethyl)-1,2,4-triazole derivatives as pesticides | |
| CH626070A5 (OSRAM) | ||
| DE2903458A1 (de) | Phenylpyrol-derivate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |