CH517098A - Verfahren zur Herstellung neuartiger Benzomorphan-Derivate - Google Patents
Verfahren zur Herstellung neuartiger Benzomorphan-DerivateInfo
- Publication number
- CH517098A CH517098A CH704467A CH704467A CH517098A CH 517098 A CH517098 A CH 517098A CH 704467 A CH704467 A CH 704467A CH 704467 A CH704467 A CH 704467A CH 517098 A CH517098 A CH 517098A
- Authority
- CH
- Switzerland
- Prior art keywords
- hydroxy
- diethyl
- benzomorphane
- alkenyl
- benzomorphan
- Prior art date
Links
- 125000000753 cycloalkyl group Chemical group 0.000 title claims abstract description 6
- 125000000217 alkyl group Chemical group 0.000 title abstract description 7
- 150000003839 salts Chemical class 0.000 title abstract description 6
- -1 2-methylenecyclopropyl Chemical group 0.000 claims abstract description 16
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 7
- 125000000304 alkynyl group Chemical group 0.000 claims abstract description 6
- 125000005020 hydroxyalkenyl group Chemical group 0.000 claims abstract description 4
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 3
- 125000005843 halogen group Chemical group 0.000 claims abstract description 3
- 238000000034 method Methods 0.000 claims description 24
- 150000001875 compounds Chemical class 0.000 claims description 19
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 claims description 11
- 238000002360 preparation method Methods 0.000 claims description 9
- 229910000030 sodium bicarbonate Inorganic materials 0.000 claims description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 claims description 6
- LPNANKDXVBMDKE-UHFFFAOYSA-N 5-bromopent-1-ene Chemical compound BrCCCC=C LPNANKDXVBMDKE-UHFFFAOYSA-N 0.000 claims description 2
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 claims description 2
- 241001079660 Phanes Species 0.000 claims 1
- 239000002253 acid Substances 0.000 abstract description 8
- 230000000694 effects Effects 0.000 abstract description 8
- 229940035676 analgesics Drugs 0.000 abstract description 3
- 239000000730 antalgic agent Substances 0.000 abstract description 3
- 230000003533 narcotic effect Effects 0.000 abstract description 3
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical group CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 abstract 1
- 150000008064 anhydrides Chemical class 0.000 abstract 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 abstract 1
- 150000004820 halides Chemical class 0.000 abstract 1
- 229910052987 metal hydride Inorganic materials 0.000 abstract 1
- 150000004681 metal hydrides Chemical class 0.000 abstract 1
- 239000003887 narcotic antagonist Substances 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 13
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- 230000000202 analgesic effect Effects 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 239000007858 starting material Substances 0.000 description 8
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 206010012335 Dependence Diseases 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000003042 antagnostic effect Effects 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- OHXAOPZTJOUYKM-UHFFFAOYSA-N 3-Chloro-2-methylpropene Chemical compound CC(=C)CCl OHXAOPZTJOUYKM-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 229940051805 benzomorphan derivative analgesics Drugs 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- ATDGTVJJHBUTRL-UHFFFAOYSA-N cyanogen bromide Chemical compound BrC#N ATDGTVJJHBUTRL-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- YQYVFVRQLZMJKJ-JBBXEZCESA-N (+)-cyclazocine Chemical compound C([C@@]1(C)C2=CC(O)=CC=C2C[C@@H]2[C@@H]1C)CN2CC1CC1 YQYVFVRQLZMJKJ-JBBXEZCESA-N 0.000 description 1
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 1
- PDAWHBQDMPNZQI-UHFFFAOYSA-N 1-bromobut-3-en-2-ol Chemical compound BrCC(O)C=C PDAWHBQDMPNZQI-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- DMAYBPBPEUFIHJ-UHFFFAOYSA-N 4-bromobut-1-ene Chemical compound BrCCC=C DMAYBPBPEUFIHJ-UHFFFAOYSA-N 0.000 description 1
- XLYOGWXIKVUXCL-UHFFFAOYSA-N 4-bromobut-1-yne Chemical compound BrCCC#C XLYOGWXIKVUXCL-UHFFFAOYSA-N 0.000 description 1
- KEKBNXAJNJSILY-UHFFFAOYSA-N 5-bromopent-1-yne Chemical compound BrCCCC#C KEKBNXAJNJSILY-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 125000005741 alkyl alkenyl group Chemical group 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229950002213 cyclazocine Drugs 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- HWJHWSBFPPPIPD-UHFFFAOYSA-N ethoxyethane;propan-2-one Chemical compound CC(C)=O.CCOCC HWJHWSBFPPPIPD-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 229960005181 morphine Drugs 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- VOKSWYLNZZRQPF-GDIGMMSISA-N pentazocine Chemical compound C1C2=CC=C(O)C=C2[C@@]2(C)[C@@H](C)[C@@H]1N(CC=C(C)C)CC2 VOKSWYLNZZRQPF-GDIGMMSISA-N 0.000 description 1
- 229960005301 pentazocine Drugs 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000002557 soporific effect Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D221/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00
- C07D221/02—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00 condensed with carbocyclic rings or ring systems
- C07D221/22—Bridged ring systems
- C07D221/26—Benzomorphans
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US55155166A | 1966-05-20 | 1966-05-20 | |
| US63049367A | 1967-04-13 | 1967-04-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH517098A true CH517098A (de) | 1971-12-31 |
Family
ID=27069800
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH704467A CH517098A (de) | 1966-05-20 | 1967-05-19 | Verfahren zur Herstellung neuartiger Benzomorphan-Derivate |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3514463A (enExample) |
| AT (1) | AT279636B (enExample) |
| BE (1) | BE698687A (enExample) |
| CH (1) | CH517098A (enExample) |
| CS (1) | CS152282B2 (enExample) |
| DE (1) | DE1695417A1 (enExample) |
| DK (1) | DK119009B (enExample) |
| ES (2) | ES340655A1 (enExample) |
| FR (1) | FR7149M (enExample) |
| GB (2) | GB1173221A (enExample) |
| GR (1) | GR33684B (enExample) |
| IL (1) | IL27871A (enExample) |
| NL (2) | NL6706977A (enExample) |
| NO (1) | NO122790B (enExample) |
| SE (1) | SE345267B (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3700734A (en) * | 1969-01-23 | 1972-10-24 | Merck & Co Inc | 2{40 -hydroxy-2,3,5-trimethyl-6,7-benzomorphan |
| IE34235B1 (en) * | 1969-06-04 | 1975-03-19 | Acf Chemiefarma Nv | 6,7-benzomorphans and their preparation |
| DE2233088A1 (de) * | 1972-06-30 | 1974-01-17 | Schering Ag | Benzomorphanderivate |
| US3891657A (en) * | 1972-10-26 | 1975-06-24 | Bristol Myers Co | 9Beta-hydroxy-5-methyl-6,7-benzomorphans |
| US4022789A (en) * | 1975-11-20 | 1977-05-10 | Sterling Drug Inc. | Dichlorocyclopropylmethyl-benzazocines |
| BE864950A (fr) * | 1976-09-22 | 1978-09-18 | Sterling Drug Inc | 2,6-methano-3-benzazocines |
| US4341904A (en) * | 1980-02-19 | 1982-07-27 | Merck & Co., Inc. | Derivatives of 2-hydroxy-6,9-methano-11-amino-5,6,7,8,9,10-hexahydro-benzocyclooctene |
| US4332807A (en) * | 1981-01-26 | 1982-06-01 | Merck & Co., Inc. | N-Substituted-benzyl-11-endo-amino-5,6,7,8,9,10-hexahydro-2-hydroxy (or methoxy)-6,9-methanobenzocyclooctene (or nonene) centrally-acting analgesics |
| US4332810A (en) * | 1981-01-26 | 1982-06-01 | Merck & Co., Inc. | N-(Substituted)-2,5-ethano-8-hydroxy (or methoxy)-1,2,3,4,5,6-hexahydro-3 (or 4)-benzazocine centrally-acting analgesics |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE246157C (enExample) * | ||||
| US2259513A (en) * | 1939-03-01 | 1941-10-21 | Du Pont | Methods of inhibiting polymerization of unsaturated methylene compounds |
| US2369158A (en) * | 1941-10-01 | 1945-02-13 | Research Corp | Synthesis of vitamin a |
| US2388657A (en) * | 1943-04-15 | 1945-11-06 | Wingfoot Corp | Preparation of acid chlorides |
| US2713574A (en) * | 1951-05-24 | 1955-07-19 | American Cyanamid Co | New syntheses of peptides and substituted amides |
| DE1420015B1 (de) * | 1959-10-16 | 1971-08-26 | Boehringer Sohn Ingelheim | 2'-Hydroxy-5,9-dimethyl-6,7-benzomorphane |
| US3372165A (en) * | 1960-12-01 | 1968-03-05 | Sterling Drug Inc | 1, 2, 3, 4, 5, 6-hexahydro-8-hydroxy-2, 6-methano-3-benzazocine derivatives |
| GB997637A (en) * | 1962-01-31 | 1965-07-07 | Smith Kline French Lab | Substituted 2-cyclopropylmethyl-6,7-benzmorphans |
| US3250678A (en) * | 1963-01-16 | 1966-05-10 | Sterling Drug Inc | Analgesia producing benzazocines |
| GB1050227A (enExample) * | 1963-11-07 |
-
0
- NL NL132139D patent/NL132139C/xx active
-
1967
- 1967-04-13 US US630493A patent/US3514463A/en not_active Expired - Lifetime
- 1967-04-27 IL IL27871A patent/IL27871A/en unknown
- 1967-05-09 GR GR670133684A patent/GR33684B/el unknown
- 1967-05-17 ES ES340655A patent/ES340655A1/es not_active Expired
- 1967-05-18 AT AT824968A patent/AT279636B/de not_active IP Right Cessation
- 1967-05-18 GB GB23071/67A patent/GB1173221A/en not_active Expired
- 1967-05-18 GB GB03034/69A patent/GB1173224A/en not_active Expired
- 1967-05-19 BE BE698687D patent/BE698687A/xx unknown
- 1967-05-19 SE SE7045/67A patent/SE345267B/xx unknown
- 1967-05-19 NL NL6706977A patent/NL6706977A/xx unknown
- 1967-05-19 NO NO168211A patent/NO122790B/no unknown
- 1967-05-19 CH CH704467A patent/CH517098A/de not_active IP Right Cessation
- 1967-05-19 DE DE19671695417 patent/DE1695417A1/de active Pending
- 1967-05-19 DK DK262167AA patent/DK119009B/da unknown
- 1967-05-20 CS CS3661A patent/CS152282B2/cs unknown
- 1967-08-18 FR FR118298A patent/FR7149M/fr not_active Expired
-
1969
- 1969-07-04 ES ES369141A patent/ES369141A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES340655A1 (es) | 1969-11-01 |
| BE698687A (enExample) | 1967-11-20 |
| GB1173224A (en) | 1969-12-03 |
| AT279636B (de) | 1970-03-10 |
| ES369141A1 (es) | 1971-06-01 |
| IL27871A (en) | 1971-05-26 |
| CS152282B2 (enExample) | 1973-12-19 |
| NL132139C (enExample) | |
| DE1695417A1 (de) | 1970-07-16 |
| NL6706977A (enExample) | 1967-11-21 |
| GB1173221A (en) | 1969-12-03 |
| DK119009B (da) | 1970-11-02 |
| NO122790B (enExample) | 1971-08-16 |
| SE345267B (enExample) | 1972-05-23 |
| GR33684B (el) | 1968-01-10 |
| US3514463A (en) | 1970-05-26 |
| FR7149M (enExample) | 1969-08-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2243961C2 (enExample) | ||
| DE2002840A1 (de) | 2,3,5-trisubstit,-2'-Hydroxy-6,7-benzomorphane und Verfahren zu deren Herstellung | |
| DE2305092C2 (enExample) | ||
| CH517098A (de) | Verfahren zur Herstellung neuartiger Benzomorphan-Derivate | |
| CH500984A (de) | Verfahren zur Herstellung neuartiger Benzomorphan-Derivate | |
| DE69232484T2 (de) | Hydroisochinolinderivate | |
| DE2748466A1 (de) | 4a-aryloctahydro-1h-2-pyrindine | |
| DE2619617C2 (enExample) | ||
| CH638784A5 (de) | Verfahren zur herstellung neuer phenylazacycloalkane. | |
| DE2649172A1 (de) | N-substituierte 6,8-dioxamorphinane, verfahren zur herstellung dieser verbindungen und daraus hergestellte arzneimittel | |
| AT269886B (de) | Verfahren zur Herstellung neuer Benzomorphanderivate und ihrer Salze | |
| CH638190A5 (de) | Verfahren zur herstellung von derivaten des 1,2,4-triazolidin-2,5-dions. | |
| DD251289A5 (de) | Verfahren zur herstellung einer neuartigen racemischen oder optisch aktiven verbindung | |
| CH516571A (de) | Verfahren zur Herstellung neuartiger Benzomorphan-Derivate | |
| CH501632A (de) | Verfahren zur Herstellung neuartiger Benzomorphan-Derivate | |
| CH526559A (de) | Verfahren zur Herstellung neuartiger Benzomorphan-Derivate | |
| US3178438A (en) | 2-benzyl-3-hydroxy and lower alkoxy piperidines | |
| DE2132810A1 (de) | Indenopyrrolderivate und ihre Salze,Verfahren zu ihrer Herstellung und Arzneipraeparate | |
| DE2002864A1 (de) | 2,3,5,9-tetrasubstit.-2'-Hydroxy-6,7-benzomorphane und Verfahren zu deren Herstellung | |
| CH638490A5 (de) | Anilide mit hustenhemmender wirkung und verfahren zur herstellung derselben. | |
| DE2140550C3 (de) | 2-Benzoylalkylbenzomorphane, Verfahren zu ihrer Herstellung und Arzneimittel | |
| CH652403A5 (en) | Halogen-containing apovincamine acid esters, processes for their preparation, and medicaments containing these compounds | |
| DE2748467A1 (de) | Decahydrocyclopent/c/azepine und verfahren zu ihrer herstellung | |
| DE2229359A1 (de) | Neue 1-benzoyloxy-2-niedere-alkylaminobenzocycloalkanderivate | |
| DE2323148A1 (de) | Verfahren zur herstellung von 2ketoaethyl-6,7-benzomorphanderivaten, neue 2-ketoaethyl-6,7-benzomorphanderivate und diese verbindungen enthaltende arzneipraeparate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |